% % This file was created by the TYPO3 extension % bib % --- Timezone: CEST % Creation date: 2022-07-01 % Creation time: 21-02-32 % --- Number of references % 4415 % @Article { AmicoTPSN2022, subid = {2720}, title = {Recent applications and novel strategies for mercury determination in environmental samples using microextraction-based approaches: A review}, journal = {Journal of Hazardous Materials}, year = {2022}, month = {7}, volume = {433}, number2 = {19NRM03: SI-Hg: Metrology for traceable protocols for elemental and oxidised mercury concentrations}, pages = {128823}, keywords = {Mercury determination, Microextraction techniques, Environmental monitoring, Exposomics studies, Green analytical chemistry (GAC), Sample preparation}, web_url = {https://doi.org/10.1016/j.jhazmat.2022.128823}, misc2 = {EMPIR 2019: Pre-Co-Normative}, publisher = {Elsevier BV}, language = {30}, ISSN = {0304-3894}, DOI = {10.1016/j.jhazmat.2022.128823}, stag_bib_extends_levelofaccess = {NA}, author = {Amico, D. and Tassone, A. and Pirrone, N. and Sprovieri, F. and Naccarato, A.} } @Article { KossertLMPRR2022, subid = {2702}, title = {High precision measurement of the 151Sm beta decay by means of a metallic magnetic calorimeter}, journal = {Applied Radiation and Isotopes}, year = {2022}, month = {7}, volume = {185}, number2 = {20FUN04: PrimA-LTD: Towards new primary activity standardisation methods based on low-temperature detectors}, pages = {110237}, keywords = {Sm-151, 151Sm, Metallic magnetic calorimeter, Beta minus decay, Kurie plot, Beta spectrum shapes}, misc2 = {EMPIR 2020: Fundamental}, publisher = {Elsevier BV}, language = {30}, ISSN = {0969-8043}, DOI = {10.1016/j.apradiso.2022.110237}, stag_bib_extends_levelofaccess = {NA}, author = {Kossert, K. and Loidl, M. and Mougeot, X. and Paulsen, M. and Ranitzsch, P. and Rodrigues, M.} } @Article { ChenKKSA2022, subid = {2782}, title = {Diamagnetically levitating resonant weighing scale}, journal = {arXiv}, year = {2022}, month = {6}, day = {15}, volume = {arXiv:2105}, number = {June 2022}, number2 = {17FUN05: PhotOQuant: Photonic and Optomechanical Sensors for Nanoscaled and Quantum Thermometry}, pages = {1-16}, keywords = {Resonant sensor, diamagnetic levitation, mass sensor, liquid sensing}, web_url = {https://arxiv.org/abs/2105.12444}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Cornell University}, language = {30}, ISSN = {arXiv:2105.12444v2}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://arxiv.org/abs/2105.12444}, author = {Chen, X. and Kothari, N. and Keskekler, A. and Steeneken, P.G. and Alijani, F.} } @Article { ChenKAS2022, subid = {2783}, title = {Rigid body dynamics of diamagnetically levitating graphite resonators}, journal = {arXiv}, year = {2022}, month = {6}, day = {15}, volume = {arXiv:2006}, number = {June 2022}, number2 = {17FUN05: PhotOQuant: Photonic and Optomechanical Sensors for Nanoscaled and Quantum Thermometry}, pages = {1-6}, keywords = {diamagnetically levitating resonators, low-noise oscillators and sensors}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Cornell University}, language = {30}, ISSN = {arXiv:2006.01733v3}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://arxiv.org/abs/2006.01733}, author = {Chen, X. and Keskekler, A. and Alijani, F. and Steeneken, P.G.} } @Article { WolterLWKKK2022, subid = {2788}, title = {Static and dynamic transport properties of multi-terminal, multi-junction microSQUIDs realized with Nb/HfTi/Nb Josephson junctions}, journal = {Superconductor Science and Technology}, year = {2022}, month = {6}, day = {13}, number2 = {17FUN10: ParaWave: Josephson travelling wave parametric amplifier and its application for metrology}, keywords = {low‐temperature superconductors, nanotechnology, multi-terminal multi-junction SQUID, niobium technology,current-phase relation, SNS Josephson junctions}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {0953-2048, 1361-6668}, DOI = {10.1088/1361-6668/ac782b}, stag_bib_extends_levelofaccess = {NA}, author = {Wolter, S. and Linek, J. and Weimann, T. and Koelle, D. and Kleiner, R. and Kieler, O.F.} } @Article { KokWE2022, subid = {2784}, title = {Impact of Imperfect Artefacts and the Modus Operandi on Uncertainty Quantification Using Virtual Instruments}, journal = {Metrology}, year = {2022}, month = {6}, day = {12}, volume = {2}, number = {2}, number2 = {20IND04: ATMOC: Traceable metrology of soft X-ray to IR optical constants and nanofilms for advanced manufacturing}, pages = {311-319}, keywords = {virtual instrument; uncertainty calculation; VCMM; artefact imperfection; form deviation}, web_url = {https://www.mdpi.com/2673-8244/2/2/19/htm}, misc2 = {EMPIR 2020: Industry}, publisher = {MDPI AG}, language = {30}, ISSN = {2673-8244}, DOI = {10.3390/metrology2020019}, stag_bib_extends_levelofaccess = {NA}, author = {Kok, G. and W{\"u}bbeler, G. and Elster, C.} } @Miscellaneous { ColomBBKB, subid = {2775}, title = {Source code and simulation results for nanoantennas supporting an enhanced Purcell factor due to interfering resonances}, journal = {Zenodo}, year = {2022}, month = {6}, day = {8}, number2 = {20FUN05: SEQUME: Single- and entangled photon sources for quantum metrology}, keywords = {Nanophotonics, nano resonator, Riesz projection expansion}, misc2 = {EMPIR 2020: Fundamental}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {http://dx.doi.org/10.5281/zenodo.6565850}, author = {Colom, R. and Binkowski, F. and Betz, F. and Kivshar, Y. and Burger, S.} } @Miscellaneous { ColomBBKB_2, subid = {2775}, title = {Source code and simulation results for nanoantennas supporting an enhanced Purcell factor due to interfering resonances}, journal = {Zenodo}, year = {2022}, month = {6}, day = {8}, number2 = {20FUN02: POLight: Pushing boundaries of nano-dimensional metrology by light}, keywords = {Nanophotonics, nano resonator, Riesz projection expansion}, misc2 = {EMPIR 2020: Fundamental}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {http://dx.doi.org/10.5281/zenodo.6565850}, author = {Colom, R. and Binkowski, F. and Betz, F. and Kivshar, Y. and Burger, S.} } @Article { IrwinHSBSBSV2022, subid = {2623}, title = {Characterising the silver particle generator; a pathway towards standardising silver aerosol generation}, journal = {Journal of Aerosol Science}, year = {2022}, month = {6}, volume = {163}, number2 = {19ENV09: MetroPEMS: Improved vehicle exhaust quantification by portable emission measurement systems metrology}, pages = {105978}, keywords = {silver particle generator, calibration, reference aerosol, CPC calibration, DMA calibration}, web_url = {https://www.sciencedirect.com/science/article/pii/S002185022200026X?via\%3Dihub}, misc2 = {EMPIR 2019: Environment}, publisher = {Elsevier BV}, language = {30}, ISSN = {0021-8502}, DOI = {10.1016/j.jaerosci.2022.105978}, stag_bib_extends_levelofaccess = {NA}, author = {Irwin, M. and Hammer, T. and Swanson, J. and Berger, V. and Sonkamble, U. and Boies, A. and Schulz, H. and Vasilatou, K.} } @Article { WitkowskiBBKSTZ2022, subid = {2771}, journal = {Optics Express}, year = {2022}, month = {5}, day = {31}, volume = {30}, number = {12}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, pages = {21423}, keywords = {blue magic wavelength, photoionization, Sr clock}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Optica Publishing Group}, language = {30}, ISSN = {1094-4087}, DOI = {10.1364/OE.460554}, stag_bib_extends_levelofaccess = {NA}, author = {Witkowski, M. and Bilicki, S. and Bober, M. and Kovacic, D. and Singh, V. and Tonoyan, A. and Zawada, M.} } @Article { WitkowskiBBKSTZ2022_2, subid = {2771}, title = {Photoionization cross sections of ultracold ⁸⁸Sr in ¹P₁ and ³S₁ states at 390 nm and the resulting blue-detuned magic wavelength optical lattice clock constraints}, journal = {Optics Express}, year = {2022}, month = {5}, day = {31}, volume = {30}, number = {12}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, pages = {21423}, keywords = {blue magic wavelength, photoionization, Sr clock}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Optica Publishing Group}, language = {30}, ISSN = {1094-4087}, DOI = {10.1364/OE.460554}, stag_bib_extends_levelofaccess = {NA}, author = {Witkowski, M. and Bilicki, S. and Bober, M. and Kovacic, D. and Singh, V. and Tonoyan, A. and Zawada, M.} } @Proceedings { BossePBOFEP2022, subid = {2781}, title = {Progress of the European Metrology Network for Advanced Manufacturing}, journal = {Proceedings 22nd euspen International Conference and Exhibition}, year = {2022}, month = {5}, day = {30}, number2 = {19NET01: AdvManuNet: Support for a European Metrology Network on advanced manufacturing}, pages = {299}, keywords = {advanced manufacturing, metrology, European Metrology Networks (EMN), Strategic Research Agenda (SRA), stakeholder, Industry 4.0}, misc2 = {EMPIR 2019: Support for Networks}, event_place = {Geneva, Switzerland}, event_name = {22nd euspen International Conference and Exhibition}, event_date = {30-05-2022 to 03-06-2022}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://www.euspen.eu/knowledge-base/ICE22299.pdf}, author = {Bosse, H. and Przyklenk, A. and Balsamo, A. and O'Connor, D. and Favre, G. and Evans, A. and Phillips, D.} } @Article { BaselgaGGL2022, subid = {2766}, title = {GBDM+: an improved methodology for a GNSS-based distance meter}, journal = {Measurement Science and Technology}, year = {2022}, month = {5}, day = {25}, volume = {33}, number = {8}, number2 = {18SIB01: GeoMetre: Large-scale dimensional measurements for geodesy}, pages = {085020}, keywords = {GNSS, Si, index of refraction, EDM, GeoMetre}, web_url = {https://iopscience.iop.org/article/10.1088/1361-6501/ac6f45}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-0233, 1361-6501}, DOI = {10.1088/1361-6501/ac6f45}, stag_bib_extends_levelofaccess = {NA}, author = {Baselga, S. and Garc{\'i}a-Asenjo, L. and Garrigues, P. and Luj{\'a}n, R.} } @Article { HohlsKSWKS2022, subid = {2758}, title = {Controlling the error mechanism in a tunable-barrier nonadiabatic charge pump by dynamic gate compensation}, journal = {Physical Review B}, year = {2022}, month = {5}, day = {20}, volume = {105}, number = {20}, number2 = {17FUN04: SEQUOIA: Single-electron quantum optics for quantum-enhanced measurements}, pages = {205425}, keywords = {single electron pump, control scheme, error mechanism, current standard}, web_url = {https://arxiv.org/abs/2112.10713}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2469-9950, 2469-9969}, DOI = {10.1103/PhysRevB.105.205425}, stag_bib_extends_levelofaccess = {NA}, author = {Hohls, F. and Kashcheyevs, V. and Stein, F. and Wenz, T. and Kaestner, B. and Schumacher, H.W.} } @Manual { NeuvonenFMLME2022, subid = {2753}, title = {Good practice guide for the measurement of the density of liquids in industry}, year = {2022}, month = {5}, day = {18}, number2 = {17RPT02: rhoLiq: Establishing traceability for liquid density measurements}, keywords = {density; oscillation-type densimetry; rhoLiq}, web_url = {https://doi.org/10.5281/zenodo.6560044}, misc2 = {EMPIR 2017: Research Potential}, publisher = {Zenodo}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://zenodo.org/record/6560044}, author = {Neuvonen, P. and Furtado, A. and Moura, S. and Laky, B. and Malejczyk, E. and Elżbieta, L.} } @Article { ChambersGWSMRMR2022, subid = {2754}, title = {Portable two-filter dual-flow-loop 222Rn detector: stand-alone monitor and calibration transfer device}, journal = {Advances in Geosciences}, year = {2022}, month = {5}, day = {18}, volume = {57}, number2 = {19ENV01: traceRadon: Radon metrology for use in climate change observation and radiation protection at the environmental level}, pages = {63-80}, keywords = {Radon monitor, two-filter dual loop detector, traceRadon, calibration, activity concentration}, misc2 = {EMPIR 2019: Environment}, publisher = {Copernicus GmbH}, language = {30}, ISSN = {1680-7359}, DOI = {10.5194/adgeo-57-63-2022}, stag_bib_extends_levelofaccess = {NA}, author = {Chambers, S.D. and Griffiths, A.D. and Williams, A.G. and Sisoutham, O. and Morosh, V. and R{\"o}ttger, S. and Mertes, F. and R{\"o}ttger, A.} } @Article { RusantoSFH2022, subid = {2787}, title = {Primary measurement method for the characterisation of impedance standard in the m\(\Omega\) range}, journal = {Measurement Science and Technology}, year = {2022}, month = {5}, day = {18}, volume = {33}, number = {8}, number2 = {17IND10: LiBforSecUse: Quality assessment of electric vehicle Li-ion batteries for second use applications}, pages = {085016}, keywords = {low impedance, impedance standard, primary measurement method, uncertainty,comparison}, web_url = {https://iopscience.iop.org/article/10.1088/1361-6501/ac6a45}, misc2 = {EMPIR 2017: Industry}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-0233, 1361-6501}, DOI = {10.1088/1361-6501/ac6a45}, stag_bib_extends_levelofaccess = {NA}, author = {Rusanto, B.H. and Seitz, S. and Funck, T. and Heinrich, M.} } @Article { GuilloryTW2022, subid = {2759}, title = {Multilateration with Self-Calibration: Uncertainty Assessment, Experimental Measurements and Monte-Carlo Simulations}, journal = {Metrology}, year = {2022}, month = {5}, day = {11}, volume = {2}, number = {2}, number2 = {18SIB01: GeoMetre: Large-scale dimensional measurements for geodesy}, pages = {241-262}, keywords = {large-volume metrology, multilateration with self-calibration, uncertainty assessment}, web_url = {https://www.mdpi.com/2673-8244/2/2/15}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {MDPI AG}, language = {30}, ISSN = {2673-8244}, DOI = {10.3390/metrology2020015}, stag_bib_extends_levelofaccess = {NA}, author = {Guillory, J. and Truong, D. and Wallerand, J-P.} } @Article { RubenVogtRGDKMKKSBBMPFCRVSH2022, subid = {2751}, title = {PV Module Energy Rating Standard IEC 61853-3 Intercomparison and Best Practice Guidelines for Implementation and Validation}, journal = {IEEE Journal of Photovoltaics}, year = {2022}, month = {5}, volume = {12}, number = {3}, number2 = {19ENG01: Metro-PV: Metrology for emerging PV applications}, pages = {844-852}, keywords = {Standards, Meteorology, IEC Standards, Temperature measurement, Power measurement, Photovoltaic systems, Mathematical models}, web_url = {https://www.techrxiv.org/articles/preprint/PV_module_energy_rating_standard_IEC_61853-3_intercomparison_and_best_practice_guidelines_for_implementation_and_validation/19635333/1}, misc2 = {EMPIR 2019: Energy}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {2156-3381, 2156-3403}, DOI = {10.1109/JPHOTOV.2021.3135258}, stag_bib_extends_levelofaccess = {NA}, author = {Ruben Vogt, M. and Riechelmann, S. and Gracia-Amillo, A.M. and Driesse, A. and Kokka, A. and Maham, K. and K{\"a}rh{\"a}, P. and Kenny, R. and Schinke, C. and Bothe, K. and Blakesley, J. and Music, E. and Plag, F. and Friesen, G. and Corbellini, G. and Riedel-Lyngskar, N. and Valckenborg, R. and Schweiger, M. and Herrmann, W.} } @Article { BriantKCLBWRMPCESTHPKKDZWMSNB2022, subid = {2714}, title = {Photonic and Optomechanical Thermometry}, journal = {Optics}, year = {2022}, month = {4}, day = {29}, volume = {3}, number = {2}, number2 = {17FUN05: PhotOQuant: Photonic and Optomechanical Sensors for Nanoscaled and Quantum Thermometry}, pages = {159-176}, keywords = {thermometry; photonic; optomechanic; temperature sensors; photonic integrated circuit}, web_url = {https://doi.org/10.3390/opt3020017}, misc2 = {EMPIR 2017: Fundamental}, publisher = {MDPI AG}, language = {30}, ISSN = {2673-3269}, DOI = {10.3390/opt3020017}, stag_bib_extends_levelofaccess = {NA}, author = {Briant, T. and Krenek, S. and Cupertino, A. and Loubar, F. and Braive, R. and Weituschat, L. and Ramos, D. and Martin, M.J. and Postigo, P.A. and Casas, A. and Eisermann, R. and Schmid, D. and Tabandeh, S. and Hahtela, O. and Pourjamal, S. and Kozlova, O. and Kroker, S. and Dickmann, W. and Zimmermann, L. and Winzer, G. and Martel, T. and Steeneken, P.G. and Norte, R.A. and Briaudeau, S.} } @Article { VolkovaHTBCMARERBPN2022, subid = {2712}, title = {Optical and Spin Properties of NV Center Ensembles in Diamond Nano-Pillars}, journal = {Nanomaterials}, year = {2022}, month = {4}, day = {29}, volume = {12}, number = {9}, number2 = {20FUN05: SEQUME: Single- and entangled photon sources for quantum metrology}, pages = {1516}, keywords = {color centers, optical quantum technology}, misc2 = {EMPIR 2020: Fundamental}, publisher = {MDPI}, language = {30}, ISSN = {2079-4991}, DOI = {10.3390/nano12091516}, stag_bib_extends_levelofaccess = {NA}, author = {Volkova, K. and Heupel, J. and Trofimov, S. and Betz, F. and Colom, R. and MacQueen, R.W. and Akhundzada, S. and Reginka, M. and Ehresmann, A. and Reithmaier, J.P. and Burger, S. and Popov, C. and Naydenov, B.} } @Article { VolkovaHTBCMARERBPN2022_2, subid = {2721}, title = {Optical and Spin Properties of NV Center Ensembles in Diamond Nano-Pillars}, journal = {Nanomaterials}, year = {2022}, month = {4}, day = {29}, volume = {12}, number = {9}, number2 = {20FUN05: SEQUME: Single- and entangled photon sources for quantum metrology}, pages = {1516}, keywords = {NV centers, diamond nano-pillars, fluorescence lifetime, ion implantation, optically detected magnetic resonance (ODMR), spin coherence time, spin relaxation time}, misc2 = {EMPIR 2020: Fundamental}, publisher = {MDPI AG}, language = {30}, ISSN = {2079-4991}, DOI = {10.3390/nano12091516}, stag_bib_extends_levelofaccess = {NA}, author = {Volkova, K. and Heupel, J. and Trofimov, S. and Betz, F. and Colom, R. and MacQueen, R.W. and Akhundzada, S. and Reginka, M. and Ehresmann, A. and Reithmaier, J.P. and Burger, S. and Popov, C. and Naydenov, B.} } @Article { RaupachDGMHGGKL2022, subid = {2765}, title = {Detection rate dependence of the inherent detection efficiency in single-photon detectors based on avalanche diodes}, journal = {Physical Review A}, year = {2022}, month = {4}, day = {25}, volume = {105}, number = {4}, number2 = {19NRM06: MeTISQ: Metrology for testing the implementation security of quantum key distribution hardware}, pages = {042615}, keywords = {Single-photon counting, Metrology for quantum technologies, QKD implementation security, standardisation}, web_url = {https://journals.aps.org/pra/pdf/10.1103/PhysRevA.105.042615}, misc2 = {EMPIR 2019: Pre-Co-Normative}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2469-9926, 2469-9934}, DOI = {10.1103/PhysRevA.105.042615}, stag_bib_extends_levelofaccess = {NA}, author = {Raupach, S.M.F. and Degiovanni, I.P. and Georgieva, H. and Meda, A. and Hofer, H. and Gramegna, M. and Genovese, M. and K{\"u}ck, S. and L{\'o}pez, M.} } @Article { HoflingBHRHWTJBGR2022, subid = {2713}, title = {Numerical optimization of single-mode fiber-coupled single-photon sources based on semiconductor quantum dots}, journal = {Optics Express}, year = {2022}, month = {4}, day = {25}, volume = {30}, number = {10}, number2 = {20FUN05: SEQUME: Single- and entangled photon sources for quantum metrology}, pages = {15913}, keywords = {single photon source; optical quantum technology}, web_url = {https://arxiv.org/abs/2202.09562}, misc2 = {EMPIR 2020: Fundamental}, publisher = {Optica Publishing Group}, language = {30}, ISSN = {1094-4087}, DOI = {10.1364/OE.456777}, stag_bib_extends_levelofaccess = {NA}, author = {H{\"o}fling, S. and Burger, S. and Herkommer, Al. and Rodt, S. and Huber, T. and Weber, K. and Thiele, S. and Jimenez, C. and Bremer, L. and Giessen, H. and Reitzenstein, S.} } @Article { KhabipovGKDZ2022, subid = {2708}, title = {Superconducting microwave resonators with non-centrosymmetric nonlinearity}, journal = {Superconductor Science and Technology}, year = {2022}, month = {4}, day = {22}, number2 = {17FUN10: ParaWave: Josephson travelling wave parametric amplifier and its application for metrology}, keywords = {coplanar waveguide resonators, rf-SQUID, three wave mixing, parametric amplification, superconductivity}, web_url = {https://arxiv.org/abs/2204.10133}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {0953-2048, 1361-6668}, DOI = {10.1088/1361-6668/ac6989}, stag_bib_extends_levelofaccess = {NA}, author = {Khabipov, M. and Gaydamachenko, V. and Kissling, C. and Dolata, R. and Zorin, A.B.} } @Article { RubinSZHFABKLZA2022, subid = {2709}, title = {Thermodynamic effects in a gas modulated Invar-based dual Fabry–P{\'e}rot cavity refractometer}, journal = {Metrologia}, year = {2022}, month = {4}, day = {14}, volume = {59}, number = {3}, number2 = {18SIB04: QuantumPascal: Towards quantum-based realisations of the pascal}, pages = {035003}, keywords = {quantumpascal, GAMOR, optical pressure standard, gas refractometry, pV-work, Invar-based}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/ac5ef9}, stag_bib_extends_levelofaccess = {NA}, author = {Rubin, T. and Silander, I. and Zakrisson, J. and Hao, M. and Forss{\'e}n, C. and Asbahr, P. and Bernien, M. and Kussicke, A. and Liu, K. and Zelan, M. and Axner, O.} } @Article { vanHeerenSPB2022, subid = {2698}, title = {Metrology challenges for microfluidics}, journal = {CMM Magazine}, year = {2022}, month = {4}, day = {13}, volume = {15}, number = {2}, number2 = {20NRM02: MFMET: Establishing metrology standards in microfluidic devices}, pages = {20-25}, keywords = {Microfluidics, metrology, fabrication, testing}, web_url = {http://www.cmmmagazine.com/cmm-articles/metrology-challenges-for-microfluidics/}, misc2 = {EMPIR 2020: Pre-Co-Normative}, publisher = {MST Global Ltd}, language = {30}, ISSN = {2634-9167}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {ISSN 2634-9167}, author = {van Heeren, H. and Silverio, V. and Pecnik, C. and Batista, E.} } @Article { 0f8afeae402022, subid = {2692}, title = {Sub-percent accuracy for the intensity of a nearinfrared water line at 10,670 cm−1: experiment and analysis}, journal = {Molecular Physics}, year = {2022}, month = {4}, day = {13}, number2 = {18SIB04: QuantumPascal: Towards quantum-based realisations of the pascal}, pages = {e2063769}, keywords = {water, partial pressure, absorption, line strength, ab initio, potential energy surface, dipole moment surface}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Taylor \& Francis}, language = {30}, DOI = {10.1080/00268976.2022.2063769}, stag_bib_extends_levelofaccess = {NA} } @Article { OrenesSLM2022, subid = {2763}, title = {Improving Short-Term Stability in Optical Lattice Clocks by Quantum Nondemolition Measurement}, journal = {Physical Review Letters}, year = {2022}, month = {4}, day = {13}, volume = {128}, number = {15}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, pages = {153201}, keywords = {Cold gases in optical lattices, Entanglement in quantum gases, Quantum metrology, Time \& frequency standards}, web_url = {https://arxiv.org/abs/2109.08418}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {0031-9007, 1079-7114}, DOI = {10.1103/PhysRevLett.128.153201}, stag_bib_extends_levelofaccess = {NA}, author = {Orenes, D.B. and Sewell, R.J. and Lodewyck, J. and Mitchell, M.W.} } @Article { ZanovelloSBWZI2022, subid = {2551}, title = {CoSimPy: An open-source python library for MRI radiofrequency Coil EM/Circuit Cosimulation}, journal = {Computer Methods and Programs in Biomedicine}, year = {2022}, month = {4}, volume = {216}, number2 = {17IND01: MIMAS: Procedures allowing medical implant manufacturers to demonstrate compliance with MRI safety regulations}, pages = {106684}, keywords = {Electromagnetic (EM) simulations, EM/Circuit cosimulation, Magnetic Resonance Imaging (MRI), Radio-frequency (RF) coils, Open source Python library}, web_url = {https://www.sciencedirect.com/science/article/pii/S0169260722000694?via\%3Dihub}, misc2 = {EMPIR 2017: Industry}, publisher = {Elsevier BV}, language = {30}, ISSN = {0169-2607}, DOI = {10.1016/j.cmpb.2022.106684}, stag_bib_extends_levelofaccess = {NA}, author = {Zanovello, U. and Seifert, F. and Bottauscio, O. and Winter, L. and Zilberti, L. and Ittermann, B.} } @Article { OgheardNGG2022, subid = {2573}, title = {Development and validation of a dynamic primary standard for unsteady liquid flow calibration}, journal = {Flow Measurement and Instrumentation}, year = {2022}, month = {4}, volume = {84}, number2 = {17IND13: Metrowamet: Metrology for real-world domestic water metering}, pages = {102138}, keywords = {Liquid flow, dynamic calibration, primary standard}, misc2 = {EMPIR 2017: Industry}, publisher = {Elsevier BV}, language = {30}, ISSN = {0955-5986}, DOI = {10.1016/j.flowmeasinst.2022.102138}, stag_bib_extends_levelofaccess = {NA}, author = {Ogheard, F. and No{\"e}l, J. and Granger, P. and Gassette, C-A.} } @Article { ZibordiKMTCDG2022, subid = {2594}, title = {Assessment of OLCI-A and OLCI-B radiometric data products across European seas}, journal = {Remote Sensing of Environment}, year = {2022}, month = {4}, volume = {272}, number2 = {19ENV07: MetEOC-4: Metrology to establish an SI traceable climate observing system}, pages = {112911}, keywords = {Ocean and Land Colour Instruments, Radiometry, AeroNET-OC, Copernicus Sentinel-3}, misc2 = {EMPIR 2019: Environment}, publisher = {Elsevier BV}, language = {30}, ISSN = {0034-4257}, DOI = {10.1016/j.rse.2022.112911}, stag_bib_extends_levelofaccess = {NA}, author = {Zibordi, G. and Kwiatkowska, E. and M{\'e}lin, F. and Talone, M. and Cazzaniga, I. and Dessailly, D. and Gossn, J.I.} } @Article { RabagoQVSRICCRCFFRG2022, subid = {2671}, title = {Intercomparison of Radon Flux Monitors at Low and at High Radium Content Areas under Field Conditions}, journal = {International Journal of Environmental Research and Public Health}, year = {2022}, month = {4}, volume = {19}, number = {7}, number2 = {19ENV01: traceRadon: Radon metrology for use in climate change observation and radiation protection at the environmental level}, pages = {4213}, keywords = {exhalation; traceRadon; proficiency test; interlaboratory comparison}, misc2 = {EMPIR 2019: Environment}, publisher = {MDPI AG}, language = {30}, ISSN = {1660-4601}, DOI = {10.3390/ijerph19074213}, stag_bib_extends_levelofaccess = {NA}, author = {Rabago, D. and Quindos, L. and Vargas, A. and Sainz, C. and Radulescu, I. and Ioan, M-R. and Cardellini, F. and Capogni, M. and Rizzo, A. and Celaya, S. and Fuente, I. and Fuente, M. and Rodriguez, M. and Grossi, C.} } @Article { KranzerSBHPLLP2022, subid = {2662}, title = {Response of diamond detectors in ultra-high dose-per-pulse electron beams for dosimetry at FLASH radiotherapy}, journal = {Physics in Medicine \& Biology}, year = {2022}, month = {3}, day = {21}, volume = {67}, number = {7}, number2 = {18HLT04: UHDpulse: Metrology for advanced radiotherapy using particle beams with ultra-high pulse dose rates}, pages = {075002}, keywords = {dosimetry, FLASH radiotherapy, ultra-high dose-per-pulse, microDiamond}, misc2 = {EMPIR 2018: Health}, publisher = {IOP Publishing}, language = {30}, ISSN = {0031-9155, 1361-6560}, DOI = {10.1088/1361-6560/ac594e}, stag_bib_extends_levelofaccess = {NA}, author = {Kranzer, R. and Sch{\"u}ller, A. and Bourgouin, A. and Hackel, T. and Poppinga, D. and Lapp, M. and Looe, H.K. and Poppe, B.} } @Article { LivreriEFGRVFMG2022, subid = {2789}, title = {Microwave Quantum Radar using a Josephson Traveling Wave Parametric Amplifier}, journal = {2022 IEEE Radar Conference (RadarConf22)}, year = {2022}, month = {3}, day = {21}, number2 = {17FUN10: ParaWave: Josephson travelling wave parametric amplifier and its application for metrology}, keywords = {Microwave quantum radar, Josephson traveling parametric amplifier, quantum microwave illumination, two-mode squeezing, non-classical light source, entanglement}, web_url = {https://arxiv.org/abs/2111.03409}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IEEE}, language = {30}, DOI = {10.1109/RadarConf2248738.2022.9764353}, stag_bib_extends_levelofaccess = {NA}, author = {Livreri, P. and Enrico, E. and Fasolo, L. and Greco, A. and Rettaroli, A. and Vitali, D. and Farina, A. and Marchetti, Com. F. and Giacomin, A. Sq. D.} } @Article { UrbanA2022, subid = {2687}, title = {Dynamic Measurement of Specific Heat Above 1000 K}, journal = {International Journal of Thermophysics}, year = {2022}, month = {3}, day = {19}, volume = {43}, number = {5}, number2 = {17IND11: Hi-TRACE: Industrial process optimisation through improved metrology of thermophysical properties}, keywords = {Specific heat, High-temperature, Hi-Trace, Induction heating, Uncertainty}, misc2 = {EMPIR 2017: Industry}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {0195-928X, 1572-9567}, DOI = {10.1007/s10765-022-03005-0}, stag_bib_extends_levelofaccess = {NA}, author = {Urban , D. and Anhalt, K.} } @Article { GogneauCSCLTHJTH2022, subid = {2666}, title = {Electromechanical conversion efficiency of GaN NWs: critical influence of the NW stiffness, the Schottky nano-contact and the surface charge effects}, journal = {Nanoscale}, year = {2022}, month = {3}, day = {17}, number2 = {19ENG05: NanoWires: High throughput metrology for nanowire energy harvesting devices}, keywords = {piezoelectric nanowires, NW, AFM, stiffness, GaN, energy, harvesting}, web_url = {https://pubs.rsc.org/en/Content/ArticleLanding/2022/NR/D1NR07863A}, misc2 = {EMPIR 2019: Energy}, publisher = {Royal Society of Chemistry (RSC)}, language = {30}, ISSN = {2040-3364, 2040-3372}, DOI = {10.1039/d1nr07863a}, stag_bib_extends_levelofaccess = {NA}, author = {Gogneau, N. and Chr{\'e}tien, P. and Sodhi, T. and Couraud, L. and Leroy, L. and Travers, L. and Harmand, J-C. and Julien, F.H. and Tchernycheva, M. and Houz{\'e}, F.} } @Article { McManusRRBSPS2022, subid = {2661}, title = {Determination of beam quality correction factors for the Roos plane-parallel ionisation chamber exposed to very high energy electron (VHEE) beams using Geant4}, journal = {Physics in Medicine \& Biology}, year = {2022}, month = {3}, day = {17}, volume = {67}, number = {6}, number2 = {18HLT04: UHDpulse: Metrology for advanced radiotherapy using particle beams with ultra-high pulse dose rates}, pages = {065011}, keywords = {geant4, Monte Carlo, perturbation factors, beam quality correction, VHEE}, misc2 = {EMPIR 2018: Health}, publisher = {IOP Publishing}, language = {30}, ISSN = {0031-9155, 1361-6560}, DOI = {10.1088/1361-6560/ac5a94}, stag_bib_extends_levelofaccess = {NA}, author = {McManus, M. and Romano, F. and Royle, G. and Botnariuc, D. and Shipley, D. and Palmans, H. and Subiel, A.} } @Article { Kok2022, subid = {2674}, title = {The digital transformation and novel calibration approaches}, journal = {tm - Technisches Messen}, year = {2022}, month = {3}, day = {17}, volume = {89}, number = {4}, number2 = {18NET05: MATHMET: Support for a European Metrology Network for mathematics and statistics}, pages = {214-223}, keywords = {Digital transformation, digitalization, calibration, artificial intelligence, virtual instrument, digital twin, new SI, self-X-solution, metrology network}, web_url = {https://doi.org/10.1515/teme-2021-0136\&\#10;https://www.degruyter.com/document/doi/10.1515/teme-2021-0136/html}, misc2 = {EMPIR 2018: Support for Networks}, publisher = {Walter de Gruyter GmbH}, language = {30}, ISSN = {2196-7113, 0171-8096}, DOI = {10.1515/teme-2021-0136}, stag_bib_extends_levelofaccess = {NA}, author = {Kok, G.} } @Article { BourgouinKMKSK2022, subid = {2663}, title = {Characterization of the PTB ultra-high pulse dose rate reference electron beam}, journal = {Physics in Medicine \& Biology}, year = {2022}, month = {3}, day = {15}, number2 = {18HLT04: UHDpulse: Metrology for advanced radiotherapy using particle beams with ultra-high pulse dose rates}, keywords = {Ultra-High Dose Rate, Dosimetry for FLASH, Monte Carlo, Diamond detector,electron beams}, misc2 = {EMPIR 2018: Health}, publisher = {IOP Publishing}, language = {30}, ISSN = {0031-9155, 1361-6560}, DOI = {10.1088/1361-6560/ac5de8}, stag_bib_extends_levelofaccess = {NA}, author = {Bourgouin, A. and Knyziak, A. and Marinelli, M. and Kranzer, R. and Sch{\"u}ller, A. and Kapsch, R-P.} } @Article { LetiziaSC2022, subid = {2718}, title = {Impact of DC Transient Disturbances on Harmonic Performance of Voltage Transformers for AC Railway Applications}, journal = {Sensors}, year = {2022}, month = {3}, day = {15}, volume = {22}, number = {6}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, pages = {2270}, keywords = {instrument transformers; harmonic measurements; DC transient disturbances; powerquality in AC railway systems}, tags = {SEG}, web_url = {https://www.mdpi.com/1424-8220/22/6/2270}, misc2 = {EMPIR 2016: Energy}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s22062270}, stag_bib_extends_levelofaccess = {NA}, author = {Letizia, P. and Signorino, D. and Crotti, G.} } @Article { KronerABBBCPSSUW2022, subid = {2643}, title = {Evaluation of the measurement performance of water meters depending on water quality}, journal = {Water Supply}, year = {2022}, month = {3}, day = {14}, number2 = {17IND13: Metrowamet: Metrology for real-world domestic water metering}, keywords = {cold water meters, test regime, water quality, water meter accuracy}, misc2 = {EMPIR 2017: Industry}, publisher = {IWA Publishing}, language = {30}, ISSN = {1606-9749, 1607-0798}, DOI = {10.2166/ws.2022.133}, stag_bib_extends_levelofaccess = {NA}, author = {Kroner, C. and Akselli, B. and Benkova, M. and Borchling, A. and B{\"u}ker, O. and Christoffersen, N. and Pavlas, J. and Schumann, D. and Seypka, V. and Unsal, B. and Warnecke, H.} } @Article { RottgerRGVKCCKRMR2022, subid = {2625}, title = {Radon metrology for use in climate change observation and radiation protection at the environmental level}, journal = {Advances in Geosciences}, year = {2022}, month = {3}, day = {10}, volume = {57}, number2 = {19ENV01: traceRadon: Radon metrology for use in climate change observation and radiation protection at the environmental level}, pages = {37-47}, keywords = {Radon, climate observation, radon monitor, radiation protection, radon tracer method (RTM), radon emanation source, activity concentration, traceability}, misc2 = {EMPIR 2019: Environment}, publisher = {Copernicus GmbH}, language = {30}, ISSN = {1680-7359}, DOI = {10.5194/adgeo-57-37-2022}, stag_bib_extends_levelofaccess = {NA}, author = {R{\"o}ttger, S. and R{\"o}ttger, A. and Grossi, C. and Vargas, A. and Karstens, U. and Cinelli, G. and Chung, E. and Kikaj, D. and Rennick, C. and Mertes, F. and Radulescu, I.} } @Article { GeorgiKNSSTJ2022, subid = {2621}, title = {Toward 3D dose verification of an electronic brachytherapy source with a plastic scintillation detector}, journal = {Medical Physics}, year = {2022}, month = {3}, volume = {1-12}, number = {1-12}, number2 = {18NRM02: PRISM-eBT: Primary standards and traceable measurement methods for X-ray emitting electronic brachytherapy devices}, pages = {1-12}, keywords = {dose verification, electronic brachytherapy, Monte Carlo dosimetry, plastic scintillators}, web_url = {https://doi.org/10.1002/mp.15568}, misc2 = {EMPIR 2018: Pre-Co-Normative}, publisher = {Wiley}, language = {30}, ISSN = {0094-2405, 2473-4209}, DOI = {10.1002/mp.15568}, stag_bib_extends_levelofaccess = {NA}, author = {Georgi, P. and Kertzscher, G. and Nyvang, L. and Solc, J. and Schneider, T. and Tanderup, K. and Johansen, J.G.} } @Article { GarciaYipSRBBG2022, subid = {2620}, title = {Characterization of small active detectors for electronic brachytherapy dosimetry}, journal = {Journal of Instrumentation}, year = {2022}, month = {3}, volume = {17}, number = {03}, number2 = {18NRM02: PRISM-eBT: Primary standards and traceable measurement methods for X-ray emitting electronic brachytherapy devices}, pages = {P03001}, keywords = {Detector alignment and calibration methods (lasers, sources, particle-beams), X-ray detectors, Diamond Detectors}, web_url = {https://doi.org/10.1088/1748-0221/17/03/P03001}, misc2 = {EMPIR 2018: Pre-Co-Normative}, publisher = {IOP Publishing}, language = {30}, ISSN = {1748-0221}, DOI = {10.1088/1748-0221/17/03/P03001}, stag_bib_extends_levelofaccess = {NA}, author = {Garcia Yip, F. and Schneider, T. and Reginatto, M. and Behrens, R. and B{\"u}ermann, L. and Grote, F.} } @Article { ChaeKKPTKPGYSCCS2022, subid = {2653}, title = {Investigation of the stability of graphene devices for quantum resistance metrology at direct and alternating current}, journal = {Measurement Science and Technology}, year = {2022}, month = {3}, volume = {33}, number = {6}, number2 = {18SIB07: GIQS: Graphene impedance quantum standard}, pages = {065012}, keywords = {quantum Hall effect, quantized Hall resistance, graphene, impedance standard,F4-TCNQ doping, stability}, web_url = {https://iopscience.iop.org/article/10.1088/1361-6501/ac4a1a}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-0233, 1361-6501}, DOI = {10.1088/1361-6501/ac4a1a}, stag_bib_extends_levelofaccess = {NA}, author = {Chae, D-H. and Kruskopf, M. and Kucera, J. and Park, J. and Tran, N.T.M. and Kim, D.B. and Pierz, K. and G{\"o}tz, M. and Yin, Y. and Svoboda, P. and Chrobok, P. and Cou{\"e}do, F. and Schopfer, F.} } @Article { KlenovskyVKVKF2022, subid = {2689}, title = {Interplay between multipole expansion of exchange interaction and Coulomb correlation of exciton in colloidal II–VI quantum dots}, journal = {Electronic Structure}, year = {2022}, month = {3}, volume = {4}, number = {1}, number2 = {20IND05: QADeT: Quantum sensors for metrology based on single-atom-like device technology}, pages = {015006}, keywords = {quantum dots}, web_url = {https://iopscience.iop.org/article/10.1088/2516-1075/ac5b7e}, misc2 = {EMPIR 2020: Industry}, publisher = {IOP Publishing}, language = {30}, ISSN = {2516-1075}, DOI = {10.1088/2516-1075/ac5b7e}, stag_bib_extends_levelofaccess = {NA}, author = {Klenovsk{\'y}, P. and Valdhans, J. and Krejč{\'i}, L. and Valtr, M. and Klapetek, P. and Fedotova, O.} } @Article { HuynhDDLBW2022, subid = {2681}, title = {Candidate High-Resolution Mass Spectrometry-Based Reference Method for the Quantification of Procalcitonin in Human Serum Using a Characterized Recombinant Protein as a Primary Calibrator}, journal = {Analytical Chemistry}, year = {2022}, month = {3}, volume = {94}, number = {10}, number2 = {18HLT03: SEPTIMET: Metrology to enable rapid and accurate clinical measurements in acute management of sepsis}, pages = {4146-4154}, keywords = {High-Resolution Mass Spectrometry, Procalcitonin, Primary Calibrator}, web_url = {https://doi.org/10.1021/acs.analchem.1c03061}, misc2 = {EMPIR 2018: Health}, publisher = {American Chemical Society (ACS)}, language = {30}, ISSN = {0003-2700, 1520-6882}, DOI = {10.1021/acs.analchem.1c03061}, stag_bib_extends_levelofaccess = {NA}, author = {Huynh, H-H. and Delatour, V. and Derbez-Morin, M. and Liu, Q. and Boeuf, A. and Webster, W.} } @Article { MuruganORWB2022, subid = {2722}, title = {Vision for a European metrology network for energy gases}, journal = {Environmental Research: Infrastructure and Sustainability}, year = {2022}, month = {3}, volume = {2}, number = {1}, number2 = {18NET01: Energy Gases: Support for a European Metrology Network for energy gases}, pages = {012003}, keywords = {metrology, energy gases, hydrogen, biomethane, natural gas, CCS}, tags = {ENG}, misc2 = {EMPIR 2018: Support for Networks}, publisher = {IOP Publishing}, language = {30}, ISSN = {2634-4505}, DOI = {10.1088/2634-4505/ac57f6}, stag_bib_extends_levelofaccess = {NA}, author = {Murugan, A. and Omoniyi, O. and Richardson, E. and Workamp, M. and Baldan, A.} } @Article { KlenovskyVKVKF20220, subid = {2689}, title = {Interplay between multipole expansion of exchange interaction and Coulomb correlation of exciton in colloidal II–VI quantum dots}, journal = {Electronic Structure}, year = {2022}, month = {3}, volume = {4}, number = {1}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {015006}, keywords = {quantum dots}, web_url = {https://iopscience.iop.org/article/10.1088/2516-1075/ac5b7e}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {2516-1075}, DOI = {10.1088/2516-1075/ac5b7e}, stag_bib_extends_levelofaccess = {NA}, author = {Klenovsk{\'y}, P. and Valdhans, J. and Krejč{\'i}, L. and Valtr, M. and Klapetek, P. and Fedotova, O.} } @Article { KlenovskyVKVKF20221, subid = {2689}, title = {Interplay between multipole expansion of exchange interaction and Coulomb correlation of exciton in colloidal II–VI quantum dots}, journal = {Electronic Structure}, year = {2022}, month = {3}, volume = {4}, number = {1}, number2 = {20FUN05: SEQUME: Single- and entangled photon sources for quantum metrology}, pages = {015006}, keywords = {quantum dots}, web_url = {https://iopscience.iop.org/article/10.1088/2516-1075/ac5b7e}, misc2 = {EMPIR 2020: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {2516-1075}, DOI = {10.1088/2516-1075/ac5b7e}, stag_bib_extends_levelofaccess = {NA}, author = {Klenovsk{\'y}, P. and Valdhans, J. and Krejč{\'i}, L. and Valtr, M. and Klapetek, P. and Fedotova, O.} } @Article { KlenovskyVKVKF20222, subid = {2689}, title = {Interplay between multipole expansion of exchange interaction and Coulomb correlation of exciton in colloidal II–VI quantum dots}, journal = {Electronic Structure}, year = {2022}, month = {3}, volume = {4}, number = {1}, number2 = {20FUN02: POLight: Pushing boundaries of nano-dimensional metrology by light}, pages = {015006}, keywords = {quantum dots}, web_url = {https://iopscience.iop.org/article/10.1088/2516-1075/ac5b7e}, misc2 = {EMPIR 2020: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {2516-1075}, DOI = {10.1088/2516-1075/ac5b7e}, stag_bib_extends_levelofaccess = {NA}, author = {Klenovsk{\'y}, P. and Valdhans, J. and Krejč{\'i}, L. and Valtr, M. and Klapetek, P. and Fedotova, O.} } @Article { SantourianQS2022, subid = {2622}, title = {Uncertainty budget for PTB’s gonioreflectometers and ways to improve it in the short VIS spectral range}, journal = {Metrologia}, year = {2022}, month = {2}, day = {28}, volume = {59}, number = {2}, number2 = {18SIB03: BxDiff: New quantities for the measurement of appearance}, pages = {025004}, keywords = {gonioreflectometer, measurement uncertainty analysis, absolute spectral radiancefactor, BRDF, sphere radiation source, LED-sphere radiator}, web_url = {https://iopscience.iop.org/article/10.1088/1681-7575/ac4e76}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/ac4e76}, stag_bib_extends_levelofaccess = {NA}, author = {Santourian, I. and Quast, T. and Schirmacher, A.} } @Article { MarlettoVKPBRAGDG2022, subid = {2679}, title = {Emergence of Constructor-Based Irreversibility in Quantum Systems: Theory and Experiment}, journal = {Physical Review Letters}, year = {2022}, month = {2}, day = {23}, volume = {128}, number = {8}, number2 = {20IND05: QADeT: Quantum sensors for metrology based on single-atom-like device technology}, pages = {080401}, keywords = {Quantum Foundations, Quantum Measurements, Quantum thermodynamics}, web_url = {https://journals.aps.org/prl/abstract/10.1103/PhysRevLett.128.080401}, misc2 = {EMPIR 2020: Industry}, publisher = {American Physical Society (APS)}, address = {Ridge, NY, United States}, language = {30}, ISSN = {0031-9007, 1079-7114}, DOI = {10.1103/PhysRevLett.128.080401}, stag_bib_extends_levelofaccess = {NA}, author = {Marletto, C. and Vedral, V. and Knoll, L.T. and Piacentini, F. and Bernardi, E. and Rebufello, E. and Avella, A. and Gramegna, M. and Degiovanni, I.P. and Genovese, M.} } @Article { MarlettoVKPBRAGDG20220, subid = {2679}, title = {Emergence of Constructor-Based Irreversibility in Quantum Systems: Theory and Experiment}, journal = {Physical Review Letters}, year = {2022}, month = {2}, day = {23}, volume = {128}, number = {8}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {080401}, keywords = {Quantum Foundations, Quantum Measurements, Quantum thermodynamics}, web_url = {https://journals.aps.org/prl/abstract/10.1103/PhysRevLett.128.080401}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, address = {Ridge, NY, United States}, language = {30}, ISSN = {0031-9007, 1079-7114}, DOI = {10.1103/PhysRevLett.128.080401}, stag_bib_extends_levelofaccess = {NA}, author = {Marletto, C. and Vedral, V. and Knoll, L.T. and Piacentini, F. and Bernardi, E. and Rebufello, E. and Avella, A. and Gramegna, M. and Degiovanni, I.P. and Genovese, M.} } @Article { MarlettoVKPBRAGDG20221, subid = {2679}, title = {Emergence of Constructor-Based Irreversibility in Quantum Systems: Theory and Experiment}, journal = {Physical Review Letters}, year = {2022}, month = {2}, day = {23}, volume = {128}, number = {8}, number2 = {20FUN05: SEQUME: Single- and entangled photon sources for quantum metrology}, pages = {080401}, keywords = {Quantum Foundations, Quantum Measurements, Quantum thermodynamics}, web_url = {https://journals.aps.org/prl/abstract/10.1103/PhysRevLett.128.080401}, misc2 = {EMPIR 2020: Fundamental}, publisher = {American Physical Society (APS)}, address = {Ridge, NY, United States}, language = {30}, ISSN = {0031-9007, 1079-7114}, DOI = {10.1103/PhysRevLett.128.080401}, stag_bib_extends_levelofaccess = {NA}, author = {Marletto, C. and Vedral, V. and Knoll, L.T. and Piacentini, F. and Bernardi, E. and Rebufello, E. and Avella, A. and Gramegna, M. and Degiovanni, I.P. and Genovese, M.} } @Article { LibrizziURGRDDdP2022, subid = {2595}, title = {Ultrasounds induce blood–brain barrier opening across a sonolucent polyolefin plate in an in vitro isolated brain preparation}, journal = {Scientific Reports}, year = {2022}, month = {2}, day = {21}, volume = {12}, number = {1}, number2 = {18HLT06: RaCHy: Radiotherapy coupled with hyperthermia - adapting the biological equivalent dose concept}, keywords = {Ultrasounds, blood–brain barrier}, misc2 = {EMPIR 2018: Health}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2045-2322}, DOI = {10.1038/s41598-022-06791-7}, stag_bib_extends_levelofaccess = {NA}, author = {Librizzi, L. and Uva, L. and Raspagliesi, L. and Gionso, M. and Regondi, M.C. and Durando, G. and DiMeco, F. and de Curtis, M. and Prada, F.} } @Article { SteindlK2022, subid = {2690}, title = {Dimension-Dependent Phenomenological Model of Excitonic Electric Dipole in InGaAs Quantum Dots}, journal = {Nanomaterials}, year = {2022}, month = {2}, day = {21}, volume = {12}, number = {4}, number2 = {20IND05: QADeT: Quantum sensors for metrology based on single-atom-like device technology}, pages = {719}, keywords = {quantum dots}, web_url = {https://www.mdpi.com/2079-4991/12/4/719}, misc2 = {EMPIR 2020: Industry}, publisher = {MDPI AG}, language = {30}, ISSN = {2079-4991}, DOI = {10.3390/nano12040719}, stag_bib_extends_levelofaccess = {NA}, author = {Steindl, P. and Klenovsk{\'y}, P.} } @Article { SteindlK20220, subid = {2690}, title = {Dimension-Dependent Phenomenological Model of Excitonic Electric Dipole in InGaAs Quantum Dots}, journal = {Nanomaterials}, year = {2022}, month = {2}, day = {21}, volume = {12}, number = {4}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {719}, keywords = {quantum dots}, web_url = {https://www.mdpi.com/2079-4991/12/4/719}, misc2 = {EMPIR 2017: Fundamental}, publisher = {MDPI AG}, language = {30}, ISSN = {2079-4991}, DOI = {10.3390/nano12040719}, stag_bib_extends_levelofaccess = {NA}, author = {Steindl, P. and Klenovsk{\'y}, P.} } @Article { SteindlK20221, subid = {2690}, title = {Dimension-Dependent Phenomenological Model of Excitonic Electric Dipole in InGaAs Quantum Dots}, journal = {Nanomaterials}, year = {2022}, month = {2}, day = {21}, volume = {12}, number = {4}, number2 = {20FUN05: SEQUME: Single- and entangled photon sources for quantum metrology}, pages = {719}, keywords = {quantum dots}, web_url = {https://www.mdpi.com/2079-4991/12/4/719}, misc2 = {EMPIR 2020: Fundamental}, publisher = {MDPI AG}, language = {30}, ISSN = {2079-4991}, DOI = {10.3390/nano12040719}, stag_bib_extends_levelofaccess = {NA}, author = {Steindl, P. and Klenovsk{\'y}, P.} } @Article { AguirreSM2022, subid = {2580}, title = {SPICE Implementation of the Dynamic Memdiode Model for Bipolar Resistive Switching Devices}, journal = {Micromachines}, year = {2022}, month = {2}, day = {19}, volume = {13}, number = {2}, number2 = {20FUN06: MEMQuD: Memristive devices as quantum standard for nanometrology}, pages = {330}, keywords = {memristor; resistive switching; memory; memdiode}, web_url = {https://doi.org/10.3390/mi13020330}, misc2 = {EMPIR 2020: Fundamental}, publisher = {MDPI AG}, language = {30}, ISSN = {2072-666X}, DOI = {10.3390/mi13020330}, stag_bib_extends_levelofaccess = {NA}, author = {Aguirre, F.L. and Su{\~n}{\'e}, J. and Miranda, E.} } @Article { WarneckeKOKCBBHHU2022, subid = {2574}, title = {New metrological capabilities for measurements of dynamic liquid flows}, journal = {Metrologia}, year = {2022}, month = {2}, day = {17}, number2 = {17IND13: Metrowamet: Metrology for real-world domestic water metering}, keywords = {dynamic liquid flow rates, test rigs with dynamic measurement capabilities, validation through inter-facility intercomparison}, misc2 = {EMPIR 2017: Industry}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/ac566e}, stag_bib_extends_levelofaccess = {NA}, author = {Warnecke, H. and Kroner, C. and Ogheard, F. and Kondrup, J.B. and Christoffersen, N. and Benkova, M. and B{\"u}ker, O. and Haack, S. and Huovinen, M. and Unsal, B.} } @Article { ForssenSZZA2022, subid = {2600}, title = {An optical pascal in Sweden}, journal = {Journal of Optics}, year = {2022}, month = {2}, day = {17}, volume = {24}, number = {3}, number2 = {18SIB04: QuantumPascal: Towards quantum-based realisations of the pascal}, pages = {033002}, keywords = {optical, pascal, Sweden, refractometry, pressure, Fabry–Perot}, web_url = {https://iopscience.iop.org/article/10.1088/2040-8986/ac4ea2}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {2040-8978, 2040-8986}, DOI = {10.1088/2040-8986/ac4ea2}, stag_bib_extends_levelofaccess = {NA}, author = {Forss{\'e}n, C. and Silander, I. and Zakrisson, J. and Zelan, M. and Axner, O.} } @Article { BergCG2022, subid = {2664}, title = {Silicone tube humidity generator}, journal = {Atmospheric Measurement Techniques}, year = {2022}, month = {2}, day = {16}, volume = {15}, number = {3}, number2 = {20IND06: PROMETH2O: Metrology for trace water in ultra-pure process gases}, pages = {819-832}, keywords = {Humidity, trace moisture, permeation tube, metrology}, web_url = {https://amt.copernicus.org/articles/15/819/2022/}, misc2 = {EMPIR 2020: Industry}, publisher = {Copernicus GmbH}, language = {30}, ISSN = {1867-8548}, DOI = {10.5194/amt-15-819-2022}, stag_bib_extends_levelofaccess = {NA}, author = {Berg, R.F. and Chiodo, N. and Georgin, E.} } @Article { MingottiCPT2022_2, subid = {2717}, title = {Accuracy Type Test for Rogowski Coils Subjected to Distorted Signals, Temperature, Humidity, and Position Variations}, journal = {Sensors}, year = {2022}, month = {2}, day = {11}, volume = {22}, number = {4}, number2 = {19NRM05: IT4PQ: Measurement methods and test procedures for assessing accuracy of instrument transformers for power quality measurements}, pages = {1397}, keywords = {accuracy, type test, low-power instrument transformer, Rogowski coil, temperature, humidity, positioning, measurements}, web_url = {https://www.mdpi.com/1424-8220/22/4/1397}, misc2 = {EMPIR 2019: Pre-Co-Normative}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s22041397}, stag_bib_extends_levelofaccess = {NA}, author = {Mingotti, A. and Costa, F. and Peretto, L. and Tinarelli, R.} } @Article { WeingartnerHVVROKMD2022, subid = {2519}, title = {Comparing black-carbon- and aerosol-absorption-measuring instruments – a new system using lab-generated soot coated with controlled amounts of secondary organic matter}, journal = {Atmospheric Measurement Techniques}, year = {2022}, month = {2}, number2 = {18HLT02: AeroTox: Measurements for mitigating adverse health effects from atmospheric particulate pollutants}, keywords = {soot , black carbon, absorption photometer, photo-thermal interferometer, calibration}, misc2 = {EMPIR 2018: Health}, language = {30}, DOI = {10.5194/amt-15-561-2022}, stag_bib_extends_levelofaccess = {NA}, author = {Weingartner, E. and Hyv{\"a}rinen, A-P. and Vasilatou, K. and Visser, B. and R{\"o}rhbein, J. and Oscity, M. and Kalbermatter, D. and Močnik, G. and Drinovec, L.} } @Article { JuradoCLLVdM2022, subid = {2544}, title = {The Spectral Extent of Phasic Suppression of Loudness and Distortion-Product Otoacoustic Emissions by Infrasound and Low-Frequency Tones}, journal = {Journal of the Association for Research in Otolaryngology}, year = {2022}, month = {2}, number2 = {15HLT03: Ears II: Metrology for modern hearing assessment and protecting public health from emerging noise sources}, keywords = {loudness, DPOAE, infrasound}, misc2 = {EMPIR 2015: Health}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {1525-3961, 1438-7573}, DOI = {10.1007/s10162-021-00830-2}, stag_bib_extends_levelofaccess = {NA}, author = {Jurado, C. and Chow, M.Y.P. and Leung, K.M.L. and Larrea, M. and Vizuete, J. and de Cheveign{\'e}, A. and Marquardt, T.} } @Article { RicciardiM2022, subid = {2558}, title = {In Materia Should Be Used Instead of In Materio}, journal = {Frontiers in Nanotechnology}, year = {2022}, month = {2}, volume = {4}, number2 = {20FUN06: MEMQuD: Memristive devices as quantum standard for nanometrology}, pages = {850561}, keywords = {neuromorphic devices, nanowire networks, in materio computing, Latin phrases, reservoir computing}, web_url = {https://www.frontiersin.org/articles/10.3389/fnano.2022.850561/full}, misc2 = {EMPIR 2020: Fundamental}, publisher = {Frontiers Media SA}, language = {30}, ISSN = {2673-3013}, DOI = {10.3389/fnano.2022.850561}, stag_bib_extends_levelofaccess = {NA}, author = {Ricciardi, C. and Milano, G.} } @Proceedings { SunCGLJBB2022, subid = {2584}, title = {Evaluation of X-ray computed tomography for surface texture measurements using a prototype additively manufactured reference standard}, journal = {Proceedings 11th Conference on Industrial Computed Tomography (iCT) 2022,}, year = {2022}, month = {2}, number2 = {17IND08: AdvanCT: Advanced Computed Tomography for dimensional and surface measurements in industry}, keywords = {calibration, X-ray computed tomography, additive manufacturing, Reference standard, surface texture, areal}, web_url = {https://www.ndt.net/search/docs.php3?id=26568}, misc2 = {EMPIR 2017: Industry}, event_place = {Wels, Austria}, event_name = {11th Conference on Industrial Computed Tomography (iCT) 2022}, event_date = {08-02-2022 to 11-02-2022}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://www.ndt.net/article/ctc2022/papers/ICT2022_paper_id260.pdf}, author = {Sun, W. and Chen, X. and Giusca, C. and Lou, S. and Jones, C. and Boulter, H. and Brown, S.} } @Proceedings { BircherMKBEKHHL2022, subid = {2585}, title = {Traceable determination of non-static XCT machine geometry: New developments and case studies}, journal = {Proceedings 11th Conference on Industrial Computed Tomography (iCT) 2022,}, year = {2022}, month = {2}, number2 = {17IND08: AdvanCT: Advanced Computed Tomography for dimensional and surface measurements in industry}, keywords = {traceability, Dimensional metrology, XCT machine geometry, calibrated reference standards, radiographic XCT geometry determination, stage error motion, CFD/FE simulations, image quality metric based methods}, web_url = {https://www.ndt.net/search/docs.php3?id=26614}, misc2 = {EMPIR 2017: Industry}, event_place = {Wels, Austria}, event_name = {11th Conference on Industrial Computed Tomography (iCT) 2022}, event_date = {08-02-2022 to 11-02-2022}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://www.ndt.net/article/ctc2022/papers/ICT2022_paper_id209.pdf}, author = {Bircher, B. and Meli, F. and K{\"u}ng, A. and Bellon, C. and Evsevleev, S. and Katić, M. and Heikkinen, V. and Hemming, B. and Lassila, A.} } @Article { XuZAPB2022, subid = {2576}, title = {Using a Tip Characterizer to Investigate Microprobe Silicon Tip Geometry Variation in Roughness Measurements}, journal = {Sensors}, year = {2022}, month = {2}, volume = {22}, number = {3}, number2 = {17IND05: MicroProbes: Multifunctional ultrafast microprobes for on-the-machine measurements}, pages = {1298}, keywords = {roughness measurement, piezoresistive microprobe, silicon fracture, tip characterization}, web_url = {https://www.mdpi.com/1424-8220/22/3/1298}, misc2 = {EMPIR 2017: Industry}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s22031298}, stag_bib_extends_levelofaccess = {NA}, author = {XU, M. and Zhou, Z. and Ahbe, T. and Peiner, E. and Brand, U.} } @Proceedings { ObatonQYLD2022, subid = {2583}, title = {Comparison campaign of XCT systems using machined standards representative of additively manufactured parts}, journal = {Proceedings 11th Conference on Industrial Computed Tomography (iCT) 2022,}, year = {2022}, month = {2}, number2 = {17IND08: AdvanCT: Advanced Computed Tomography for dimensional and surface measurements in industry}, keywords = {Dimensional metrology, X-ray computed tomography (XCT), Additive Manufacturing (AM), Comparison campaign, round robin test, material measure}, web_url = {https://www.ndt.net/search/docs.php3?id=26635}, misc2 = {EMPIR 2017: Industry}, event_place = {Wels, Austria}, event_name = {Publication: 11th Conference on Industrial Computed Tomography (iCT) 2022}, event_date = {08-02-2022 to 11-02-2022}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://www.ndt.net/article/ctc2022/papers/ICT2022_paper_id207.pdf}, author = {Obaton, A-F. and Quagliotte, D. and Yardin, C. and Liltorp, K. and De Chiffre, L.} } @Article { SunGLYCFJWBB2022, subid = {2588}, title = {Establishment of X-ray computed tomography traceability for additively manufactured surface texture evaluation}, journal = {Additive Manufacturing}, year = {2022}, month = {2}, volume = {50}, number2 = {17IND08: AdvanCT: Advanced Computed Tomography for dimensional and surface measurements in industry}, pages = {102558}, keywords = {Additive manufacturing, Surface texture, Reference standard, X-ray computed tomography}, web_url = {https://www.sciencedirect.com/science/article/pii/S2214860421007053?via\%3Dihub}, misc2 = {EMPIR 2017: Industry}, publisher = {Elsevier BV}, language = {30}, ISSN = {2214-8604}, DOI = {10.1016/j.addma.2021.102558}, stag_bib_extends_levelofaccess = {NA}, author = {Sun, W. and Giusca, C. and Lou, S. and Yang, X. and Chen, X. and Fry, T. and Jiang, X. and Wilson, A. and Brown, S. and Boulter, H.} } @Proceedings { SinghRathoreLBSV2022, subid = {2587}, title = {Benchmarking of different reconstruction algorithms for industrial cone-beam CT}, journal = {Proceedings 11th Conference on Industrial Computed Tomography (iCT) 2022,}, year = {2022}, month = {2}, number2 = {17IND08: AdvanCT: Advanced Computed Tomography for dimensional and surface measurements in industry}, keywords = {reconstruction, tomography, iterative, Analytical}, web_url = {https://www.ndt.net/search/docs.php3?id=26640}, misc2 = {EMPIR 2017: Industry}, event_place = {Wels, Austria}, event_name = {11th Conference on Industrial Computed Tomography (iCT) 2022}, event_date = {08-02-2022 to 11-02-2022}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://www.ndt.net/article/ctc2022/papers/ICT2022_paper_id244.pdf}, author = {Singh Rathore, J. and Laquai, R. and Biguri, A. and Soleimani, M. and Vienne, C. } } @Article { ZutzBKHR2022, subid = {2630}, title = {DEVELOPMENT OF A EUROPEAN METROLOGY NETWORK FOR RELIABLE RADIATION PROTECTION: PULSED HIGH ENERGY PHOTON REFERENCE FIELD AS A METROLOGICAL GAP IN RADIATION PROTECTION}, journal = {Physica Medica}, year = {2022}, month = {2}, volume = {94}, number2 = {19NET03: supportBSS: Support for a European Metrology Network on reliable radiation protection regulation}, pages = {S113}, keywords = {high energy pulsed fields, European Metrology Network for Radiation Protection, photon reference field, metrological gaps, supportBSS}, misc2 = {EMPIR 2019: Support for Networks}, publisher = {Elsevier BV}, language = {30}, ISSN = {1120-1797}, DOI = {10.1016/S1120-1797(22)01699-4}, stag_bib_extends_levelofaccess = {NA}, author = {Zutz, H. and Busse, J. and Khanbabaee, B. and Hupe, O. and R{\"o}ttger, A.} } @Article { MartinMGd2022, subid = {2644}, title = {Construction, Characterization and Measurement of Fe–C and Pd–C HTFPs at CEM}, journal = {International Journal of Thermophysics}, year = {2022}, month = {2}, volume = {43}, number = {4}, number2 = {18SIB02: Real-K: Realising the redefined kelvin}, keywords = {Fe–C Furnace effect High temperature fixed points Pd–C}, web_url = {https://link.springer.com/article/10.1007/s10765-022-02978-2}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {0195-928X, 1572-9567}, DOI = {10.1007/s10765-022-02978-2}, stag_bib_extends_levelofaccess = {NA}, author = {Martin, M.J. and Mantilla, J.M. and Garcia-Izquierdo, C. and del Campo, D.} } @Article { ArrheniusFB2022, subid = {2685}, title = {Sampling methods for renewable gases and related gases: challenges and current limitations}, journal = {Analytical and bioanalytical chemistry}, year = {2022}, month = {2}, number2 = {20IND10: Decarb: Metrology for decarbonising the gas grid}, keywords = {Material compatibility, Renewable gases, Sampling}, misc2 = {EMPIR 2020: Industry}, publisher = {Springer}, language = {30}, DOI = {10.1007/s00216-022-03949-0}, stag_bib_extends_levelofaccess = {NA}, author = {Arrhenius, K. and Francini, L. and B{\"u}ker, O.} } @Article { PalaciosAlvarezGCZMM2022, subid = {2741}, title = {Single-domain Bose condensate magnetometer achieves energy resolution per bandwidth below ℏ}, journal = {Proceedings of the National Academy of Sciences}, year = {2022}, month = {2}, volume = {119}, number = {6}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, keywords = {BEC, Magnetometer}, web_url = {https://acris.aalto.fi/ws/portalfiles/portal/79762019/Single_domain_Bose_condensate_magnetometer_achieves_energy_resolution_per_bandwidth_below_.pdf}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Proceedings of the National Academy of Sciences}, language = {30}, ISSN = {0027-8424, 1091-6490}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://arxiv.org/abs/2108.11716}, author = {Palacios Alvarez, S. and Gomez, P. and Coop, S. and Zamora-Zamora, R. and Mazzinghi, C. and Mitchell, M.W.} } @Article { MarinelliFGGGHPPVVVV2022, subid = {2659}, title = {Design, realization, and characterization of a novel diamond detector prototype for FLASH radiotherapy dosimetry}, journal = {Medical Physics}, year = {2022}, month = {1}, day = {31}, volume = {49}, number = {3}, number2 = {18HLT04: UHDpulse: Metrology for advanced radiotherapy using particle beams with ultra-high pulse dose rates}, pages = {1902-1910}, keywords = {diamond detector, dosimetry, FLASH radiotherapy}, misc2 = {EMPIR 2018: Health}, publisher = {Wiley}, language = {30}, ISSN = {0094-2405, 2473-4209}, DOI = {10.1002/mp.15473}, stag_bib_extends_levelofaccess = {NA}, author = {Marinelli, M. and Felici, G. and Galante, F. and Gasparini, A. and Giuliano, L. and Heinrich, S. and Pacitti, M. and Prestopino, G. and Vanreusel, V. and Verellen, D. and Verona, C. and Verona Rinati, G.} } @Article { VillegasQUTL2022, subid = {2535}, title = {Identification of Model Particle Mixtures Using Machine-Learning-Assisted Laser Diffraction}, journal = {Photonics}, year = {2022}, month = {1}, day = {28}, volume = {9}, number = {2}, number2 = {20FUN02: POLight: Pushing boundaries of nano-dimensional metrology by light}, pages = {74}, keywords = {Particle characterization; Laser diffraction; Machine learning; Neural networks}, web_url = {https://www.mdpi.com/2304-6732/9/2/74}, misc2 = {EMPIR 2020: Fundamental}, publisher = {MDPI AG}, language = {30}, ISSN = {2304-6732}, DOI = {10.3390/photonics9020074}, stag_bib_extends_levelofaccess = {NA}, author = {Villegas, A. and Quiroz-Ju{\'a}rez, M.A. and U’Ren, A.B. and Torres, J.P. and Le{\'o}n-Montiel, R. de J.} } @Article { MilanoBVR2022, subid = {2556}, title = {Memristive devices based on single ZnO nanowires—from material synthesis to neuromorphic functionalities}, journal = {Semiconductor Science and Technology}, year = {2022}, month = {1}, day = {28}, volume = {37}, number = {3}, number2 = {20FUN06: MEMQuD: Memristive devices as quantum standard for nanometrology}, pages = {034002}, keywords = {nanowires, ZnO, chemical vapor deposition (CVD), resistive switching,memristive devices, neuromorphic devices}, web_url = {https://iopscience.iop.org/article/10.1088/1361-6641/ac4b8a}, misc2 = {EMPIR 2020: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {0268-1242, 1361-6641}, DOI = {10.1088/1361-6641/ac4b8a}, stag_bib_extends_levelofaccess = {NA}, author = {Milano, G. and Boarino, L. and Valov, I. and Ricciardi, C.} } @Article { KuckLHGCRPSGBFLTTCMDTRR2022, subid = {2486}, title = {Single photon sources for quantum radiometry: a brief review about the current state-of-the-art}, journal = {Applied Physics B}, year = {2022}, month = {1}, day = {23}, volume = {128}, number = {2}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, keywords = {Single photon sources, quantum radiometry, quantum metrology}, web_url = {https://doi.org/10.1007/s00340-021-07734-2}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {0946-2171, 1432-0649}, DOI = {10.1007/s00340-021-07734-2}, stag_bib_extends_levelofaccess = {NA}, author = {K{\"u}ck, S. and L{\'o}pez, M. and Hofer, H. and Georgieva, H. and Christinck, J. and Rodiek, B. and Porrovecchio, G. and Smid, M. and G{\"o}tzinger, S. and Becher, C. and Fuchs, P. and Lombardi, P. and Toninelli, C. and Trapuzzano, M. and Colautti, M. and Margheri, G. and Degiovanni, I.P. and Traina, P. and Rodt, S. and Reitzenstein, S.} } @Article { KuckLHGCRPSGBFLTTCMDTRR2022_2, subid = {2752}, title = {Single photon sources for quantum radiometry: a brief review about the current state-of-the-art}, journal = {Applied Physics B}, year = {2022}, month = {1}, day = {23}, volume = {128}, number = {2}, number2 = {20FUN05: SEQUME: Single- and entangled photon sources for quantum metrology}, keywords = {Single-photon sources, quantum radiometry, calibration, single photon detectors. defect centres, (nano-)diamonds, molecule semiconductor quantum dots, photon flux, single-photon purity, spectral power distribution}, misc2 = {EMPIR 2020: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {0946-2171, 1432-0649}, DOI = {10.1007/s00340-021-07734-2}, stag_bib_extends_levelofaccess = {NA}, author = {K{\"u}ck, S. and L{\'o}pez, M. and Hofer, H. and Georgieva, H. and Christinck, J. and Rodiek, B. and Porrovecchio, G. and Smid, M. and G{\"o}tzinger, S. and Becher, C. and Fuchs, P. and Lombardi, P. and Toninelli, C. and Trapuzzano, M. and Colautti, M. and Margheri, G. and Degiovanni, I.P. and Traina, P. and Rodt, S. and Reitzenstein, S.} } @Article { TongBKRGGGCHC2022, subid = {2570}, title = {Cathodoluminescence mapping of electron concentration in MBE-grown GaAs:Te nanowires}, journal = {Nanotechnology}, year = {2022}, month = {1}, day = {22}, volume = {33}, number = {18}, number2 = {19ENG05: NanoWires: High throughput metrology for nanowire energy harvesting devices}, pages = {185704}, keywords = {nanowires, GaAs, doping, cathodoluminescence}, web_url = {https://iopscience.iop.org/article/10.1088/1361-6528/ac4d58}, misc2 = {EMPIR 2019: Energy}, publisher = {IOP}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://hal.archives-ouvertes.fr/hal-03539939}, author = {Tong, C. and Bidaud, T. and Koivusalo, E. and Rizzo Piton, M. and Guina, M. and Galeti, H. and Galvao Gobato, Y. and Cattoni, A. and Hakkarainen, T. and Collin, S.} } @Article { DeVisMHMSB2022, subid = {2536}, title = {Ancillary Data Uncertainties within the SeaDAS Uncertainty Budget for Ocean Colour Retrievals}, journal = {Remote Sensing}, year = {2022}, month = {1}, day = {21}, volume = {14}, number = {3}, number2 = {16ENV03: MetEOC-3: Further metrology for earth observation and climate}, pages = {497}, keywords = {Ocean Colour, Atmospheric correction, uncertainty, ancillary parameters}, misc2 = {EMPIR 2016: Environment}, publisher = {MDPI AG}, language = {30}, ISSN = {2072-4292}, DOI = {10.3390/rs14030497}, stag_bib_extends_levelofaccess = {NA}, author = {De Vis, P. and M{\'e}lin, F. and Hunt, S.E. and Morrone, R. and Sinclair, M. and Bell, B.} } @Article { DeVisMHMSB2022_2, subid = {2590}, title = {Ancillary Data Uncertainties within the SeaDAS Uncertainty Budget for Ocean Colour Retrievals}, journal = {Remote Sensing}, year = {2022}, month = {1}, day = {21}, volume = {14}, number = {3}, number2 = {19ENV07: MetEOC-4: Metrology to establish an SI traceable climate observing system}, pages = {497}, keywords = {ocean colour, atmospheric correction, uncertainty, ancillary parameters}, misc2 = {EMPIR 2019: Environment}, publisher = {MDPI AG}, language = {30}, ISSN = {2072-4292}, DOI = {10.3390/rs14030497}, stag_bib_extends_levelofaccess = {NA}, author = {De Vis, P. and M{\'e}lin, F. and Hunt, S.E. and Morrone, R. and Sinclair, M. and Bell, B.} } @Article { MontanoMR2022, subid = {2557}, title = {Grid-graph modeling of emergent neuromorphic dynamics and heterosynaptic plasticity in memristive nanonetworks}, journal = {Neuromorphic Computing and Engineering}, year = {2022}, month = {1}, day = {20}, volume = {2}, number = {1}, number2 = {20FUN06: MEMQuD: Memristive devices as quantum standard for nanometrology}, pages = {014007}, keywords = {nanoarchitectures, nanowire networks, memristive networks, heterosynaptic plasticity, neuromorphic systems, self-organizing systems}, web_url = {https://iopscience.iop.org/article/10.1088/2634-4386/ac4d86}, misc2 = {EMPIR 2020: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {2634-4386}, DOI = {10.1088/2634-4386/ac4d86}, stag_bib_extends_levelofaccess = {NA}, author = {Montano, K. and Milano, G. and Ricciardi, C.} } @Article { DuKJMYCOMZ2022, subid = {2748}, title = {SU(2)-in-SU(1,1) Nested Interferometer}, journal = {Physical Review Letters}, year = {2022}, month = {1}, day = {20}, volume = {128}, number = {3}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, keywords = {SU(1,1) interferometry, spin squeezing, entanglement}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {0031-9007, 1079-7114}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://arxiv.org/abs/2004.14266}, author = {Du, W. and Kong, J. and ., . and ., . and Jia, J. and Ming, S. and Yuan, C-H. and Chen, J.F. and Ou, Z.Y. and Mitchell, M.W. and Zhang, W.} } @Article { KellerSKFCVCOBHMMNORBCNCDDGLVWZK2022, subid = {2778}, title = {RNA reference materials with defined viral RNA loads of SARS-CoV-2—A useful tool towards a better PCR assay harmonization}, journal = {PLOS ONE}, year = {2022}, month = {1}, day = {20}, volume = {17}, number = {1}, number2 = {18HLT03: SEPTIMET: Metrology to enable rapid and accurate clinical measurements in acute management of sepsis}, pages = {e0262656}, keywords = {SARS-CoV-2, RNA, PCR}, misc2 = {EMPIR 2018: Health}, publisher = {Public Library of Science (PLoS)}, language = {30}, ISSN = {1932-6203}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://zenodo.org/record/6637818}, author = {Keller, T. and Schellenberg, I. and Kummrow, A. and Falak, S. and Cleveland, M.H. and Vallone, P.M. and Cowen, S. and O’Sullivan, D. and Busby, E. and Huggett, J. and Mielke, M. and Michel, J. and Nitsche, A. and Obermeier, M. and Rabenau, H.F. and Berger, A. and Ciesek, S. and Niemeyer, D. and Corman, V. and Duehring, U. and Drosten, C. and Grunert, H-P. and Lindig, V. and Vierbaum, L. and Wojtalewicz, N. and Zeichhardt, H. and Kammel, M.} } @Article { HansenJJH2022, subid = {2518}, title = {Enhanced Measurement Accuracy for Nanostructures Using Hybrid Metrology}, journal = {Frontiers in Physics}, year = {2022}, month = {1}, day = {19}, volume = {9}, number2 = {20FUN02: POLight: Pushing boundaries of nano-dimensional metrology by light}, pages = {791459}, keywords = {metrology, Mueller ellipsometry, inverse modelling, scatterometry, nanostructures}, web_url = {https://www.frontiersin.org/articles/10.3389/fphy.2021.791459/full}, misc2 = {EMPIR 2020: Fundamental}, publisher = {Frontiers Media SA}, language = {30}, ISSN = {2296-424X}, DOI = {10.3389/fphy.2021.791459}, stag_bib_extends_levelofaccess = {NA}, author = {Hansen, P-E. and Johannsen, S.R. and Jensen, S.A. and Hansen, P.} } @Article { MittelstadtSK2022, subid = {2680}, title = {Modeling electronic and optical properties of III–V quantum dots—selected recent developments}, journal = {Light: Science \& Applications}, year = {2022}, month = {1}, day = {17}, volume = {11}, number = {1}, number2 = {20IND05: QADeT: Quantum sensors for metrology based on single-atom-like device technology}, pages = {17}, keywords = {quantum dots, empirical tight binding}, web_url = {https://www.nature.com/articles/s41377-021-00700-9}, misc2 = {EMPIR 2020: Industry}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2047-7538}, DOI = {10.1038/s41377-021-00700-9}, stag_bib_extends_levelofaccess = {NA}, author = {Mittelst{\"a}dt, A. and Schliwa, A. and Klenovsk{\'y}, P.} } @Article { MittelstadtSK20220, subid = {2680}, title = {Modeling electronic and optical properties of III–V quantum dots—selected recent developments}, journal = {Light: Science \& Applications}, year = {2022}, month = {1}, day = {17}, volume = {11}, number = {1}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {17}, keywords = {quantum dots, empirical tight binding}, web_url = {https://www.nature.com/articles/s41377-021-00700-9}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2047-7538}, DOI = {10.1038/s41377-021-00700-9}, stag_bib_extends_levelofaccess = {NA}, author = {Mittelst{\"a}dt, A. and Schliwa, A. and Klenovsk{\'y}, P.} } @Article { MittelstadtSK20221, subid = {2680}, title = {Modeling electronic and optical properties of III–V quantum dots—selected recent developments}, journal = {Light: Science \& Applications}, year = {2022}, month = {1}, day = {17}, volume = {11}, number = {1}, number2 = {20FUN05: SEQUME: Single- and entangled photon sources for quantum metrology}, pages = {17}, keywords = {quantum dots, empirical tight binding}, web_url = {https://www.nature.com/articles/s41377-021-00700-9}, misc2 = {EMPIR 2020: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2047-7538}, DOI = {10.1038/s41377-021-00700-9}, stag_bib_extends_levelofaccess = {NA}, author = {Mittelst{\"a}dt, A. and Schliwa, A. and Klenovsk{\'y}, P.} } @Article { BeckhoffURHTHE2022, subid = {2463}, title = {Investigating Membrane‐Mediated Antimicrobial Peptide Interactions with Synchrotron Radiation Far‐Infrared Spectroscopy}, journal = {ChemPhysChem}, year = {2022}, month = {1}, day = {14}, number2 = {HLT10: BiOrigin: Metrology for biomolecular origin of disease}, pages = {1-11}, keywords = {antimicrobialpeptides, electrostatic interactions, IR spectroscopy, phospholipid membranes, protein folding}, misc2 = {EMRP A169: Call 2011 Metrology for Health}, publisher = {Wiley}, language = {30}, ISSN = {1439-4235, 1439-7641}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://doi.org/10.1002/cphc.202100815}, author = {Beckhoff, B. and Ulm, G. and Ryadnov, M.G. and Hoehl, A. and Tiersch, B. and Hornemann, A. and Eichert, D.M.} } @Article { MertesRR2022, subid = {2442}, title = {Development of 222Rn Emanation Sources with Integrated Quasi 2pi Active Monitoring}, journal = {International Journal of Environmental Research and Public Health}, year = {2022}, month = {1}, day = {12}, number2 = {19ENV01: traceRadon: Radon metrology for use in climate change observation and radiation protection at the environmental level}, keywords = {222Rn emanation; physical vapor deposition; silicon detectors}, misc2 = {EMPIR 2019: Environment}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {10.3390/ijerph19020840}, author = {Mertes, F. and R{\"o}ttger, S. and R{\"o}ttger, A.} } @Article { MertesRR2022_2, subid = {2480}, title = {Development of 222Rn Emanation Sources with Integrated Quasi 2\(\pi\) Active Monitoring}, journal = {International Journal of Environmental Research and Public Health}, year = {2022}, month = {1}, day = {12}, volume = {19}, number = {2}, number2 = {19ENV01: traceRadon: Radon metrology for use in climate change observation and radiation protection at the environmental level}, pages = {840}, keywords = {222Rn emanation; physical vapor deposition; silicon detectors}, misc2 = {EMPIR 2019: Environment}, publisher = {MDPI AG}, language = {30}, ISSN = {1660-4601}, DOI = {10.3390/ijerph19020840}, stag_bib_extends_levelofaccess = {NA}, author = {Mertes, F. and R{\"o}ttger, S. and R{\"o}ttger, A.} } @Article { ChristensenDLSLRSMSMVMRLMLQKSGMMYYISDVVFLPBFNSMRTPKTTBCPLPMMHMDTGCHIP2022, subid = {2567}, title = {2022 roadmap on neuromorphic computing and engineering}, journal = {Neuromorphic Computing and Engineering}, year = {2022}, month = {1}, day = {12}, number2 = {20FUN06: MEMQuD: Memristive devices as quantum standard for nanometrology}, keywords = {neuromorphic computing, neuromorphic engineering}, web_url = {https://iopscience.iop.org/article/10.1088/2634-4386/ac4a83}, misc2 = {EMPIR 2020: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {2634-4386}, DOI = {10.1088/2634-4386/ac4a83}, stag_bib_extends_levelofaccess = {NA}, author = {Christensen, D.V. and Dittmann, R. and Linares-Barranco, B. and Sebastian, A. and Le Gallo, M. and Redaelli, A. and Slesazeck, S. and Mikolajick, T. and Spiga, S. and Menzel, S. and Valov, I. and Milano, G. and Ricciardi, C. and Liang, S-J. and Miao, F. and Lanza, M. and Quill, T.J. and Keene, S.T. and Salleo, A. and Grollier, J. and Markovic, D. and Mizrahi, A. and Yao, P. and Yang, J.J. and Indiveri, G. and Strachan, J.P. and Datta, S. and Vianello, E. and Valentian, A. and Feldmann, J. and Li, X. and Pernice, W.H.P. and Bhaskaran, H. and Furber, S. and Neftci, E. and Scherr, F. and Maass, W. and Ramaswamy, S. and Tapson, J. and Panda, P. and Kim, Y. and Tanaka, G. and Thorpe, S. and Bartolozzi, C. and Cleland, T.A. and Posch, C. and Liu, S-C. and Panuccio, G. and Mahmud, M. and Mazumder, A.N. and Hosseini, M. and Mohsenin, T. and Donati, E. and Tolu, S. and Galeazzi, R. and Christensen, M.E. and Holm, S. and Ielmini, D. and Pryds, N.} } @Article { PearceTICFWC2022, subid = {2429}, title = {Correlation between insulation resistance breakdown and temperature measurement error in Type K and N mineral insulated, metal sheathed thermocouples}, journal = {International Journal of Thermophysics}, year = {2022}, month = {1}, day = {10}, volume = {43}, number = {N/A}, number2 = {17IND04: EMPRESS 2: Enhancing process efficiency through improved temperature measurement 2}, pages = {35}, keywords = {Insulation resistance breakdown, Mineral insulated metal sheathedthermocouple, Temperature, Thermocouple, Thermoelectric}, web_url = {https://link.springer.com/content/pdf/10.1007/s10765-021-02967-x.pdf}, misc2 = {EMPIR 2017: Industry}, publisher = {Springer}, address = {London}, language = {30}, ISSN = {0195-928X}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://doi.org/10.1007/s10765-021-02967-x}, author = {Pearce, J. and Tucker, D. and Izquierdo, C.G. and Caballero, R. and Ford, T. and Williams, P. and Cowley, P.} } @Article { ClivatiMDVGLMPYSLDC2022, subid = {2524}, title = {Coherent phase transfer for real-world twin-field quantum key distribution}, journal = {Nature Communications}, year = {2022}, month = {1}, day = {10}, volume = {13}, number = {1}, number2 = {19NRM06: MeTISQ: Metrology for testing the implementation security of quantum key distribution hardware}, pages = {s41467-021-27808-1}, keywords = {QKD, Single photons and quantum effects, Optical metrology, Fibre optics and optical communications, Optoelectronic devices and components, Quantum information}, misc2 = {EMPIR 2019: Pre-Co-Normative}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2041-1723}, DOI = {10.1038/s41467-021-27808-1}, stag_bib_extends_levelofaccess = {NA}, author = {Clivati, C. and Meda, A. and Donadello, S. and Virz{\`i}, S. and Genovese, M. and Levi, F. and Mura, A. and Pittaluga, M. and Yuan, Z. and Shields, A.J. and Lucamarini, M. and Degiovanni, I.P. and Calonico, D.} } @Article { GuilloryTWA2022, subid = {2169}, title = {Absolute multilateration-based coordinate measurement system using retroreflecting glass spheres}, journal = {Precision Engineering}, year = {2022}, month = {1}, volume = {73}, number2 = {18SIB01: GeoMetre: Large-scale dimensional measurements for geodesy}, pages = {214-227}, keywords = {Large volume metrologyAbsolute distance metreRetroreflecting glass spheresCoordinate measurement systemMultilateration technique with self-calibration}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Elsevier BV}, language = {30}, ISSN = {0141-6359}, DOI = {10.1016/j.precisioneng.2021.09.009}, stag_bib_extends_levelofaccess = {NA}, author = {Guillory, J. and Truong, D. and Wallerand, J.-P. and Alexandre, C.} } @Article { GuilloryTWA2022_2, subid = {2172}, title = {Absolute multilateration-based coordinate measurement system using retroreflecting glass spheres}, journal = {Precision Engineering}, year = {2022}, month = {1}, volume = {73}, number2 = {17IND03: LaVA: Large Volume Metrology Applications}, pages = {214-227}, keywords = {Large Volume Metrology; Absolute Distance Metre; retroreflecting glass spheres; coordinate measurementsystem; multilateration technique with self-calibration.}, web_url = {https://hal.archives-ouvertes.fr/hal-03349168v1}, misc2 = {EMPIR 2017: Industry}, publisher = {Elsevier BV}, language = {30}, ISSN = {0141-6359}, DOI = {10.1016/j.precisioneng.2021.09.009}, stag_bib_extends_levelofaccess = {NA}, author = {Guillory, J. and Truong, D. and Wallerand, J-P. and Alexandre, C.} } @Article { RadulescuCLRGDI2022, subid = {2290}, title = {Inter-comparison of commercial continuous radon monitors responses}, journal = {Nuclear Instruments and Methods in Physics Research Section A: Accelerators, Spectrometers, Detectors and Associated Equipment}, year = {2022}, month = {1}, volume = {1021}, number2 = {19ENV01: traceRadon: Radon metrology for use in climate change observation and radiation protection at the environmental level}, pages = {165927}, keywords = {Radon monitoringTransfer standardMetrological traceability}, misc2 = {EMPIR 2019: Environment}, publisher = {Elsevier BV}, language = {30}, ISSN = {0168-9002}, DOI = {10.1016/j.nima.2021.165927}, stag_bib_extends_levelofaccess = {NA}, author = {Radulescu, I. and Calin, M.R. and Luca, A. and R{\"o}ttger, A. and Grossi, C. and Done, L. and Ioan, M.R.} } @Article { CelikovicPVNiCGBQR2022, subid = {2428}, title = {Outdoor Radon as a Tool to Estimate Radon Priority Areas—A Literature Overview}, journal = {International Journal of Environmental Research and Public Health}, year = {2022}, month = {1}, number2 = {19ENV01: traceRadon: Radon metrology for use in climate change observation and radiation protection at the environmental level}, keywords = {outdoor radon concentrations; literature overview; radiation risk; indoor radonconcentrations; radon priority areas}, misc2 = {EMPIR 2019: Environment}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://doi.org/10.3390/ijerph19020662}, author = {Čeliković, I. and Pantelić, G. and Vukanac, I. and Nikolić, J.K. and Živanović, M. and Cinelli, G. and Gruber, V. and Baumann, S. and Quindos Poncela, L.S. and Rabago, D.} } @Proceedings { HulsenGPGKF2022, subid = {2416}, title = {Angular responsivity of ground and space-based direct solar irradiance radiometers}, journal = {Journal of Physics: Conference Series}, year = {2022}, month = {1}, volume = {2149}, number = {2149}, number2 = {19ENV04: MAPP: Metrology for aerosol optical properties}, pages = {1-7}, keywords = {Radiometry, field of view, angular responsivity}, web_url = {https://iopscience.iop.org/issue/1742-6596/2149/1}, misc2 = {EMPIR 2019: Environment}, publisher = {IOP Publishing Limited}, event_place = {Boulder}, event_name = {14th International Conference on New Developments and Applications in Optical Radiometry (NEWRAD 2021)}, event_date = {21-06-2021 to 24-06-2021}, language = {30}, DOI = {10.1088/1742-6596/2149/1/012001}, stag_bib_extends_levelofaccess = {NA}, author = {H{\"u}lsen, G. and Gr{\"o}bner, J. and Pfiffner, D. and Gyo, M. and Kouremeti, N. and F{\"o}ller, J.} } @Article { SantourianQTHS2022, subid = {2420}, title = {Novel LED-based radiation source and its application in diffuse reflectometry and polarization measurements}, journal = {Journal of Physics: Conference Series}, year = {2022}, month = {1}, volume = {2149 (2022}, number2 = {18SIB03: BxDiff: New quantities for the measurement of appearance}, pages = {1-8}, keywords = {Source based radiometry, BRDF, Spectral radiance factor, LED sphere radiator, polarisation, diffuse reflection}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {NEWRAD 2021 - IOP Publishing}, language = {30}, ISSN = {1742-6588}, DOI = {10.1088/1742-6596/2149/1/012010}, stag_bib_extends_levelofaccess = {NA}, author = { Santourian, I. and Quast, T. and Teichert, S. and Hauer, K-O. and Schirmacher, A.} } @Proceedings { KouremetiGN2022, subid = {2417}, title = {Stray-Light Correction Methodology for the Precision Solar Spectroradiometer}, journal = {Journal of Physics: Conference Series}, year = {2022}, month = {1}, volume = {2149}, number = {2149}, number2 = {19ENV04: MAPP: Metrology for aerosol optical properties}, pages = {1-9}, keywords = {Radiometry, spectral, stray light, spectroradiometer}, web_url = {https://iopscience.iop.org/issue/1742-6596/2149/1}, misc2 = {EMPIR 2019: Environment}, publisher = {IOP Publishing Limited}, event_place = {Boulder}, event_name = {14th International Conference on New Developments and Applications in Optical Radiometry (NEWRAD 2021)}, event_date = {21-06-2021 to 24-06-2021}, language = {30}, DOI = {10.1088/1742-6596/2149/1/012002}, stag_bib_extends_levelofaccess = {NA}, author = {Kouremeti, N. and Gr{\"o}bner, J. and Nevas, S.} } @Article { SchaudeGH2022, subid = {2443}, title = {Effect of a Misidentified Centre of a Type ASG Material Measure on the Determined Topographic Spatial Resolution of an Optical Point Sensor}, journal = {Metrology}, year = {2022}, month = {1}, volume = {2}, number = {1}, number2 = {20IND07: TracOptic: Traceable industrial 3D roughness and dimensional measurement using optical 3D microscopy and optical distance sensors}, pages = {19-32}, keywords = {surface metrology, topographic spatial resolution, lateral period limit, type ASG materialmeasure, Siemens star, confocal sensor, nano measuring machine}, web_url = {https://www.mdpi.com/2673-8244/2/1/2}, misc2 = {EMPIR 2020: Industry}, publisher = {MDPI}, language = {30}, DOI = {10.3390/metrology2010002}, stag_bib_extends_levelofaccess = {NA}, author = {Schaude, J. and Gr{\"o}schl, A. and Hausotte, T. } } @Article { Villajos2022, subid = {2472}, title = {Experimental Volumetric Hydrogen Uptake Determination at 77 K of Commercially Available Metal-Organic Framework Materials}, journal = {C-Journal of Carbon Research}, year = {2022}, month = {1}, volume = {8}, number = {1}, number2 = {19ENG03: MefHySto: Metrology for Advanced Hydrogen Storage Solutions}, pages = {5}, keywords = {hydrogen adsorption, commercial metal-organic frameworks, hydrogen uptake reproducibility, volumetric uptake, packing density}, misc2 = {EMPIR 2019: Energy}, publisher = {MDPI AG}, language = {30}, ISSN = {2311-5629}, DOI = {10.3390/c8010005}, stag_bib_extends_levelofaccess = {NA}, author = {Villajos, J.A.} } @Article { MingottiCPT2022, subid = {2520}, title = {Effect of Proximity, Burden, and Position on the Power Quality Accuracy Performance of Rogowski Coils}, journal = {Sensors}, year = {2022}, month = {1}, volume = {22}, number = {1}, number2 = {19NRM05: IT4PQ: Measurement methods and test procedures for assessing accuracy of instrument transformers for power quality measurements}, pages = {397}, keywords = {low-power instrument transformer, Rogowski coil, position, burden, proximity, accuracy, harmonic, power quality}, web_url = {https://www.mdpi.com/1424-8220/22/1/397}, misc2 = {EMPIR 2019: Pre-Co-Normative}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s22010397}, stag_bib_extends_levelofaccess = {NA}, author = {Mingotti, A. and Costa, F. and Peretto, L. and Tinarelli, R.} } @Article { ChristinckRLGHGK2022, subid = {2506}, title = {Comparison of back focal plane imaging of nitrogen vacancy centers in nanodiamond and core-shell CdSe/CdS quantum dots}, journal = {Journal of Physics: Conference Series}, year = {2022}, month = {1}, volume = {2149}, number = {1}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {012014}, keywords = {nitrogen vacancy center, nanodiamond, CdSe/CdS quantum dots, back focal imaging}, web_url = {https://iopscience.iop.org/article/10.1088/1742-6596/2149/1/012014}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {1742-6588, 1742-6596}, DOI = {10.1088/1742-6596/2149/1/012014}, stag_bib_extends_levelofaccess = {NA}, author = {Christinck, J. and Rodiek, B. and L{\'o}pez, M. and Georgieva, H. and Hofer, H. and G{\"o}tzinger, S. and K{\"u}ck, S.} } @Article { KatonaTSKN2022, subid = {2568}, title = {Geometric system analysis of ILMD-based LID measurement systems using Monte-Carlo simulation}, journal = {Journal of Physics: Conference Series}, year = {2022}, month = {1}, volume = {2149}, number = {1}, number2 = {19NRM02: RevStdLED: Revision and extension of standards for test methods for LED lamps, luminaires and modules}, pages = {012015}, keywords = {ILMD, goniophotometer, geoemtric uncertainty, monte carlo simulation,}, misc2 = {EMPIR 2019: Pre-Co-Normative}, publisher = {IOP Publishing}, language = {30}, ISSN = {1742-6588, 1742-6596}, DOI = {10.1088/1742-6596/2149/1/012015}, stag_bib_extends_levelofaccess = {NA}, author = {Katona, M. and Trampert, K. and Schwanengel, C. and Kr{\"u}ger, U. and Neumann, C.} } @Article { OanceaBPGJCOC2022, subid = {2657}, title = {Stray radiation produced in FLASH electron beams characterized by the MiniPIX Timepix3 Flex detector}, journal = {Journal of Instrumentation}, year = {2022}, month = {1}, volume = {17}, number = {01}, number2 = {18HLT04: UHDpulse: Metrology for advanced radiotherapy using particle beams with ultra-high pulse dose rates}, pages = {C01003}, keywords = {MiniPIX Timepix3, Particle fluxes, Dose rates, FLASH electron beams, UHDpulse, electronradiotherapy}, web_url = {https://doi.org/10.48550/arXiv.2201.13171}, misc2 = {EMPIR 2018: Health}, publisher = {IOP Publishing}, language = {30}, ISSN = {1748-0221}, DOI = {10.1088/1748-0221/17/01/C01003}, stag_bib_extends_levelofaccess = {NA}, author = {Oancea, C. and Bălan, C. and Pivec, J. and Granja, C. and Jakubek, J. and Chvatil, D. and Olsansky, V. and Chiș, V.} } @Article { ChavelSLSHO2022, subid = {2684}, title = {Advocating a statistical definition for the BRDF}, journal = {Journal of Physics: Conference Series}, year = {2022}, month = {1}, volume = {2149}, number = {1}, number2 = {18SIB03: BxDiff: New quantities for the measurement of appearance}, pages = {012013}, keywords = {BRDF, metrology, spectrophotometry, speckle}, web_url = {https://iopscience.iop.org/article/10.1088/1742-6596/2149/1/012013}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {1742-6588, 1742-6596}, DOI = {10.1088/1742-6596/2149/1/012013}, stag_bib_extends_levelofaccess = {NA}, author = {Chavel, P. and Sortais, Y. and Labardens, T. and Simonot, L. and Hebert, M. and Obein, G.} } @Article { ShellingNetoDK2022, subid = {2719}, title = {Deep learning assisted design of high reflectivity metamirrors}, journal = {Optics Express}, year = {2022}, month = {1}, volume = {30}, number = {2}, number2 = {20FUN08: NEXTLASERS: Next generation ultrastable lasers: reducing thermal noise limit and overcoming technical limitations with new materials and tech}, pages = {986}, keywords = {deep learning, nanostructured mirrors, metamirrors}, misc2 = {EMPIR 2020: Fundamental}, publisher = {The Optical Society}, language = {30}, ISSN = {1094-4087}, DOI = {10.1364/OE.446442}, stag_bib_extends_levelofaccess = {NA}, author = {Shelling Neto, L. and Dickmann, J. and Kroker, S.} } @Article { MelinCDH2022, subid = {2591}, title = {Sensitivity of Ocean Color Atmospheric Correction to Uncertainties in Ancillary Data: A Global Analysis with SeaWiFS Data}, journal = {IEEE Transactions on Geoscience and Remote Sensing}, year = {2022}, number2 = {19ENV07: MetEOC-4: Metrology to establish an SI traceable climate observing system}, pages = {1-1}, keywords = {Ocean color, uncertainties, SeaWiFS,Image color analysis, Sensitivity, Remote sensing, Distributed databases, Satellites, Aerosols}, misc2 = {EMPIR 2019: Environment}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0196-2892, 1558-0644}, DOI = {10.1109/TGRS.2022.3150400}, stag_bib_extends_levelofaccess = {NA}, author = {M{\'e}lin, F. and Colandrea, P. and De Vis, P. and Hunt, S.E.} } @Article { ZibordiTM2022, subid = {2593}, title = {Uncertainty Estimate of Satellite-Derived Normalized Water-Leaving Radiance}, journal = {IEEE Geoscience and Remote Sensing Letters}, year = {2022}, volume = {19}, number2 = {19ENV07: MetEOC-4: Metrology to establish an SI traceable climate observing system}, pages = {1-5}, keywords = {Ocean color, remote sensing, uncertainties, Satellite broadcasting, Image color analysis, Oceans, Radiometry, Standards, Sea measurements}, misc2 = {EMPIR 2019: Environment}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {1545-598X, 1558-0571}, DOI = {10.1109/LGRS.2021.3134876}, stag_bib_extends_levelofaccess = {NA}, author = {Zibordi, G. and Talone, M. and M{\'e}lin, F.} } @Article { FasoloBBCCCCCDEFFFFGGGGKLLLMMMMMMMNOPPPRRRSUV2022, subid = {2612}, title = {Bimodal Approach for Noise Figures of Merit Evaluation in Quantum-Limited Josephson Traveling Wave Parametric Amplifiers}, journal = {IEEE Transactions on Applied Superconductivity}, year = {2022}, number2 = {17FUN10: ParaWave: Josephson travelling wave parametric amplifier and its application for metrology}, keywords = {Physics, Gain, Microwave amplifiers, Noise figure, Superconducting microwave devices, Microwave photonics, Bandwidth}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {1051-8223, 1558-2515, 2378-707}, DOI = {10.1109/TASC.2022.3148692}, stag_bib_extends_levelofaccess = {NA}, author = {Fasolo, L. and Barone, C. and Borghesi, M. and Carapella, G. and Caricato, A.P. and Carusotto, I. and Chung, W. and Cian, A. and Di Gioacchino, D. and Enrico, E. and Falferi, P. and Faverzani, M. and Ferri, E. and Filatrella, G. and Gatti, C. and Giachero, A. and Giubertoni, D. and Greco, A. and Kutlu, C. and Leo, A. and Ligi, C. and Livreri, P. and Maccarone, G. and Margesin, B. and Maruccio, G. and Matlashov, A. and Mauro, C. and Mezzena, R. and Monteduro, A.G. and Nucciotti, A. and Oberto, L. and Pagano, S. and Pierro, V. and Piersanti, L. and Rajteri, M. and Rettaroli, A. and Rizzato, S. and Semertzidis, Y.K. and Uchaikin, S.V. and Vinante, A.} } @Article { PolanskyS2022, subid = {2696}, title = {Implementation of turbulence damping in the OpenFOAM multiphase flow solver interFoam}, journal = {Archives of Thermodynamics}, year = {2022}, volume = {43}, number = {1}, number2 = {16ENG07: MultiFlowMet II: Multiphase flow reference metrology}, pages = {21-43}, keywords = {Multiphase flow, Stratified flow, Turbulence damping, Computational fluid dynamics, OpenFOAM, Reynolds-averaged Navier-Stokes, Detached eddy simulation, Delayed detached eddy simulation}, web_url = {http://journals.pan.pl/Content/122890/PDF/art02_internet.pdf}, misc2 = {EMPIR 2016: Energy}, publisher = {The Committee of Thermodynamics and Combustion of the Polish Academy of Sciences and The Institute of Fluid-Flow Machinery Polish Academy of Sciences}, address = {Gdańsk}, language = {30}, ISSN = {1231-0956}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {10.24425/ather.2022.140923}, author = {Polansky, Jiri and Schmelter, Sonja} } @Article { MinelliWBCIDGKMJMSFHTBNHRKHKRCAMGPOTJKHRLWSGSLLCBJAHLKKZGCCGlJBWFERDKPNOPBCHGGMFCTSTMPLASCTTPDGLFCGBVHKKPKGS2022, subid = {2764}, title = {Versailles project on advanced materials and standards (VAMAS) interlaboratory study on measuring the number concentration of colloidal gold nanoparticles}, journal = {Nanoscale}, year = {2022}, volume = {14}, number = {12}, number2 = {18SIP01: ISOCONCur: An ISO Technical Report on Nanoparticle Concentration}, pages = {4690-4704}, keywords = {nanoparticle, concentration, standardization, VAMAS, interlaboratory}, misc2 = {EMPIR 2018: Support for Impact}, publisher = {Royal Society of Chemistry (RSC)}, language = {30}, ISSN = {2040-3364, 2040-3372}, DOI = {10.1039/D1NR07775A}, stag_bib_extends_levelofaccess = {NA}, author = {Minelli, C. and Wywijas, M. and Bartczak, D. and Cuello-Nu{\~n}ez, S. and Infante, H.G. and Deumer, J. and Gollwitzer, C. and Krumrey, M. and Murphy, K.E. and Johnson, M.E. and Montoro Bustos, A.R. and Strenge, I.H. and Faure, B. and H{\o}gh{\o}j, P. and Tong, V. and Burr, L. and Norling, K. and H{\"o}{\"o}k, F. and Roesslein, M. and Kocic, J. and Hendriks, L. and Kestens, V. and Ramaye, Y. and Contreras Lopez, M.C. and Auclair, G. and Mehn, D. and Gilliland, D. and Potthoff, A. and Oelschl{\"a}gel, K. and Tentschert, J. and Jungnickel, H. and Krause, B.C. and Hachenberger, Y.U. and Reichardt, P. and Luch, A. and Whittaker, T.E. and Stevens, M.M. and Gupta, S. and Singh, A. and Lin, F-h. and Liu, Y-H. and Costa, A.L. and Baldisserri, C. and Jawad, R. and Andaloussi, S.E.L. and Holme, M.N. and Lee, T.G. and Kwak, M. and Kim, J. and Ziebel, J. and Guignard, C. and Cambier, S. and Contal, S. and Gutleb, A.C. and “Kuba” Tatarkiewicz, J. and Jankiewicz, B.J. and Bartosewicz, B. and Wu, X. and Fagan, J.A. and Elje, E. and Rund{\'e}n-Pran, E. and Dusinska, M. and Kaur, I.P. and Price, D. and Nesbitt, I. and O\(\prime\) Reilly, S. and Peters, R.J.B. and Bucher, G. and Coleman, D. and Harrison, A.J. and Ghanem, A. and Gering, A. and McCarron, E. and Fitzgerald, N. and Cornelis, G. and Tuoriniemi, J. and Sakai, M. and Tsuchida, H. and Maguire, C. and Prina-Mello, A. and Lawlor, A.J. and Adams, J. and Schultz, C.L. and Constantin, D. and Thanh, N.T.K. and Tung, L.D. and Panariello, L. and Damilos, S. and Gavriilidis, A. and Lynch, I. and Fryer, B. and Carrazco Quevedo, A. and Guggenheim, E. and Briffa, S. and Valsami-Jones, E. and Huang, Y. and Keller, A.A. and Kinnunen, V-T. and Per{\"a}m{\"a}ki, S. and Krpetic, Z. and Greenwood, M. and Shard, A.G.} } @Article { ColomBBKB2022, subid = {2774}, title = {Enhanced Purcell factor for nanoantennas supporting interfering resonances}, journal = {Physical Review Research}, year = {2022}, volume = {4}, number2 = {20FUN05: SEQUME: Single- and entangled photon sources for quantum metrology}, pages = {023189}, keywords = {Nanoantennas, nanophotonics, near field optics, nanodisks, optical microcavities, electromagnetic wave theory, finite-element method}, misc2 = {EMPIR 2020: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2643-1564}, DOI = {10.1103/PhysRevResearch.4.023189}, stag_bib_extends_levelofaccess = {NA}, author = {Colom, R. and Binkowski, F. and Betz, F. and Kivshar, Y. and Burger, S.} } @Article { LeviCTB2022, subid = {2725}, title = {Optically Loaded Strontium Lattice Clock With a Single Multi-Wavelength Reference Cavity}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2022}, volume = {71}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, pages = {1-9}, keywords = {Atomic spectroscopy, laser stabilization, opticalfrequency metrology, optical frequency standard, optical latticeclock, strontium.}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9456, 1557-9662}, DOI = {10.1109/TIM.2022.3165292}, stag_bib_extends_levelofaccess = {NA}, author = {Levi, F. and Calonico, D. and Tarallo, M.G. and Barbiero, M.} } @Article { ColomBBKB2022_2, subid = {2774}, title = {Enhanced Purcell factor for nanoantennas supporting interfering resonances}, journal = {Physical Review Research}, year = {2022}, volume = {4}, number2 = {20FUN02: POLight: Pushing boundaries of nano-dimensional metrology by light}, pages = {023189}, keywords = {Nanoantennas, nanophotonics, near field optics, nanodisks, optical microcavities, electromagnetic wave theory, finite-element method}, misc2 = {EMPIR 2020: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2643-1564}, DOI = {10.1103/PhysRevResearch.4.023189}, stag_bib_extends_levelofaccess = {NA}, author = {Colom, R. and Binkowski, F. and Betz, F. and Kivshar, Y. and Burger, S.} } @Article { LeviCTB2022_2, subid = {2725}, title = {Optically Loaded Strontium Lattice Clock With a Single Multi-Wavelength Reference Cavity}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2022}, volume = {71}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, pages = {1-9}, keywords = {Atomic spectroscopy, laser stabilization, opticalfrequency metrology, optical frequency standard, optical latticeclock, strontium.}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9456, 1557-9662}, DOI = {10.1109/TIM.2022.3165292}, stag_bib_extends_levelofaccess = {NA}, author = {Levi, F. and Calonico, D. and Tarallo, M.G. and Barbiero, M.} } @Article { HrabinaHRCPZLC2022, subid = {2785}, title = {Absolute frequencies of H13C14N hydrogen cyanide hyper-fine transitions in 1,5 \(\mu\)m region with saturated spectroscopy and sub-kHz scanning laser}, journal = {Optics Letters}, year = {2022}, volume = {TBD}, number = {TBD}, number2 = {17IND03: LaVA: Large Volume Metrology Applications}, pages = {TBD}, keywords = {saturated spectroscopy, hydrogen cyanide, scanning laser}, misc2 = {EMPIR 2017: Industry}, publisher = {Optica}, language = {30}, ISSN = {1539-4794}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://arxiv.org/abs/2206.09232}, author = {Hrabina, J. and Hošek, M. and Rerucha, S. and Č{\'i}žek, M. and Pilat, Z. and Zucco, M. and Lazar, J. and Č{\'i}p, O.} } @Article { RobertIK2021, subid = {2163}, title = {Variable Launch System for the Metrology of EOCBs}, journal = {International Journal of Optics and Photonic Engineering}, year = {2021}, month = {12}, day = {31}, volume = {6}, number = {1}, number2 = {19SIP05: TTPWC: Technology Transfer of Photonic Waveguide Characterisation}, pages = {6:037}, keywords = {Optical metrology, EOCB, Optical interconnect}, web_url = {https://vibgyorpublishers.org/content/ijope/ijope-6-037.pdf}, misc2 = {EMPIR 2019: Support for Impact}, publisher = {VIBGYOR ePress}, language = {30}, ISSN = {2631-5092}, DOI = {10.35840/2631-5092/4537}, stag_bib_extends_levelofaccess = {NA}, author = {Robert, F. and Irshaad, F. and Ka-ming, L.} } @Article { ArrheniusBSCGBB2021, subid = {2487}, title = {Detection of Contaminants in Hydrogen Fuel for Fuel Cell Electrical Vehicles with Sensors—Available Technology, Testing Protocols and Implementation Challenges}, journal = {Processes}, year = {2021}, month = {12}, day = {24}, volume = {10}, number = {1}, number2 = {19ENG04: MetroHyVe 2: Metrology for hydrogen vehicles 2}, pages = {20}, keywords = {sensors, hydrogen quality, FCEV, testing protocols}, misc2 = {EMPIR 2019: Energy}, publisher = {MDPI AG}, language = {30}, ISSN = {2227-9717}, DOI = {10.3390/pr10010020}, stag_bib_extends_levelofaccess = {NA}, author = {Arrhenius, K. and Bacquart, T. and Schr{\"o}ter, K. and Carr{\'e}, M. and Gozlan, B. and Beurey, C. and Blondeel, C.} } @Article { Melin2021, subid = {2592}, title = {From Validation Statistics to Uncertainty Estimates: Application to VIIRS Ocean Color Radiometric Products at European Coastal Locations}, journal = {Frontiers in Marine Science}, year = {2021}, month = {12}, day = {23}, volume = {8}, number2 = {19ENV07: MetEOC-4: Metrology to establish an SI traceable climate observing system}, keywords = {Uncertainty, Ocean Colour, Aeronet-OC, SeaWiFS, SeaPRISM}, misc2 = {EMPIR 2019: Environment}, publisher = {Frontiers Media SA}, language = {30}, ISSN = {2296-7745}, DOI = {10.3389/fmars.2021.790948}, stag_bib_extends_levelofaccess = {NA}, author = {M{\'e}lin, F.} } @Article { MiloroABBZFR2021, subid = {2444}, title = {A standard test phantom for the performance assessment of magnetic resonance guided high intensity focused ultrasound (MRgHIFU) thermal therapy devices}, journal = {International Journal of Hyperthermia}, year = {2021}, month = {12}, day = {22}, volume = {39}, number = {1}, number2 = {18HLT06: RaCHy: Radiotherapy coupled with hyperthermia - adapting the biological equivalent dose concept}, pages = {57-68}, keywords = {HIFU; thermal ablation; quality control; phantom; thermal dosimetry}, web_url = {https://www.tandfonline.com/doi/full/10.1080/02656736.2021.2017023}, misc2 = {EMPIR 2018: Health}, publisher = {Informa UK Limited}, language = {30}, ISSN = {0265-6736, 1464-5157}, DOI = {10.1080/02656736.2021.2017023}, stag_bib_extends_levelofaccess = {NA}, author = {Miloro, P and Ambrogio, S. and Bosio, F. and Ba{\^e}sso, R.M. and Zeqiri, B. and Fedele, F. and Ramnarine, K.V.} } @Article { WooldridgeAZZCCB2021, subid = {2546}, title = {Gradient coil and radiofrequency induced heating of orthopaedic implants in MRI: influencing factors}, journal = {Physics in Medicine \& Biology}, year = {2021}, month = {12}, day = {21}, volume = {66}, number = {24}, number2 = {17IND01: MIMAS: Procedures allowing medical implant manufacturers to demonstrate compliance with MRI safety regulations}, pages = {245024}, keywords = {MRI; finite element modelling; implant heating}, web_url = {https://iopscience.iop.org/article/10.1088/1361-6560/ac3eab}, misc2 = {EMPIR 2017: Industry}, publisher = {IOP Publishing}, language = {30}, ISSN = {0031-9155, 1361-6560}, DOI = {10.1088/1361-6560/ac3eab}, stag_bib_extends_levelofaccess = {NA}, author = {Wooldridge, J. and Arduino, A. and Zilberti, L. and Zanovello, U. and Chiampi, M. and Clementi, V. and Bottauscio, O.} } @Article { McManusRRPS2021, subid = {2658}, title = {A Geant4 Fano test for novel very high energy electron beams}, journal = {Physics in Medicine \& Biology}, year = {2021}, month = {12}, day = {21}, volume = {66}, number = {24}, number2 = {18HLT04: UHDpulse: Metrology for advanced radiotherapy using particle beams with ultra-high pulse dose rates}, pages = {245023}, keywords = {Fano, VHEE, dosimetry, geant4}, misc2 = {EMPIR 2018: Health}, publisher = {IOP Publishing}, language = {30}, ISSN = {0031-9155, 1361-6560}, DOI = {10.1088/1361-6560/ac3e0f}, stag_bib_extends_levelofaccess = {NA}, author = {McManus, M. and Romano, F. and Royle, G. and Palmans, H. and Subiel, A.} } @Article { DieudonneSHCL2021, subid = {2400}, title = {A Study of Experiment-based Radio Frequency Electromagnetic Field Exposure Evidence on Stochastic Nature of A Massive MIMO System}, journal = {A Study of Experiment-based Radio Frequency Electromagnetic Field}, year = {2021}, month = {12}, day = {17}, volume = {1}, number = {1}, number2 = {18SIP02: 5GRFEX: Metrology for RF exposure from massive MIMO 5G base station: Impact on 5G network deployment}, pages = {1-5}, keywords = {exposure, radiofrequency, electromagnetic field, massive mimo, stochastic nature, measurements.}, web_url = {https://arxiv.org/abs/2112.09637}, misc2 = {EMPIR 2018: Support for Impact}, publisher = {Tian Hong Loh}, language = {30}, ISSN = {arXiv:2112.09637v1}, DOI = {10.23919/EuCAP51087.2021.9411325}, stag_bib_extends_levelofaccess = {NA}, author = {Dieudonne, M. and Sunday, A. and Heliot, F. and Cheadle, D. and Loh, T.} } @Article { Melendez2021, subid = {2390}, title = {Multispectral Mid-Infrared Camera System for Accurate Stand-Off Temperature and Column Density Measurements on Flames}, journal = {Sensors}, year = {2021}, month = {12}, day = {16}, volume = {21}, number = {24}, number2 = {17IND04: EMPRESS 2: Enhancing process efficiency through improved temperature measurement 2}, pages = {8395}, keywords = {infrared imaging; multispectral imaging; hyperspectral imaging; combustion monitoring; remote sensing and sensors; spectroscopy; fourier transform; image processing}, web_url = {https://www.mdpi.com/1424-8220/21/24/8395}, misc2 = {EMPIR 2017: Industry}, publisher = {MDPI}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s21248395}, stag_bib_extends_levelofaccess = {NA}, author = {Mel{\'e}ndez, J.} } @Article { BassottiSC2021, subid = {2437}, title = {From the spin eigenmodes of isolated Nel skyrmions to the magnonic bands of a skyrmionic crystal: a micromagnetic study as a function of the strength of both the interfacial Dzyaloshinskii-Moriya and the exchange constants}, journal = {IEEE Magnetic Letters}, year = {2021}, month = {12}, day = {16}, number2 = {17FUN08: TOPS: Metrology for topological spin structures}, keywords = {Micromagnetic simulations, skyrmiond, magnetic crystals, DMI}, web_url = {https://arxiv.org/ftp/arxiv/papers/2112/2112.04967.pdf}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IEEE}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://ieeexplore.ieee.org/document/9653803}, author = {Bassotti, M. and Silvani, R. and Carlotti, G.} } @Article { GarberoglioHJ2021, subid = {2399}, title = {Path-integral calculation of the third dielectric virial coefficient of noble gases}, journal = {The Journal of Chemical Physics}, year = {2021}, month = {12}, day = {15}, volume = {155}, number2 = {18SIB04: QuantumPascal: Towards quantum-based realisations of the pascal}, pages = {234103}, keywords = {Third dielectric virial coefficient, Path Integral Monte Carlo, Ab-initio calculation}, web_url = {https://arxiv.org/abs/2111.02691}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {AIP Publishing}, language = {30}, ISSN = {1089-7690}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {10.1063/5.0077684}, author = {Garberoglio, G. and Harvey, A. and Jeziorski, B.} } @Thesis { Seppalainen2021, subid = {2404}, title = {Reducing the statistical and systematic uncertainty of the VTT MIKES 88Sr+ ion clock}, year = {2021}, month = {12}, day = {14}, number2 = {18SIB05: ROCIT: Robust Optical Clocks for International Timescales}, keywords = {metrology, atomic clocks, optical clocks, simulation, SI second, ion trap}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Aalto University}, school = {Aalto University}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {http://urn.fi/URN:NBN:fi:aalto-2021121910848}, author = {Sepp{\"a}l{\"a}inen, L.} } @Article { HutzschenreuterMLK2021, subid = {2415}, title = {Validation of SI-based digital data of measurement the TraCIM system}, journal = {Journal of Sensors and Sensor Systems}, year = {2021}, month = {12}, day = {13}, volume = {10}, number = {2}, number2 = {17IND02: SmartCom: Communication and validation of smart data in IoT-networks}, pages = {289-295}, keywords = {Digital Transformation, TraCIM, XML, D-SI, Online Validation}, misc2 = {EMPIR 2017: Industry}, language = {30}, DOI = {10.5194/jsss-10-289-2021}, stag_bib_extends_levelofaccess = {NA}, author = {Hutzschenreuter, D. and Muller, B. and Loewe, J.H. and Klobucar, R.} } @Article { KayserOHB2021, subid = {2485}, title = {Reliable compositional analysis of airborne particulate matter beyond the quantification limits of total reflection X-ray fluorescence.}, journal = {Analytica Chimica Acta}, year = {2021}, month = {12}, day = {12}, volume = {1192}, number = {1}, number2 = {19ENV08: AEROMET II: Advanced aerosol metrology for atmospheric science and air quality}, pages = {339367}, keywords = {Total reflection X-ray fluorescence, Grazing incidence X-ray fluorescence, Aerosols, Airborne particulate matter, Air pollution, Cascade impactors}, web_url = {https://www.sciencedirect.com/journal/analytica-chimica-acta\&\#10;http://www.aerometprojectii.com/}, misc2 = {EMPIR 2019: Environment}, publisher = {Elsevier B.V.}, language = {30}, ISSN = {0003-2670}, DOI = {10.1016/j.aca.2021.339367}, stag_bib_extends_levelofaccess = {NA}, author = {Kayser, Y. and Os{\'a}n, J. and Honicke, P. and Beckhoff, B.} } @Article { GollwitzerDSTCMPDFCH2021, subid = {2389}, title = {Correlative Analysis of the Dimensional Properties of Bipyramidal Titania Nanoparticles by Complementing Electron Microscopy with Other Methods}, journal = {Nanomaterials}, year = {2021}, month = {12}, day = {10}, volume = {11}, number = {12}, number2 = {17NRM04: nPSize: Improved traceability chain of nanoparticle size measurements}, pages = {3359}, keywords = {nanoparticle; complex‐shape; bipyramid; electron microscopy; atomic force microscopy;size measurements; TKD; STEM‐in‐SEM; SAXS; nanoparticle concentration; correlative analysis}, web_url = {https://www.mdpi.com/2079-4991/11/12/3359}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {MDPI}, language = {30}, ISSN = {2079-4991}, DOI = {10.3390/nano11123359}, stag_bib_extends_levelofaccess = {NA}, author = {Gollwitzer, C. and Deumer, J. and Salzmann, C. and Tokarski, T. and Cios, G. and Maurino, V. and Pellegrino, F. and Delvall{\'e}e, A. and Feltin, N. and Crouzier, L. and Hodoroaba, V-D.} } @Article { XieDv2021, subid = {2478}, title = {Design of “Universal Module” Based Time and Frequency System using White Rabbit Technology}, journal = {IEEE TechRxiv}, year = {2021}, month = {12}, day = {10}, number2 = {17IND14: WRITE: Precision Time for Industry}, keywords = {White Rabbit; time and frequency transfer; frequency distribution; frequency stability measurement}, misc2 = {EMPIR 2017: Industry}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, DOI = {10.36227/techrxiv.17122154.v1}, stag_bib_extends_levelofaccess = {NA}, author = {Xie, Y. and Dierikx, E. and van Veghel, M.} } @Article { OlbrichHLvBOS2021, subid = {2175}, title = {Comparing temporal characteristics of slug flow from tomography measurements and video observations}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number2 = {16ENG07: MultiFlowMet II: Multiphase flow reference metrology}, pages = {100222}, keywords = {slug flow, interface dynamics, tomography, video observation}, web_url = {https://www.sciencedirect.com/science/article/pii/S2665917421001859}, misc2 = {EMPIR 2016: Energy}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100222}, stag_bib_extends_levelofaccess = {NA}, author = {Olbrich, M. and Hunt, A. and Leonard, T. and van Putten, D.S. and B{\"a}r, M. and Oberleithner, K. and Schmelter, S.} } @Article { MariPF2021, subid = {2186}, title = {Rayleigh scattering for pressure assessment}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number2 = {18SIB04: QuantumPascal: Towards quantum-based realisations of the pascal}, pages = {100253}, keywords = {SI, Pascal realization, Optical pressure standard, Rayleigh scattering, Pressure metrology}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100253}, stag_bib_extends_levelofaccess = {NA}, author = {Mari, D. and Pisani, M. and Francese, C.} } @Article { Bruns2021, subid = {2195}, title = {Efficient very low frequency primary calibration method for accelerometers}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number2 = {19ENV03: Infra-AUV: Metrology for low-frequency sound and vibration}, pages = {100156}, keywords = {Primary vibration calibrationMulti-sineSine-approximation}, web_url = {https://www.sciencedirect.com/science/article/pii/S2665917421001197}, misc2 = {EMPIR 2019: Environment}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100156}, stag_bib_extends_levelofaccess = {NA}, author = {Bruns, T.} } @Article { SchmelterOKB2021, subid = {2196}, title = {Analysis of multiphase flow simulations and comparison with high-speed video observations}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number2 = {16ENG07: MultiFlowMet II: Multiphase flow reference metrology}, pages = {100154}, keywords = {Multiphase flowSlug flowPlug flowComputational fluid dynamics (CFD)High-speed video observationsLiquid level time series}, web_url = {https://doi.org/10.1016/j.measen.2021.100154}, misc2 = {EMPIR 2016: Energy}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100154}, stag_bib_extends_levelofaccess = {NA}, author = {Schmelter, S. and Olbrich, M. and Knotek, S. and B{\"a}r, M.} } @Article { ZelenkaAHKPZM2021, subid = {2205}, title = {Why and how to improve the subdivision technique in mass metrology}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number2 = {19RPT02: RealMass: Improvement of the realisation of the mass scale}, pages = {100228}, keywords = {Mass scale, Weights, Kilogram, Multiples and submultiples, Subdivision, OIML R111}, misc2 = {EMPIR 2019: Research Potential}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100228}, stag_bib_extends_levelofaccess = {NA}, author = {Zelenka, Z. and Alisic, S. and Hanrahan, R. and Kolozinsky, I. and Popa, G. and Zůda, J. and Malengo, A.} } @Article { GrahamTKBBNBOZZ2021, subid = {2275}, title = {Ultra-low flow rate measurement techniques}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number2 = {18HLT08: MEDDII: Metrology for drug delivery}, pages = {100279}, keywords = {Flow metrologyDrug deliveryCalibrationUncertaintyNanoflow}, misc2 = {EMPIR 2018: Health}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100279}, stag_bib_extends_levelofaccess = {NA}, author = {Graham, E. and Thiemann, K. and Kartmann, S. and Batista, E. and Bissig, H. and Niemann, A. and Boudaoud, A.W. and Ogheard, F. and Zhang, Y. and Zagnoni, M.} } @Article { MelinCFGW2021, subid = {2307}, title = {Construct specification equations: ‘Recipes’ for certified reference materials in cognitive measurement}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number2 = {18HLT09: Neuromet2: Metrology and innovation for early diagnosis and accurate stratification of patients with neurodegenerative diseases}, pages = {100290}, keywords = {Cognition, Entropy, Metrology, Rasch, Person ability, Task difficulty}, misc2 = {EMPIR 2018: Health}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100290}, stag_bib_extends_levelofaccess = {NA}, author = {Melin, J. and Cano, S.J. and Fl{\"o}el, A. and G{\"o}schel, L. and Webster, Will} } @Article { BatistaFFGAAM2021, subid = {2277}, title = {Uncertainty calculations in optical methods used for micro flow measurement}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number2 = {18HLT08: MEDDII: Metrology for drug delivery}, pages = {100155}, keywords = {MicroflowFront trackingMethodPending drop methodMeasurement uncertainty}, misc2 = {EMPIR 2018: Health}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100155}, stag_bib_extends_levelofaccess = {NA}, author = {Batista, E. and Furtado, A. and Ferreira, M. do C. and Godinho, I. and Alvares, M. and Afonso, J. and Martins, R.F.} } @Article { MelinCGFLHFP2021, subid = {2306}, title = {Metrological references for person ability in memory tests}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number2 = {18HLT09: Neuromet2: Metrology and innovation for early diagnosis and accurate stratification of patients with neurodegenerative diseases}, pages = {100289}, keywords = {Alzheimer's, Cognition, Construct specification equations, Memory metrology, Rasch, Person ability}, misc2 = {EMPIR 2018: Health}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100289}, stag_bib_extends_levelofaccess = {NA}, author = {Melin, J. and Cano, S.J. and G{\"o}schel, L. and Fillmer, A. and Lehmann, S. and Hirtz, C. and Fl{\"o}el, A. and Pendrill, L.R.} } @Article { BatistaSAAM2021, subid = {2276}, title = {Development of an experimental setup for micro flow measurement using the front tracking method}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number2 = {18HLT08: MEDDII: Metrology for drug delivery}, pages = {100152}, keywords = {Microflow measurementFront trackingCalibrationMeasurement uncertainty}, misc2 = {EMPIR 2018: Health}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100152}, stag_bib_extends_levelofaccess = {NA}, author = {Batista, E. and Sousa, J.A. and Alvares, M. and Afonso, J. and Martins, R.F.} } @Article { GersakSNJFDRPSP2021, subid = {2330}, title = {Physiology-based patient simulator for blood pressure meter testing}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number2 = {18RPT02: adOSSIG: Developing an infrastructure for improved and harmonised metrological checks of blood-pressure measurements in Europe}, pages = {100260}, keywords = {Blood pressure, Sphygmomanometer, Simulator, Patient simulator, Oscillometry, Metrology}, misc2 = {EMPIR 2018: Research Potential}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100260}, stag_bib_extends_levelofaccess = {NA}, author = {Geršak, G. and Schiebl, M. and Nawotka, M. and Jugo, E. and Ferreira, M. do C. and Duffy, A. and Rosu, D.M. and Pavlasek, P. and Sedl{\'a}k, V. and Praž{\'a}k, D.} } @Article { SedlakPSNJFDRPG2021, subid = {2331}, title = {Smart specialisation concept in metrology for blood and intraocular pressure measurements}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number2 = {18RPT02: adOSSIG: Developing an infrastructure for improved and harmonised metrological checks of blood-pressure measurements in Europe}, pages = {100283}, keywords = {Medical metrology, Smart specialisation concept, Metrological traceability, Intraocular pressure, Blood pressure}, misc2 = {EMPIR 2018: Research Potential}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100283}, stag_bib_extends_levelofaccess = {NA}, author = {Sedl{\'a}k, V. and Praž{\'a}k, D. and Schiebl, M. and Nawotka, M. and Jugo, E. and Ferreira, M. do C. and Duffy, A. and Rosu, D.M. and Pavlasek, P. and Geršak, G.} } @Article { ForssenSZZA2021, subid = {2351}, title = {Fabry–Perot-cavity-based refractometry without influence of mirror penetration depth}, journal = {Journal of Vacuum Science \& Technology B}, year = {2021}, month = {12}, volume = {39}, number = {6}, number2 = {18SIB04: QuantumPascal: Towards quantum-based realisations of the pascal}, pages = {065001}, keywords = {Refractometry, Fabry-Perot cavity, Penetration depth}, web_url = {https://avs.scitation.org/doi/10.1116/6.0001501}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {American Vacuum Society}, language = {30}, ISSN = {2166-2746, 2166-2754}, DOI = {10.1116/6.0001501}, stag_bib_extends_levelofaccess = {NA}, author = {Forss{\'e}n, C. and Silander, I. and Zakrisson, J. and Zelan, M. and Axner, O.} } @Article { AssoulineJBWTJGKRPR2021, subid = {2371}, title = {Excitonic nature of magnons in a quantum Hall ferromagnet}, journal = {Nature Physics}, year = {2021}, month = {12}, volume = {17}, number = {12}, number2 = {17FUN04: SEQUOIA: Single-electron quantum optics for quantum-enhanced measurements}, pages = {1369-1374}, keywords = {Graphene, mangons, interferometry, p-n-junction}, web_url = {https://arxiv.org/abs/2102.02068}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {1745-2473, 1745-2481}, DOI = {10.1038/s41567-021-01411-z}, stag_bib_extends_levelofaccess = {NA}, author = {Assouline, A. and Jo, M. and Brasseur, P. and Watanabe, K. and Taniguchi, T. and Jolicoeur, Th. and Glattli, D.C. and Kumada, N. and Roche, P. and Parmentier, F.D. and Roulleau, P.} } @Article { LieberherrACCCGKMMMOSSTV2021, subid = {2368}, title = {Assessment of real-time bioaerosol particle counters using reference chamber experiments}, journal = {Atmospheric Measurement Techniques}, year = {2021}, month = {12}, volume = {14}, number = {12}, number2 = {19ENV08: AEROMET II: Advanced aerosol metrology for atmospheric science and air quality}, pages = {7693-7706}, keywords = {bioaerosol monitors, calibration, counting efficiency, fluorescence}, web_url = {https://amt.copernicus.org/articles/14/7693/2021/}, misc2 = {EMPIR 2019: Environment}, publisher = {Copernicus GmbH}, language = {30}, ISSN = {1867-8548}, DOI = {10.5194/amt-14-7693-2021}, stag_bib_extends_levelofaccess = {NA}, author = {Lieberherr, G. and Auderset, K. and Calpini, B. and Clot, B. and Crouzy, B. and Gysel-Beer, M. and Konzelmann, T. and Manzano, J. and Mihajlovic, A. and Moallemi, A. and O'Connor, D. and Sikoparija, B. and Sauvageat , E. and Tummon, F. and Vasilatou, K.} } @Article { SudTSBSDSSWZZRCKKC2021, subid = {2383}, title = {Tailoring interfacial effect in multilayers with Dzyaloshinskii–Moriya interaction by helium ion irradiation}, journal = {Scientific Reports}, year = {2021}, month = {12}, volume = {11}, number = {23626}, number2 = {17FUN08: TOPS: Metrology for topological spin structures}, keywords = {Spintronics, Nano magnetism, Magnetic skyrmions, Dzyaloshinskii–Moriya interaction}, web_url = {https://www.nature.com/articles/s41598-021-02902-y.pdf}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Nature}, language = {30}, DOI = {10.1038/s41598-021-02902-y}, stag_bib_extends_levelofaccess = {NA}, author = { Sud, A. and Tacchi, S. and Sagkovits, D. and Barton, C. and Sall, M. and Diez, L.H. and Stylianidis, E. and Smith, N. and Wright, L. and Zhang, S. and Zhang, X. and Ravelosona, D. and Carlotti, G. and Kurebayashi, H. and Kazakova, O. and Cubukcu, M. } } @Article { LisdatDNS2021, subid = {2373}, title = {Blackbody radiation shift in strontium lattice clocks revisited}, journal = {Physical Review Research}, year = {2021}, month = {12}, volume = {3}, number = {4}, number2 = {18SIB05: ROCIT: Robust Optical Clocks for International Timescales}, pages = {L042036}, keywords = {optical clocks, lattice clocks, strontium, blackbody radiation shift}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2643-1564}, DOI = {10.1103/PhysRevResearch.3.L042036}, stag_bib_extends_levelofaccess = {NA}, author = {Lisdat, Ch. and D{\"o}rscher, S. and Nosske, I. and Sterr, U.} } @Article { MertesKHKSWRRWW2021, subid = {2423}, title = {Ion implantation of 226Ra for a primary 222Rn emanation standard}, journal = {Applied Radiation and Isotopes}, year = {2021}, month = {12}, number2 = {19ENV01: traceRadon: Radon metrology for use in climate change observation and radiation protection at the environmental level}, keywords = {Ion implantation222Rn emanationLaser ionizationDefined solid-angle alpha-particle spectrometry}, misc2 = {EMPIR 2019: Environment}, language = {30}, DOI = {10.1016/j.apradiso.2021.110093}, stag_bib_extends_levelofaccess = {NA}, author = {Mertes, F. and Kneip, N. and Heinke, R. and Kieck, T. and Studer, D. and Weber, F. and R{\"o}ttger, S. and R{\"o}ttger, A. and Wendt, K. and Walther, C.} } @Article { Winther2021, subid = {2481}, title = {Progress in the realisation of ultra- low frequency vibration calibrations}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number2 = {19ENV03: Infra-AUV: Metrology for low-frequency sound and vibration}, pages = {100350}, keywords = {Ultra low frequency vibration,Low noise,Coherent power,Calibration,Traceability}, web_url = {https://www.sciencedirect.com/science/article/pii/S2665917421003135}, misc2 = {EMPIR 2019: Environment}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100350}, stag_bib_extends_levelofaccess = {NA}, author = {Winther, J.H.} } @Article { ForbesJDE2021, subid = {2458}, title = {Optimization of sensor distribution using Gaussian processes}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number = {1}, number2 = {17IND12: Met4FoF: Metrology for the Factory of the Future}, pages = {100128}, keywords = {Gaussian processes, design of experiment, measurement uncertainty, sensor networks}, misc2 = {EMPIR 2017: Industry}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100128}, stag_bib_extends_levelofaccess = {NA}, author = {Forbes, A. and Jagan, K. and Donlevy, J. and Eichst{\"a}dt, S.} } @Article { HirtCHRK2021, subid = {2505}, title = {Sample fabrication and metrological characterization of single-photon emitters based on nitrogen vacancy centers in nanodiamonds}, journal = {Engineering Research Express}, year = {2021}, month = {12}, volume = {3}, number = {4}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {045038}, keywords = {nitrogen vacancy center, nanodiamond, single-photon source, fabrication}, web_url = {https://iopscience.iop.org/article/10.1088/2631-8695/ac34c2}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {2631-8695}, DOI = {10.1088/2631-8695/ac34c2}, stag_bib_extends_levelofaccess = {NA}, author = {Hirt, F. and Christinck, J. and Hofer, H. and Rodiek, B. and K{\"u}ck, S.} } @Article { Kuck2021, subid = {2507}, title = {Single photon sources for absolute radiometry – A review about the current state of the art}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {100219}, keywords = {single-photon source, quantum dots, molecules, NV-centre, quantum radiometry}, web_url = {https://www.sciencedirect.com/science/article/pii/S2665917421001823?via\%3Dihub}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100219}, stag_bib_extends_levelofaccess = {NA}, author = {K{\"u}ck, S.} } @Proceedings { ThorsethLB2021, subid = {2547}, title = {SENSITIVITY ANALYSIS ON THE EFFECT OF MEASUREMENT NOISE AND SAMPLING FREQUENCY ON THE CALCULATION OF THE TEMPORAL LIGHT ARTEFACTS}, journal = {Proceedings of the Conference CIE 2021}, year = {2021}, month = {12}, volume = {x48}, number2 = {20NRM01: MetTLM: Metrology for temporal light modulation}, pages = {OP28}, keywords = {Photometry, Temporal light modulation, TLM, Temporal light artefacts, TLA, Flicker, Measurement uncertainty, Propagation of uncertainty.}, web_url = {https://orbit.dtu.dk/en/publications/sensitivity-analysis-on-the-effect-of-measurement-noise-and-sampl}, misc2 = {EMPIR 2020: Pre-Co-Normative}, publisher = {International Commission on Illumination, CIE}, event_place = {Kuala Lumpur, Malaysia}, event_name = {CIE 2021 Midterm Meeting \& Conference}, event_date = {27-09-2021 to 29-09-2021}, language = {30}, DOI = {10.25039/x48.2021.OP28}, stag_bib_extends_levelofaccess = {NA}, author = {Thorseth, A. and Lind{\'e}n, J. and Bouroussis, C.A.} } @Proceedings { FerreroT2021, subid = {2555}, title = {IMPACT OF THE NORMALIZATION OF THE SPECTRAL RESPONSIVITY ON THE PERFORMANCE OF THE GENERAL V(\(\lambda\)) MISMATCH INDEX}, journal = {Proceedings of the Conference CIE 2021}, year = {2021}, month = {12}, number2 = {19NRM02: RevStdLED: Revision and extension of standards for test methods for LED lamps, luminaires and modules}, keywords = {Photometry, LED sources, LED reference spectrum, photometric calibrations,spectral mismatch}, web_url = {https://orbit.dtu.dk/en/publications/impact-of-the-normalization-of-the-spectral-responsivity-on-the-p}, misc2 = {EMPIR 2019: Pre-Co-Normative}, publisher = {International Commission on Illumination, CIE}, event_place = {Malaysia}, event_name = {CIE 2021, Miterm meetting and conference}, event_date = {27-09-2021 to 29-09-2021}, language = {30}, DOI = {10.25039/x48.2021.PO20}, stag_bib_extends_levelofaccess = {NA}, author = {Ferrero, A. and Thorseth, A.} } @Article { FasoloGEILVL2021, subid = {2582}, title = {Josephson Traveling Wave Parametric Amplifiers as non-classical light source for Microwave Quantum Illumination}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number2 = {17FUN10: ParaWave: Josephson travelling wave parametric amplifier and its application for metrology}, pages = {100349}, keywords = {Microwave quantum illumination, Josephson traveling wave parametric amplifiers, Entangled quantum states, Detection probability improvement}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100349}, stag_bib_extends_levelofaccess = {NA}, author = {Fasolo, L. and Greco, A. and Enrico, E. and Illuminati, F. and Lo Franco, R. and Vitali, D. and Livreri, P.} } @Article { Forbes2021, subid = {2608}, title = {Generation of numerical artefacts incorporating spatially correlated form error}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number = {Part of sp}, number2 = {17NRM03: EUCoM: Standards for the evaluation of the uncertainty of coordinate measurements in industry}, pages = {100302}, keywords = {Coordinate metrology, Form error, Minimum zone, Numerical artefacts, Spatial correlation}, web_url = {https://www.sciencedirect.com/science/article/pii/S2665917421002658}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100302}, stag_bib_extends_levelofaccess = {NA}, author = {Forbes, A.} } @Article { RosnerWGB2021, subid = {2603}, title = {Uncertainty evaluation for complex GPS characteristics}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number = {-}, number2 = {17NRM03: EUCoM: Standards for the evaluation of the uncertainty of coordinate measurements in industry}, pages = {100323}, keywords = {Coordinate measuring systems, Measurement uncertainty, Geometrical product specification, Sensitivity analysis, GUM uncertainty Framework}, web_url = {https://www.sciencedirect.com/science/article/pii/S2665917421002865}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100323}, stag_bib_extends_levelofaccess = {NA}, author = {Rosner, P. and Wojtyła, M. and Gomez-Acedo, E. and Balsamo, A.} } @Article { WojtyaRFSB2021, subid = {2605}, title = {Verification of sensitivity analysis method of measurement uncertainty evaluation}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number = {Part of sp}, number2 = {17NRM03: EUCoM: Standards for the evaluation of the uncertainty of coordinate measurements in industry}, pages = {100274}, keywords = {Coordinate measuring machines, Measurement uncertainty, Geometrical product specification, Sensitivity analysis, GUM uncertainty Framework, Uncertainty evaluating software}, web_url = {https://www.sciencedirect.com/science/article/pii/S2665917421002373}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100274}, stag_bib_extends_levelofaccess = {NA}, author = {Wojtyła, M. and Rosner, P. and Forbes, A.B. and Savio, E. and Balsamo, A.} } @Article { Forbes2021_2, subid = {2607}, title = {Approximate models of CMM behaviour and point cloud uncertainties}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number = {Part of sp}, number2 = {17NRM03: EUCoM: Standards for the evaluation of the uncertainty of coordinate measurements in industry}, pages = {100304}, keywords = {Coordinate metrology, Spatial correlation, Statistical models, Uncertainty evaluation}, web_url = {https://www.sciencedirect.com/science/article/pii/S2665917421002671}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100304}, stag_bib_extends_levelofaccess = {NA}, author = {Forbes, A.} } @Article { DizdarAV2021, subid = {2673}, title = {Establishment of continuous force calibration system at TUBITAK UME force laboratory in Turkey}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number2 = {18SIB08: ComTraForce: Comprehensive traceability for force metrology services}, pages = {100216}, keywords = {Piezoelectric force sensor; Continuous force calibration}, web_url = {https://www.sciencedirect.com/science/article/pii/S2665917421001793}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100216}, stag_bib_extends_levelofaccess = {NA}, author = {Dizdar, H. and Aydemir, B. and Vatan, C.} } @Article { MiuraNTS2021, subid = {2604}, title = {GD\&T task specific measurement uncertainty evaluation for manufacturing floor}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number = {Part of sp}, number2 = {17NRM03: EUCoM: Standards for the evaluation of the uncertainty of coordinate measurements in industry}, pages = {100141}, keywords = {Coordinate measuring machine, Uncertainty, Analysis of variance, Maximum entropy model}, web_url = {https://www.sciencedirect.com/science/article/pii/S2665917421001045}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100141}, stag_bib_extends_levelofaccess = {NA}, author = {Miura, Y. and Nakanishi, S. and Takatsuji, T. and Sato, O.} } @Article { Hiti2021, subid = {2670}, title = {Compensation of synchronization error effect in testing machine calibration}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number2 = {18SIB08: ComTraForce: Comprehensive traceability for force metrology services}, pages = {100132}, keywords = {Force calibration, Data synchronization; Continuous loading; Material testing machines}, web_url = {https://www.sciencedirect.com/science/article/pii/S2665917421000957}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100132}, stag_bib_extends_levelofaccess = {NA}, author = {Hiti, M.} } @Article { PratoBMFG2021, subid = {2668}, title = {Theoretical insights on the influence of the experimental plan in the calibration of multicomponent force and moment transducers}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number2 = {18SIB08: ComTraForce: Comprehensive traceability for force metrology services}, pages = {100209}, keywords = {Experimental planMulticomponent transducersForce metrologyCalibration}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100209}, stag_bib_extends_levelofaccess = {NA}, author = {Prato, A. and Borgiattino, D. and Mazzoleni, F. and Facello, A. and Germak, A.} } @Article { SanderK2021, subid = {2669}, title = {Comparison of force measuring devices with static and continuous loading}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number2 = {18SIB08: ComTraForce: Comprehensive traceability for force metrology services}, pages = {100241}, keywords = {Piezoelectric; Drift; Creep; Creep recovery; Continuous load; Hysteresis; Force transducer}, web_url = {https://www.sciencedirect.com/science/article/pii/S266591742100204X}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100241}, stag_bib_extends_levelofaccess = {NA}, author = {Sander, J. and Kumme, R.} } @Article { Hiti2021_2, subid = {2672}, title = {Analysis of loading profile effect on testing machine calibration results}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number2 = {18SIB08: ComTraForce: Comprehensive traceability for force metrology services}, pages = {100131}, keywords = {Force calibration; Loading profile; Measurement uncertainty; Continuous loading; Material testing machines}, web_url = {https://www.sciencedirect.com/science/article/pii/S2665917421000945}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100131}, stag_bib_extends_levelofaccess = {NA}, author = {Hiti, M.} } @Article { OgrincRDBMBKOAGQMUOG2021, subid = {2701}, title = {Support for a European metrology network on food safety Food-MetNet}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number2 = {20NET02: Food-MetNet: Support for a European Metrology Network on Food Safety}, pages = {100285}, keywords = {Food; Metrology; Network; Safety; Stakeholders}, misc2 = {EMPIR 2020: Support for Networks}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100285}, stag_bib_extends_levelofaccess = {NA}, author = {Ogrinc, N. and Rossi, A.M. and Durbiano, F. and Becker, R. and Milavec, M. and Bogožalec Košir, A. and Kakoulides, E. and Ozer, H. and Ak\c{c}adag, F. and Goenaga-Infante, H. and Quaglia, M. and Mallia, S. and Umbricht, G. and O'Connor, G. and Guettler, B.} } @Article { ZjawinBCLZW2021, subid = {2745}, title = {Engineering the sensitivity of macroscopic physical systems to variations in the fine-structure constant}, journal = {Europhysics Letters}, year = {2021}, month = {12}, volume = {136}, number = {5}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, pages = {58001}, keywords = {variation of alpha,}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {0295-5075, 1286-4854}, DOI = {10.1209/0295-5075/ac3da3}, stag_bib_extends_levelofaccess = {NA}, author = {Zjawin, B. and Bober, M. and Ciuryło, R. and Lisak, D. and Zawada, M. and Wcisło, P.} } @Article { DegiovanniGBSC2021, subid = {2760}, title = {EURAMET EMN-Q: The European metrology network for quantum technologies}, journal = {Measurement: Sensors}, year = {2021}, month = {12}, volume = {18}, number2 = {19NET02: EMN-Quantum: Support for a European Metrology Network on quantum technologies}, pages = {100348}, keywords = {Quantum Metrology, Metrology for Quantum Technologies, Quantum Technologies, Quantum Clocks, Atomic Sensors, Quantum Electronics, Quantum Photonics, Quantum Computing, Quantum Sensing, Quantum Imaging}, web_url = {https://www.sciencedirect.com/science/article/pii/S2665917421003111}, misc2 = {EMPIR 2019: Support for Networks}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100348}, stag_bib_extends_levelofaccess = {NA}, author = {Degiovanni, I.P. and Gramegna, M. and Bize, S. and Scherer, H. and Chunnilall, C.} } @Article { PezzeSN2021, subid = {2744}, title = {A machine learning approach to Bayesian parameter estimation}, journal = {npj Quantum Information}, year = {2021}, month = {12}, volume = {7}, number = {1}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, keywords = {Bayesian statistics, machine learning}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2056-6387}, DOI = {10.1038/s41534-021-00497-w}, stag_bib_extends_levelofaccess = {NA}, author = {Pezz{\`e}, L. and Smerzi, A. and Nolan, S.} } @Article { PezzeSN2021_2, subid = {2744}, title = {A machine learning approach to Bayesian parameter estimation}, journal = {npj Quantum Information}, year = {2021}, month = {12}, volume = {7}, number = {1}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, keywords = {Bayesian statistics, machine learning}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2056-6387}, DOI = {10.1038/s41534-021-00497-w}, stag_bib_extends_levelofaccess = {NA}, author = {Pezz{\`e}, L. and Smerzi, A. and Nolan, S.} } @Article { DierikxXSLG2021, subid = {2477}, title = {White Rabbit Multi-Point Time Distribution Network}, journal = {IEEE TechRxiv}, year = {2021}, month = {11}, day = {29}, number2 = {17IND14: WRITE: Precision Time for Industry}, keywords = {Time and Frequency transfer; White Rabbit; Precision Time Protocol}, misc2 = {EMPIR 2017: Industry}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, DOI = {10.36227/techrxiv.17069279.v1}, stag_bib_extends_levelofaccess = {NA}, author = {Dierikx, E. and Xie, Y. and Savencu, A. and Lopez, J. and Guti{\'e}rrez, J.L.} } @Article { GrecoFMCE2021, subid = {2342}, title = {Quantum model for rf-SQUID-based metamaterials enabling three-wave mixing and four-wave mixing traveling-wave parametric amplification}, journal = {Physical Review B}, year = {2021}, month = {11}, day = {24}, volume = {104}, number = {18}, number2 = {17FUN10: ParaWave: Josephson travelling wave parametric amplifier and its application for metrology}, keywords = {Superconductivity, Josephson junctions, Josephson metamaterials, Parametric amplifiers}, web_url = {https://arxiv.org/abs/2009.01002}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2469-9950, 2469-9969}, DOI = {10.1103/PhysRevB.104.184517}, stag_bib_extends_levelofaccess = {NA}, author = {Greco, A. and Fasolo, L. and Meda, A. and Callegaro, L. and Enrico, E.} } @Article { KoybasiNTPRPBMSKGOIG2021, subid = {2601}, title = {High Performance Predictable Quantum Efficient Detector Based on Induced-Junction Photodiodes Passivated with SiO2/SiNx}, journal = {Sensors}, year = {2021}, month = {11}, day = {24}, volume = {21}, number = {23}, number2 = {18SIB10: chipS·CALe: Self-calibrating photodiodes for the radiometric linkage to fundamental constants}, pages = {7807}, keywords = {silicon photodetector; inversion layer photodiode; induced-junction; surface passivation;PECVD silicon nitride; radiometry; optical power; primary standard; predictable quantum efficiency}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s21237807}, stag_bib_extends_levelofaccess = {NA}, author = {Koybasi, O. and Nordseth, {\O}. and Tran, T. and Povoli, M. and Rajteri, M. and Pepe, C. and Bardalen, E. and Manoocheri, F. and Summanwar, A. and Korpusenko, M. and Getz, M.N. and Ohlckers, P. and Ikonen, E. and Gran, J.} } @Proceedings { MierR2019, subid = {2398}, title = {Test Bench and Frequency Response of a Magnetic Antenna used in GIS PD Measurements}, journal = {2021 IEEE Electrical Insulation Conference}, year = {2021}, month = {11}, day = {21}, number2 = {19ENG02: FutureEnergy: Metrology for future energy transmission}, pages = {269-272}, keywords = {Partial discharge, VHF, UHF, gas insulated substation, magnetic antenna, loop antenna, test bench, frequency response}, tags = {SEG}, misc2 = {EMPIR 2019: Energy}, publisher = {IEEE}, event_place = {Denver, Colorado}, event_name = {2021 IEEE Electrical Insulation Conference}, event_date = {07-06-2021 to 28-06-2021}, language = {30}, ISBN = {978-1-6654-1564-4}, ISSN = {2576-6791}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://zenodo.org/record/5815711}, author = {Mier, C. and Rodrigo, A.} } @Article { ChenV2021, subid = {2452}, title = {Design of Materials Configuration for Optimizing Redox‐Based Resistive Switching Memories}, journal = {Advanced Materials}, year = {2021}, month = {11}, day = {21}, number2 = {20FUN06: MEMQuD: Memristive devices as quantum standard for nanometrology}, pages = {2105022}, keywords = {capping layers, electrode materials, redox reactions, resistive switching, thicknesses}, web_url = {https://onlinelibrary.wiley.com/doi/full/10.1002/adma.202105022}, misc2 = {EMPIR 2020: Fundamental}, publisher = {Wiley}, language = {30}, ISSN = {0935-9648, 1521-4095}, DOI = {10.1002/adma.202105022}, stag_bib_extends_levelofaccess = {NA}, author = {Chen, S. and Valov, I.} } @Article { NugrohoHPRYIKPWS2021, subid = {2473}, title = {Vertically Aligned n-Type Silicon Nanowire Array as a Free-Standing Anode for Lithium-Ion Batteries}, journal = {Nanomaterials}, year = {2021}, month = {11}, day = {20}, volume = {11}, number = {11}, number2 = {19ENG05: NanoWires: High throughput metrology for nanowire energy harvesting devices}, pages = {3137}, keywords = {silicon nanowire, nanowire array, silicon anode, n-type silicon anode, Li-ion battery}, misc2 = {EMPIR 2019: Energy}, publisher = {MDPI AG}, language = {30}, ISSN = {2079-4991}, DOI = {10.3390/nano11113137}, stag_bib_extends_levelofaccess = {NA}, author = {Nugroho, A.P. and Hawari, N.H. and Prakoso, B. and Refino, A.D. and Yulianto, N. and Iskandar, F. and Kartini, E. and Peiner, E. and Wasisto, H.S. and Sumboja, A.} } @Article { ChretienGST2021, subid = {2471}, title = {Fast Hyperparameter Calibration of Sparsity Enforcing Penalties in Total Generalised Variation Penalised Reconstruction Methods for XCT Using a Planted Virtual Reference Image}, journal = {Mathematics}, year = {2021}, month = {11}, day = {19}, volume = {9}, number = {22}, number2 = {17IND08: AdvanCT: Advanced Computed Tomography for dimensional and surface measurements in industry}, pages = {2960}, keywords = {XCT reconstruction, sparsity enforcing penalties, hyperparameter selection, Bayesian optimisation, virtual planted reference image}, misc2 = {EMPIR 2017: Industry}, publisher = {MDPI AG}, language = {30}, ISSN = {2227-7390}, DOI = {10.3390/math9222960}, stag_bib_extends_levelofaccess = {NA}, author = {Chretien, S. and Giampiccolo, C. and Sun, W. and Talbott, J.} } @Article { RottgerVSPDISBAGGBWPiN2021, subid = {2317}, title = {Metrology for radiation protection: a new European network in the foundation phase}, journal = {Advances in Geosciences}, year = {2021}, month = {11}, day = {17}, volume = {57}, number2 = {19NET03: supportBSS: Support for a European Metrology Network on reliable radiation protection regulation}, pages = {1-7}, keywords = {supportBSS, EMN for Radiation Protection, metrology, regulation, EURAMET, EURATOM}, misc2 = {EMPIR 2019: Support for Networks}, publisher = {Copernicus GmbH}, language = {30}, ISSN = {1680-7359}, DOI = {10.5194/adgeo-57-1-2021}, stag_bib_extends_levelofaccess = {NA}, author = {R{\"o}ttger, A. and Veres, A. and Sochor, V. and Pinto, M. and Derlacinski, M. and Ioan, M-R. and Sabeta, A. and Bernat, R. and Adam-Guillermin, C. and Gracia Alves, J.H. and Glavič-Cindro, D. and Bell, S. and Wens, B. and Persson, L. and Živanović, M. and Nylund, R.} } @Thesis { Liu2021, subid = {2314}, title = {Setup and characterization of calibration systems for Sampled value-based instruments}, year = {2021}, month = {11}, day = {16}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, keywords = {characterization, calibration, Sampled value, instruments}, misc2 = {EMPIR 2017: Industry}, publisher = {Zenodo}, address = {CERN}, school = {Technische Universit{\"a}t Braunschweig}, language = {30}, ISBN = {-}, ISSN = {-}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://doi.org/10.5281/zenodo.5704757}, author = {Liu, Z.} } @Article { RiemannAEBMSSRIF2021, subid = {2569}, title = {Assessment of measurement precision in single‐voxel spectroscopy at 7 T: Toward minimal detectable changes of metabolite concentrations in the human brain in vivo}, journal = {Magnetic Resonance in Medicine}, year = {2021}, month = {11}, day = {16}, volume = {87}, number = {3}, number2 = {18HLT09: Neuromet2: Metrology and innovation for early diagnosis and accurate stratification of patients with neurodegenerative diseases}, pages = {1119-1135}, keywords = {CRLBs, measurement precision, minimal detectable change, MR spectroscopy, reproducibility/repeatability, SPECIAL}, web_url = {https://onlinelibrary.wiley.com/doi/10.1002/mrm.29034}, misc2 = {EMPIR 2018: Health}, publisher = {Wiley}, language = {30}, ISSN = {0740-3194, 1522-2594}, DOI = {10.1002/mrm.29034}, stag_bib_extends_levelofaccess = {NA}, author = {Riemann, L.T. and Aigner, C.S. and Ellison, S.L.R. and Br{\"u}hl, R. and Mekle, R. and Schmitter, S. and Speck, O. and Rose, G. and Ittermann, B. and Fillmer, A.} } @Article { PellegrinoOMSMH2021, subid = {2347}, title = {Customizing New Titanium Dioxide Nanoparticles with Controlled Particle Size and Shape Distribution – A Feasibility Study towards Reference Materials for Quality Assurance of Non‐Spherical Nanoparticle Characterization}, journal = {Advanced Engineering Materials}, year = {2021}, month = {11}, day = {13}, number2 = {17NRM04: nPSize: Improved traceability chain of nanoparticle size measurements}, keywords = {nanoparticles, titanium dioxide, reference materials, standardization, particle size and shape distribution}, web_url = {https://onlinelibrary.wiley.com/doi/10.1002/adem.202101347}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {Wiley}, language = {30}, ISSN = {1438-1656, 1527-2648}, DOI = {10.1002/adem.202101347}, stag_bib_extends_levelofaccess = {NA}, author = {Pellegrino, F. and Ortel, E. and Mielke, J. and Schmidt, R. and Maurino, V. and Hodoroaba, V-D.} } @Article { ChenYG2021, subid = {2319}, title = {Unidirectional spin-wave propagation and devices}, journal = {Journal of Physics D: Applied Physics}, year = {2021}, month = {11}, day = {12}, volume = {55}, number = {12}, number2 = {17FUN08: TOPS: Metrology for topological spin structures}, pages = {123001}, keywords = {magnonics, spin waves, unidirectionality}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {0022-3727, 1361-6463}, DOI = {10.1088/1361-6463/ac31f4}, stag_bib_extends_levelofaccess = {NA}, author = {Chen, J. and Yu, H. and Gubbiotti, G.} } @Article { FarooquiMWWHPWS2021, subid = {2284}, title = {Development of High Temperature Multi-Layer Laser Flash Artefacts}, journal = {International Journal of Thermophysics}, year = {2021}, month = {11}, volume = {43}, number = {1}, number2 = {17IND11: Hi-TRACE: Industrial process optimisation through improved metrology of thermophysical properties}, keywords = {Hafnium, Isotropic graphite, Laser flash analysis, Multi-layer systems, Partial de-bonding, Reference artefacts}, misc2 = {EMPIR 2017: Industry}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {0195-928X, 1572-9567}, DOI = {10.1007/s10765-021-02928-4}, stag_bib_extends_levelofaccess = {NA}, author = {Farooqui, A. and Morrell, R. and Wu, J. and Wright, L. and Hay, B. and Pekris, M. and Whiting, M.J. and Saunders, T.} } @Article { HuiMZAABBBBBBBBBBCCCCCCCCDdDDDDDDEEEEFFFGGGGHHHHHHHJJJJJKKLLLLLLLLMMMMMMMMMNNNNOOOPPPPPPPPPRRRRRROSSSSSSSSSSSSSTTTTTTTvVVVWWWWWWWWXLYZZZE2021, subid = {2336}, title = {Frequency drift in MR spectroscopy at 3T}, journal = {NeuroImage}, year = {2021}, month = {11}, volume = {241}, number2 = {18HLT09: Neuromet2: Metrology and innovation for early diagnosis and accurate stratification of patients with neurodegenerative diseases}, pages = {118430}, keywords = {Magnetic resonance spectroscopy (MRS), Frequency drift, 3T, Press, Multi-vendor, Multi-site}, misc2 = {EMPIR 2018: Health}, publisher = {Elsevier BV}, language = {30}, ISSN = {1053-8119}, DOI = {10.1016/j.neuroimage.2021.118430}, stag_bib_extends_levelofaccess = {NA}, author = {Hui, S.C.N. and Mikkelsen, M. and Z{\"o}llner, H.J. and Ahluwalia, V. and Alcauter, S. and Baltusis, L. and Barany, D.A. and Barlow, L.R. and Becker, R. and Berman, J.I. and Berrington, A. and Bhattacharyya, P.K. and Blicher, J.U. and Bogner, W. and Brown, M.S. and Calhoun, V.D. and Castillo, R. and Cecil, K.M. and Choi, Y.B. and Chu, W.C.W. and Clarke, W.T. and Craven, A.R. and Cuypers, K. and Dacko, M. and de la Fuente-Sandoval, C. and Desmond, P. and Domagalik, A. and Dumont, J. and Duncan, N.W. and Dydak, U. and Dyke, K. and Edmondson, D.A. and Ende, G. and Ersland, L. and Evans, C.J. and Fermin, A.S.R. and Ferretti, A. and Fillmer, A. and Gong, T. and Greenhouse, I. and Grist, J.T. and Gu, M. and Harris, A.D. and Hat, K. and Heba, S. and Heckova, E. and Hegarty, J.P. and Heise, K-F. and Honda, S. and Jacobson, A. and Jansen, J.F.A. and Jenkins, C.W. and Johnston, S.J. and Juchem, C. and Kangarlu, A. and Kerr, A.B. and Landheer, K. and Lange, T. and Lee, P. and Levendovszky, S.R. and Limperopoulos, C. and Liu, F. and Lloyd, W. and Lythgoe, D.J. and Machizawa, M.G. and MacMillan, E.L. and Maddock, R.J. and Manzhurtsev, A.V. and Martinez-Gudino, M.L. and Miller, J.J. and Mirzakhanian, H. and Moreno-Ortega, M. and Mullins, P.G. and Nakajima, S. and Near, J. and Noeske, R. and Nordh{\o}y, W. and Oeltzschner, G. and Osorio-Duran, R. and Otaduy, M.C.G. and Pasaye, E.H. and Peeters, R. and Peltier, S.J. and Pilatus, U. and Polomac, N. and Porges, E.C. and Pradhan, S. and Prisciandaro, J.J. and Puts, N.A. and Rae, C.D. and Reyes-Madrigal, F. and Roberts, T.P.L. and Robertson, C.E. and Rosenberg, J.T. and Rotaru, D-G. and O'Gorman Tuura, R.L. and Saleh, M.G. and Sandberg, K. and Sangill, R. and Schembri, K. and Schrantee, A. and Semenova, N.A. and Singel, D. and Sitnikov, R. and Smith, J. and Song, Y. and Stark, C. and Stoffers, D. and Swinnen, S.P. and Tain, R. and Tanase, C. and Tapper, S. and Tegenthoff, M. and Thiel, T. and Thioux, M. and Truong, P. and van Dijk, P. and Vella, N. and Vidyasagar, R. and Vovk, A. and Wang, G. and Westlye, L.T. and Wilbur, T.K. and Willoughby, W.R. and Wilson, M. and Wittsack, H-J. and Woods, A.J. and Wu, Y-C. and Xu, J. and Lopez, M.Y. and Yeung, D.K.W. and Zhao, Q. and Zhou, X. and Zupan, G. and Edden, R.A.E.} } @Article { CervantesDBDB2021, subid = {2315}, title = {Monte Carlo calculation of detector perturbation and quality correction factors in a 1.5 T magnetic resonance guided radiation therapy small photon beams}, journal = {Physics in Medicine \& Biology}, year = {2021}, month = {11}, volume = {66}, number = {22}, number2 = {19NRM01: MRgRT-DOS: Traceable dosimetry for small fields in MR-guided radiotherapy}, pages = {225004}, keywords = {magnetic fields, small fields, perturbation factors, quality correction factors, MRgRT, ionization chambers, solid-state detectors}, misc2 = {EMPIR 2019: Pre-Co-Normative}, publisher = {IOP Publishing}, language = {30}, ISSN = {0031-9155, 1361-6560}, DOI = {10.1088/1361-6560/ac3344}, stag_bib_extends_levelofaccess = {NA}, author = {Cervantes, Y. and Duchaine, J. and Billas, I. and Duane, S. and Bouchard, H.} } @Article { RazoukBHH2021, subid = {2324}, title = {Towards accurate measurements of specific heat of solids by drop calorimetry up to 3000 \(^{\circ}\)C}, journal = {Thermal Science and Engineering Progress}, year = {2021}, month = {11}, volume = {26}, number2 = {17IND11: Hi-TRACE: Industrial process optimisation through improved metrology of thermophysical properties}, pages = {101130}, keywords = {Drop calorimetry, Specific heat, High temperature, Metrology}, misc2 = {EMPIR 2017: Industry}, publisher = {Elsevier BV}, language = {30}, ISSN = {2451-9049}, DOI = {10.1016/j.tsep.2021.101130}, stag_bib_extends_levelofaccess = {NA}, author = {Razouk, R. and Beaumont, O. and Hameury, J. and Hay, B.} } @Article { RagusaAFd2021, subid = {2397}, title = {Anisotropy of losses in grain-oriented Fe–Si}, journal = {AIP Advances}, year = {2021}, month = {11}, volume = {11}, number = {11}, number2 = {19ENG06: HEFMAG: Metrology of magnetic losses in electrical steel sheets for high-efficiency energy conversion}, pages = {115208}, keywords = {Magnetic hysteresis,Magnetic properties,Electrical grid,Magnetization dynamics,Eddy current,Magnetic materials,Magneto-optical imaging,Transformer Ferromagnetic materials}, misc2 = {EMPIR 2019: Energy}, publisher = {AIP}, address = {College Park, Maryland}, language = {30}, ISSN = {2158-3226}, DOI = {10.1063/5.0066131}, stag_bib_extends_levelofaccess = {NA}, author = {Ragusa, C. and Appino, C. and Ferrara, E. and de la Barri{\`e}re, O.} } @Article { Eichstadt2021, subid = {2464}, title = {Metrology for the Factory of the Future}, journal = {Research Outreach}, year = {2021}, month = {11}, number = {126}, number2 = {17IND12: Met4FoF: Metrology for the Factory of the Future}, keywords = {sensor network, industry 4.0, machine learning, software, multi-agent system}, misc2 = {EMPIR 2017: Industry}, publisher = {Research Outreach}, language = {30}, DOI = {10.32907/RO-126-1869538673}, stag_bib_extends_levelofaccess = {NA}, author = {Eichst{\"a}dt, S.} } @Article { CorteSDLPTDMOMGF2021, subid = {2503}, title = {Spectral Emission Dependence of Tin‐Vacancy Centers in Diamond from Thermal Processing and Chemical Functionalization}, journal = {Advanced Photonics Research}, year = {2021}, month = {11}, volume = {3}, number = {1}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {2100148}, keywords = {tin vacancy centers, single-photon sources, nanodiamond}, web_url = {https://onlinelibrary.wiley.com/doi/epdf/10.1002/adpr.202100148}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Wiley}, language = {30}, ISSN = {2699-9293, 2699-9293}, DOI = {10.1002/adpr.202100148}, stag_bib_extends_levelofaccess = {NA}, author = {Corte, E. and Sachero, S. and Ditalia Tchernij, S. and L{\"u}hmann, T. and Pezzagna, S. and Traina, P. and Degiovanni, I.P. and Moreva, E. and Olivero, P. and Meijer, J. and Genovese, M. and Forneris, J.} } @Article { LehmannHP2021, subid = {2651}, title = {Three-Dimensional Transfer Functions of Interference Microscopes}, journal = {Metrology}, year = {2021}, month = {11}, volume = {1}, number = {2}, number2 = {20IND07: TracOptic: Traceable industrial 3D roughness and dimensional measurement using optical 3D microscopy and optical distance sensors}, pages = {122-141}, keywords = {interference microscopy, coherence scanning interferometry, three-dimensional transfer function}, web_url = {https://www.mdpi.com/2673-8244/1/2/9/htm}, misc2 = {EMPIR 2020: Industry}, publisher = {MDPI AG}, language = {30}, ISSN = {2673-8244}, DOI = {10.3390/metrology1020009}, stag_bib_extends_levelofaccess = {NA}, author = {Lehmann, P. and Hagemeier, S. and Pahl, T.} } @Article { CorteSDLPTDMOMGF2021_2, subid = {2678}, title = {Spectral Emission Dependence of Tin‐Vacancy Centers in Diamond from Thermal Processing and Chemical Functionalization}, journal = {Advanced Photonics Research}, year = {2021}, month = {11}, volume = {3}, number = {1}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {2100148}, keywords = {color centers, confocal microscopy}, web_url = {https://onlinelibrary.wiley.com/doi/full/10.1002/adpr.202100148}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Wiley}, language = {30}, ISSN = {2699-9293, 2699-9293}, DOI = {10.1002/adpr.202100148}, stag_bib_extends_levelofaccess = {NA}, author = {Corte, E. and Sachero, S. and Ditalia Tchernij, S. and L{\"u}hmann, T. and Pezzagna, S. and Traina, P. and Degiovanni, I.P. and Moreva, E. and Olivero, P. and Meijer, J. and Genovese, M. and Forneris, J.} } @Article { CorteSDLPTDMOMGF2021_20, subid = {2678}, title = {Spectral Emission Dependence of Tin‐Vacancy Centers in Diamond from Thermal Processing and Chemical Functionalization}, journal = {Advanced Photonics Research}, year = {2021}, month = {11}, volume = {3}, number = {1}, number2 = {20FUN05: SEQUME: Single- and entangled photon sources for quantum metrology}, pages = {2100148}, keywords = {color centers, confocal microscopy}, web_url = {https://onlinelibrary.wiley.com/doi/full/10.1002/adpr.202100148}, misc2 = {EMPIR 2020: Industry}, publisher = {Wiley}, language = {30}, ISSN = {2699-9293, 2699-9293}, DOI = {10.1002/adpr.202100148}, stag_bib_extends_levelofaccess = {NA}, author = {Corte, E. and Sachero, S. and Ditalia Tchernij, S. and L{\"u}hmann, T. and Pezzagna, S. and Traina, P. and Degiovanni, I.P. and Moreva, E. and Olivero, P. and Meijer, J. and Genovese, M. and Forneris, J.} } @Article { CorteSDLPTDMOMGF2021_21, subid = {2678}, title = {Spectral Emission Dependence of Tin‐Vacancy Centers in Diamond from Thermal Processing and Chemical Functionalization}, journal = {Advanced Photonics Research}, year = {2021}, month = {11}, volume = {3}, number = {1}, number2 = {20IND05: QADeT: Quantum sensors for metrology based on single-atom-like device technology}, pages = {2100148}, keywords = {color centers, confocal microscopy}, web_url = {https://onlinelibrary.wiley.com/doi/full/10.1002/adpr.202100148}, misc2 = {EMPIR 2020: Industry}, publisher = {Wiley}, language = {30}, ISSN = {2699-9293, 2699-9293}, DOI = {10.1002/adpr.202100148}, stag_bib_extends_levelofaccess = {NA}, author = {Corte, E. and Sachero, S. and Ditalia Tchernij, S. and L{\"u}hmann, T. and Pezzagna, S. and Traina, P. and Degiovanni, I.P. and Moreva, E. and Olivero, P. and Meijer, J. and Genovese, M. and Forneris, J.} } @Article { CarratuDDLP2021, subid = {2267}, title = {Image Processing Technique for Improving the Sensitivity of Mechanical Register Water Meters to Very Small Leaks}, journal = {Sensors}, year = {2021}, month = {10}, day = {30}, volume = {21}, number = {21}, number2 = {17IND13: Metrowamet: Metrology for real-world domestic water metering}, pages = {13}, keywords = {water leak detection; IoT; smart water meter; smart city; EMPIR}, misc2 = {EMPIR 2017: Industry}, publisher = {MDPI}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s21217251}, stag_bib_extends_levelofaccess = {NA}, author = {Carrat{\`u}, M. and Dello Iacono, S. and Di Leo, G. and Liguori, C. and Pietrosanto, A.} } @Article { RipaIGSGFBLDG2021_2, subid = {2694}, title = {Corrigendum: Refractive index gas thermometry between 13.8 K and 161.4 K (2021 Metrologia 58 025008)}, journal = {Metrologia}, year = {2021}, month = {10}, day = {25}, volume = {58}, number = {6}, number2 = {18SIB02: Real-K: Realising the redefined kelvin}, pages = {069501}, keywords = {refractive index gas thermometry}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/ac2d9e}, stag_bib_extends_levelofaccess = {NA}, author = {Ripa, D.M. and Imbraguglio, D. and Gaiser, C. and Steur, P.P.M. and Giraudi, D. and Fogliati, M. and Bertinetti, M. and Lopardo, G. and Dematteis, R. and Gavioso, R.M.} } @Article { ZeichhardtFDBHSHIVHVMCGSOEBHK2021, subid = {2777}, title = {The Dangers of Using Cq to Quantify Nucleic Acid in Biological Samples: A Lesson From COVID-19}, journal = {Clinical Chemistry}, year = {2021}, month = {10}, day = {22}, volume = {68}, number = {1}, number2 = {18HLT03: SEPTIMET: Metrology to enable rapid and accurate clinical measurements in acute management of sepsis}, pages = {153-162}, keywords = {SARS-CoV-2, RT-qPC, EQA}, web_url = {https://academic.oup.com/clinchem/article/68/1/153/6385233\#325300656\&\#10;https://zenodo.org/record/6637873/files/18HLT03\%20Septimet\%20Supplementary\%20Funding\%20Acknowledgement\%20CLIN\%20CHEM.pdf?download=1}, misc2 = {EMPIR 2018: Health}, publisher = {Oxford University Press (OUP)}, language = {30}, ISSN = {0009-9147, 1530-8561}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://zenodo.org/record/6637873}, author = {Zeichhardt, H. and Foy, C.A. and D{\"u}hring, U. and Bae, Y-K. and Hingley-Wilson, S. and Storey, N. and Hong, K.H. and In, J. and Vandesompele, J. and Harris, K. and Verwilt, J. and Moran-Gilad, J. and Cowen, S. and Grunert, H-P. and Stewart, G. and O’Sullivan, D.M. and Evans, D. and Braybrook, J. and Huggett, Ji.F. and Kammel, M.} } @Article { DubovikFLLLDXDCTDLHHKMSEPLFPCKCAMBHLHF2021, subid = {2365}, title = {A Comprehensive Description of Multi-Term LSM for Applying Multiple a Priori Constraints in Problems of Atmospheric Remote Sensing: GRASP Algorithm, Concept, and Applications}, journal = {Frontiers in Remote Sensing}, year = {2021}, month = {10}, day = {19}, volume = {2}, number2 = {19ENV04: MAPP: Metrology for aerosol optical properties}, keywords = {GRASP, Radiative Transfer, Inversion model}, web_url = {https://www.frontiersin.org/articles/10.3389/frsen.2021.706851/full}, misc2 = {EMPIR 2019: Environment}, publisher = {Frontiers Media SA}, language = {30}, ISSN = {2673-6187}, DOI = {10.3389/frsen.2021.706851}, stag_bib_extends_levelofaccess = {NA}, author = {Dubovik, O. and Fuertes, D. and Litvinov, P. and Lopatin, A. and Lapyonok, T. and Doubovik, I. and Xu, F. and Ducos, F. and Chen, C. and Torres, B. and Derimian, Y. and Li, L. and Herreras-Giralda, M. and Herrera, M. and Karol, Y. and Matar, C. and Schuster, G.L. and Espinosa, R. and Puthukkudy, A. and Li, Z. and Fischer, J. and Preusker, R. and Cuesta, J. and Kreuter, A. and Cede, A. and Aspetsberger, M. and Marth, D. and Bindreiter, L. and Hangler, A. and Lanzinger, V. and Holter, C. and Federspiel, C.} } @Proceedings { HosekRHCC2021, subid = {2703}, title = {Measurement of the Hydrogen Cyanide Absorption Lines' Centers with the Potential for Mise en Pratique}, journal = {Conference IEEE EFTF IFCS 2021}, year = {2021}, month = {10}, day = {19}, number2 = {17IND03: LaVA: Large Volume Metrology Applications}, keywords = {hydrogen cyanide, linear absorption spectroscopy, optical frequency comb, frequency reference, frequency stabilized lasers, SI unit meter}, web_url = {https://zenodo.org/record/6497486}, misc2 = {EMPIR 2017: Industry}, publisher = {IEEE Service Center}, event_place = {Online}, event_name = {Joint Conference of the European Frequency and Time Forum and IEEE International Frequency Control Symposium (EFTF/IFCS)}, event_date = {07-07-2021 to 17-07-2021}, language = {30}, ISBN = {978-1-6654-3935-0}, ISSN = {2327-1949}, DOI = {10.1109/EFTF/IFCS52194.2021.9604261}, stag_bib_extends_levelofaccess = {NA}, author = {Hošek, M. and Rerucha, S. and Hrabina, J. and Č{\'i}žek, M. and Č{\'i}p, O.} } @Proceedings { HrabinaHRPLCP2021, subid = {2704}, title = {Saturated Spectroscopy of HCN}, journal = {Conference IEEE EFTF IFCS 2021}, year = {2021}, month = {10}, day = {19}, number2 = {17IND03: LaVA: Large Volume Metrology Applications}, keywords = {saturated spectroscopy, optical frequency standard, hydrogen cyanide}, web_url = {https://zenodo.org/record/6497501}, misc2 = {EMPIR 2017: Industry}, publisher = {IEEE Service Center}, event_place = {Online}, event_name = {Joint Conference of the European Frequency and Time Forum and IEEE International Frequency Control Symposium (EFTF/IFCS)}, event_date = {07-07-2021 to 17-07-2021}, language = {30}, ISBN = {978-1-6654-3935-0}, ISSN = {2327-1949}, DOI = {10.1109/EFTF/IFCS52194.2021.9604272}, stag_bib_extends_levelofaccess = {NA}, author = {Hrabina, J. and Hošek, M. and Rerucha, S. and Pravdova, L. and Lazar, J. and Č{\'i}p, O. and Pilat, Z.} } @Article { deGrootCSCL2021, subid = {2432}, title = {Modeling of coherence scanning interferometry using classical Fourier optics}, journal = {Optical Engineering}, year = {2021}, month = {10}, day = {18}, volume = {60}, number = {10}, number2 = {20IND07: TracOptic: Traceable industrial 3D roughness and dimensional measurement using optical 3D microscopy and optical distance sensors}, pages = {104106}, keywords = {interferometry, interferometer, metrology, topography, coherence scanning interferometry,Fourier optics}, web_url = {https://www.spiedigitallibrary.org/journals/optical-engineering/volume-60/issue-10/104106/Modeling-of-coherence-scanning-interferometry-using-classical-Fourier-optics/10.1117/1.OE.60.10.104106.full}, misc2 = {EMPIR 2020: Industry}, language = {30}, DOI = {10.1117/1.OE.60.10.104106}, stag_bib_extends_levelofaccess = {NA}, author = {de Groot, P. and Colonna de Lega, X. and Su, R. and Coupland, J. and Leach, R.} } @Article { HayBFFGRDH2021, subid = {2250}, title = {Uncertainty Assessment for Very High Temperature Thermal Diffusivity Measurements on Molybdenum, Tungsten and Isotropic Graphite}, journal = {International Journal of Thermophysics}, year = {2021}, month = {10}, day = {17}, volume = {43}, number = {1}, number2 = {17IND11: Hi-TRACE: Industrial process optimisation through improved metrology of thermophysical properties}, keywords = {High temperature, Isotropic graphite, Molybdenum, Thermal diffusivity, Tungsten, Uncertainty}, misc2 = {EMPIR 2017: Industry}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {0195-928X, 1572-9567}, DOI = {10.1007/s10765-021-02926-6}, stag_bib_extends_levelofaccess = {NA}, author = {Hay, B. and Beaumont, O. and Failleau, G. and Fleurence, N. and Grelard, M. and Razouk, R. and Dav{\'e}e, G. and Hameury, J.} } @Article { ArrheniusABMBWBGLCSBNR2021, subid = {2482}, title = {Strategies for the sampling of hydrogen at refuelling stations for purity assessment}, journal = {International Journal of Hydrogen Energy}, year = {2021}, month = {10}, day = {11}, volume = {46}, number = {70}, number2 = {19ENG04: MetroHyVe 2: Metrology for hydrogen vehicles 2}, pages = {34839-34853}, keywords = {Hydrogen,Refuelling stations,Sampling device,Fuel quality assessment}, web_url = {https://www.sciencedirect.com/science/article/pii/S0360319921031694}, misc2 = {EMPIR 2019: Energy}, publisher = {Elsevier}, language = {30}, ISSN = {0360-3199}, DOI = {10.1016/j.ijhydene.2021.08.043}, stag_bib_extends_levelofaccess = {NA}, author = {Arrhenius, K. and Aarhaug, T.A. and Bacquart, T. and Morris, A. and Bartlett, S. and Wagner, L. and Blondeel, C. and Gozlan, B. and Lescornes, Y. and Chramosta, N. and Spitta, C. and Basset, E. and Nouvelot, Q. and Rizand, M.} } @Article { CorderoVALPP2021, subid = {2259}, title = {Equivalence regimes for geometric quantum discord and local quantum uncertainty}, journal = {Phys. Rev. A}, year = {2021}, month = {10}, volume = {104}, number = {4}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {042401}, keywords = {Quantum Optics, non-classical correlations, quantum metrology}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society}, language = {30}, ISSN = {2469-9934}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://arxiv.org/abs/2107.14265}, author = {Cordero, O. and Villegas, A. and Alvarez, J.R. and Leon Montiel, R. de J. and Passos, M.H.M. and P. Torres, Juan} } @Article { VidakoviKochMiCKP2021, subid = {2305}, title = {Nonlinear frequency response analysis: a recent review and perspectives}, journal = {Current Opinion in Electrochemistry}, year = {2021}, month = {10}, number2 = {17IND10: LiBforSecUse: Quality assessment of electric vehicle Li-ion batteries for second use applications}, pages = {100851}, keywords = {Harmonic analysis, Diagnosis, Kinetics, MModel discrimination, Battery}, misc2 = {EMPIR 2017: Industry}, publisher = {Elsevier BV}, language = {30}, ISSN = {2451-9103}, DOI = {10.1016/j.coelec.2021.100851}, stag_bib_extends_levelofaccess = {NA}, author = {Vidaković-Koch, T. and Miličić, T. and Živković, L.A. and Chan, H.S. and Krewer, U. and Petkovska, M.} } @Article { SantafeGabardaFTC2021, subid = {2273}, title = {Primary facility for traceable measurement of the BSSRDF}, journal = {Optics Express}, year = {2021}, month = {10}, volume = {29}, number = {21}, number2 = {18SIB03: BxDiff: New quantities for the measurement of appearance}, pages = {34175}, keywords = {BSSRDF, translucency, reflectance, measurement, gonispectrophotometry}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {The Optical Society}, language = {30}, ISSN = {1094-4087}, DOI = {10.1364/OE.439108}, stag_bib_extends_levelofaccess = {NA}, author = {Santaf{\'e}-Gabarda, P. and Ferrero, A. and Tejedor-Sierra, N. and Campos, J.} } @Article { FrigoA2021, subid = {2322}, title = {Calibration of a Digital Current Transformer Measuring Bridge: Metrological Challenges and Uncertainty Contributions}, journal = {Metrology}, year = {2021}, month = {10}, volume = {1}, number = {2}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, pages = {93-106}, keywords = {measuring bridge; calibration; non-conventional instrument transformer; sampled values;digital output; synchronization}, web_url = {https://www.mdpi.com/2673-8244/1/2/7}, misc2 = {EMPIR 2017: Industry}, publisher = {MDPI AG}, address = {Basel, Switzerland}, language = {30}, ISSN = {2673-8244}, DOI = {10.3390/metrology1020007}, stag_bib_extends_levelofaccess = {NA}, author = {Frigo, G. and Agustoni, M.} } @Article { SteindlSABK2021, subid = {2345}, title = {On the importance of antimony for temporal evolution of emission from self-assembled (InGa) (AsSb)/GaAs quantum dots on GaP(001)}, journal = {New Journal of Physics}, year = {2021}, month = {10}, volume = {23}, number = {10}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {103029}, keywords = {Quantum Dots, carrier dynamics, optical spectroscopy, memory devices}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {1367-2630}, DOI = {10.1088/1367-2630/ac2bd6}, stag_bib_extends_levelofaccess = {NA}, author = {Steindl, P. and Sala, E.M. and Al{\'e}n, B. and Bimberg, D. and Klenovsk{\'y}, P.} } @Article { AguirrePPMSM2021, subid = {2451}, title = {Assessment and Improvement of the Pattern Recognition Performance of Memdiode-Based Cross-Point Arrays with Randomly Distributed Stuck-at-Faults}, journal = {Electronics}, year = {2021}, month = {10}, volume = {10}, number = {19}, number2 = {20FUN06: MEMQuD: Memristive devices as quantum standard for nanometrology}, pages = {2427}, keywords = {stuck-at fault; RRAM; pattern recognition; memristor; QMM; neural network; neuromorphics}, web_url = {https://www.mdpi.com/2079-9292/10/19/2427}, misc2 = {EMPIR 2020: Fundamental}, publisher = {MDPI AG}, language = {30}, ISSN = {2079-9292}, DOI = {10.3390/electronics10192427}, stag_bib_extends_levelofaccess = {NA}, author = {Aguirre, F.L. and Pazos, S.M. and Palumbo, F. and Morell, A. and Su{\~n}{\'e}, J. and Miranda, E.} } @Article { RefinoYSNHSKIVSPW2021, subid = {2474}, title = {Versatilely tuned vertical silicon nanowire arrays by cryogenic reactive ion etching as a lithium-ion battery anode}, journal = {Scientific Reports}, year = {2021}, month = {10}, volume = {11}, number = {1}, number2 = {19ENG05: NanoWires: High throughput metrology for nanowire energy harvesting devices}, keywords = {high-aspect-ratio silicon (Si), nanowire array, lithium ion batteries, ICP-RIE}, web_url = {https://www.nature.com/articles/s41598-021-99173-4}, misc2 = {EMPIR 2019: Energy}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2045-2322}, DOI = {10.1038/s41598-021-99173-4}, stag_bib_extends_levelofaccess = {NA}, author = {Refino, A.D. and Yulianto, N. and Syamsu, I. and Nugroho, A.P. and Hawari, N.H. and Syring, A. and Kartini, E. and Iskandar, F. and Voss, T. and Sumboja, A. and Peiner, E. and Wasisto, H.S.} } @Proceedings { MingottiCPT2021, subid = {2575}, title = {External Magnetic Fields Effect on Harmonics Measurements with Rogowski coils}, journal = {Workshop AMPS 2021}, year = {2021}, month = {10}, volume = {1}, number = {1}, number2 = {19NRM05: IT4PQ: Measurement methods and test procedures for assessing accuracy of instrument transformers for power quality measurements}, pages = {1-6}, keywords = {instrument transformer}, misc2 = {EMPIR 2019: Pre-Co-Normative}, publisher = {IEEE}, event_place = {Cagliari}, event_name = {Workshop on Applied Measurement for Power Systems}, event_date = {29-09-2021 to 01-10-2021}, language = {30}, ISBN = {978-1-7281-6923-1}, ISSN = {2475-2304}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://zenodo.org/record/5946938}, author = {Mingotti, A. and Costa, F. and Peretto, L. and Tinarelli, R.} } @Article { MilanoPMRHBIR2021, subid = {2676}, title = {In materia reservoir computing with a fully memristive architecture based on self-organizing nanowire networks}, journal = {Nature Materials}, year = {2021}, month = {10}, volume = {21}, number = {2}, number2 = {20FUN06: MEMQuD: Memristive devices as quantum standard for nanometrology}, pages = {195-202}, keywords = {memristive devices, memristive networks, nanowire networks, reservoir computing, physical computing}, web_url = {https://iris.polito.it/retrieve/handle/11583/2936403/537201/05_Manuscript.pdf}, misc2 = {EMPIR 2020: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {1476-1122, 1476-4660}, DOI = {10.1038/s41563-021-01099-9}, stag_bib_extends_levelofaccess = {NA}, author = {Milano, G. and Pedretti, G. and Montano, K. and Ricci, S. and Hashemkhani, S. and Boarino, L. and Ielmini, D. and Ricciardi, C.} } @Article { SteindlSABK20210, subid = {2345}, title = {On the importance of antimony for temporal evolution of emission from self-assembled (InGa) (AsSb)/GaAs quantum dots on GaP(001)}, journal = {New Journal of Physics}, year = {2021}, month = {10}, volume = {23}, number = {10}, number2 = {20FUN05: SEQUME: Single- and entangled photon sources for quantum metrology}, pages = {103029}, keywords = {Quantum Dots, carrier dynamics, optical spectroscopy, memory devices}, misc2 = {EMPIR 2020: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {1367-2630}, DOI = {10.1088/1367-2630/ac2bd6}, stag_bib_extends_levelofaccess = {NA}, author = {Steindl, P. and Sala, E.M. and Al{\'e}n, B. and Bimberg, D. and Klenovsk{\'y}, P.} } @Article { SteindlSABK20211, subid = {2345}, title = {On the importance of antimony for temporal evolution of emission from self-assembled (InGa) (AsSb)/GaAs quantum dots on GaP(001)}, journal = {New Journal of Physics}, year = {2021}, month = {10}, volume = {23}, number = {10}, number2 = {20IND05: QADeT: Quantum sensors for metrology based on single-atom-like device technology}, pages = {103029}, keywords = {Quantum Dots, carrier dynamics, optical spectroscopy, memory devices}, misc2 = {EMPIR 2020: Industry}, publisher = {IOP Publishing}, language = {30}, ISSN = {1367-2630}, DOI = {10.1088/1367-2630/ac2bd6}, stag_bib_extends_levelofaccess = {NA}, author = {Steindl, P. and Sala, E.M. and Al{\'e}n, B. and Bimberg, D. and Klenovsk{\'y}, P.} } @Article { KnotekSO2021, subid = {2193}, title = {Assessment of different parameters used in mesh independence studies in two-phase slug flow simulations}, journal = {Measurement: Sensors}, year = {2021}, month = {9}, day = {29}, volume = {18}, number = {2021}, number2 = {16ENG07: MultiFlowMet II: Multiphase flow reference metrology}, pages = {100317}, keywords = {Multiphase flow, Slug flow, Computational fluid dynamics (CFD), Mesh study, Grid refinement}, web_url = {https://doi.org/10.1016/j.measen.2021.100317}, misc2 = {EMPIR 2016: Energy}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100317}, stag_bib_extends_levelofaccess = {NA}, author = {Knotek, S. and Schmelter, S. and Olbrich, M.} } @Proceedings { ManzinVFV2021, subid = {2197}, title = {In silico experiments as a tool to reduce preclinical tests of magnetic hyperthermia}, journal = {Biomedical Science and Engineering}, year = {2021}, month = {9}, day = {29}, volume = {4}, number = {s1}, number2 = {18HLT06: RaCHy: Radiotherapy coupled with hyperthermia - adapting the biological equivalent dose concept}, pages = {117-118}, keywords = {magnetic hyperthermia, magnetic nanoparticles, computational animal models, bio-heat model}, web_url = {https://www.pagepress.org/technology/index.php/bse/article/view/199}, misc2 = {EMPIR 2018: Health}, publisher = {PAGEPress}, event_place = {virtual meeting}, event_name = {Third Centro 3R Annual Meeting}, event_date = {30-09-2021 to 01-10-2021}, language = {30}, ISSN = {eISSN 2531-9892}, DOI = {10.4081/bse.2021.199}, stag_bib_extends_levelofaccess = {NA}, author = {Manzin, A. and Vassallo, M. and Ferrero, R. and Vicentini, M.} } @Article { BukerSKBPS2021, subid = {2207}, title = {Investigations on the Influence of Total Water Hardness and pH Value on the Measurement Accuracy of Domestic Cold Water Meters}, journal = {MDPI Water}, year = {2021}, month = {9}, day = {29}, volume = {13}, number = {19}, number2 = {17IND13: Metrowamet: Metrology for real-world domestic water metering}, keywords = {domestic water meters; total hardness; pH value; wear test; flow measurement}, misc2 = {EMPIR 2017: Industry}, language = {30}, DOI = {10.3390/w13192701}, stag_bib_extends_levelofaccess = {NA}, author = {B{\"u}ker, O. and Stolt, K. and Kroner, C. and Benkova, M. and Pavlas, J. and Seypka, V.} } @Proceedings { SeferiCB2021, subid = {2268}, title = {Review of PMU Algorithms Suitable for Real-Time Operation With Digital Sampled Value Data}, journal = {2021 IEEE 11th International Workshop on Applied Measurements for Power Systems (AMPS)}, year = {2021}, month = {9}, day = {29}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, pages = {6}, keywords = {Algorithms, frequency, phasor measurement unit, real-time operation, ROCOF, sample value data, synchrophasor}, web_url = {https://strathprints.strath.ac.uk/78316/}, misc2 = {EMPIR 2017: Industry}, publisher = {IEEE}, event_place = {Online}, event_name = {IEEE 11th International Workshop on Applied Measurements for Power Systems (AMPS)}, event_date = {29-09-2021 to 01-10-2021}, language = {30}, ISBN = {978-1-7281-6923-1}, ISSN = {2475-2304}, DOI = {10.1109/AMPS50177.2021.9586034}, stag_bib_extends_levelofaccess = {NA}, author = {Seferi, Y. and Cetina, R.G.Q. and Blair, S.M.} } @Proceedings { OlivanMBC2021, subid = {2313}, title = {An IEC 61850 Sampled Values-based Analyzer for Power Quality applications on Smart Substations}, journal = {2021 IEEE 11th International Workshop on Applied Measurements for Power Systems (AMPS)}, year = {2021}, month = {9}, day = {29}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, keywords = {Power quality,substation automation, smart grids, measuremen ttechniques, instrument transformers}, misc2 = {EMPIR 2017: Industry}, publisher = {IEEE}, event_place = {Cagliari, Italy}, event_name = {2021 IEEE 11th International Workshop on Applied Measurements for Power Systems (AMPS)}, event_date = {29-09-2021 to 01-10-2021}, language = {30}, ISBN = {978-1-7281-6923-1}, ISSN = {2475-2304}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://zenodo.org/record/5703000}, author = {Oliv{\'a}n, M.A. and Mareca, A. and Bruna, J. and Cervero, D.} } @Proceedings { ChenCDLMLB2021, subid = {2327}, title = {Novel Calibration systems for the dynamic and steady-state testing of digital instrument transformers}, journal = {2021 IEEE 11th International Workshop on Applied Measurements for Power Systems}, year = {2021}, month = {9}, day = {29}, volume = {-}, number = {-}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, pages = {6}, keywords = {Power quality, substation automation, smart grids, measurement techniques, instrument transformers}, web_url = {https://ieeexplore.ieee.org/document/9586040}, misc2 = {EMPIR 2017: Industry}, publisher = {IEEE}, event_place = {Cagliari, Italy}, event_name = {2021 IEEE 11th International Workshop on Applied Measurements for Power Systems (AMPS)}, event_date = {29-09-2021 to 01-10-2021}, language = {30}, ISBN = {Electronic ISBN:978-1-7281-692}, ISSN = {Electronic ISSN: 2475-2304 Pri}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://doi.org/10.5281/zenodo.5717933}, author = {Chen, Y. and Crotti, G. and Dubowik, A. and Letizia, P.S. and Mohns, E. and Luiso, M. and Bruna, J.} } @Proceedings { ChenMSd2021, subid = {2309}, title = {Traceable calibration system for non-conventional current sensors with analogue or digital output}, journal = {2021 IEEE 11th International Workshop on Applied Measurements for Power Systems}, year = {2021}, month = {9}, day = {29}, volume = {-}, number = {-}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, pages = {6}, keywords = {digital, current transformer, merging unit, standalone merging unit, traceability, calibration, sampled values}, web_url = {https://zenodo.org/record/5704497}, misc2 = {EMPIR 2017: Industry}, publisher = {IEEE}, event_place = {Cagliari, Italy}, event_name = {2021 IEEE 11th International Workshop on Applied Measurements for Power Systems (AMPS)}, event_date = {29-09-2021 to 01-10-2021}, language = {30}, ISBN = {Electronic ISBN:978-1-7281-692}, ISSN = {Electronic ISSN: 2475-2304 Pri}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {Electronic ISBN:978-1-7281-6923-1 Print on Demand(PoD) ISBN:978-1-7281-6924-8}, author = {Chen, Y. and Mohns, E. and Seckelmann, M. and de Rose, S.} } @Proceedings { vandenBromMLLLCD2021, subid = {2565}, title = {Instrument Transformers for Power Quality Measurements: a Review of Literature and Standards}, journal = {2021 IEEE 11th International Workshop on Applied Measurements for Power Systems (AMPS)}, year = {2021}, month = {9}, day = {29}, number2 = {19NRM05: IT4PQ: Measurement methods and test procedures for assessing accuracy of instrument transformers for power quality measurements}, keywords = {Instrument Transformer, Power Quality, Power System Measurements, Calibration, Uncertainty, Standard}, misc2 = {EMPIR 2019: Pre-Co-Normative}, publisher = {IEEE}, event_place = {Virtual Conference}, event_name = {2021 IEEE 11th International Workshop on Applied Measurements for Power Systems (AMPS)}, event_date = {29-09-2021 to 01-10-2021}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://zenodo.org/record/6093507}, author = {van den Brom, H. and Munoz, F. and Luiso, M. and Letizia, P.S. and Landi, C. and Crotti, G. and D'Avanzo, G.} } @Article { FogliettaGBCBFDSC2021, subid = {2263}, title = {5-Aminolevulinic Acid Triggered by Ultrasound Halts Tumor Proliferation in a Syngeneic Model of Breast Cancer}, journal = {Pharmaceuticals}, year = {2021}, month = {9}, day = {25}, volume = {14}, number = {10}, number2 = {18HLT06: RaCHy: Radiotherapy coupled with hyperthermia - adapting the biological equivalent dose concept}, pages = {972}, keywords = {ultrasound; sonodynamic therapy; breast cancer}, misc2 = {EMPIR 2018: Health}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8247}, DOI = {10.3390/ph14100972}, stag_bib_extends_levelofaccess = {NA}, author = {Foglietta, F. and Gola, G. and Biasibetti, E. and Capucchio, M.T. and Bruni, I. and Francovich, A. and Durando, G. and Serpe, L. and Canaparo, R.} } @Article { CzompolyBGPO2021, subid = {2484}, title = {Characterization of unique aerosol pollution episodes in urban areas using TXRF and TXRF-XANES.}, journal = {Atmospheric Pollution Research}, year = {2021}, month = {9}, day = {25}, volume = {12}, number = {11}, number2 = {19ENV08: AEROMET II: Advanced aerosol metrology for atmospheric science and air quality}, pages = {101214}, keywords = {Atmospheric aerosols, TXRF, XANES, Elemental size distribution, Elemental speciation, Cascade impactor}, misc2 = {EMPIR 2019: Environment}, publisher = {Elsevier B.V.}, language = {30}, ISSN = {1309-1042}, DOI = {10.1016/j.apr.2021.101214}, stag_bib_extends_levelofaccess = {NA}, author = {Cz{\"o}mp{\"o}ly, O. and B{\"o}rcs{\"o}k, E. and Groma, V. and Pollastri, S. and Os{\'a}n, J.} } @Article { RottgerRGVCOHCCBIRKCAYFMM2021, subid = {2224}, title = {New metrology for radon at the environmental level}, journal = {Measurement Science and Technology}, year = {2021}, month = {9}, day = {23}, number2 = {19ENV01: traceRadon: Radon metrology for use in climate change observation and radiation protection at the environmental level}, keywords = {radon, metrology, tracer, environmental measurements}, misc2 = {EMPIR 2019: Environment}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-0233, 1361-6501}, DOI = {10.1088/1361-6501/ac298d}, stag_bib_extends_levelofaccess = {NA}, author = {R{\"o}ttger, A. and R{\"o}ttger, S. and Grossi, C. and Vargas, A. and Curcoll, R. and Ot{\'a}hal, P. and Hern{\'a}ndez-Ceballos, M.{\'A}. and Cinelli, G. and Chambers, S. and Barbosa, S.A. and Ioan, M-R. and Radulescu, I. and Kikaj, D. and Chung, E. and Arnold, T. and Yver Kwok, C. and Fuente, M. and Mertes, F. and Morosh, V.} } @Proceedings { WeidingerDLYKZEMZ2021, subid = {2253}, title = {Need for a traceable efficiency determination method of nacelles performed on test benches}, journal = {Measurement: Sensors}, year = {2021}, month = {9}, day = {23}, volume = {18}, number2 = {19ENG08: WindEFCY: Traceable mechanical and electrical power measurement for efficiency determination of wind turbines}, pages = {100159}, keywords = {nacelle test bench, wind turbine power curves, direct efficiency determination, mechanical power measurement, electrical power measurement}, misc2 = {EMPIR 2019: Energy}, publisher = {Elsevier BV}, event_place = {Yokohama, JAPAN}, event_name = {XXIII IMEKO World Congress}, event_date = {30-08-2021 to 03-09-2021}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100159}, stag_bib_extends_levelofaccess = {NA}, author = {Weidinger, P. and Dubowik, A. and Lehrmann, C. and Yogal, N. and Kumme, R. and Zweiffel, M. and Eich, N. and Mester, C. and Zhang, H.} } @Article { AguirrePPSM2021, subid = {2450}, title = {SPICE Simulation of RRAM-Based Cross-Point Arrays Using the Dynamic Memdiode Model}, journal = {Frontiers in Physics}, year = {2021}, month = {9}, day = {23}, volume = {9}, number2 = {20FUN06: MEMQuD: Memristive devices as quantum standard for nanometrology}, pages = {735021}, keywords = {RRAM, resistive switching, cross-point, memristor, neuromorphic, pattern recognition, write-verify,frequency}, web_url = {https://www.frontiersin.org/articles/10.3389/fphy.2021.735021/full}, misc2 = {EMPIR 2020: Fundamental}, publisher = {Frontiers Media SA}, language = {30}, ISSN = {2296-424X}, DOI = {10.3389/fphy.2021.735021}, stag_bib_extends_levelofaccess = {NA}, author = {Aguirre, F.L. and Pazos, S.M. and Palumbo, F. and Su{\~n}{\'e}, J. and Miranda, E.} } @Proceedings { SongWEZYK2021, subid = {2252}, title = {10 MW mechanical power transfer standard for nacelle test benches using a torque transducer and an inclinometer}, journal = {Measurement: Sensors}, year = {2021}, month = {9}, day = {22}, volume = {18}, number2 = {19ENG08: WindEFCY: Traceable mechanical and electrical power measurement for efficiency determination of wind turbines}, pages = {100249}, keywords = {nacelle test bench, wind turbine, inclinometer, rotational speed measurement, mechanical power measurement}, misc2 = {EMPIR 2019: Energy}, publisher = {Elsevier BV}, event_place = {Yokohama, JAPAN}, event_name = {XXIII IMEKO World Congress}, event_date = {30-08-2021 to 03-09-2021}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100249}, stag_bib_extends_levelofaccess = {NA}, author = {Song, Z. and Weidinger, P. and Eich, N. and Zhang, H. and Yogal, N. and Kumme, R.} } @Article { GroscheKBK2021, subid = {2176}, title = {Validating frequency transfer via interferometric fiber links for optical clock comparisons}, journal = {New Journal of Physics}, year = {2021}, month = {9}, day = {20}, volume = {23}, number = {9}, number2 = {18SIB06: TiFOON: Advanced time/frequency comparison and dissemination through optical telecommunication networks}, pages = {093024}, keywords = {optical frequency dissemination, optical fiber links, optical clocks, optical clock comparisons, ultra-stable lasers}, web_url = {https://iopscience.iop.org/article/10.1088/1367-2630/ac21a0}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {1367-2630}, DOI = {10.1088/1367-2630/ac21a0}, stag_bib_extends_levelofaccess = {NA}, author = {Grosche, G. and Kuhl, A. and Benkler, E. and Koke, S.} } @Article { GroscheKBK20210, subid = {2176}, title = {Validating frequency transfer via interferometric fiber links for optical clock comparisons}, journal = {New Journal of Physics}, year = {2021}, month = {9}, day = {20}, volume = {23}, number = {9}, number2 = {15SIB05: OFTEN: Optical frequency transfer - a European network}, pages = {093024}, keywords = {optical frequency dissemination, optical fiber links, optical clocks, optical clock comparisons, ultra-stable lasers}, web_url = {https://iopscience.iop.org/article/10.1088/1367-2630/ac21a0}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {1367-2630}, DOI = {10.1088/1367-2630/ac21a0}, stag_bib_extends_levelofaccess = {NA}, author = {Grosche, G. and Kuhl, A. and Benkler, E. and Koke, S.} } @Article { ForssenSZAZ2021, subid = {2174}, title = {The Short-Term Performances of Two Independent Gas Modulated Refractometers for Pressure Assessments}, journal = {Sensors}, year = {2021}, month = {9}, day = {18}, volume = {21}, number = {18}, number2 = {18SIB04: QuantumPascal: Towards quantum-based realisations of the pascal}, pages = {6272}, keywords = {refractometry,pressure, short-term performance,Fabry–Perot cavity, gas modulation, modulation techniques, metrology}, web_url = {https://www.mdpi.com/1424-8220/21/18/6272}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s21186272}, stag_bib_extends_levelofaccess = {NA}, author = {Forss{\'e}n, C. and Silander, I. and Zakrisson, J. and Axner, O. and Zelan, M.} } @Article { ArduiniMSEH2021, subid = {2199}, title = {Development and Evaluation of an Improved Apparatus for Measuring the Emissivity at High Temperatures}, journal = {Sensors}, year = {2021}, month = {9}, day = {17}, volume = {21}, number = {18}, number2 = {17IND11: Hi-TRACE: Industrial process optimisation through improved metrology of thermophysical properties}, pages = {6252}, keywords = {emissivity, reflectivity, infrared radiation, high temperature, FTIR-spectrometer, blackbody,uncertainty, X-point, inductive heating, direct radiative method}, misc2 = {EMPIR 2017: Industry}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s21186252}, stag_bib_extends_levelofaccess = {NA}, author = {Arduini, M. and Manara, J. and Stark, T. and Ebert, H-P. and Hartmann, J.} } @Article { TangSJHCMT2021, subid = {2730}, title = {Cavity-immune spectral features in the pulsed superradiant crossover regime}, journal = {Physical Review Research}, year = {2021}, month = {9}, day = {17}, volume = {3}, number = {3}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, keywords = {superradiance}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2643-1564}, DOI = {10.1103/PhysRevResearch.3.033258}, stag_bib_extends_levelofaccess = {NA}, author = {Tang, M. and Sch{\"a}ffer, S.A. and J{\o}rgensen, A.A. and Henriksen, M.R. and Christensen, B.T.R. and M{\"u}ller, J.H. and Thomsen, J.W.} } @Article { LainelaLHCACS2021, subid = {2180}, title = {Toward Unified pH of Saline Solutions}, journal = {Water}, year = {2021}, month = {9}, day = {15}, volume = {13}, number = {18}, number2 = {17FUN09: UnipHied: Realisation of a Unified pH Scale}, pages = {2522}, keywords = {acidity;seawater;pH scales; unified scaleabsolute pHdifferential potentiometric measurementsminimization of liquid junction potential ionic liquid salt bridgesresidual liquid junction potential}, misc2 = {EMPIR 2017: Fundamental}, publisher = {MDPI AG}, language = {30}, ISSN = {2073-4441}, DOI = {10.3390/w13182522}, stag_bib_extends_levelofaccess = {NA}, author = {Lainela, S. and Leito, I. and Heering, A. and Capitaine, G. and Anes, B. and Cam{\~o}es, F. and Stoica, D.} } @Article { YaoMGZKK2021, subid = {2189}, title = {Induced radiofrequency fields in patients undergoing MR examinations: insights for risk assessment}, journal = {Physics in Medicine \& Biology}, year = {2021}, month = {9}, day = {15}, volume = {66}, number = {18}, number2 = {17IND01: MIMAS: Procedures allowing medical implant manufacturers to demonstrate compliance with MRI safety regulations}, pages = {185014}, keywords = {MR safety, electromagnetic modelling, specific power absorption}, misc2 = {EMPIR 2017: Industry}, publisher = {IOP Publishing}, language = {30}, ISSN = {0031-9155, 1361-6560}, DOI = {10.1088/1361-6560/ac212d}, stag_bib_extends_levelofaccess = {NA}, author = {Yao, A. and Murbach, M. and Goren, T. and Zastrow, E. and Kainz, W. and Kuster, N.} } @Article { LainelaLHCACS2021_2, subid = {2288}, title = {Toward Unified pH of Saline Solutions}, journal = {Water}, year = {2021}, month = {9}, day = {15}, volume = {13}, number = {18}, number2 = {17FUN09: UnipHied: Realisation of a Unified pH Scale}, pages = {2522}, keywords = {acidity; seawater; pH scales; unified scale; absolute pH; differential potentiometric measurements; minimization of liquid junction potential; ionic liquid salt bridges; residual liquid junction potential}, misc2 = {EMPIR 2017: Fundamental}, publisher = {MDPI AG}, language = {30}, ISSN = {2073-4441}, DOI = {10.3390/w13182522}, stag_bib_extends_levelofaccess = {NA}, author = {Lainela, S. and Leito, I. and Heering, A. and Capitaine, G. and Anes, B. and Cam{\~o}es, F. and Stoica, D.} } @Article { BuonacorsiSSTKHHRWB2021, subid = {2168}, title = {Non-adiabatic single-electron pumps in a dopant-free GaAs/AlGaAs 2DEG}, journal = {Applied Physics Letters}, year = {2021}, month = {9}, day = {13}, volume = {119}, number = {11}, number2 = {17FUN04: SEQUOIA: Single-electron quantum optics for quantum-enhanced measurements}, pages = {114001}, keywords = {Single electron transport, quantum dot, dopant-free GaAs/AlGaAs system, quantum transport, single electron pump}, web_url = {https://arxiv.org/abs/2102.13320}, misc2 = {EMPIR 2017: Fundamental}, publisher = {AIP Publishing}, language = {30}, ISSN = {0003-6951, 1077-3118}, DOI = {10.1063/5.0062486}, stag_bib_extends_levelofaccess = {NA}, author = {Buonacorsi, B. and Sfigakis, F. and Shetty, A. and Tam, M.C. and Kim, H.S. and Harrigan, S.R. and Hohls, F. and Reimer, M.E. and Wasilewski, Z.R. and Baugh, J.} } @Article { YamakawaATBFBKRD2021, subid = {2038}, title = {Hg isotopic composition of one-year-old spruce shoots: Application to long-term Hg atmospheric monitoring in Germany}, journal = {Chemosphere}, year = {2021}, month = {9}, volume = {279}, number2 = {16ENV01: MercOx: Metrology for oxidised mercury}, pages = {130631}, keywords = {Hg isotopic composition, spruce shoots, Hg atmospheric monitoring}, misc2 = {EMPIR 2016: Environment}, publisher = {Elsevier BV}, language = {30}, ISSN = {0045-6535}, DOI = {10.1016/j.chemosphere.2021.130631}, stag_bib_extends_levelofaccess = {NA}, author = {Yamakawa, A. and Amouroux, D. and Tessier, E. and B{\'e}rail, S. and Fettig, I. and Barre, J.P.G. and Koschorreck, J. and R{\"u}del, H. and Donard, O.F.X.} } @Article { VasilatouWKHISSSWA2021, subid = {2082}, title = {Calibration of optical particle size spectrometers against a primary standard: Counting efficiency profile of the TSI Model 3330 OPS and Grimm 11-D monitor in the particle size range from 300 nm to 10 \(\mu\)m}, journal = {Journal of Aerosol Science}, year = {2021}, month = {9}, volume = {157}, number2 = {19ENV08: AEROMET II: Advanced aerosol metrology for atmospheric science and air quality}, pages = {105818}, keywords = {calibration, aerosol spectrometers, PSL particles, primary standard, particle number concentration}, misc2 = {EMPIR 2019: Environment}, publisher = {Elsevier BV}, language = {30}, ISSN = {0021-8502}, DOI = {10.1016/j.jaerosci.2021.105818}, stag_bib_extends_levelofaccess = {NA}, author = {Vasilatou, K. and W{\"a}lchli, C. and Koust, S. and Horender, S. and Iida, K. and Sakurai, H. and Schneider, F. and Spielvogel, J. and Wu, T.Y. and Auderset, K.} } @Article { EssBKGV2021, subid = {2081}, title = {Coated soot particles with tunable, well-controlled properties generated in the laboratory with a miniCAST BC and a micro smog chamber}, journal = {Journal of Aerosol Science}, year = {2021}, month = {9}, volume = {157}, number2 = {18HLT02: AeroTox: Measurements for mitigating adverse health effects from atmospheric particulate pollutants}, pages = {105820}, keywords = {soot, aerosol, secondary organic matter, calibration, black carbon, absorption photometers}, misc2 = {EMPIR 2018: Health}, publisher = {Elsevier BV}, language = {30}, ISSN = {0021-8502}, DOI = {10.1016/j.jaerosci.2021.105820}, stag_bib_extends_levelofaccess = {NA}, author = {Ess, M.N. and Bert{\`o}, M. and Keller, A. and Gysel-Beer, M. and Vasilatou, K.} } @Article { AlegriaL2021, subid = {2166}, title = {Efficiency calculation by Monte Carlo simulation for the rapidly-deployable spectrometric air-sampling system (MARE)}, journal = {Journal of Instrumentation}, year = {2021}, month = {9}, volume = {16}, number = {09}, number2 = {16ENV04: Preparedness: Metrology for mobile detection of ionising radiation following a nuclear or radiological incident}, pages = {P09018}, keywords = {Radiation monitoring; Real-time monitoring; Spectrometers; Scintillators and scintillatingfibres and light guides}, misc2 = {EMPIR 2016: Environment}, publisher = {IOP Publishing}, language = {30}, ISSN = {1748-0221}, DOI = {10.1088/1748-0221/16/09/P09018}, stag_bib_extends_levelofaccess = {NA}, author = {Alegria, N. and Legarda, F.} } @Article { SeegerT2021, subid = {2194}, title = {Primary calibration of mechanical sensors with digital output for dynamic applications}, journal = {Acta IMEKO}, year = {2021}, month = {9}, volume = {10}, number = {3}, number2 = {17IND12: Met4FoF: Metrology for the Factory of the Future}, pages = {177 - 184}, keywords = {Primary calibration; MEMS; complex frequency response; digital interface; dynamic measurement}, web_url = {https://acta.imeko.org/index.php/acta-imeko/article/view/IMEKO-ACTA-10\%20\%282021\%29-03-24/0}, misc2 = {EMPIR 2017: Industry}, publisher = {IMEKO}, address = {Braunschweig}, language = {30}, ISSN = {2221-870X}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {IMEKO-ACTA-10 (2021)-03-24}, author = {Seeger, B. and Thomas, B.} } @Article { UthayakumaarDP2021, subid = {2222}, title = {Mass Loss of Platinum-Rhodium Thermocouple Wires at 1324\(^{\circ}\)C}, journal = {Johnson Matthey Technology Review}, year = {2021}, month = {9}, volume = {65}, number = {4}, number2 = {17IND04: EMPRESS 2: Enhancing process efficiency through improved temperature measurement 2}, pages = {568-573}, keywords = {Thermocouple, thermoelectric stability, calibration drift, traceability, ITS-90}, misc2 = {EMPIR 2017: Industry}, publisher = {Johnson Matthey}, language = {30}, ISSN = {2056-5135}, DOI = {10.1595/205651321X16183288904988}, stag_bib_extends_levelofaccess = {NA}, author = {Uthayakumaar, S. and Davidson, S. and Pearce, J.} } @Article { TeirLWHBFPL2021, subid = {2254}, title = {In-Line Measurement of the Surface Texture of Rolls Using Long Slender Piezoresistive Microprobes}, journal = {Sensors}, year = {2021}, month = {9}, volume = {21}, number = {17}, number2 = {17IND05: MicroProbes: Multifunctional ultrafast microprobes for on-the-machine measurements}, pages = {5955}, keywords = {silicon microprobe, high speed, roughness, paper machine roll, metrology}, misc2 = {EMPIR 2017: Industry}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s21175955}, stag_bib_extends_levelofaccess = {NA}, author = {Teir, L. and Lindstedt, T. and Widmaier, T. and Hemming, B. and Brand, U. and Fahrbach, M. and Peiner, E. and Lassila, A.} } @Article { EisermannKWR2021, subid = {2243}, title = {Photonic contact thermometry using silicon ring resonators and tuneable laser-based spectroscopy}, journal = {tm - Technisches Messen}, year = {2021}, month = {9}, volume = {88}, number = {10}, number2 = {17FUN05: PhotOQuant: Photonic and Optomechanical Sensors for Nanoscaled and Quantum Thermometry}, pages = {640-654}, keywords = {Thermometry; photonic; temperature sensor; optical ring resonator}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Walter de Gruyter GmbH}, language = {30}, ISSN = {2196-7113, 0171-8096}, DOI = {10.1515/teme-2021-0054}, stag_bib_extends_levelofaccess = {NA}, author = {Eisermann, R. and Krenek, S. and Winzer, G. and Rudtsch, S.} } @Article { MierEscurraRV2021, subid = {2366}, title = {Design and Characterization of a Magnetic Loop Antenna for Partial Discharge Measurements in Gas Insulated Substations}, journal = {IEEE Sensors Journal}, year = {2021}, month = {9}, volume = {21}, number = {17}, number2 = {19ENG02: FutureEnergy: Metrology for future energy transmission}, pages = {18618-18625}, keywords = {Magnetic loop antenna, partial discharges, transfer function, electric circuit, GIS, broadband antenna, VHF, high voltage}, tags = {SEG}, misc2 = {EMPIR 2019: Energy}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {1530-437X, 1558-1748, 2379-915}, DOI = {10.1109/JSEN.2021.3089084}, stag_bib_extends_levelofaccess = {NA}, author = {Mier Escurra, C. and Rodrigo Mor, A. and Vaessen, P.} } @Article { CrottiGDLL2021, subid = {2563}, title = {A New Industry-Oriented Technique for the Wideband Characterization of Voltage Transformers}, journal = {Measurement}, year = {2021}, month = {9}, volume = {182}, number2 = {19NRM05: IT4PQ: Measurement methods and test procedures for assessing accuracy of instrument transformers for power quality measurements}, pages = {109674}, keywords = {Voltage transformer, Power system measurements, SINDICOMP-LV, Harmonics, Frequency response, Non-linearity.}, web_url = {https://www.sciencedirect.com/science/article/pii/S0263224121006436?via\%3Dihub}, misc2 = {EMPIR 2019: Pre-Co-Normative}, publisher = {Elsevier BV}, language = {30}, ISSN = {0263-2241}, DOI = {10.1016/j.measurement.2021.109674}, stag_bib_extends_levelofaccess = {NA}, author = {Crotti, G. and Giordano, D. and D'Avanzo, G. and Letizia, P.S. and Luiso, M.} } @Article { StoreyBPOHWBH2021, subid = {2597}, title = {Single base mutations in the nucleocapsid gene of SARS-CoV-2 affects amplification efficiency of sequence variants and may lead to assay failure}, journal = {Journal of Clinical Virology Plus}, year = {2021}, month = {9}, volume = {1}, number = {3}, number2 = {18HLT03: SEPTIMET: Metrology to enable rapid and accurate clinical measurements in acute management of sepsis}, pages = {100037}, keywords = {SARS-CoV-2, Nucleocapsid, Mutations, PCR, Failure, Silico}, web_url = {https://www.sciencedirect.com/science/article/pii/S2667038021000296}, misc2 = {EMPIR 2018: Health}, publisher = {Elsevier BV}, language = {30}, ISSN = {2667-0380}, DOI = {10.1016/j.jcvp.2021.100037}, stag_bib_extends_levelofaccess = {NA}, author = {Storey, N. and Brown, J.R. and Pereira, R.P.A. and O'Sullivan, D.M. and Huggett, J.F. and Williams, R. and Breuer, J. and Harris, K.A.} } @Article { DollemanCLvSS2021, subid = {2244}, title = {Squeeze-Film Effect on Atomically Thin Resonators in the High-Pressure Limit}, journal = {Nano Letters}, year = {2021}, month = {8}, day = {30}, volume = {21}, number = {18}, number2 = {17FUN05: PhotOQuant: Photonic and Optomechanical Sensors for Nanoscaled and Quantum Thermometry}, pages = {7617-7624}, keywords = {graphene, nanoelectromechanical systems (NEMS), pressure sensor, gas damping}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Chemical Society (ACS)}, language = {30}, ISSN = {1530-6984, 1530-6992}, DOI = {10.1021/acs.nanolett.1c02237}, stag_bib_extends_levelofaccess = {NA}, author = {Dolleman, R.J. and Chakraborty, D. and Ladiges, D.R. and van der Zant, H.S.J. and Sader, J.E. and Steeneken, P.G.} } @Article { FerreiroVilaMWGPR2021, subid = {2241}, title = {Micro-Kelvin Resolution at Room Temperature Using Nanomechanical Thermometry}, journal = {ACS Omega}, year = {2021}, month = {8}, day = {27}, volume = {6}, number = {36}, number2 = {17FUN05: PhotOQuant: Photonic and Optomechanical Sensors for Nanoscaled and Quantum Thermometry}, pages = {23052-23058}, keywords = {stress, membranes, power, resonance structures, lasers}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Chemical Society (ACS)}, language = {30}, ISSN = {2470-1343, 2470-1343}, DOI = {10.1021/acsomega.1c02045}, stag_bib_extends_levelofaccess = {NA}, author = {Ferreiro-Vila, E. and Molina, J. and Weituschat, L.M. and Gil-Santos, E. and Postigo, P.A. and Ramos, D.} } @Article { FerreroBCVHYACMT2021, subid = {2146}, title = {Experimental and Modelling Analysis of the Hyperthermia Properties of Iron Oxide Nanocubes}, journal = {Nanomaterials}, year = {2021}, month = {8}, day = {25}, volume = {11}, number = {9}, number2 = {18HLT06: RaCHy: Radiotherapy coupled with hyperthermia - adapting the biological equivalent dose concept}, pages = {2179}, keywords = {nanomedicine, magnetic hyperthermia, magnetic nanoparticles, iron oxide nanocubes, chemical synthesis, magnetometry, thermometric measurements, micromagnetic simulations, thermal simulations}, misc2 = {EMPIR 2018: Health}, publisher = {MDPI}, language = {30}, ISSN = {2079-4991}, DOI = {10.3390/nano11092179}, stag_bib_extends_levelofaccess = {NA}, author = {Ferrero, R. and Barrera, G. and Celegato, F. and Vicentini, M. and H{\"u}seyin, H. and Yıldız, N. and Atila Din\c{c}er, C. and Co{\"i}sson, M. and Manzin, A. and Tiberto, P.} } @Article { SmithHKWPSDS2021, subid = {2242}, title = {High precision integrated photonic thermometry enabled by a transfer printed diamond resonator on GaN waveguide chip}, journal = {Optics Express}, year = {2021}, month = {8}, day = {25}, volume = {29}, number = {18}, number2 = {17FUN05: PhotOQuant: Photonic and Optomechanical Sensors for Nanoscaled and Quantum Thermometry}, pages = {29095}, keywords = {photonic thermometer, diamond micro-disk resonator}, misc2 = {EMPIR 2017: Fundamental}, publisher = {The Optical Society}, language = {30}, ISSN = {1094-4087}, DOI = {10.1364/OE.433607}, stag_bib_extends_levelofaccess = {NA}, author = {Smith, J.A. and Hill, P. and Klitis, C. and Weituschat, L. and Postigo, P.A. and Sorel, M. and Dawson, M.D. and Strain, M.J.} } @Article { DorstRESS2021, subid = {2170}, title = {Influence of synchronization within a sensor network on machine learning results}, journal = {Journal of Sensors and Sensor Systems}, year = {2021}, month = {8}, day = {24}, volume = {10}, number = {2}, number2 = {17IND12: Met4FoF: Metrology for the Factory of the Future}, pages = {233-245}, keywords = {synchronization, machine learning, sensor network}, web_url = {https://jsss.copernicus.org/articles/10/233/2021/}, misc2 = {EMPIR 2017: Industry}, publisher = {Copernicus GmbH}, language = {30}, ISSN = {2194-878X}, DOI = {10.5194/jsss-10-233-2021}, stag_bib_extends_levelofaccess = {NA}, author = {Dorst, T. and Robin, Y. and Eichst{\"a}dt, S. and Sch{\"u}tze, A. and Schneider, T.} } @Article { SteinKP2021, subid = {2160}, title = {A Unified Theory for 3D Gear and Thread Metrology}, journal = {Applied Sciences}, year = {2021}, month = {8}, day = {19}, volume = {11}, number = {16}, number2 = {19ENG07: Met4Wind: Metrology for enhanced reliability and efficiency of wind energy systems}, pages = {7611}, keywords = {coordinate metrology, gear metrology, thread metrology, helical machine elements, holistic evaluation, areal measurements}, misc2 = {EMPIR 2019: Energy}, publisher = {MDPI AG}, language = {30}, ISSN = {2076-3417}, DOI = {10.3390/app11167611}, stag_bib_extends_levelofaccess = {NA}, author = {Stein, M. and Keller, F. and Przyklenk, A.} } @Article { SilemekSPHPSRIW2021, subid = {2173}, title = {Rapid safety assessment and mitigation of radiofrequency induced implant heating using small root mean square sensors and the sensor matrix Q s}, journal = {Magnetic Resonance in Medicine}, year = {2021}, month = {8}, day = {16}, number2 = {17IND01: MIMAS: Procedures allowing medical implant manufacturers to demonstrate compliance with MRI safety regulations}, keywords = {magnetic resonance imaging, MR safety, implant safety, parallel transmission, sensor-equipped implants, rms sensors}, web_url = {https://onlinelibrary.wiley.com/doi/full/10.1002/mrm.28968}, misc2 = {EMPIR 2017: Industry}, publisher = {Wiley}, language = {30}, ISSN = {0740-3194, 1522-2594}, DOI = {10.1002/mrm.28968}, stag_bib_extends_levelofaccess = {NA}, author = {Silemek, B. and Seifert, F. and Petzold, J. and Hoffmann, W. and Pfeiffer, H. and Speck, O. and Rose, G. and Ittermann, B. and Winter, L.} } @Article { SteenekenDDAv2021, subid = {2239}, title = {Dynamics of 2D material membranes}, journal = {2D Materials}, year = {2021}, month = {8}, day = {12}, volume = {8}, number = {4}, number2 = {17FUN05: PhotOQuant: Photonic and Optomechanical Sensors for Nanoscaled and Quantum Thermometry}, pages = {042001}, keywords = {2D material, dynamics, mechanics, graphene, NEMS}, web_url = {https://arxiv.org/ct?url=https\%3A\%2F\%2Fdx.doi.org\%2F10.1088\%2F2053-1583\%2Fac152c\&v=8246bcbf}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {2053-1583}, DOI = {10.1088/2053-1583/ac152c}, stag_bib_extends_levelofaccess = {NA}, author = {Steeneken, P.G. and Dolleman, R.J. and Davidovikj, D. and Alijani, F. and van der Zant, H.S.J.} } @Article { NagelSDL2021, subid = {2439}, title = {A bi-atrial statistical shape model for large-scale in silico studies of human atria: Model development and application to ECG simulations}, journal = {Medical Image Analysis}, year = {2021}, month = {8}, day = {10}, volume = {Volume 74}, number2 = {18HLT07: MedalCare: Metrology of automated data analysis for cardiac arrhythmia management}, keywords = {Statistical shape modelingBi-atrial shape modelElectrophysiological simulation12-Lead ECGP waves}, web_url = {https://www.sciencedirect.com/science/article/pii/S1361841521002553?via\%3Dihub}, misc2 = {EMPIR 2018: Health}, publisher = {Elsevier}, language = {30}, DOI = {10.1016/j.media.2021.102210}, stag_bib_extends_levelofaccess = {NA}, author = {Nagel, C. and Schuler, S. and D{\"o}ssel, O. and Loewe, A.} } @Article { AhlawatSGTW2021, subid = {2479}, title = {Observation of systematic deviations between Faraday cup aerosol electrometers for varying particle sizes and flowrates—results of the AEROMET FCAE workshop}, journal = {Metrologia}, year = {2021}, month = {8}, day = {5}, volume = {58}, number = {5}, number2 = {16ENV07: AEROMET: Aerosol metrology for atmospheric science and air quality}, pages = {8}, keywords = {Faraday cup aerosol electrometer, CPC calibration, inter-comparison}, web_url = {https://iopscience.iop.org/journal/0026-1394}, misc2 = {EMPIR 2016: Environment}, publisher = {IOP Publishing Ltd}, language = {30}, ISSN = {1681-7575}, DOI = {10.1088/1681-7575/ac0710}, stag_bib_extends_levelofaccess = {NA}, author = {Ahlawat, A. and Seeger, S. and Gottschalk, M. and Tuch, T. and Wiedensohler, A.} } @Article { KneeviMBBIKMNNWi2021, subid = {2111}, title = {Investigations into the basic properties of different passive dosimetry systems used in environmental radiation monitoring in the aftermath of a nuclear or radiological event}, journal = {Radiation Measurements}, year = {2021}, month = {8}, volume = {146}, number2 = {16ENV04: Preparedness: Metrology for mobile detection of ionising radiation following a nuclear or radiological incident}, pages = {106615}, keywords = {Passive dosimetry systems, Environmental radiation monitoring, Nuclear or radiological event}, misc2 = {EMPIR 2016: Environment}, publisher = {Elsevier BV}, language = {30}, ISSN = {1350-4487}, DOI = {10.1016/j.radmeas.2021.106615}, stag_bib_extends_levelofaccess = {NA}, author = {Knežević, Ž. and Majer, M. and Baranowska, Z. and Bjelac, O.C. and Iurlaro, G. and Kržanović, N. and Mariotti, F. and Nodilo, M. and Neumaier, S. and Wołoszczuk, K. and Živanović, M.} } @Article { EdlerBGJTAASZ2021, subid = {2137}, title = {Pt-40\%Rh Versus Pt-6\%Rh Thermocouples: An emf-Temperature Reference Function for the Temperature Range 0 \(^{\circ}\)C to 1769 \(^{\circ}\)C}, journal = {International Journal of Thermophysics}, year = {2021}, month = {8}, volume = {42}, number = {11}, number2 = {17IND04: EMPRESS 2: Enhancing process efficiency through improved temperature measurement 2}, pages = {1-13}, keywords = {Noble metal thermocouples, Reference function, Thermoelectric stability and homogeneity}, web_url = {https://link.springer.com/content/pdf/10.1007/s10765-021-02895-w.pdf.}, misc2 = {EMPIR 2017: Industry}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {0195-928X, 1572-9567}, DOI = {10.1007/s10765-021-02895-w}, stag_bib_extends_levelofaccess = {NA}, author = {Edler, F. and Bojkovski, J. and Garcia Izquerdo, C. and Jose Martin, M. and Tucker, D. and Arifovic, N. and Andersen, S.L. and Šindel{\'a}rov{\'a}, L. and Žužek, V.} } @Article { SousaBDFPRM2021, subid = {2153}, title = {Uncertainty calculation methodologies in microflow measurements: Comparison of GUM, GUM-S1 and Bayesian approach}, journal = {Measurement}, year = {2021}, month = {8}, volume = {181}, number2 = {17NRM05: EMUE: Advancing measurement uncertainty - comprehensive examples for key international standards}, pages = {109589}, keywords = {Uncertainty evaluation; Accuracy; Microflow measurement; Syringe pump; Gravimetric method; Bayesian approach}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {Elsevier BV}, language = {30}, ISSN = {0263-2241}, DOI = {10.1016/j.measurement.2021.109589}, stag_bib_extends_levelofaccess = {NA}, author = {Sousa, J.A. and Batista, E. and Demeyer, S. and Fischer, N. and Pellegrino, O. and Ribeiro, A.S. and Martins, L.L.} } @Article { CorcolesYK2021, subid = {2190}, title = {Experimental and numerical optimization modelling to reduce radiofrequency-induced risks of magnetic resonance examinations on leaded implants}, journal = {Applied Mathematical Modelling}, year = {2021}, month = {8}, volume = {96}, number2 = {17IND01: MIMAS: Procedures allowing medical implant manufacturers to demonstrate compliance with MRI safety regulations}, pages = {177-188}, keywords = {MR safety, implant safety, RF induced heating}, misc2 = {EMPIR 2017: Industry}, publisher = {Elsevier BV}, language = {30}, ISSN = {0307-904X}, DOI = {10.1016/j.apm.2021.02.036}, stag_bib_extends_levelofaccess = {NA}, author = {C{\'o}rcoles, J. and Yao, A. and Kuster, N.} } @Article { uekB2021, subid = {2280}, title = {Miniature iron-carbon eutectic point crucible for the calibration of thermometers}, journal = {Measurement}, year = {2021}, month = {8}, volume = {181}, number2 = {17IND04: EMPRESS 2: Enhancing process efficiency through improved temperature measurement 2}, pages = {109619}, keywords = {temperature, calibration, melting point, iron-carbon eutectic, crucible}, misc2 = {EMPIR 2017: Industry}, publisher = {Elsevier BV}, language = {30}, ISSN = {0263-2241}, DOI = {10.1016/j.measurement.2021.109619}, stag_bib_extends_levelofaccess = {NA}, author = {Žužek, V. and Bojkovski, J.} } @Article { BatistaG2021, subid = {2278}, title = {Improving infusion dosing accuracy for patient safety}, journal = {European Pharmaceutical Review}, year = {2021}, month = {8}, volume = {26}, number = {4}, number2 = {18HLT08: MEDDII: Metrology for drug delivery}, pages = {8-10}, keywords = {Drug deliverPatient safetyInfusion errors}, web_url = {https://www.europeanpharmaceuticalreview.com/article/160985/european-pharmaceutical-review-issue-4-2021/}, misc2 = {EMPIR 2018: Health}, publisher = {Russell Publishing}, language = {30}, ISSN = {1360-8606}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {ISSN 1360-8606}, author = {Batista, E. and Graham, E.} } @Article { BillasBOD2021, subid = {2316}, title = {Traceable reference dosimetry in MRI guided radiotherapy using alanine: calibration and magnetic field correction factors of ionisation chambers}, journal = {Physics in Medicine \& Biology}, year = {2021}, month = {8}, volume = {66}, number = {16}, number2 = {19NRM01: MRgRT-DOS: Traceable dosimetry for small fields in MR-guided radiotherapy}, pages = {165006}, keywords = {MRI-linac, magnetic field, traceable reference dosimetry, magnetic field correction factors, alanine dosimetry}, misc2 = {EMPIR 2019: Pre-Co-Normative}, publisher = {IOP Publishing}, language = {30}, ISSN = {0031-9155, 1361-6560}, DOI = {10.1088/1361-6560/ac0680}, stag_bib_extends_levelofaccess = {NA}, author = {Billas, I. and Bouchard, H. and Oelfke, U. and Duane, S.} } @Article { GallianaCR2021, subid = {2333}, title = {Towards a traceable divider for composite voltage waveforms below 1 kV}, journal = {Electrical Engineering}, year = {2021}, month = {8}, number2 = {19NRM07: HV-com²: Support for standardisation of high voltage testing with composite and combined wave shapes}, keywords = {Voltage divider · Composite and combined voltages · Traceability · Scale factor calibration · Step response ·Measurement uncertainty}, misc2 = {EMPIR 2019: Pre-Co-Normative}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {0948-7921, 1432-0487}, DOI = {10.1007/s00202-021-01368-5}, stag_bib_extends_levelofaccess = {NA}, author = {Galliana, F. and Caria, S.E. and Roccato, P.E.} } @Article { ViereckKNP2021, subid = {2418}, title = {MEMS-Based Cantilever Sensor for Simultaneous Measurement of Mass and Magnetic Moment of Magnetic Particles}, journal = {Chemosensors 2021}, year = {2021}, month = {8}, volume = {9}, number = {207}, number2 = {17IND05: MicroProbes: Multifunctional ultrafast microprobes for on-the-machine measurements}, keywords = {cantilever, resonant frequency, mass, magnetic moment, magnetic force gradient, magneticparticles}, web_url = {https://www.mdpi.com/2227-9040/9/8/207}, misc2 = {EMPIR 2017: Industry}, publisher = {MDPI}, language = {30}, DOI = {10.3390/chemosensors9080207}, stag_bib_extends_levelofaccess = {NA}, author = {Viereck, T. and Kahmann, T. and Nyang’au, W.O. and Peiner, E.} } @Proceedings { deGrootCSCL2021_2, subid = {2433}, title = {Fourier optics modelling of coherence scanning interferometers}, journal = {Applied Optical Metrology IV - Proc. of SPIE}, year = {2021}, month = {8}, volume = {11817}, number2 = {20IND07: TracOptic: Traceable industrial 3D roughness and dimensional measurement using optical 3D microscopy and optical distance sensors}, pages = {118170M}, keywords = {Interferometry, interferometer, metrology, topography, CSI, Fourier optics}, web_url = {https://repository.lboro.ac.uk/articles/conference_contribution/Fourier_optics_modelling_of_coherence_scanning_interferometers/16948690}, misc2 = {EMPIR 2020: Industry}, event_place = {San Diego, California}, event_name = {SPIE Optical Engineering + Applications}, event_date = {01-08-2021 to 05-08-2021}, language = {30}, DOI = {10.1117/12.2595668}, stag_bib_extends_levelofaccess = {NA}, author = {de Groot, P. and Colonna de Lega, X. and Su, R. and Coupland, J. and Leach, R.} } @Article { FuchsJKMB2021, subid = {2508}, title = {A cavity-based optical antenna for color centers in diamond}, journal = {APL Photonics}, year = {2021}, month = {8}, volume = {6}, number = {8}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {086102}, keywords = {color centres, diamond, optical antenna, single-photon source}, web_url = {https://aip.scitation.org/doi/10.1063/5.0057161}, misc2 = {EMPIR 2017: Fundamental}, publisher = {AIP Publishing}, language = {30}, ISSN = {2378-0967}, DOI = {10.1063/5.0057161}, stag_bib_extends_levelofaccess = {NA}, author = {Fuchs, P. and Jung, T. and Kieschnick, M. and Meijer, J. and Becher, C.} } @Article { HodoroabaHPMDT2021, subid = {2142}, title = {Nanoparticle size, shape, and concentration measurement at once – two VAMAS pre-standardization projects ready to start}, journal = {Microscopy and Microanalysis}, year = {2021}, month = {7}, day = {30}, volume = {27}, number = {S1}, number2 = {17NRM04: nPSize: Improved traceability chain of nanoparticle size measurements}, pages = {2250-2251}, keywords = {Electron microscopy, Inter-laboratory comparison, Nanoparticles, SiO2, TiO2, VAMAS}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {Cambridge University Press (CUP)}, language = {30}, ISSN = {1431-9276, 1435-8115}, DOI = {10.1017/S1431927621008126}, stag_bib_extends_levelofaccess = {NA}, author = {Hodoroaba, V-D. and H{\"o}renz, C. and Pellegrino, F. and Maurino, V. and Durand, B. and Tache, O.} } @Article { BarrattRCSKE2021, subid = {2167}, title = {Asymmetric arms maximize visibility in hot-electron interferometers}, journal = {Physical Review B}, year = {2021}, month = {7}, day = {30}, volume = {104}, number = {3}, number2 = {17FUN04: SEQUOIA: Single-electron quantum optics for quantum-enhanced measurements}, pages = {035436}, keywords = {single electrons, electron interferometry, quantum transport, electron quantum optics}, web_url = {https://arxiv.org/abs/2104.01653}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2469-9950, 2469-9969}, DOI = {10.1103/PhysRevB.104.035436}, stag_bib_extends_levelofaccess = {NA}, author = {Barratt, C.J. and Ryu, S. and Clark, L.A. and Sim, H.-S. and Kataoka, M. and Emary, C.} } @Article { FogliettaPGBPDTSC2021, subid = {2264}, title = {Sonodynamic Treatment Induces Selective Killing of Cancer Cells in an In Vitro Co-Culture Model}, journal = {Cancers}, year = {2021}, month = {7}, day = {30}, volume = {13}, number = {15}, number2 = {18HLT06: RaCHy: Radiotherapy coupled with hyperthermia - adapting the biological equivalent dose concept}, pages = {3852}, keywords = {ultrasound; sonodynamic therapy; cancer cells; membrane fluidity}, misc2 = {EMPIR 2018: Health}, publisher = {MDPI AG}, language = {30}, ISSN = {2072-6694}, DOI = {10.3390/cancers13153852}, stag_bib_extends_levelofaccess = {NA}, author = {Foglietta, F. and Pinnelli, V. and Giuntini, F. and Barbero, N. and Panzanelli, P. and Durando, G. and Terreno, E. and Serpe, L. and Canaparo, R.} } @Article { RadtkeCKLSDAHNVRQLDBUL2021, subid = {2285}, title = {A unified pH scale for all solvents: part I – intention and reasoning (IUPAC Technical Report)}, journal = {Pure and Applied Chemistry}, year = {2021}, month = {7}, day = {30}, volume = {93}, number = {9}, number2 = {17FUN09: UnipHied: Realisation of a Unified pH Scale}, pages = {1049-1060}, keywords = {Chemical potential; differential potentiometry; intersolvental;liquid junction potential; pH; traceability}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Walter de Gruyter GmbH}, language = {30}, ISSN = {0033-4545, 1365-3075}, DOI = {10.1515/pac-2019-0504}, stag_bib_extends_levelofaccess = {NA}, author = {Radtke, V. and Cam{\~o}es, F. and Krossing, I. and Leito, I. and Stoica, D. and Deleebeeck, L. and Anes, B. and Heering, A. and N{\"a}ykki, T. and Veltz{\'e}, S. and Rozikov{\'a}, M. and Quendera, R. and Liv, L. and D{\'a}niel, N. and Bastkowski, F. and Uysal, E. and Lawrence, N.} } @Article { MilanoLLBRV2021, subid = {2236}, title = {Structure‐Dependent Influence of Moisture on Resistive Switching Behavior of ZnO Thin Films}, journal = {Advanced Materials Interfaces}, year = {2021}, month = {7}, day = {28}, volume = {8}, number = {16}, number2 = {20FUN06: MEMQuD: Memristive devices as quantum standard for nanometrology}, pages = {2100915}, keywords = {effect of moisture on electroforming, electrical conductivity, memristors, nanostructures, resistive switching}, web_url = {https://onlinelibrary.wiley.com/doi/10.1002/admi.202100915}, misc2 = {EMPIR 2020: Fundamental}, publisher = {Wiley}, language = {30}, ISSN = {2196-7350, 2196-7350}, DOI = {10.1002/admi.202100915}, stag_bib_extends_levelofaccess = {NA}, author = {Milano, G. and Luebben, M. and Laurenti, M. and Boarino, L. and Ricciardi, C. and Valov, I.} } @Article { SilvaniKTC2021, subid = {2426}, title = {Impact of the interfacial Dzyaloshinskii-Moriya interaction on the band structure of one-dimensional artificial magnonic crystals: a micromagnetic study}, journal = {Journal of Magnetism and magnetic Materials}, year = {2021}, month = {7}, day = {27}, volume = {539}, number2 = {17FUN08: TOPS: Metrology for topological spin structures}, pages = {168342}, keywords = {Magnonic Crystals, spin waves, DMI}, web_url = {https://doi.org/10.1016/j.jmmm.2021.168342}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Elsevier}, language = {30}, ISSN = {0304-8853}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://arxiv.org/abs/2112.05360}, author = {Silvani, R. and Kuepferling, M. and Tacchi, S. and Carlotti, G.} } @Article { DosselLNL2021, subid = {2441}, title = {Computer Modeling of the Heart for ECG Interpretation—A Review}, journal = {Hearts}, year = {2021}, month = {7}, day = {26}, number = {The Applic}, number2 = {18HLT07: MedalCare: Metrology of automated data analysis for cardiac arrhythmia management}, keywords = {in silico; electrophysiology; electrocardiogram; ECG; cardiac disease; arrhythmia; ischemia}, web_url = {https://www.mdpi.com/2673-3846/2/3/28/htm}, misc2 = {EMPIR 2018: Health}, publisher = {MDPI}, language = {30}, DOI = {10.3390/hearts2030028}, stag_bib_extends_levelofaccess = {NA}, author = {D{\"o}ssel, O. and Luongo, G. and Nagel, C. and Loewe, A.} } @Article { RibeiroACSMLBSS2021, subid = {2198}, title = {Role of measurement uncertainty in the comparison of average areal rainfall methods}, journal = {Metrologia}, year = {2021}, month = {7}, day = {23}, volume = {58}, number = {4}, number2 = {17NRM05: EMUE: Advancing measurement uncertainty - comprehensive examples for key international standards}, pages = {044001}, keywords = {measurement uncertainty, rainfall, precipitation, estimating, arithmetic mean method, Thiessen polygon method, isohyetal method}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {IOP Publishing}, address = {Bristol, United Kingdom}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/ac0d49}, stag_bib_extends_levelofaccess = {NA}, author = {Ribeiro, A.S. and Almeida, M.C. and Cox, M.G. and Sousa, J.A. and Martins, L. and Loureiro, D. and Brito, R. and Silva, M. and Soares, A.C.} } @Article { TranGiaDFRCFFFGHJKLMSSGTWBBBBCCCCDDGHKKLMMSSSSVWL2021, subid = {2260}, title = {A multicentre and multi-national evaluation of the accuracy of quantitative Lu-177 SPECT/CT imaging performed within the MRTDosimetry project}, journal = {EJNMMI Physics}, year = {2021}, month = {7}, day = {23}, volume = {8}, number = {1}, number2 = {15HLT06: MRTDosimetry: Metrology for clinical implementation of dosimetry in molecular radiotherapy}, keywords = {Quantitative SPECT/CT, 177Lu SPECT/CT imaging, Standardization ofSPECT/CT imaging, Harmonization of SPECT/CT imaging, International multicentercomparison exercise, Traceability of SPECT/CT imaging, Molecular radiotherapy(MRT), 3D printing, Phantom}, misc2 = {EMPIR 2015: Health}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2197-7364}, DOI = {10.1186/s40658-021-00397-0}, stag_bib_extends_levelofaccess = {NA}, author = {Tran-Gia, J. and Denis-Bacelar, A.M. and Ferreira, K.M. and Robinson, A.P. and Calvert, N. and Fenwick, A.J. and Finocchiaro, D. and Fioroni, F. and Grassi, E. and Heetun, W. and Jewitt, S.J. and Kotzassarlidou, M. and Ljungberg, M. and McGowan, D.R. and Scott, N. and Scuffham, J. and Gleisner, K.S. and Tipping, J. and Wevrett, J. and Bardi{\`e}s, M. and Berenato, S. and Bilas, I. and Bobin, C. and Capogni, M. and Chauvin, M. and COLLINS, S. and Cox, M. and Dabin, J. and D’Arienzo, M. and Gustafsson, J. and Hallam, A. and Kalathas, T. and Kayal, G. and Lorusso, G. and Maringer, F-J. and Morgan, D. and Smyth, V. and Solc, J. and Štemberkov{\'a}, L. and Struelens, L. and Vergara-Gil, A. and Wiedner, H. and Lassmann, M.} } @Article { NaftalyG2021, subid = {2157}, title = {Terahertz and Microwave Optical Properties of Single-Crystal Quartz and Vitreous Silica and the Behavior of the Boson Peak}, journal = {Applied Sciences}, year = {2021}, month = {7}, day = {22}, volume = {11}, number = {15}, number2 = {18SIB09: TEMMT: Traceability for electrical measurements at millimetre-wave and terahertz frequencies for communications and electronics technologies}, pages = {6733}, keywords = {single-crystal quartz; silica glass; complex permittivity; terahertz; microwave; Boson peak}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {MDPI AG}, language = {30}, ISSN = {2076-3417}, DOI = {10.3390/app11156733}, stag_bib_extends_levelofaccess = {NA}, author = {Naftaly, M. and Gregory, A.} } @Article { GaiserF2021, subid = {2750}, title = {Primary thermometry at 4 K, 14 K, and 25 K applying dielectric-constant gas thermometry}, journal = {Metrologia}, year = {2021}, month = {7}, day = {22}, volume = {58}, number = {4}, number2 = {18SIB02: Real-K: Realising the redefined kelvin}, pages = {042101}, keywords = {Primary thermometry, dielectric-constant, gas thermometry}, web_url = {https://iopscience.iop.org/article/10.1088/1681-7575/ac0d4a}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/ac0d4a}, stag_bib_extends_levelofaccess = {NA}, author = {Gaiser, C. and Fellmuth, B.} } @Article { NissilaFKMIJBKKOBMGK2021, subid = {2138}, title = {Driving a low critical current Josephson junction array with a mode-locked laser}, journal = {Applied Physics Letters}, year = {2021}, month = {7}, day = {19}, volume = {119}, number = {3}, number2 = {15SIB04: QuADC: Waveform metrology based on spectrally pure Josephson voltages}, pages = {032601}, keywords = {Josephson voltage standard, Josephson effect, Superconducting device, Laser, Photodiode}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {AIP Publishing}, language = {30}, ISSN = {0003-6951, 1077-3118}, DOI = {10.1063/5.0060804}, stag_bib_extends_levelofaccess = {NA}, author = {Nissil{\"a}, J. and Fordell, T. and Kohop{\"a}{\"a}, K. and Mykk{\"a}nen, E. and Immonen, P. and Jabdaraghi, R.N. and Bardalen, E. and Kieler, O. and Karlsen, B. and {\O}hlckers, P.A. and Behr, R. and Manninen, A.J. and Govenius, J. and Kemppinen, A.} } @Proceedings { TeichelLW2021, subid = {2355}, title = {Assessing Time Transfer Methods for Accuracy and Reliability: Navigating the Time Transfer Trade-off Triangle}, journal = {2021 Joint Conference of the European Frequency and Time Forum and IEEE International Frequency Control Symposium (EFTF/IFCS)}, year = {2021}, month = {7}, day = {17}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, keywords = {time transfer techniques, synchronization techniques, NTP, Network Time Security, assessment, accuracy, evaluation}, web_url = {https://oar.ptb.de/resources/show/10.7795/820.20211123K}, misc2 = {EMPIR 2017: Industry}, publisher = {IEEE}, event_place = {Online}, event_name = {2021 Joint Conference of the European Frequency and Time Forum and IEEE International Frequency Control Symposium (EFTF/IFCS)}, event_date = {07-07-2021 to 17-07-2021}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {10.7795/820.20211123K}, author = {Teichel, K. and Lehtonen, T. and Wallin, A.} } @Article { ChinchellaCSL2021, subid = {2393}, title = {Investigation of the Wind-Induced Airflow Pattern Near the Thies LPM Precipitation Gauge}, journal = {Sensors}, year = {2021}, month = {7}, day = {17}, volume = {21}, number = {14}, number2 = {18NRM03: INCIPIT: Calibration and accuracy of non-catching instruments to measure liquid/solid atmospheric precipitation}, pages = {4880}, keywords = {precipitation, measurement, non-catching gauges, wind induced bias, computational fluid dynamics, wind tunnel, disdrometer}, web_url = {https://www.mdpi.com/1424-8220/21/14/4880}, misc2 = {EMPIR 2018: Pre-Co-Normative}, publisher = {MDPI}, language = {30}, ISSN = {14248220}, DOI = {10.3390/s21144880}, stag_bib_extends_levelofaccess = {NA}, author = {Chinchella, E. and Cauteruccio, A. and Stagnaro, M. and Lanza, L.G.} } @Article { tenHaveAHPMSL2021, subid = {2120}, title = {Estimation of Static Energy Meter Interference in Waveforms Obtained in On-Site Scenarios}, journal = {IEEE Transactions on Electromagnetic Compatibility}, year = {2021}, month = {7}, day = {12}, volume = {1}, number = {1}, number2 = {17NRM02: MeterEMI: Electromagnetic Interference on Static Electricity Meters}, pages = {1-8}, keywords = {Electromagnetic interference (EMI), nonlinear waveforms, on-site survey, static energy meters, time domain.}, tags = {SEG}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9375, 1558-187X}, DOI = {10.1109/TEMC.2021.3089877}, stag_bib_extends_levelofaccess = {NA}, author = {ten Have, B. and Azpurua, M.A. and Hartman, T. and Pous, M. and Moonen, N. and Silva, F. and Leferink, F.} } @Article { CrouzierDDASH2021, subid = {2045}, title = {Influence of electron landing energy on the measurement of the dimensional properties of nanoparticle populations imaged by SEM}, journal = {Ultramicroscopy}, year = {2021}, month = {7}, volume = {226}, number = {July}, number2 = {17NRM04: nPSize: Improved traceability chain of nanoparticle size measurements}, pages = {113300}, keywords = {SEMElectron landing energyNanoparticlesDimensional propertiesMetrology}, web_url = {https://reader.elsevier.com/reader/sd/pii/S0304399121000875?token=909C79CE3C3F38B3A66DB9C19F03753326F07A8C27AA6D2752B29C970B6044F466C12F79E394D396CE7598E6F1497E2E\&originRegion=eu-west-1\&originCreation=20210517160957}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {Elsevier BV}, language = {30}, ISSN = {0304-3991}, DOI = {10.1016/j.ultramic.2021.113300}, stag_bib_extends_levelofaccess = {NA}, author = {Crouzier, L. and Delvall{\'e}e, A. and Devoille, L. and Artous, S. and Saint-Antonin, F. and Feltin, N.} } @Article { SilanderFZZA2021, subid = {2110}, title = {Optical realization of the pascal—Characterization of two gas modulated refractometers}, journal = {Journal of Vacuum Science \& Technology B}, year = {2021}, month = {7}, volume = {39}, number = {4}, number2 = {18SIB04: QuantumPascal: Towards quantum-based realisations of the pascal}, pages = {044201}, keywords = {Refractomtery, Fabry-Perot cavity, GAMOR, Accuracy}, web_url = {https://avs.scitation.org/doi/10.1116/6.0001042}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {American Vacuum Society}, language = {30}, ISSN = {2166-2746, 2166-2754}, DOI = {10.1116/6.0001042}, stag_bib_extends_levelofaccess = {NA}, author = {Silander, I. and Forss{\'e}n, C. and Zakrisson, J. and Zelan, M. and Axner, O.} } @Article { VargasCMRPLNSL2021, subid = {2114}, title = {Comparison of airborne radiation detectors carried by rotary-wing unmanned aerial systems}, journal = {Radiation Measurements}, year = {2021}, month = {7}, volume = {145}, number2 = {16ENV04: Preparedness: Metrology for mobile detection of ionising radiation following a nuclear or radiological incident}, pages = {106595}, keywords = {Airborne radiological detectorUnmanned aerial systemEnvironmental radioactivity mappingSource localization}, misc2 = {EMPIR 2016: Environment}, publisher = {Elsevier BV}, language = {30}, ISSN = {1350-4487}, DOI = {10.1016/j.radmeas.2021.106595}, stag_bib_extends_levelofaccess = {NA}, author = {Vargas, A. and Costa, D. and Macias, M. and Royo, P. and Pastor, E. and Luchkov, M. and Neumaier, S. and St{\"o}hlker, U. and Luff, R.} } @Article { KruskopfBPCPREPPGS2021, subid = {2113}, title = {Graphene Quantum Hall Effect Devices for AC and DC Electrical Metrology}, journal = {IEEE Transactions on Electron Devices}, year = {2021}, month = {7}, volume = {68}, number = {7}, number2 = {18SIB07: GIQS: Graphene impedance quantum standard}, pages = {3672-3677}, keywords = {Alternating current, dissipation factor,double-shield, epitaxial graphene, magnetocapacitance,magnetotransport, precision measurements, quantized Hallresistance (QHR) standards, quantum Hall effect (QHE),superconducting contacts}, web_url = {https://ieeexplore.ieee.org/document/9446081}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9383, 1557-9646}, DOI = {10.1109/TED.2021.3082809}, stag_bib_extends_levelofaccess = {NA}, author = {Kruskopf, M. and Bauer, S. and Pimsut, Y. and Chatterjee, A. and Patel, D.K. and Rigosi, A.F. and Elmquist, R.E. and Pierz, K. and Pesel, E. and G{\"o}tz, M. and Schurr, J.} } @Article { NeasK2021, subid = {2117}, title = {Synthetic Data in Quantitative Scanning Probe Microscopy}, journal = {Nanomaterials}, year = {2021}, month = {7}, volume = {11}, number = {7}, number2 = {19ENG05: NanoWires: High throughput metrology for nanowire energy harvesting devices}, pages = {1746}, keywords = {nanometrology; data synthesis; scanning probe microscopy}, web_url = {https://www.mdpi.com/2079-4991/11/7/1746}, misc2 = {EMPIR 2019: Energy}, publisher = {MDPI AG}, language = {30}, ISSN = {2079-4991}, DOI = {10.3390/nano11071746}, stag_bib_extends_levelofaccess = {NA}, author = {Nečas, D. and Klapetek, P.} } @Techreport { KlingKRBRBS2021, subid = {2126}, title = {Specifications and testing strategies for measurement devices for noise exposure determination in the infrasound frequency range}, journal = {PTB Open Access Repository}, year = {2021}, month = {7}, volume = {n. a.}, number = {n. a.}, number2 = {19ENV03: Infra-AUV: Metrology for low-frequency sound and vibration}, pages = {20210609}, keywords = {Sound level meters, Infrasound, Type approval, Noise exposure}, web_url = {https://oar.ptb.de/resources/show/10.7795/EMPIR.19ENV03.RE.20210609}, misc2 = {EMPIR 2019: Environment}, publisher = {PTB}, language = {30}, ISBN = {n. a.}, ISSN = {n. a.}, DOI = {10.7795/EMPIR.19ENV03.RE.20210609}, stag_bib_extends_levelofaccess = {NA}, author = {Kling, C. and Koch, C. and Rust, M. and Barham, R. and Rodrigues, D. and Barrera Figueroa, S. and Sandermann Olsen, E.} } @Article { AxnerFSZZ2021, subid = {2135}, title = {Ability of gas modulation to reduce the pickup of drifts in refractometry}, journal = {Journal of the Optical Society of America B}, year = {2021}, month = {7}, volume = {38}, number = {8}, number2 = {18SIB04: QuantumPascal: Towards quantum-based realisations of the pascal}, pages = {2419-2436}, keywords = {Refractometry, Pascal, Pressure, Fabry-Perot cavity, Gas modulation, GAMOR, drifts,}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {The Optical Society of America}, language = {30}, ISSN = {0740-3224, 1520-8540}, DOI = {10.1364/JOSAB.420982}, stag_bib_extends_levelofaccess = {NA}, author = {Axner, O. and Forss{\'e}n, C. and Silander, I. and Zakrisson, J. and Zelan, M.} } @Article { ZeliKG2021, subid = {2303}, title = {Derivation of Transmission Line Model from the Concentrated Solution Theory (CST) for Porous Electrodes}, journal = {Journal of The Electrochemical Society}, year = {2021}, month = {7}, volume = {168}, number = {7}, number2 = {17IND10: LiBforSecUse: Quality assessment of electric vehicle Li-ion batteries for second use applications}, pages = {070543}, keywords = {transmission line model, concentrated solution theory, electrochemical cell, porous electrodes, batteries}, misc2 = {EMPIR 2017: Industry}, publisher = {The Electrochemical Society}, language = {30}, ISSN = {0013-4651, 1945-7111}, DOI = {10.1149/1945-7111/ac1314}, stag_bib_extends_levelofaccess = {NA}, author = {Zelič, K. and Katrašnik, T. and Gaberšček, M.} } @Proceedings { ed6f2ecb2b2021, subid = {2334}, title = {Assessing Time Transfer Methods for Accuracy and Reliability : Navigating the Time Transfer Trade-off Triangle}, journal = {2021 Joint Conference of the European Frequency and Time Forum and IEEE International Frequency Control Symposium (EFTF/IFCS)}, year = {2021}, month = {7}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, keywords = {time transfer, technological assessment, security, accuracy, effort, pre-deployment evaluation}, web_url = {https://oar.ptb.de/resources/show/10.7795/820.20211123K}, misc2 = {EMPIR 2017: Industry}, publisher = {IEEE}, event_place = {Gainesville, FL, USA}, event_name = {2021 Joint Conference of the European Frequency and Time Forum and IEEE International Frequency Control Symposium (EFTF/IFCS)}, event_date = {07-07-2021 to 17-07-2021}, language = {30}, DOI = {10.1109/EFTF/IFCS52194.2021.9604300}, stag_bib_extends_levelofaccess = {NA} } @Article { GeorgievaLHKKRRK2021, subid = {2504}, title = {Absolute calibration of a single-photon avalanche detector using a bright triggered single-photon source based on an InGaAs quantum dot}, journal = {Optics Express}, year = {2021}, month = {7}, volume = {29}, number = {15}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {23500}, keywords = {calibration, single-photon avalanche detector, triggered single-photon source, InGaAs quantum dot}, web_url = {https://opg.optica.org/oe/fulltext.cfm?uri=oe-29-15-23500\&id=453180}, misc2 = {EMPIR 2017: Fundamental}, publisher = {The Optical Society}, language = {30}, ISSN = {1094-4087}, DOI = {10.1364/OE.430680}, stag_bib_extends_levelofaccess = {NA}, author = {Georgieva, H. and L{\'o}pez, M. and Hofer, H. and Kanold, N. and Kaganskiy, A. and Rodt, S. and Reitzenstein, S. and K{\"u}ck, S.} } @Article { PanSZGPIGMGP2021, subid = {2715}, title = {Acoustic measurement of the triple point of neon T Ne and thermodynamic calibration of a transfer standard for accurate cryogenic thermometry}, journal = {Metrologia}, year = {2021}, month = {7}, volume = {58}, number = {4}, number2 = {18SIB02: Real-K: Realising the redefined kelvin}, pages = {045006}, keywords = {Acoustic measurement, triple point of neon}, web_url = {https://iopscience.iop.org/article/10.1088/1681-7575/ac0711}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/ac0711}, stag_bib_extends_levelofaccess = {NA}, author = {Pan, C. and Sparasci, F. and Zhang, H. and Gambette, P. and Plimmer, M. and Imbraguglio, D. and Gavioso, R.M. and Moldover, M.R. and Gao, B. and Pitre, L.} } @Article { ZhangWLLWYLSC2021, subid = {2737}, title = {Rabi Spectroscopy and Sensitivity of a Floquet Engineered Optical Lattice Clock}, journal = {Chinese Physics Letters}, year = {2021}, month = {7}, volume = {38}, number = {7}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, pages = {073201}, keywords = {Floquet, lattice clock, Rabi spectroscopy}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {0256-307X, 1741-3540}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://arxiv.org/pdf/2007.00851.pdf}, author = {Zhang, X-F. and Wang, Y-B. and Li, T. and Lu, X-T. and Wang, T. and Yin, M-J. and Li, W-D. and Smerzi, A. and Chang, H.} } @Article { ZhangWLLWYLSC2021_2, subid = {2737}, title = {Rabi Spectroscopy and Sensitivity of a Floquet Engineered Optical Lattice Clock}, journal = {Chinese Physics Letters}, year = {2021}, month = {7}, volume = {38}, number = {7}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, pages = {073201}, keywords = {Floquet, lattice clock, Rabi spectroscopy}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {0256-307X, 1741-3540}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://arxiv.org/pdf/2007.00851.pdf}, author = {Zhang, X-F. and Wang, Y-B. and Li, T. and Lu, X-T. and Wang, T. and Yin, M-J. and Li, W-D. and Smerzi, A. and Chang, H.} } @Article { MarzanoTDSEOPKC2021, subid = {2115}, title = {Design and development of a coaxial cryogenic probe for precision measurements of the quantum Hall effect in the AC regime}, journal = {ACTA IMEKO}, year = {2021}, month = {6}, day = {29}, volume = {10}, number = {2}, number2 = {18SIB07: GIQS: Graphene impedance quantum standard}, pages = {24}, keywords = {Quantum Hall effect, Metrology, Impedance, Graphene, Cryogenic probe}, web_url = {https://acta.imeko.org/index.php/acta-imeko/article/view/IMEKO-ACTA-10\%20\%282021\%29-02-05}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IMEKO International Measurement Confederation}, language = {30}, ISSN = {2221-870X}, DOI = {10.21014/acta_imeko.v10i2.925}, stag_bib_extends_levelofaccess = {NA}, author = {Marzano, M. and Tran, N.T.M. and D'Elia, V. and Serazio, D. and Enrico, E. and Ortolano, M. and Pierz, K. and Kucera, J. and Callegaro, L.} } @Article { AmerWJA2021, subid = {2343}, title = {Evaluation of Shock Tube Retrofitted with Fast-Opening Valve for Dynamic Pressure Calibration}, journal = {Sensors}, year = {2021}, month = {6}, day = {29}, volume = {21}, number = {13}, number2 = {17IND07: DynPT: Development of measurement and calibration techniques for dynamic pressures and temperatures}, pages = {4470}, keywords = {dynamic pressure, shock tube, fast-opening valve, repeatability}, web_url = {https://www.mdpi.com/1424-8220/21/13/4470}, misc2 = {EMPIR 2017: Industry}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s21134470}, stag_bib_extends_levelofaccess = {NA}, author = {Amer, E. and Wozniak, M. and J{\"o}nsson, G. and Arrh{\'e}n, F.} } @Article { SaccoPGR2021, subid = {2618}, title = {Graphene edge method for three‐dimensional probing of Raman microscopes focal volumes}, journal = {Journal of Raman Spectroscopy}, year = {2021}, month = {6}, day = {23}, volume = {52}, number = {10}, number2 = {19NRM04: ISO-G-SCoPe: Standardisation of structural and chemical properties of graphene}, pages = {1671-1684}, keywords = {Raman spectroscopy, Metrology, graphene, graphene edge, confocal volume, focal volume, Raman quantification}, web_url = {https://analyticalsciencejournals.onlinelibrary.wiley.com/doi/10.1002/jrs.6187}, misc2 = {EMPIR 2019: Pre-Co-Normative}, publisher = {Wiley}, language = {30}, ISSN = {0377-0486, 1097-4555}, DOI = {10.1002/jrs.6187}, stag_bib_extends_levelofaccess = {NA}, author = {Sacco, A. and Portesi, C. and Giovannozzi, A.M. and Rossi, A.M.} } @Article { Milosevi2021, subid = {2107}, title = {Application of the subsecond calorimetry technique with both contact and radiance temperature measurements: case study on solid phase tungsten at very high temperatures}, journal = {Journal of Thermal Analysis and Calorimetry}, year = {2021}, month = {6}, day = {21}, number2 = {17IND11: Hi-TRACE: Industrial process optimisation through improved metrology of thermophysical properties}, keywords = {Specific heat, Specific electrical resistivity, Total hemispherical emissivity, Normal spectral emissivity, Hightemperatures, Subsecond calorimetry technique}, misc2 = {EMPIR 2017: Industry}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {1388-6150, 1588-2926}, DOI = {10.1007/s10973-021-10866-4}, stag_bib_extends_levelofaccess = {NA}, author = {Milošević, N.D.} } @Article { PrzyklenkBOEYAFPZCMRB2021, subid = {2104}, title = {New European Metrology Network for Advanced Manufacturing}, journal = {Measurement Science and Technology}, year = {2021}, month = {6}, day = {21}, number2 = {19NET01: AdvManuNet: Support for a European Metrology Network on advanced manufacturing}, keywords = {Advance Manufacturing, Metrology, European Metrology Networks (EMN), Strategic Research Agenda (SRA), Stakeholder}, misc2 = {EMPIR 2019: Support for Networks}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-0233, 1361-6501}, DOI = {10.1088/1361-6501/ac0d25}, stag_bib_extends_levelofaccess = {NA}, author = {Przyklenk, A. and Balsamo, A. and O'Connor, D. and Evans, A. and Yandayan, T. and Akg{\"o}z, A. and Flys, O. and Phillips, D. and Zelen{\'y}, V. and Czułek, D. and Meli, F. and Ragusa, C. and Bosse, H.} } @Proceedings { DickmannWEKPK2021, subid = {2279}, title = {Heat dynamics in optical ring resonators}, journal = {Modeling Aspects in Optical Metrology VIII}, year = {2021}, month = {6}, day = {20}, volume = {11783}, number = {1178309}, number2 = {17FUN05: PhotOQuant: Photonic and Optomechanical Sensors for Nanoscaled and Quantum Thermometry}, pages = {1-12}, keywords = {optical ring resonators, heat equation, absorption, two-photon absorption, temperature sensing, thermalmodeling}, web_url = {https://www.spiedigitallibrary.org/conference-proceedings-of-spie}, misc2 = {EMPIR 2017: Fundamental}, publisher = {SPIE}, event_place = {on line}, event_name = {SPIE Optical Metrology, 2021}, event_date = {21-06-2021 to 25-06-2021}, language = {30}, DOI = {10.1117/12.2592552}, stag_bib_extends_levelofaccess = {NA}, author = {Dickmann, W. and Weituschat, L. and Eisermann, R. and Krenek, S. and Postigo, P.A. and Kroker, S.} } @Article { TrimMH2021, subid = {2112}, title = {Spectroradiometer spectral calibration, ISRF shapes, and related uncertainties}, journal = {Applied Optics}, year = {2021}, month = {6}, day = {16}, volume = {60}, number = {18}, number2 = {19ENV07: MetEOC-4: Metrology to establish an SI traceable climate observing system}, pages = {5405}, keywords = {Spectroradiometer, spectral calibration, ISRF Shapes, Instrument line shape, slit function}, misc2 = {EMPIR 2019: Environment}, publisher = {The Optical Society}, language = {30}, ISSN = {1559-128X, 2155-3165}, DOI = {10.1364/AO.425676}, stag_bib_extends_levelofaccess = {NA}, author = {Trim, S.A. and Mason, K. and Hueni, A.} } @Article { GajjelaHDSSKBMBK2021, subid = {2614}, title = {Structural and compositional analysis of (InGa)(AsSb)/GaAs/GaP Stranski–Krastanov quantum dots}, journal = {Light: Science \& Applications}, year = {2021}, month = {6}, day = {15}, volume = {10}, number = {1}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {125}, keywords = {Ga)(AsSb)/GaAs/GaP, Stranski–Krastanov, quantum dots}, web_url = {https://www.nature.com/articles/s41377-021-00564-z}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2047-7538}, DOI = {10.1038/s41377-021-00564-z}, stag_bib_extends_levelofaccess = {NA}, author = {Gajjela, R.S.R. and Hendriks, A.L. and Douglas, J.O. and Sala, E.M. and Steindl, P. and Klenovsk{\'y}, P. and Bagot, P.A.J. and Moody, M.P. and Bimberg, D. and Koenraad, P.M.} } @Article { SetionoFDFSSWP2021, subid = {2363}, title = {Performance of an Electrothermal MEMS Cantilever Resonator with Fano-Resonance Annoyance under Cigarette Smoke Exposure}, journal = {Sensors}, year = {2021}, month = {6}, day = {14}, volume = {21}, number = {12}, number2 = {17IND05: MicroProbes: Multifunctional ultrafast microprobes for on-the-machine measurements}, pages = {4088}, keywords = {electrothermal piezoresistive cantilever sensors, parasitic feedthrough subtraction, particle mass concentration measurement, cigarette smoke exposure}, web_url = {https://www.mdpi.com/1424-8220/21/12/4088}, misc2 = {EMPIR 2017: Industry}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s21124088}, stag_bib_extends_levelofaccess = {NA}, author = {Setiono, A. and Fahrbach, M. and Deutschinger, A. and Fantner, E.J. and Schwalb, C.H. and Syamsu, I. and Wasisto, H.S. and Peiner, E.} } @Proceedings { ThompsonRSEHL2021, subid = {2410}, title = {Calibration of X-ray computed tomography for surface topography measurement using metrological characteristics}, journal = {Proceedings 21st euspen International Conference and Exhibition}, year = {2021}, month = {6}, day = {10}, number2 = {17IND08: AdvanCT: Advanced Computed Tomography for dimensional and surface measurements in industry}, keywords = {Metrology, surface topography, metrological characteristics, X-ray computed tomography}, misc2 = {EMPIR 2017: Industry}, event_place = {Online Conference}, event_name = {21st euspen International Conference and Exhibition}, event_date = {07-06-2021 to 10-06-2021}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://www.euspen.eu/knowledge-base/ICE21165.pdf}, author = {Thompson, A. and Rodr{\'i}guez-S{\'a}nchez, {\'A}. and Senin, N. and Eifler, M. and Hering, J. and Leach, R.} } @Article { euchaHSHOiL2021, subid = {1981}, title = {Compact differential plane interferometer with in-axis mirror tilt detection}, journal = {Optics and Lasers in Engineering}, year = {2021}, month = {6}, volume = {141}, number2 = {17IND03: LaVA: Large Volume Metrology Applications}, pages = {106568}, keywords = {Laser interferometryOptical metrologyDimensional measurementCommon path interferometerDifferential interferometerTilt compensationLarge volume metrology}, misc2 = {EMPIR 2017: Industry}, publisher = {Elsevier BV}, language = {30}, ISSN = {0143-8166}, DOI = {10.1016/j.optlaseng.2021.106568}, stag_bib_extends_levelofaccess = {NA}, author = {Rerucha, S. and Hola, M. and Sarbort, M. and Hrabina, J. and Oulehla, J. and Č{\'i}p, O. and Lazar, J.} } @Article { VeenC2021, subid = {2070}, title = {Getting started with uncertainty evaluation using the Monte Carlo method in R}, journal = {Accreditation and Quality Assurance}, year = {2021}, month = {6}, number2 = {17NRM05: EMUE: Advancing measurement uncertainty - comprehensive examples for key international standards}, keywords = {measurement uncertainty, Monte Carlo method, GUM, propagation of distributions, law of propagation of uncertainty, sensitivity coefficient}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {0949-1775, 1432-0517}, DOI = {10.1007/s00769-021-01469-5}, stag_bib_extends_levelofaccess = {NA}, author = {Veen, A.M.H. van der and Cox, M.G.} } @Article { QuNLWH2021, subid = {2094}, title = {Measurements of N2, CO2, Ar, O2 and Air Pressure Broadening Coefficients of the HCl P(5) Line in the 1–0 Band Using an Interband Cascade Laser}, journal = {Applied Sciences}, year = {2021}, month = {6}, volume = {11}, number = {11}, number2 = {16ENV08: IMPRESS 2: Metrology for air pollutant emissions}, pages = {5190}, keywords = {HCl; hydrogen chloride; collisional broadening; laser spectroscopy; TDLAS}, web_url = {https://www.mdpi.com/2076-3417/11/11/5190}, misc2 = {EMPIR 2016: Environment}, publisher = {MDPI AG}, language = {30}, ISSN = {2076-3417}, DOI = {10.3390/app11115190}, stag_bib_extends_levelofaccess = {NA}, author = {Qu, Z. and Nwaboh, J.A. and Li, G. and Werhahn, O. and Hensey, G.} } @Article { SmalesP2021, subid = {2105}, title = {The MOUSE project: a meticulous approach for obtaining traceable, wide-range X-ray scattering information}, journal = {Journal of Instrumentation}, year = {2021}, month = {6}, volume = {16}, number = {06}, number2 = {17NRM04: nPSize: Improved traceability chain of nanoparticle size measurements}, pages = {P06034}, keywords = {Inspection with x-rays; Analysis and statistical methods; Data processing methods;Software architectures (event data models, frameworks and databases)}, web_url = {https://iopscience.iop.org/article/10.1088/1748-0221/16/06/P06034}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {IOP Publishing}, language = {30}, ISSN = {1748-0221}, DOI = {10.1088/1748-0221/16/06/P06034}, stag_bib_extends_levelofaccess = {NA}, author = {Smales, G.J. and Pauw, B.R.} } @Proceedings { SchodelKMTHWSPP2021, subid = {2106}, title = {Design and manufacture of a reference interferometer for long-range distance metrology}, journal = {Proceedings of the euspen 21st International Conference \& Exhibition}, year = {2021}, month = {6}, number2 = {18SIB01: GeoMetre: Large-scale dimensional measurements for geodesy}, pages = {511-512}, keywords = {Geodetic length instrumentation, closed-frame design, thermal and long-term stability, manual positioning system, precision assembly}, misc2 = {EMPIR 2018: SI Broader Scope}, event_place = {Copenhagen, DK}, event_name = {euspen 21st International Conference \& Exhibition}, event_date = {07-06-2021 to 11-06-2021}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://www.euspen.eu/knowledge-base/ICE21222.pdf}, author = {Sch{\"o}del, R. and K{\"o}chert, P. and Meyer, T. and Truong, D. and Huismann, J. and Weinrich, S. and Schmaljohann, F. and Pilarski, F. and Pollinger, F.} } @Proceedings { PrzyklenkBOEYAFZCPMRB2021, subid = {2123}, title = {AdvManuNet: Support for a European Metrology Network for Advanced Manufacturing}, journal = {Proceedings 21st euspen International Conference and Exhibition}, year = {2021}, month = {6}, volume = {2021}, number2 = {19NET01: AdvManuNet: Support for a European Metrology Network on advanced manufacturing}, keywords = {advanced manufacturing, metrology, European metrology networks (EMN), Strategic Research Agenda (SRA), stakeholder, Industry 4.0}, misc2 = {EMPIR 2019: Support for Networks}, event_place = {Online Conference}, event_name = {21st euspen International Conference and Exhibition}, event_date = {07-06-2021 to 10-06-2021}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://www.euspen.eu/knowledge-base//ICE21292.pdf}, author = {Przyklenk, A. and Balsamo, A. and O’Connor, D. and Evans, A. and Yandayan, T. and Akg{\"o}z, S. and Flys, O. and Zelen{\'y}, V. and Czułek, D. and Phillips, D. and Meli, F. and Ragusa, C. and Bosse, H.} } @Article { DorosinskiySHL2021, subid = {2121}, title = {Effect of the in-plane field component on the response of the magneto optical indicator film sensors}, journal = {Journal of Magnetism and Magnetic Materials}, year = {2021}, month = {6}, volume = {527}, number2 = {15SIB06: NanoMag: Nano-scale traceable magnetic field measurements}, pages = {167725}, keywords = {Magneto-opticsLocal magnetic field measurementsMetrology}, web_url = {https://www.sciencedirect.com/science/article/pii/S0304885321000019}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {Elsevier BV}, language = {30}, ISSN = {0304-8853}, DOI = {10.1016/j.jmmm.2021.167725}, stag_bib_extends_levelofaccess = {NA}, author = {Dorosinskiy, L. and Sievers, S. and Hu, X. and Lindner, M.} } @Article { KusterYGKS2021, subid = {2191}, title = {Radiofrequency‐induced heating of broken and abandoned implant leads during magnetic resonance examinations}, journal = {Magnetic Resonance in Medicine}, year = {2021}, month = {6}, volume = {86}, number = {4}, number2 = {17IND01: MIMAS: Procedures allowing medical implant manufacturers to demonstrate compliance with MRI safety regulations}, pages = {2156-2164}, keywords = {magnetic resonance imaging, MR safety, implant safety, abandoned leads}, misc2 = {EMPIR 2017: Industry}, publisher = {Wiley}, language = {30}, ISSN = {0740-3194, 1522-2594}, DOI = {10.1002/mrm.28836}, stag_bib_extends_levelofaccess = {NA}, author = {Kuster, N. and Yao, A. and Goren, T. and Kainz, W. and Samaras, T.} } @Article { DeleebeeckSNSRVHBLQCS2021, subid = {2183}, title = {Unified pH Measurements of Ethanol, Methanol, and Acetonitrile, and Their Mixtures with Water}, journal = {Sensors}, year = {2021}, month = {6}, volume = {21}, number = {11}, number2 = {17FUN09: UnipHied: Realisation of a Unified pH Scale}, pages = {3935}, keywords = {pHabs; ionic liquid salt bridge; commercial glass electrodes; water–alcohol mixture;non-aqueous pH}, misc2 = {EMPIR 2017: Fundamental}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s21113935}, stag_bib_extends_levelofaccess = {NA}, author = {Deleebeeck, L. and Snedden, A. and Nagy, D. and Szil{\'a}gyi Nagyn{\'e}, Z. and Rozikov{\'a}, M. and Vičarov{\'a}, M. and Heering, A. and Bastkowski, F. and Leito, I. and Quendera, R. and Cabral, V. and Stoica, D.} } @Article { FahrbachFBXCBP2021, subid = {2255}, title = {Customized piezoresistive microprobes for combined imaging of topography and mechanical properties}, journal = {Measurement: Sensors}, year = {2021}, month = {6}, volume = {15}, number2 = {17IND05: MicroProbes: Multifunctional ultrafast microprobes for on-the-machine measurements}, pages = {100042}, keywords = {Cantilever microprobe, Piezoresistive, Atomic force microscopy, Force–distance curves, Contact resonance, Lubricants}, misc2 = {EMPIR 2017: Industry}, publisher = {Elsevier BV}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100042}, stag_bib_extends_levelofaccess = {NA}, author = {Fahrbach, M. and Friedrich, S. and Behle, H. and XU, M. and Cappella, B. and Brand, U. and Peiner, E.} } @Article { DitaliaTchernijCLTPDPMMOGF2021, subid = {2261}, title = {Spectral features of Pb-related color centers in diamond – a systematic photoluminescence characterization}, journal = {New Journal of Physics}, year = {2021}, month = {6}, volume = {23}, number = {6}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {063032}, keywords = {diamond, ion implantation, single photon emitters, luminescent centers, Pb-related color center}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {1367-2630}, DOI = {10.1088/1367-2630/ac038a}, stag_bib_extends_levelofaccess = {NA}, author = {Ditalia Tchernij, S. and Corte, E. and L{\"u}hmann, T. and Traina, P. and Pezzagna, S. and Degiovanni, I.P. and Provatas, G. and Moreva, E. and Meijer, J. and Olivero, P. and Genovese, M. and Forneris, J.} } @Article { PicolloBBSORR2021, subid = {2266}, title = {Creation of pure non-crystalline diamond nanostructures via room-temperature ion irradiation and subsequent thermal annealing}, journal = {Nanoscale Advances}, year = {2021}, month = {6}, volume = {3}, number = {14}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {4156-4165}, keywords = {Diamond, Irradiation, Carbon, Imaging}, web_url = {https://pubs.rsc.org/en/Content/ArticleLanding/2021/NA/D1NA00136A}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Royal Society of Chemistry (RSC)}, language = {30}, ISSN = {2516-0230}, DOI = {10.1039/d1na00136a}, stag_bib_extends_levelofaccess = {NA}, author = {Picollo, F. and Battiato, A. and Bosia, F. and Scaffidi Muta, F. and Olivero, P. and Rigato, V. and Rubanov, S.} } @Article { KnotekBCKHUKS2021, subid = {2369}, title = {Measurements of water consumption for the development of new test regimes for domestic water meters}, journal = {Flow Measurement and Instrumentation}, year = {2021}, month = {6}, volume = {79}, number = {-}, number2 = {17IND13: Metrowamet: Metrology for real-world domestic water metering}, pages = {101963}, keywords = {water consumption, consumption measurement, water meters, dynamic loads, billing}, misc2 = {EMPIR 2017: Industry}, publisher = {Elsevier BV}, language = {30}, ISSN = {0955-5986}, DOI = {10.1016/j.flowmeasinst.2021.101963}, stag_bib_extends_levelofaccess = {NA}, author = {Knotek, S. and Benkova, M. and Christophersen, N. and Kondrup, J.B. and Haack, S. and Unsal, B. and Kroner, C. and Schumann, D.} } @Thesis { Gunz2021, subid = {2422}, title = {Combined Dielectric-Constant Gas Thermometry and Expansion Experiments - Virial Coefficients of Argon}, year = {2021}, month = {6}, number2 = {18SIB04: QuantumPascal: Towards quantum-based realisations of the pascal}, keywords = {DCGT, real-gas properties, virial coefficients, gas metrology, argon, expansion experiments, Burnett method}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Physikalisch-Technische Bundesanstalt (PTB)}, address = {Braunschweig and Berlin}, school = {Ruhr-University Bochum}, language = {30}, ISBN = {978-3-95606-599-6}, ISSN = {1614-9327}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://doi.org/10.7795/110.20220106}, author = {G{\"u}nz, C.} } @Article { BircherNKM2021, subid = {2411}, title = {Measurement of temperature induced X-ray tube transmission target displacements for dimensional computed tomography}, journal = {Precision Engineering}, year = {2021}, month = {6}, volume = {72}, number = {2021}, number2 = {17IND08: AdvanCT: Advanced Computed Tomography for dimensional and surface measurements in industry}, pages = {409-416}, keywords = {X-ray tube, Transmission target, Thermal stability, Focal spot, Finite element simulation, Dimensional metrology, X-ray computed tomography}, web_url = {https://www.sciencedirect.com/science/article/pii/S0141635921001574?via\%3Dihub}, misc2 = {EMPIR 2017: Industry}, publisher = {Elsevier}, language = {30}, ISSN = {0141-6359}, DOI = {10.1016/j.precisioneng.2021.06.002}, stag_bib_extends_levelofaccess = {NA}, author = {Bircher, B. and Neuhaus, S. and K{\"u}ng, A. and Meli, F.} } @Article { OzturkSOGFSS2021, subid = {2483}, title = {A Ti/Pt/Co Multilayer Stack for Transfer Function Based Magnetic Force Microscopy Calibrations}, journal = {Magnetochemistry}, year = {2021}, month = {6}, volume = {7}, number = {6}, number2 = {17FUN08: TOPS: Metrology for topological spin structures}, pages = {78}, keywords = {magnetic force microscopy; calibration; reference samples; micromagnetism; metrology for magnetism; magnetic multilayers}, web_url = {https://arxiv.org/abs/2201.09763}, misc2 = {EMPIR 2017: Fundamental}, publisher = {MDPI AG}, language = {30}, ISSN = {2312-7481}, DOI = {10.3390/magnetochemistry7060078}, stag_bib_extends_levelofaccess = {NA}, author = {{\"O}zt{\"u}rk, O. and Schumacher, H.W. and {\"O}ztoprak, İ. and Garcia-Sanchez, F. and Fern{\'a}ndez Scarioni, A. and Sievers, S. and Sakar, B.} } @Article { KhamlichiGOAR2021, subid = {2488}, title = {Error in the measurement of partial discharge pulses according to the frequency response of HFCT sensors}, journal = {2021 IEEE Electrical Insulation Conference (EIC)}, year = {2021}, month = {6}, volume = {.}, number = {.}, number2 = {19ENG02: FutureEnergy: Metrology for future energy transmission}, pages = {.}, keywords = {sensor phenomena and characterization, performance evaluation, partial discharges, insulation testing,condition monitoring}, tags = {SEG}, web_url = {https://zenodo.org/record/5906679}, misc2 = {EMPIR 2019: Energy}, publisher = {IEEE}, language = {30}, ISSN = {2576-6791}, DOI = {10.1109/EIC49891.2021.9612353}, stag_bib_extends_levelofaccess = {NA}, author = {Khamlichi, A. and Garnacho, F. and Ortego, J. and Alvarez, F. and Rovira, J.} } @Article { DitaliaTchernijCLTPDPMMOGF20210, subid = {2261}, title = {Spectral features of Pb-related color centers in diamond – a systematic photoluminescence characterization}, journal = {New Journal of Physics}, year = {2021}, month = {6}, volume = {23}, number = {6}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {063032}, keywords = {diamond, ion implantation, single photon emitters, luminescent centers, Pb-related color center}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {1367-2630}, DOI = {10.1088/1367-2630/ac038a}, stag_bib_extends_levelofaccess = {NA}, author = {Ditalia Tchernij, S. and Corte, E. and L{\"u}hmann, T. and Traina, P. and Pezzagna, S. and Degiovanni, I.P. and Provatas, G. and Moreva, E. and Meijer, J. and Olivero, P. and Genovese, M. and Forneris, J.} } @Article { DitaliaTchernijCLTPDPMMOGF20211, subid = {2261}, title = {Spectral features of Pb-related color centers in diamond – a systematic photoluminescence characterization}, journal = {New Journal of Physics}, year = {2021}, month = {6}, volume = {23}, number = {6}, number2 = {20FUN05: SEQUME: Single- and entangled photon sources for quantum metrology}, pages = {063032}, keywords = {diamond, ion implantation, single photon emitters, luminescent centers, Pb-related color center}, misc2 = {EMPIR 2020: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {1367-2630}, DOI = {10.1088/1367-2630/ac038a}, stag_bib_extends_levelofaccess = {NA}, author = {Ditalia Tchernij, S. and Corte, E. and L{\"u}hmann, T. and Traina, P. and Pezzagna, S. and Degiovanni, I.P. and Provatas, G. and Moreva, E. and Meijer, J. and Olivero, P. and Genovese, M. and Forneris, J.} } @Article { PicolloBBSORR20210, subid = {2266}, title = {Creation of pure non-crystalline diamond nanostructures via room-temperature ion irradiation and subsequent thermal annealing}, journal = {Nanoscale Advances}, year = {2021}, month = {6}, volume = {3}, number = {14}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {4156-4165}, keywords = {Diamond, Irradiation, Carbon, Imaging}, web_url = {https://pubs.rsc.org/en/Content/ArticleLanding/2021/NA/D1NA00136A}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Royal Society of Chemistry (RSC)}, language = {30}, ISSN = {2516-0230}, DOI = {10.1039/d1na00136a}, stag_bib_extends_levelofaccess = {NA}, author = {Picollo, F. and Battiato, A. and Bosia, F. and Scaffidi Muta, F. and Olivero, P. and Rigato, V. and Rubanov, S.} } @Proceedings { ArsovicMS2021, subid = {2610}, title = {An approach to improve accuracy and productivity of industrial CMM measurements at high scanning speed}, journal = {euspen’s 21st International Conference \& Exhibition, Copenhagen, DK, June 2021}, year = {2021}, month = {6}, number2 = {17NRM03: EUCoM: Standards for the evaluation of the uncertainty of coordinate measurements in industry}, keywords = {Coordinate measuring machine, measurement uncertainty, contact scanning probing mode}, web_url = {https://www.euspen.eu/knowledge-base/ICE21150.pdf}, misc2 = {EMPIR 2017: Pre-Co-Normative}, event_place = {Virtual Conference - Copenhagen, Denmark}, event_name = {euspen’s 21st International Conference \& Exhibition}, event_date = {07-06-2021 to 10-06-2021}, language = {30}, DOI = {10.5281/zenodo.6323538}, stag_bib_extends_levelofaccess = {NA}, author = {Arsovic, A. and Menoncin, M. and Savio, E.} } @Proceedings { ZaniniSC2021, subid = {2611}, title = {Uncertainty determination of X-ray computed tomography dimensional measurements of additively manufactured metal lattice structures}, journal = {euspen’s 21st International Conference \& Exhibition, Copenhagen, DK, June 2021}, year = {2021}, month = {6}, number2 = {17NRM03: EUCoM: Standards for the evaluation of the uncertainty of coordinate measurements in industry}, keywords = {X-ray computed tomography, Additive manufacturing, Lattice structures, Dimensional metrology, uncertainty}, web_url = {https://www.euspen.eu/knowledge-base/ICE21306.pdf}, misc2 = {EMPIR 2017: Pre-Co-Normative}, event_place = {Virtual Conference - Copenhagen, Denmark}, event_name = {euspen’s 21st International Conference \& Exhibition}, event_date = {07-06-2021 to 10-06-2021}, language = {30}, DOI = {10.5281/zenodo.6323598}, stag_bib_extends_levelofaccess = {NA}, author = {Zanini, F. and Savio, E. and Carmignato, S.} } @Article { Zorin2021, subid = {2066}, title = {Quasi-phasematching in a poled Josephson traveling-wave parametric amplifier with three-wave mixing}, journal = {Applied Physics Letters}, year = {2021}, month = {5}, day = {31}, volume = {118}, number = {22}, number2 = {17FUN10: ParaWave: Josephson travelling wave parametric amplifier and its application for metrology}, pages = {222601}, keywords = {Josephson traveling-wave parametric amplifier, three-wave mixing, quasi-phasematching}, web_url = {https://arxiv.org/pdf/2101.11697}, misc2 = {EMPIR 2017: Fundamental}, publisher = {AIP Publishing}, language = {30}, ISSN = {0003-6951, 1077-3118}, DOI = {10.1063/5.0050787}, stag_bib_extends_levelofaccess = {NA}, author = {Zorin, A.B.} } @Article { LoweSSMP2021, subid = {2076}, title = {Design, construction and traceable calibration of a phosphor-based fibre-optic thermometer from 0 \(^{\circ}\)C to 650 \(^{\circ}\)C}, journal = {Measurement Science and Technology}, year = {2021}, month = {5}, day = {28}, volume = {32}, number = {9}, number2 = {17IND04: EMPRESS 2: Enhancing process efficiency through improved temperature measurement 2}, pages = {094004}, keywords = {Phosphor thermometry, temperature, temperature measurement, traceability, harsh environments, EMPRESS 2}, misc2 = {EMPIR 2017: Industry}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-0233, 1361-6501}, DOI = {10.1088/1361-6501/abee53}, stag_bib_extends_levelofaccess = {NA}, author = {Lowe, D. and Sutton, G. and Sposito, A. and Machin, G. and Pearce, J.} } @Article { LanzaMCCSDGNKRCMBP2021, subid = {2392}, title = {Calibration of non-catching precipitation measurement instruments: A review}, journal = {Meteorological Applications}, year = {2021}, month = {5}, day = {25}, volume = {28}, number = {3}, number2 = {18NRM03: INCIPIT: Calibration and accuracy of non-catching instruments to measure liquid/solid atmospheric precipitation}, pages = {e2002}, keywords = {calibration, hydro-meteorology, meteomet, non-catching gauges, precipitation, precipitation measurement and analysis, uncertainty analysis, verification}, web_url = {https://onlinelibrary.wiley.com/doi/10.1002/met.2002}, misc2 = {EMPIR 2018: Pre-Co-Normative}, publisher = {RMets}, language = {30}, ISSN = {14698080}, DOI = {10.1002/met.2002}, stag_bib_extends_levelofaccess = {NA}, author = {Lanza, L.G. and Merlone, A. and Cauteruccio, A. and Chinchella, E. and Stagnaro, M. and Dobre, M. and Garcia Izquierdo, M.C. and Nielsen, J. and Kjeldsen, H. and Roulet, Y.A. and Coppa, G. and Musacchio, C. and Bordianu, C. and Parrondo, M.} } @Article { RebufelloPASGDCVDG2021, subid = {2446}, title = {Anomalous weak values via a single photon detection}, journal = {Light: Science \& Applications}, year = {2021}, month = {5}, day = {25}, volume = {10}, number = {1}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, keywords = {Quantum Measurement, Weak Values, Single Photons, Quantum Metrology}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2047-7538}, DOI = {10.1038/s41377-021-00539-0}, stag_bib_extends_levelofaccess = {NA}, author = {Rebufello, E. and Piacentini, F. and Avella, A. and Souza, M.A. de and Gramegna, M. and Dziewior, J. and Cohen, E. and Vaidman, L. and Degiovanni, I.P. and Genovese, M.} } @Article { XuLAP2021, subid = {2295}, title = {Non-reciprocity in optical fiber links: experimental evidence}, journal = {Journal of Lightwave Technology}, year = {2021}, month = {5}, day = {21}, volume = {39}, number = {10}, number2 = {18SIB06: TiFOON: Advanced time/frequency comparison and dissemination through optical telecommunication networks}, pages = {3106-3111}, keywords = {Optical fiber link, ultrastable frequency transfer, two-way noise compensation, polarization mode dispersion, reciprocity, non-reciprocity.}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Paul-Eric Pottie}, language = {30}, ISSN = {1094-4087}, DOI = {10.1364/OE.420661}, stag_bib_extends_levelofaccess = {NA}, author = {Xu, D. and Lopez, O. and Amy-Klein, A. and Pottie, P-E.} } @Article { EdlerE2021, subid = {2272}, title = {Thermoelektrische Eigenschaften von Pt-40 \%Rh/Pt-6 \%Rh Thermoelementen}, journal = {tm - Technisches Messen}, year = {2021}, month = {5}, day = {20}, volume = {88}, number = {10}, number2 = {17IND04: EMPRESS 2: Enhancing process efficiency through improved temperature measurement 2}, pages = {592-597}, keywords = {Thermoelement, Kennlinienfunktion, Temperaturmessung}, misc2 = {EMPIR 2017: Industry}, publisher = {Walter de Gruyter GmbH}, language = {43}, ISSN = {2196-7113, 0171-8096}, DOI = {10.1515/teme-2021-0042}, stag_bib_extends_levelofaccess = {NA}, author = {Edler, F. and Ederer, P.} } @Article { PetryDSCCD2021, subid = {2072}, title = {Uncertainty evaluation in atomic force microscopy measurement of nanoparticles based on statistical mixed model in a Bayesian framework}, journal = {Measurement Science and Technology}, year = {2021}, month = {5}, day = {19}, volume = {32}, number = {8}, number2 = {17NRM05: EMUE: Advancing measurement uncertainty - comprehensive examples for key international standards}, pages = {085008}, keywords = {AFM,mixed model,uncertainty calculation,Bayesian statistics,design of experiment}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-0233, 1361-6501}, DOI = {10.1088/1361-6501/abe47f}, stag_bib_extends_levelofaccess = {NA}, author = {P{\'e}try, J. and De Boeck, B. and Seba{\"i}hi, N. and Coenegrachts, M. and Caebergs, T. and Dobre, M.} } @Article { LombardiCDMMT2021, subid = {2509}, title = {Triggered emission of indistinguishable photons from an organic dye molecule}, journal = {Applied Physics Letters}, year = {2021}, month = {5}, day = {17}, volume = {118}, number = {20}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {204002}, keywords = {single-photon source, indistinguishability, molecule single-photon source}, web_url = {https://aip.scitation.org/doi/10.1063/5.0048567}, misc2 = {EMPIR 2017: Fundamental}, publisher = {AIP Publishing}, language = {30}, ISSN = {0003-6951, 1077-3118}, DOI = {10.1063/5.0048567}, stag_bib_extends_levelofaccess = {NA}, author = {Lombardi, P. and Colautti, M. and Duquennoy, R. and Murtaza, G. and Majumder, P. and Toninelli, C.} } @Proceedings { D039AvanzoFLLLLOT2021, subid = {2566}, title = {Improving Harmonic Measurements with Instrument Transformers: a Comparison Among Two Techniques}, journal = {2021 IEEE International Instrumentation and Measurement Technology Conference (I2MTC)}, year = {2021}, month = {5}, day = {17}, number2 = {19NRM05: IT4PQ: Measurement methods and test procedures for assessing accuracy of instrument transformers for power quality measurements}, keywords = {Instrument Transformers (IT), Power Quality (PQ), harmonics, harmonics measurement, power systemmeasurements, harmonic distortion, nonlinearity, compensation}, misc2 = {EMPIR 2019: Pre-Co-Normative}, publisher = {IEEE}, event_place = {Glasgow, United Kingdom}, event_name = {2021 IEEE International Instrumentation and Measurement Technology Conference (I2MTC)}, event_date = {17-05-2021 to 20-05-2021}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://zenodo.org/record/6104280}, author = {D'Avanzo, G. and Faifer, M. and Landi, C. and Laurano, C. and Letizia, P.S. and Luiso, M. and Ottoboni, R. and Toscani, S.} } @Article { XuLAP2021_2, subid = {2294}, title = {Polarization Scramblers to Solve Practical Limitations of Frequency Transfer}, journal = {Journal of Lightwave Technology}, year = {2021}, month = {5}, day = {15}, volume = {39}, number = {10}, number2 = {18SIB06: TiFOON: Advanced time/frequency comparison and dissemination through optical telecommunication networks}, pages = {3106-3111}, keywords = {Optical fiber link, ultrastable frequency trans- fer, two-way noise compensation, polarization mode dispersion, polarization scrambler}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Paul-Eric Pottie}, language = {30}, ISSN = {0733-8724, 1558-2213}, DOI = {10.1109/JLT.2021.3057804}, stag_bib_extends_levelofaccess = {NA}, author = {Xu, D. and Lopez, O. and Amy-Klein, A. and Pottie, P-E.} } @Article { GolokolenovGKPT2021, subid = {2051}, title = {On the origin of the controversial electrostatic field effect in superconductors}, journal = {Nature Communications}, year = {2021}, month = {5}, day = {12}, volume = {12}, number = {1}, number2 = {17FUN10: ParaWave: Josephson travelling wave parametric amplifier and its application for metrology}, keywords = {superconducting devices, superconductor electronics, electrostatic field effect}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2041-1723}, DOI = {10.1038/s41467-021-22998-0}, stag_bib_extends_levelofaccess = {NA}, author = {Golokolenov, I. and Guthrie, A. and Kafanov, S. and Pashkin, Y.A. and Tsepelin, V.} } @Proceedings { PhungA2021_2, subid = {2287}, title = {Impact of Chuck Boundary Conditions on Wideband On-Wafer Measurements}, journal = {2021 IEEE 25th Workshop on Signal and Power Integrity (SPI)}, year = {2021}, month = {5}, day = {10}, number2 = {18SIB09: TEMMT: Traceability for electrical measurements at millimetre-wave and terahertz frequencies for communications and electronics technologies}, pages = {1-4}, keywords = {coplanar waveguides, leakage, radiation, surface waves}, web_url = {https://oar.ptb.de/files/download/618907218e2a000011003f97}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IEEE}, event_place = {Siegen, Germany}, event_name = {2021 IEEE 25th Workshop on Signal and Power Integrity (SPI)}, event_date = {10-05-2021 to 12-05-2021}, language = {30}, DOI = {10.1109/SPI52361.2021.9505192}, stag_bib_extends_levelofaccess = {NA}, author = {Phung, G.N. and Arz, U.} } @Article { AxnerSFZZ2021, subid = {1990}, title = {Assessment of gas molar density by gas modulation refractometry: A review of its basic operating principles and extraordinary performance}, journal = {Spectrochimica Acta Part B: Atomic Spectroscopy}, year = {2021}, month = {5}, volume = {179}, number2 = {18SIB04: QuantumPascal: Towards quantum-based realisations of the pascal}, pages = {106121}, keywords = {Gas modulation refractometry (GAMOR)Fabry-Perot cavityPrecisionAccuracyGas molar (or number) density}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Elsevier BV}, language = {30}, ISSN = {0584-8547}, DOI = {10.1016/j.sab.2021.106121}, stag_bib_extends_levelofaccess = {NA}, author = {Axner, O. and Silander, I. and Forss{\'e}n, C. and Zakrisson, J. and Zelan, M.} } @Article { ManskePKRP2021, subid = {2044}, title = {Monte-Carlo Analysis of Challenges and Limitations of Dispersion-based Optical Thermometry}, journal = {SMSI 2021 - Sensors and Instrumentation}, year = {2021}, month = {5}, number2 = {18SIB01: GeoMetre: Large-scale dimensional measurements for geodesy}, pages = {203-204}, keywords = {dispersive thermometry, measurement uncertainty modelling, multi-wavelength interferometry, Monte-Carlo Simulation}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {AMA Service GmbH, Von-M{\"u}nchhausen-Str. 49, 31515 Wunstorf, Germany}, language = {30}, DOI = {10.5162/SMSI2021/C4.4}, stag_bib_extends_levelofaccess = {NA}, author = {Manske, E. and Prellinger, G. and K{\"o}chert, P. and Rose, A. and Pollinger, F.} } @Techreport { QuintanillaCrespoZHMMDHW2021, subid = {2027}, title = {Report on the technical requirements for the electrical power measurements and definition of the measurands for nacelle test benches}, journal = {Zenodo}, year = {2021}, month = {5}, number2 = {19ENG08: WindEFCY: Traceable mechanical and electrical power measurement for efficiency determination of wind turbines}, pages = {1-25}, keywords = {WindEFCY, EMPIR, Horizon2020, 10ENG08, Nacelle efficiency, Electrical power measurement}, web_url = {https://zenodo.org/record/4726089\#.YJjxR6FCRmE}, misc2 = {EMPIR 2019: Energy}, publisher = {Zenodo}, language = {30}, DOI = {10.5281/zenodo.4726089}, stag_bib_extends_levelofaccess = {NA}, author = {Quintanilla Crespo, J. and Zweiffel, M. and Heller, M. and Mester, C. and Mohns, E. and Dubowik, A. and H{\"a}llstr{\"o}m, J. and Weidinger, P.} } @Article { KazemipourHWHRSAGZ2021, subid = {2048}, title = {Standard Load Method: A New Calibration Technique for Material Characterization at Terahertz Frequencies}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2021}, month = {5}, volume = {70}, number = {N/A}, number2 = {18SIB09: TEMMT: Traceability for electrical measurements at millimetre-wave and terahertz frequencies for communications and electronics technologies}, pages = {1007310}, keywords = {Material characterization, measurement uncertainty, parameter extraction, standard load, vector network analyzer (VNA) time gating}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9456, 1557-9662}, DOI = {10.1109/TIM.2021.3077660}, stag_bib_extends_levelofaccess = {NA}, author = {Kazemipour, A. and Hoffmann, J. and Wollensack, M. and Hudlicka, M. and R{\"u}fenacht, J. and Stalder, D. and Allal, D. and G{\"a}umann, G. and Zeier, M.} } @Article { SiekkinenKKSFSTISTT2021, subid = {2109}, title = {Assessment of a digital and an analog PET/CT system for accurate myocardial perfusion imaging with a flow phantom}, journal = {Journal of Nuclear Cardiology}, year = {2021}, month = {5}, volume = {n/a}, number = {n/a}, number2 = {19SIP04: TracPETperf: Software for evaluating PET cardiac perfusion imaging uncertainties for more accurate diagnosis}, pages = {n/a}, keywords = {digital and analog PET/CT system, myocardial perfusion imaging, flow phantom}, misc2 = {EMPIR 2019: Support for Impact}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {1071-3581, 1532-6551}, DOI = {10.1007/s12350-021-02631-9}, stag_bib_extends_levelofaccess = {NA}, author = {Siekkinen, R. and Kirjavainen, A.K. and Koskensalo, K. and Smith, N.A.S. and FENWICK, A. and Saunavaara, V. and Tolvanen, T. and Iida, H. and Saraste, A. and Ter{\"a}s, M. and Teuho, J.} } @Article { RousselCFD2021, subid = {2219}, title = {Processing Quantum Signals Carried by Electrical Currents}, journal = {PRX Quantum}, year = {2021}, month = {5}, volume = {2}, number2 = {17FUN04: SEQUOIA: Single-electron quantum optics for quantum-enhanced measurements}, pages = {020314}, keywords = {Edge states, Integer quantum Hall effect, Mesoscopics, Quantum information processing, Quantum transport, Quasiparticles \& collective excitations}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2691-3399}, DOI = {10.1103/PRXQuantum.2.020314}, stag_bib_extends_levelofaccess = {NA}, author = {Roussel, B. and Cabart, C. and F{\`e}ve, G. and Degiovanni, P.} } @Proceedings { FahrbachPXB2021, subid = {2256}, title = {Self-excited Contact Resonance Operation of a Tactile Piezoresistive Cantilever Microprobe with Diamond Tip}, journal = {SMSI 2021 - Sensors and Instrumentation}, year = {2021}, month = {5}, volume = {A5 MEMS Se}, number2 = {17IND05: MicroProbes: Multifunctional ultrafast microprobes for on-the-machine measurements}, pages = {73-74}, keywords = {MEMS, microprobe, thermal actuator, piezoresistive cantilever, contact resonance}, web_url = {https://www.ama-science.org/proceedings/details/3948}, misc2 = {EMPIR 2017: Industry}, publisher = {AMA Service GmbH, Von-M{\"u}nchhausen-Str. 49, 31515 Wunstorf, Germany}, event_place = {Digital}, event_name = {SMSI 2021 Conference – Sensor and Measurement Science International}, event_date = {03-05-2021 to 06-05-2021}, language = {30}, ISBN = {978-3-9819376-4-0}, DOI = {10.5162/SMSI2021/A5.4}, stag_bib_extends_levelofaccess = {NA}, author = {Fahrbach, M. and Peiner, E. and XU, M. and Brand, U.} } @Article { KlapetekGNVSN2021, subid = {2318}, title = {GSvit — An open source FDTD solver for realistic nanoscale optics simulations}, journal = {Computer Physics Communications}, year = {2021}, month = {5}, volume = {265}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {108025}, keywords = {FDTD, Plasmonics, Optics, Roughness}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Elsevier BV}, language = {30}, ISSN = {0010-4655}, DOI = {10.1016/j.cpc.2021.108025}, stag_bib_extends_levelofaccess = {NA}, author = {Klapetek, P. and Grolich, P. and Nezval, D. and Valtr, M. and Šlesinger, R. and Nečas, D.} } @Proceedings { NeyezhmakovPPSS2021, subid = {2402}, title = {Towards the assessment of the accuracy of measuring the integral characteristics of physical quantities using the sensors of discrete values of these quantities}, journal = {SMSI 2021 - System of Units and Metreological Infrastructure}, year = {2021}, month = {5}, volume = {C9 Advance}, number = {2021}, number2 = {18SIB01: GeoMetre: Large-scale dimensional measurements for geodesy}, pages = {C9.2, 310-311}, keywords = {sensor, integral, discrete values, quadrature formula, accuracy}, web_url = {https://doi.org/10.5162/SMSI2021/C9.2}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {AMA}, event_place = {Online Conference}, event_name = {SMSI 2021 Conference – Sensor and Measurement Science International}, event_date = {03-05-2021 to 06-05-2021}, language = {30}, ISBN = {978-3-9819376-4-0}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://www.ama-science.org/proceedings/details/4069}, author = {Neyezhmakov, P. and Panasenko, T and Prokopov, A. and Skliarov, V. and Shloma, A.} } @Article { RebufelloPALVTGBCVDG2021, subid = {2447}, title = {Protective Measurement—A New Quantum Measurement Paradigm: Detailed Description of the First Realization}, journal = {Applied Sciences}, year = {2021}, month = {5}, volume = {11}, number = {9}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {4260}, keywords = {Quantum Measurement, Weak Measurement, Quantum Metrology, Single Photons}, misc2 = {EMPIR 2017: Fundamental}, publisher = {MDPI AG}, language = {30}, ISSN = {2076-3417}, DOI = {10.3390/app11094260}, stag_bib_extends_levelofaccess = {NA}, author = {Rebufello, E. and Piacentini, F. and Avella, A. and Lussana, R. and Villa, F. and Tosi, A. and Gramegna, M. and Brida, G. and Cohen, E. and Vaidman, L. and Degiovanni, I.P. and Genovese, M.} } @Article { KalincevDKYFM2021, subid = {2476}, title = {Motional heating of spatially extended ion crystals}, journal = {Quantum Science and Technology}, year = {2021}, month = {5}, volume = {6}, number = {3}, number2 = {17FUN07: CC4C: Coulomb Crystals for Clocks}, pages = {034003}, keywords = {multi-ion clocks, vibrational mode heating, ion Coulomb crystals, precision metrology, radio frequency noise}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {2058-9565}, DOI = {10.1088/2058-9565/abee99}, stag_bib_extends_levelofaccess = {NA}, author = {Kalincev, D. and Dreissen, L.S. and Kulosa, A.P. and Yeh, C-H. and F{\"u}rst, H.A. and Mehlst{\"a}ubler, T.E.} } @Article { Pearce2021, subid = {2077}, title = {Some predictions of a validated physical model of Pt–Rh thermocouple drift above 1200 \(^{\circ}\)C}, journal = {Metrologia}, year = {2021}, month = {4}, day = {29}, volume = {58}, number = {3}, number2 = {17IND04: EMPRESS 2: Enhancing process efficiency through improved temperature measurement 2}, pages = {035011}, keywords = {thermocouple, thermoelectric stability, ITS-90, temperature metrology, drifttesting}, web_url = {https://iopscience.iop.org/article/10.1088/1681-7575/abeb80}, misc2 = {EMPIR 2017: Industry}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/abeb80}, stag_bib_extends_levelofaccess = {NA}, author = {Pearce, J.V.} } @Article { MelendezSanchezTGL2021, subid = {2078}, title = {Mapping of temperature and CO2 column density in a standard flame by multispectral imaging}, journal = {Thermosense: Thermal Infrared Applications XLIII}, year = {2021}, month = {4}, day = {28}, volume = {N/A}, number = {N/A}, number2 = {17IND04: EMPRESS 2: Enhancing process efficiency through improved temperature measurement 2}, pages = {N/A}, keywords = {flame thermometry, EMPRESS 2, combustion thermometry, temperature, temperature traceability}, web_url = {https://www.spiedigitallibrary.org/conference-proceedings-of-spie/11743/2585805/Mapping-of-temperature-and-CO2-column-density-in-a-standard/10.1117/12.2585805.full}, misc2 = {EMPIR 2017: Industry}, publisher = {SPIE}, language = {30}, DOI = {10.1117/12.2585805}, stag_bib_extends_levelofaccess = {NA}, author = {Mel{\'e}ndez Sanchez, J. and Talavante, J. and Guarnizo, G. and L{\'o}pez, F.} } @Techreport { CoxJR2021, subid = {2192}, title = {Statistical analysis of temperature rise in passive medical implants in a magnetic resonance imaging environment}, journal = {National Physical Laboratory}, year = {2021}, month = {4}, day = {28}, number2 = {17IND01: MIMAS: Procedures allowing medical implant manufacturers to demonstrate compliance with MRI safety regulations}, keywords = {implant safety, magnetic resonance imaging, MR safety}, misc2 = {EMPIR 2017: Industry}, publisher = {National Physical Laboratory}, language = {30}, DOI = {10.47120/npl.MS28}, stag_bib_extends_levelofaccess = {NA}, author = {Cox, M. and Jagan, K. and Rajan, S.} } @Article { RussellS2021, subid = {2024}, title = {mmSIM: An open toolbox for accessible structured illumination microscopy}, journal = {Philosophical Transactions of the Royal Society A}, year = {2021}, month = {4}, day = {26}, number2 = {18HLT02: AeroTox: Measurements for mitigating adverse health effects from atmospheric particulate pollutants}, keywords = {Structured illumination microscopy, SIM hardware control, image acquisition, Micro-Manager microscope control package}, web_url = {https://www.biorxiv.org/content/10.1101/2021.01.18.427184v1}, misc2 = {EMPIR 2018: Health}, language = {30}, DOI = {10.1101/2021.01.18.427184}, stag_bib_extends_levelofaccess = {NA}, author = {Russell, C.T. and Shaw, M.} } @Article { GeorgievaMRHGDGLK2021, subid = {2092}, title = {Detection of ultra-weak laser pulses by free-running single-photon detectors: Modeling dead time and dark counts effects}, journal = {Applied Physics Letters}, year = {2021}, month = {4}, day = {26}, volume = {118}, number = {17}, number2 = {19NRM06: MeTISQ: Metrology for testing the implementation security of quantum key distribution hardware}, pages = {174002}, keywords = {Quantum commutation, QKD, Non-Classical Light Emitters, Single-Photon Detectors, RadiometryMetrology for Quantum Technologies}, misc2 = {EMPIR 2019: Pre-Co-Normative}, publisher = {AIP Publishing}, language = {30}, ISSN = {0003-6951, 1077-3118}, DOI = {10.1063/5.0046014}, stag_bib_extends_levelofaccess = {NA}, author = {Georgieva, H. and Meda, A. and Raupach, S.M.F. and Hofer, H. and Gramegna, M. and Degiovanni, I.P. and Genovese, M. and L{\'o}pez, M. and K{\"u}ck, S.} } @Article { FleischerHSPZH2021, subid = {2431}, title = {Absolute ¹³C/¹²C isotope amount ratio for Vienna PeeDee Belemnite from infrared absorption spectroscopy}, journal = {Nature Physics}, year = {2021}, month = {4}, day = {26}, volume = {17}, number2 = {18SIB04: QuantumPascal: Towards quantum-based realisations of the pascal}, pages = {889-893}, keywords = {Characterization and analytical techniques, Near-infrared spectroscopy}, web_url = {https://discovery.ucl.ac.uk/id/eprint/10131639/}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Springer Nature}, language = {30}, ISSN = {1745-2481}, DOI = {10.1038/s41567-021-01226-y}, stag_bib_extends_levelofaccess = {NA}, author = {Fleischer, A.J. and Hongming, Y. and Srivastava, A. and Polyansky, O. and Zobov, N.F. and Hodges, J.T.} } @Article { NagelLASDL2021, subid = {2440}, title = {Non-Invasive and Quantitative Estimation of Left Atrial Fibrosis Based on P Waves of the 12-Lead ECG—A Large-Scale Computational Study Covering Anatomical Variability}, journal = {Journal of Clinical Medicine}, year = {2021}, month = {4}, day = {20}, volume = {10}, number = {8}, number2 = {18HLT07: MedalCare: Metrology of automated data analysis for cardiac arrhythmia management}, keywords = {electrophysiological simulation, atrial cohort modeling, 12-lead ECG, P wave, atrial fibrosis, atrial fibrillation}, web_url = {https://www.mdpi.com/2077-0383/10/8/1797/htm}, misc2 = {EMPIR 2018: Health}, publisher = {MDPI}, language = {30}, DOI = {10.3390/jcm10081797}, stag_bib_extends_levelofaccess = {NA}, author = {Nagel, C. and Luongo, G. and Azzolin, L. and Schuler, S. and D{\"o}ssel, O. and Loewe, A.} } @Article { Mester2021, subid = {2127}, title = {Sampling Primary Power Standard from DC up to 9 kHz Using Commercial Off-The-Shelf Components}, journal = {Energies}, year = {2021}, month = {4}, day = {15}, volume = {14}, number = {8}, number2 = {19ENG08: WindEFCY: Traceable mechanical and electrical power measurement for efficiency determination of wind turbines}, pages = {2203}, keywords = {electrical power, power quality, power standard, sampling, traceability, WindEFCY}, misc2 = {EMPIR 2019: Energy}, publisher = {MDPI AG}, language = {30}, ISSN = {1996-1073}, DOI = {10.3390/en14082203}, stag_bib_extends_levelofaccess = {NA}, author = {Mester, C.} } @Article { PeikSSPWT2021, subid = {2228}, title = {Nuclear clocks for testing fundamental physics}, journal = {Quantum Science and Technology}, year = {2021}, month = {4}, day = {15}, volume = {6}, number = {3}, number2 = {17FUN07: CC4C: Coulomb Crystals for Clocks}, pages = {034002}, keywords = {nuclear clock, fundamental physics, thorium-229 isomer, dark matter searches}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {2058-9565}, DOI = {10.1088/2058-9565/abe9c2}, stag_bib_extends_levelofaccess = {NA}, author = {Peik, E. and Schumm, T. and Safronova, M.S. and P{\'a}lffy, A. and Weitenberg, J. and Thirolf, P.G.} } @Article { PeruzziRPEBu2021, subid = {2057}, title = {Survey of subrange inconsistency of long-stem standard platinum resistance thermometers}, journal = {Metrologia}, year = {2021}, month = {4}, day = {14}, volume = {58}, number = {3}, number2 = {18SIB02: Real-K: Realising the redefined kelvin}, pages = {035009}, keywords = {platinum resistance thermometers (SPRTs), statistical test, fixed-point uncertainty propagation (PoU)}, web_url = {https://iopscience.iop.org/article/10.1088/1681-7575/abe8c1/pdf}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IOP Publishing}, address = {Bristol, United Kingdom}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/abe8c1}, stag_bib_extends_levelofaccess = {NA}, author = {Peruzzi, A and Rusby, R L and Pearce, J V and Eusebio, L and Bojkovski, J and Žužek, V} } @Article { Arduino2021, subid = {2004}, title = {EPTlib: An Open-Source Extensible Collection of Electric Properties Tomography Techniques}, journal = {Applied Sciences}, year = {2021}, month = {4}, number = {Latest Adv}, number2 = {18HLT05: QUIERO: Quantitative MR-based imaging of physical biomarkers}, keywords = {electric properties tomography; open-source software; magnetic resonance imaging; quantitative imaging}, misc2 = {EMPIR 2018: Health}, language = {30}, ISSN = {2076-3417}, DOI = {10.3390/app11073237}, stag_bib_extends_levelofaccess = {NA}, author = {Arduino, A.} } @Article { MoroshRNKiKPIMSBIKS2021, subid = {2017}, title = {Investigation into the performance of dose rate measurement instruments used in non-governmental networks}, journal = {Radiation Measurements}, year = {2021}, month = {4}, number2 = {16ENV04: Preparedness: Metrology for mobile detection of ionising radiation following a nuclear or radiological incident}, pages = {106580}, keywords = {Dosimetry networks.Dose rate meters.Environmental Radiation.Geiger counter.Metrological evaluation}, misc2 = {EMPIR 2016: Environment}, publisher = {Elsevier BV}, language = {30}, ISSN = {1350-4487}, DOI = {10.1016/j.radmeas.2021.106580}, stag_bib_extends_levelofaccess = {NA}, author = {Morosh, V. and R{\"o}ttger, A. and Neumaier, S. and Krasniqi, F. and Živanović, M. and Kržanović, N. and Pantelić, G. and Iurlaro, G. and Mariotti, F. and Sperandio, L. and Bell, S. and Ioannidis, S. and Kelly, M. and Sangiorgi, M.} } @Article { GanikiRJKH2021, subid = {2034}, title = {Validating an Evaporative Calibrator for Gaseous Oxidized Mercury}, journal = {Sensors}, year = {2021}, month = {4}, volume = {21}, number = {7}, number2 = {16ENV01: MercOx: Metrology for oxidised mercury}, pages = {2501}, keywords = {Gaseous oxidized mercury, calibration, traceability, 197-Hg}, misc2 = {EMPIR 2016: Environment}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s21072501}, stag_bib_extends_levelofaccess = {NA}, author = {Gačnik, J. and Živković, I. and Ribeiro Guevara, S. and Jaćimović, R. and Kotnik, J. and Horvat, M.} } @Article { HartmanGML2021, subid = {2083}, title = {Electromagnetic Compatible Energy Measurements Using the Orthogonality of Nonfundamental Power Components}, journal = {IEEE Transactions on Electromagnetic Compatibility}, year = {2021}, month = {4}, volume = {63}, number = {2}, number2 = {17NRM02: MeterEMI: Electromagnetic Interference on Static Electricity Meters}, pages = {598-605}, keywords = {Conducted immunity and emissions, EMC measurements, low frequency EMC, power electronics, powerquality}, tags = {SEG}, web_url = {https://research.utwente.nl/en/publications/electromagnetic-compatible-energy-measurements-using-the-orthogon}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9375, 1558-187X}, DOI = {10.1109/TEMC.2020.3019974}, stag_bib_extends_levelofaccess = {NA}, author = {Hartman, T. and Grootjans, R. and Moonen, N. and Leferink, F.} } @Article { JoBAFSWTDRGKPR2021, subid = {2125}, title = {Quantum Hall Valley Splitters and a Tunable Mach-Zehnder Interferometer in Graphene}, journal = {Physical Review Letters}, year = {2021}, month = {4}, volume = {126}, number = {14}, number2 = {17FUN04: SEQUOIA: Single-electron quantum optics for quantum-enhanced measurements}, pages = {146803}, keywords = {Graphene, electron interferometer, Mach-Zehnder, Quantum Hall Valley Beam Splitter}, web_url = {https://arxiv.org/abs/2011.04958}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {0031-9007, 1079-7114}, DOI = {10.1103/PhysRevLett.126.146803}, stag_bib_extends_levelofaccess = {NA}, author = {Jo, M. and Brasseur, P. and Assouline, A. and Fleury, G. and Sim, H-S. and Watanabe, K. and Taniguchi, T. and Dumnernpanich, W. and Roche, P. and Glattli, D.C. and Kumada, N. and Parmentier, F.D. and Roulleau, P.} } @Article { SzulcMCBG2021, subid = {2394}, title = {Nonreciprocal spin-wave dynamics in Pt/Co/W/Co/Pt multilayers}, journal = {Phys. Rev. B}, year = {2021}, month = {4}, volume = {103}, number = {13}, number2 = {17FUN08: TOPS: Metrology for topological spin structures}, pages = {134404}, keywords = {Spin Waves, Brillouin light scattering, interfacial Dzyaloshinskii-Moriya interaction}, web_url = {https://arxiv.org/abs/2112.11206}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2469-9950, 2469-9969}, DOI = {10.1103/PhysRevB.103.134404}, stag_bib_extends_levelofaccess = {NA}, author = { Szulc, K. and Mendisch, S. and Casoli, F. and Becherer, M. and Gubbiotti, G.} } @Article { ChaudharyMAOMPB2021, subid = {2656}, title = {Radiobiology Experiments With Ultra-high Dose Rate Laser-Driven Protons: Methodology and State-of-the-Art}, journal = {Frontiers in Physics}, year = {2021}, month = {4}, volume = {9}, number = {1}, number2 = {18HLT04: UHDpulse: Metrology for advanced radiotherapy using particle beams with ultra-high pulse dose rates}, keywords = {protontherapy, cancer, radiobiology, laser-driven ions, particle accelerator, ultra-high dose rate}, misc2 = {EMPIR 2018: Health}, publisher = {Frontiers Media SA}, language = {30}, ISSN = {2296-424X}, DOI = {10.3389/fphy.2021.624963}, stag_bib_extends_levelofaccess = {NA}, author = {Chaudhary, P. and Milluzzo, G. and Ahmed, H. and Odlozilik, B. and McMurray, A. and Prise, K.M. and Borghesi, M.} } @Article { RobertsonSPJ2021, subid = {2728}, title = {ARC 3.0: An expanded Python toolbox for atomic physics calculations}, journal = {Computer Physics Communications}, year = {2021}, month = {4}, volume = {261}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, pages = {107814}, keywords = {Alkaline earth atomsDivalent atomsAlkali atomsRydberg statesAtom–surface van der Waals interactionQuantum technologiesNeutral-atom quantum computingAtom-based sensors}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Elsevier BV}, language = {30}, ISSN = {0010-4655}, DOI = {10.1016/j.cpc.2020.107814}, stag_bib_extends_levelofaccess = {NA}, author = {Robertson, E.J. and Šibalić, N. and Potvliege, R.M. and Jones, M.P.A. } } @Article { GruberBALBPCPDTCFSQ2021, subid = {2028}, title = {Comparison of radon mapping methods for the delineation of radon priority areas – an exercise}, journal = {Journal of the European Radon Association}, year = {2021}, month = {3}, day = {31}, volume = {2}, number = {2021}, number2 = {16ENV10: MetroRADON: Metrology for radon monitoring}, pages = {1-14}, keywords = {radon, mapping, prediction, interpolation, radon priority areas, risk, hazard}, web_url = {https://radonjournal.net/index.php/radon/article/view/5755}, misc2 = {EMPIR 2016: Environment}, publisher = {European Radon Association}, language = {30}, ISSN = {2736-2272}, DOI = {10.35815/radon.v2.5755}, stag_bib_extends_levelofaccess = {NA}, author = {Gruber, V. and Baumann, S. and Alber, O. and Laubichler, C. and Bossew, P. and Petermann, E. and Ciotoli, G. and Pereira , A. and Domingos, F. and Tondeur, F. and Cinelli, G. and Fernandez , A. and Sainz, C. and Quindos-Poncela, L.} } @Article { BukerSLWPM2021, subid = {2188}, title = {A unique test facility for calibration of domestic flow meters under dynamic flow conditions}, journal = {Flow Measurement and Instrumentation}, year = {2021}, month = {3}, day = {29}, volume = {79}, number2 = {17IND13: Metrowamet: Metrology for real-world domestic water metering}, keywords = {Test facility, Dynamic flow measurement, Domestic water meters, Calibration, Flow meter accuracy}, misc2 = {EMPIR 2017: Industry}, language = {30}, ISSN = {0955-5986}, DOI = {10.1016/j.flowmeasinst.2021.101934}, stag_bib_extends_levelofaccess = {NA}, author = {B{\"u}ker, O. and Stolt, K. and Lindstr{\"o}m, K. and Wennergren, P. and Penttinen, O. and Mattiasson, K.} } @Article { ManzinFV2021, subid = {1996}, title = {From Micromagnetic to In Silico Modeling of Magnetic Nanodisks for Hyperthermia Applications}, journal = {Advanced Theory and Simulations}, year = {2021}, month = {3}, day = {26}, volume = {4}, number = {3}, number2 = {18HLT06: RaCHy: Radiotherapy coupled with hyperthermia - adapting the biological equivalent dose concept}, pages = {2100013}, keywords = {Magnetic hyperthermia, Magnetic nanoparticles, Micromagnetic modeling, In silico modeling, Bioheat transfer equation}, web_url = {https://onlinelibrary.wiley.com/doi/full/10.1002/adts.202100013}, misc2 = {EMPIR 2018: Health}, publisher = {Wiley-VCH}, language = {30}, DOI = {10.1002/adts.202100013}, stag_bib_extends_levelofaccess = {NA}, author = {Manzin, A. and Ferrero, R. and Vicentini, M.} } @Article { PanuTTMAKF2021, subid = {2201}, title = {Real-time HCl gas detection at parts-per-billion level concentrations utilising a diode laser and a bismuth-doped fibre amplifier}, journal = {Measurement Science and Technology}, year = {2021}, month = {3}, day = {26}, volume = {32}, number = {5}, number2 = {17IND09: MetAMCII: Metrology for Airborne Molecular Contaminants II}, pages = {055206}, keywords = {gas sensing, photoacoustic spectroscopy, laser, bismuth, fibre, cleanroom}, misc2 = {EMPIR 2017: Industry}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-0233, 1361-6501}, DOI = {10.1088/1361-6501/abd651}, stag_bib_extends_levelofaccess = {NA}, author = {Panu, H. and Timo, R. and Thomas, F. and Makkonen, J. and Alyshev, S. and Kharakhordin, A. and Firstov, S.} } @Article { SilvaniATC2021, subid = {2021}, title = {Effect of the Interfacial Dzyaloshinskii–Moriya Interaction on the Spin Waves Eigenmodes of Isolated Stripes and Dots Magnetized In-Plane: A Micromagnetic Study}, journal = {Applied Sciences}, year = {2021}, month = {3}, day = {25}, volume = {11}, number = {7}, number2 = {17FUN08: TOPS: Metrology for topological spin structures}, pages = {2929}, keywords = {Micromagnetism, DMI, Magnetic dots}, misc2 = {EMPIR 2017: Fundamental}, publisher = {MDPI AG}, language = {30}, ISSN = {2076-3417}, DOI = {10.3390/app11072929}, stag_bib_extends_levelofaccess = {NA}, author = {Silvani, R. and Alunni, M. and Tacchi, S. and Carlotti, G.} } @Article { deKromBZMBiGFKHE2021, subid = {2071}, title = {Comparability of calibration strategies for measuring mercury concentrations in gas emission sources and the atmosphere}, journal = {Atmospheric Measurement Techniques}, year = {2021}, month = {3}, day = {25}, volume = {14}, number = {3}, number2 = {19NRM03: SI-Hg: Metrology for traceable protocols for elemental and oxidised mercury concentrations}, pages = {2317-2326}, keywords = {Mercury, Metrology, Calibration, SI-traceability, Environmental}, web_url = {https://amt.copernicus.org/articles/14/2317/2021/amt-14-2317-2021.html}, misc2 = {EMPIR 2019: Pre-Co-Normative}, publisher = {Copernicus GmbH}, language = {30}, ISSN = {1867-8548}, DOI = {10.5194/amt-14-2317-2021}, stag_bib_extends_levelofaccess = {NA}, author = {de Krom, I. and Bavius, W. and Ziel, R. and McGhee, E.A. and Brown, R.J.C. and Živković, I. and Gačnik, J. and Fajon, V. and Kotnik, J. and Horvat, M. and Ent, H.} } @Article { MetznerWFGKE2021, subid = {1989}, title = {Bayesian uncertainty quantification for magnetic resonance fingerprinting}, journal = {Physics in Medicine \& Biology}, year = {2021}, month = {3}, day = {23}, volume = {66}, number = {7}, number2 = {18HLT05: QUIERO: Quantitative MR-based imaging of physical biomarkers}, pages = {075006}, keywords = {MRF, Bayesian inference, uncertainty}, misc2 = {EMPIR 2018: Health}, publisher = {IOP Publishing}, language = {30}, ISSN = {0031-9155, 1361-6560}, DOI = {10.1088/1361-6560/abeae7}, stag_bib_extends_levelofaccess = {NA}, author = {Metzner, S. and W{\"u}bbeler, G. and Flassbeck, S. and Gatefait, C. and Kolbitsch, C. and Elster, C.} } @Article { LoslerEKR2021, subid = {2007}, title = {ILRS Reference Point Determination Using Close Range Photogrammetry}, journal = {Applied Sciences}, year = {2021}, month = {3}, day = {20}, volume = {11}, number = {6}, number2 = {18SIB01: GeoMetre: Large-scale dimensional measurements for geodesy}, pages = {2785}, keywords = {close range photogrammetry, bundle adjustment, reference point determination, unscentedtransformation, stochastic model, satellite laser ranging, GeoMetre}, web_url = {https://www.mdpi.com/2076-3417/11/6/2785}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {MDPI AG}, language = {30}, ISSN = {2076-3417}, DOI = {10.3390/app11062785}, stag_bib_extends_levelofaccess = {NA}, author = {L{\"o}sler, M. and Eschelbach, C. and Kl{\"u}gel, T. and Riepl, S.} } @Article { CrottiDGLL2021, subid = {2139}, title = {Extended SINDICOMP: Characterizing MV Voltage Transformers with Sine Waves}, journal = {Energies}, year = {2021}, month = {3}, day = {19}, volume = {14}, number = {6}, number2 = {19NRM05: IT4PQ: Measurement methods and test procedures for assessing accuracy of instrument transformers for power quality measurements}, pages = {1715}, keywords = {voltage transformer (VT); instrument transformer (IT); power system measurement; voltage measurement; harmonics; power quality (PQ); frequency response}, tags = {SEG}, web_url = {https://www.mdpi.com/1996-1073/14/6/1715}, misc2 = {EMPIR 2019: Pre-Co-Normative}, publisher = {MDPI AG}, language = {30}, ISSN = {1996-1073}, DOI = {10.3390/en14061715}, stag_bib_extends_levelofaccess = {NA}, author = {Crotti, G. and D’Avanzo, G. and Giordano, D. and Letizia, P.S. and Luiso, M.} } @Article { SchmidtGNBvZMBSHWR2021, subid = {2616}, title = {Bimodal behavior of microlasers investigated with a two-channel photon-number-resolving transition-edge sensor system}, journal = {Physical Review Research}, year = {2021}, month = {3}, day = {19}, volume = {3}, number = {1}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {013263}, keywords = {microlaser, transition-edge sensor, photon statistics, photon counting, nanophotonics}, web_url = {https://journals.aps.org/prresearch/abstract/10.1103/PhysRevResearch.3.013263}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2643-1564}, DOI = {10.1103/PhysRevResearch.3.013263}, stag_bib_extends_levelofaccess = {NA}, author = {Schmidt, M. and Grothe, I.H. and Neumeier, S. and Bremer, L. and von Helversen, M. and Zent, W. and Melcher, B. and Beyer, J. and Schneider, C. and H{\"o}fling, S. and Wiersig, J. and Reitzenstein, S.} } @Article { WuRSM2021, subid = {1999}, title = {Assessing the Impact of Data Filtering Techniques on Material Characterization at Millimeter-Wave Frequencies}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2021}, month = {3}, day = {18}, volume = {70}, number = {N/A}, number2 = {18SIB09: TEMMT: Traceability for electrical measurements at millimetre-wave and terahertz frequencies for communications and electronics technologies}, pages = {6005904}, keywords = {Data filtering, dielectric constant, loss tangent, millimeter-wave measurements, time-domain gating, vector network analyzer (VNA)}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IEEE}, language = {30}, ISSN = {1557-9662}, DOI = {10.1109/TIM.2021.3067224}, stag_bib_extends_levelofaccess = {NA}, author = {Wu, W. and Ridler, N. and Shang, X. and Ma, D.} } @Article { MelendezG2021, subid = {2058}, title = {Fast Quantification of Air Pollutants by Mid-Infrared Hyperspectral Imaging and Principal Component Analysis}, journal = {Sensors}, year = {2021}, month = {3}, day = {17}, volume = {20}, number = {6}, number2 = {16ENV08: IMPRESS 2: Metrology for air pollutant emissions}, pages = {2092}, keywords = {infrared imaging; multispectral and hyperspectral imaging; air pollution monitoring; remote sensing and sensors; spectroscopy; fourier transform; image processing}, misc2 = {EMPIR 2016: Environment}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s21062092}, stag_bib_extends_levelofaccess = {NA}, author = {Mel{\'e}ndez, J. and Guarnizo, G.} } @Article { CliffordMFHHKPRSP2021, subid = {2013}, title = {The importance of international standards for the graphene community}, journal = {Nature Reviews Physics}, year = {2021}, month = {3}, day = {15}, volume = {3}, number = {4}, number2 = {19NRM04: ISO-G-SCoPe: Standardisation of structural and chemical properties of graphene}, pages = {233-235}, keywords = {graphene, standards, ISO, IEC, 2D materials, standardisation}, web_url = {https://www.nature.com/articles/s42254-021-00278-6.epdf?sharing_token=_RIs5V6Xm7w_YnHU36ykhtRgN0jAjWel9jnR3ZoTv0NPpzni0dDHfaSDxkLVCOVw58FsyO6wELZUo5O32Eh0l-PBSDtirSTDnDrgEzBq40IQw69h7pcwLtLVCw2MuYIUVmHN0-WNNYkKy_jgkRmTZPKe2I2wUTrJd-QYBiq-ZrQ\%3D}, misc2 = {EMPIR 2019: Pre-Co-Normative}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2522-5820}, DOI = {dx.doi.org/10.1038/s42254-021-00278-6}, stag_bib_extends_levelofaccess = {NA}, author = {Clifford, C.A. and Martins Ferreira, E.H. and Fujimoto, T. and Herrmann, J. and Hight Walker, A.R. and Koltsov, D. and Punckt, C. and Ren, L. and Smallwood, G.J. and Pollard, A.J.} } @Article { EssBIMGV2021, subid = {2011}, title = {Optical and morphological properties of soot particles generated by the miniCAST 5201 BC generator}, journal = {Aerosol Science and Technology}, year = {2021}, month = {3}, day = {15}, number2 = {16ENV02: Black Carbon: Metrology for light absorption by atmospheric aerosols}, pages = {1-25}, keywords = {soot, miniCAST, morphology, optical properties, calibration aerosol, combustion generator}, web_url = {https://www.tandfonline.com/doi/full/10.1080/02786826.2021.1901847}, misc2 = {EMPIR 2016: Environment}, publisher = {Informa UK Limited}, address = {London, United Kingdom}, language = {30}, ISSN = {0278-6826, 1521-7388}, DOI = {10.1080/02786826.2021.1901847}, stag_bib_extends_levelofaccess = {NA}, author = {Ess, M.N. and Bert{\`o}, M. and Irwin, M. and Modini, R.L. and Gysel-Beer, M. and Vasilatou, K.} } @Article { GarberoglioH2021, subid = {1991}, title = {Path-integral calculation of the fourth virial coefficient of helium isotopes}, journal = {The Journal of Chemical Physics}, year = {2021}, month = {3}, day = {14}, volume = {154}, number = {10}, number2 = {18SIB02: Real-K: Realising the redefined kelvin}, pages = {104107}, keywords = {helium; virial coefficient; path integral}, web_url = {https://arxiv.org/abs/2101.02624}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {AIP Publishing}, language = {30}, ISSN = {0021-9606, 1089-7690}, DOI = {10.1063/5.0043446}, stag_bib_extends_levelofaccess = {NA}, author = {Garberoglio, G. and Harvey, A.H.} } @Proceedings { LoslerEH2021, subid = {2405}, title = {On the Impact of the Coordinate Representation onto the Estimates in Least-Squares Adjustment}, journal = {Proceedings of the 25th European VLBI for Geodesy and Astrometry (EVGA) Working Meeting}, year = {2021}, month = {3}, day = {14}, volume = {2021}, number2 = {18SIB01: GeoMetre: Large-scale dimensional measurements for geodesy}, pages = {49-55}, keywords = {Paraboloid, Least-Squares Adjustment, Sequential Quadratic Programming, Surface Analysis, Cartesian Coordinates, Polar Coordinates, GeoMetre}, web_url = {https://zenodo.org/record/5811948}, misc2 = {EMPIR 2018: SI Broader Scope}, event_place = {Gothenburg, Sweden}, event_name = {25th European VLBI for Geodesy and Astrometry (EVGA) Working Meeting}, event_date = {14-03-2021 to 18-03-2021}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://doi.org/10.5281/zenodo.5811948}, author = {L{\"o}sler, M. and Eschelbach, C. and Holst, C} } @Article { Rovira2021, subid = {1978}, title = {Calibration set-up for energy measuring systems installed in AC railway systems}, journal = {IEEE Vehicle Power and Propulsion Conference}, year = {2021}, month = {3}, day = {12}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, keywords = {Energy measurement, calibration set-up, on-board calibration, railway system, energy measuring system, phantom source, harmonic wave-shape, distorted regime}, misc2 = {EMPIR 2016: Energy}, language = {30}, DOI = {10.5281/zenodo.4588726}, stag_bib_extends_levelofaccess = {NA}, author = {Rovira, J.} } @Article { Rovira2021_2, subid = {1977}, title = {Reference Energy Measuring System for On-Board Calibration of EMS Installed in Locomotives}, journal = {International Conference on Sensors Engineering and Electronics Instrumentation Advances}, year = {2021}, month = {3}, day = {12}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, keywords = {Energy measurement, energy measuring system, calibration set-up, on-board calibration, railway system, harmonic, distorted regime.}, misc2 = {EMPIR 2016: Energy}, language = {30}, DOI = {10.5281/zenodo.4588736}, stag_bib_extends_levelofaccess = {NA}, author = {Rovira, J.} } @Article { EichstadtGVSBK2021, subid = {2301}, title = {Toward Smart Traceability for Digital Sensors and the Industrial Internet of Things}, journal = {Sensors}, year = {2021}, month = {3}, day = {12}, volume = {21}, number = {6}, number2 = {17IND12: Met4FoF: Metrology for the Factory of the Future}, pages = {2019}, keywords = {Internet of Things, calibration, measurement uncertainty, traceability, semantics, ontology, sensor network, digital sensors, redundancy}, misc2 = {EMPIR 2017: Industry}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s21062019}, stag_bib_extends_levelofaccess = {NA}, author = {Eichst{\"a}dt, S. and Gruber, M. and Vedurmudi, A.P. and Seeger, B. and Bruns, T. and Kok, G.} } @Article { AsconeKWKK2021_2, subid = {2541}, title = {A longitudinal, randomized experimental pilot study to investigate the effects of airborne ultrasound on human mental health, cognition, and brain structure}, journal = {Scientific Reports}, year = {2021}, month = {3}, day = {12}, volume = {11}, number = {1}, number2 = {15HLT03: Ears II: Metrology for modern hearing assessment and protecting public health from emerging noise sources}, pages = {5814-5823}, keywords = {air-borne ultrasound, noise assessment, functional magnetic resonance imaging}, misc2 = {EMPIR 2015: Health}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2045-2322}, DOI = {10.1038/s41598-021-83527-z}, stag_bib_extends_levelofaccess = {NA}, author = {Ascone, L. and Kling, C. and Wieczorek, J. and Koch, C. and K{\"u}hn, S.} } @Article { KenbarS2021, subid = {1774}, title = {Influence of flow disturbances on the performance of industry-standard LNG flow meters}, journal = {Flow Measurement and Instrumentation}, year = {2021}, month = {3}, volume = {77}, number2 = {16ENG09: LNG III: Metrological support for LNG and LBG as transport fuel}, pages = {101871}, keywords = {LNG Liquid nitrogen Calibration Cryogenic Flow meter Flow disturbance Custody transfer}, tags = {EnG}, misc2 = {EMPIR 2016: Energy}, publisher = {Elsevier BV}, language = {30}, ISSN = {0955-5986}, DOI = {10.1016/j.flowmeasinst.2020.101871}, stag_bib_extends_levelofaccess = {NA}, author = {Kenbar, A. and Schakel, M.} } @Article { IurlaroBCBFKMMMNNSVWi2021, subid = {2018}, title = {Study on the uncertainty of passive area dosimetry systems for environmental radiation monitoring in the framework of the EMPIR “Preparedness” project}, journal = {Radiation Measurements}, year = {2021}, month = {3}, volume = {142}, number2 = {16ENV04: Preparedness: Metrology for mobile detection of ionising radiation following a nuclear or radiological incident}, pages = {106543}, keywords = {Passive dosimetry systems, Uncertainty budget, Decision threshold, Detection limitEnvironmental radiation monitoring, Emergency preparedness}, misc2 = {EMPIR 2016: Environment}, publisher = {Elsevier BV}, language = {30}, ISSN = {1350-4487}, DOI = {10.1016/j.radmeas.2021.106543}, stag_bib_extends_levelofaccess = {NA}, author = {Iurlaro, G. and Baranowska, Z. and Campani, L. and Bjelac, O.C. and Ferrari, P. and Knežević, Ž. and Majer, M. and Mariotti, F. and Morelli, B. and Neumaier, S. and Nodilo, M. and Sperandio, L. and Vittoria, F.A. and Wołoszczuk, K. and Živanović, M.} } @Article { FailleauFBRHH2021, subid = {1993}, title = {Metal-carbon eutectic high temperature fixed points for in-situ calibration of radiation thermometers}, journal = {High Temperatures-High Pressures}, year = {2021}, month = {3}, volume = {50}, number = {2}, number2 = {17IND11: Hi-TRACE: Industrial process optimisation through improved metrology of thermophysical properties}, pages = {149-165}, keywords = {Thermal Diffusivity, High Temperature, Radiation Thermometry, Fixed-Point}, web_url = {https://www.oldcitypublishing.com/journals/hthp-home/hthp-issue-contents/hthp-volume-50-number-2-2021/19302-2/}, misc2 = {EMPIR 2017: Industry}, publisher = {Old City Publishing}, language = {30}, ISSN = {1472-3441}, DOI = {10.32908/hthp.v50.1013}, stag_bib_extends_levelofaccess = {NA}, author = {Failleau, G. and Fleurence, N. and Beaumont, O. and Razouk, R. and Hameury, J. and Hay, B.} } @Article { RuhleKH2021, subid = {2046}, title = {Workflow towards automated segmentation of agglomerated, non-spherical particles from electron microscopy images using artificial neural networks}, journal = {Scientific Reports}, year = {2021}, month = {3}, volume = {11}, number = {1}, number2 = {17NRM04: nPSize: Improved traceability chain of nanoparticle size measurements}, pages = {10}, keywords = {Artificial intelligence;Automated image analysis;Electron microscopy;Image segmentation;Neural networks}, web_url = {https://www.nature.com/articles/s41598-021-84287-6.pdf}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2045-2322}, DOI = {10.1038/s41598-021-84287-6}, stag_bib_extends_levelofaccess = {NA}, author = {R{\"u}hle, B. and Krumrey, J.F. and Hodoroaba, V-D.} } @Article { HaveML2021, subid = {2087}, title = {Time Domain Analysis of Current Transducer Responses Using Impulsive Signals}, journal = {IEEE Letters on Electromagnetic Compatibility Practice and Applications}, year = {2021}, month = {3}, volume = {3}, number = {1}, number2 = {17NRM02: MeterEMI: Electromagnetic Interference on Static Electricity Meters}, pages = {19-23}, keywords = {Current transducer, Impulsive signals, Nonlinear behavior, Time domain parameters, Wide-band}, web_url = {https://research.utwente.nl/en/publications/time-domain-analysis-of-current-transducer-responses-using-impuls}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {2637-6423}, DOI = {10.1109/LEMCPA.2020.3031986}, stag_bib_extends_levelofaccess = {NA}, author = {Have, B. t. and Moonen, N. and Leferink, F.} } @Article { KietheTLKMM2021, subid = {2421}, title = {Finite-temperature spectrum at the symmetry-breaking linear to zigzag transition}, journal = {Physical Review B}, year = {2021}, month = {3}, volume = {103}, number = {10}, number2 = {17FUN07: CC4C: Coulomb Crystals for Clocks}, pages = {104106}, keywords = {research areas, second order phase transitions, structural phase transition, physical systems, trapped ions, techniques, atom and ion cooling, molecular dynamics, atomic, molecular and optical}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society}, language = {30}, ISSN = {ISSN 2469-9969 (online), 2469-}, DOI = {10.1103/PhysRevB.103.104106}, stag_bib_extends_levelofaccess = {NA}, author = {Kiethe, J. and Timm, L. and Landa, H. and Kalincev, D. and Morigi, G. and Mehlst{\"a}ubler, T.E.} } @Article { RodtR2021, subid = {2615}, title = {High-performance deterministic in situ electron-beam lithography enabled by cathodoluminescence spectroscopy}, journal = {Nano Express}, year = {2021}, month = {3}, volume = {2}, number = {1}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {014007}, keywords = {in situ EBL, deterministic processing, cathodoluminescence spectroscopy, quantum dots, nanophotonics}, web_url = {https://iopscience.iop.org/article/10.1088/2632-959X/abed3c}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {2632-959X}, DOI = {10.1088/2632-959X/abed3c}, stag_bib_extends_levelofaccess = {NA}, author = {Rodt, S. and Reitzenstein, S.} } @Article { RipaIGSGFBLDG2021, subid = {2645}, title = {Refractive index gas thermometry between 13.8 K and 161.4 K}, journal = {Metrologia}, year = {2021}, month = {3}, volume = {58}, number = {2}, number2 = {18SIB02: Real-K: Realising the redefined kelvin}, pages = {025008}, keywords = {refractive index gas thermometry, thermodynamic temperature, ITS-90,microwave resonator}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/abe249}, stag_bib_extends_levelofaccess = {NA}, author = {Ripa, D.M. and Imbraguglio, D. and Gaiser, C. and Steur, P.P.M. and Giraudi, D. and Fogliati, M. and Bertinetti, M. and Lopardo, G. and Dematteis, R. and Gavioso, R.M.} } @Article { HuggettML2021, subid = {2682}, title = {COVID-19 new diagnostics development: novel detection methods for SARS-CoV-2 infection and considerations for their translation to routine use}, journal = {Current Opinion in Pulmonary Medicine}, year = {2021}, month = {3}, volume = {27}, number = {3}, number2 = {18HLT03: SEPTIMET: Metrology to enable rapid and accurate clinical measurements in acute management of sepsis}, pages = {155-162}, keywords = {accuracy, diagnosis, diagnostics, point of care, SARS-CoV-2}, web_url = {https://journals.lww.com/co-pulmonarymedicine/Fulltext/2021/05000/COVID_19_new_diagnostics_development__novel.4.aspx}, misc2 = {EMPIR 2018: Health}, publisher = {Ovid Technologies (Wolters Kluwer Health)}, language = {30}, ISSN = {1070-5287, 1531-6971}, DOI = {10.1097/MCP.0000000000000768}, stag_bib_extends_levelofaccess = {NA}, author = {Huggett, J.F. and Moran-Gilad, J. and Lee, J.E.} } @Article { GogyanTZ2021, subid = {2734}, title = {Multi-reference ab initio calculations of Hg spectral data and analysis of magic and zero-magic wavelengths}, journal = {Optics Express}, year = {2021}, month = {3}, volume = {29}, number = {6}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, pages = {8654}, keywords = {Hg spectrum, magic wavelength}, misc2 = {EMPIR 2017: Fundamental}, publisher = {The Optical Society}, language = {30}, ISSN = {1094-4087}, DOI = {10.1364/OE.416106}, stag_bib_extends_levelofaccess = {NA}, author = {Gogyan, A. and Tecmer, P. and Zawada, M.} } @Article { DiCapuaMSDVCFFV2021, subid = {1927}, title = {Analysis of Dynamic Wireless Power Transfer Systems Based on Behavioral Modeling of Mutual Inductance}, journal = {Sustainability}, year = {2021}, month = {2}, day = {26}, volume = {13}, number = {5}, number2 = {16ENG08: MICEV: Metrology for inductive charging of electric vehicles}, pages = {2556}, keywords = {behavioral modeling; inductive coupling; mutual inductance; wireless power transfer}, web_url = {https://www.mdpi.com/2071-1050/13/5/2556}, misc2 = {EMPIR 2016: Energy}, publisher = {MDPI AG}, language = {30}, ISSN = {2071-1050}, DOI = {10.3390/su13052556}, stag_bib_extends_levelofaccess = {NA}, author = {Di Capua, G. and Maffucci, A. and Stoyka, K. and Di Mambro, G. and Ventre, S. and Cirimele, V. and Freschi, F. and Femia, N. and Villone, F.} } @Article { vandenBergDOPD2021, subid = {2217}, title = {Calibration of a CubeSat spectroradiometer with a narrow-band widely tunable radiance source}, journal = {Applied Optics}, year = {2021}, month = {2}, day = {26}, volume = {60}, number = {7}, number2 = {16ENV03: MetEOC-3: Further metrology for earth observation and climate}, pages = {1995}, keywords = {CubeSat, Calibration, Spectroradiometer}, misc2 = {EMPIR 2016: Environment}, publisher = {The Optical Society}, language = {30}, ISSN = {1559-128X, 2155-3165}, DOI = {10.1364/AO.417467}, stag_bib_extends_levelofaccess = {NA}, author = {van den Berg, S. and Dekker, P. and Otter, G. and P{\'a}scoa, M.P. and Dijkhuizen, N.} } @Article { JobbagyMS2021, subid = {1920}, title = {Preparation of multi-purpose radon emanation sources}, journal = {Journal of Radioanalytical and Nuclear Chemistry}, year = {2021}, month = {2}, day = {25}, number2 = {16ENV10: MetroRADON: Metrology for radon monitoring}, keywords = {radon emanation, chemisorption, drop deposition, radon-in-water}, misc2 = {EMPIR 2016: Environment}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {0236-5731, 1588-2780}, DOI = {10.1007/s10967-021-07630-1}, stag_bib_extends_levelofaccess = {NA}, author = {Jobb{\'a}gy, V. and Marouli, M. and Stroh, H.} } @Article { OkhapkinTSSBP2021, subid = {2227}, title = {The thorium-229 low-energy isomer and the nuclear clock}, journal = {Nature Reviews Physics}, year = {2021}, month = {2}, day = {25}, volume = {3}, number = {4}, number2 = {17FUN07: CC4C: Coulomb Crystals for Clocks}, pages = {238-248}, keywords = {Atomic and molecular interactions with photonsExperimental nuclear physics}, web_url = {https://oar.ptb.de/resources/show/10.7795/120.20211006}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2522-5820}, DOI = {10.1038/s42254-021-00286-6}, stag_bib_extends_levelofaccess = {NA}, author = {Okhapkin, M.V. and Thielking, J. and Schumm, T. and Sikorsky, T. and Beeks, K. and Peik, E.} } @Article { XuLFPB2021, subid = {1914}, title = {Investigating the Trackability of Silicon Microprobes in High-Speed Surface Measurements}, journal = {Sensors}, year = {2021}, month = {2}, day = {24}, volume = {21}, number = {5}, number2 = {17IND05: MicroProbes: Multifunctional ultrafast microprobes for on-the-machine measurements}, pages = {1557}, keywords = {roughness measurement, piezoresistive microprobe, high-speed surface measurement}, misc2 = {EMPIR 2017: Industry}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s21051557}, stag_bib_extends_levelofaccess = {NA}, author = {XU, M. and Li, Z. and Fahrbach, M. and Peiner, E. and Brand, U.} } @Thesis { Losler2021, subid = {1926}, title = {Modellbildungen zur Signalweg- und in-situ Referenzpunktbestimmung von VLBI-Radioteleskopen}, year = {2021}, month = {2}, day = {24}, number2 = {18SIB01: GeoMetre: Large-scale dimensional measurements for geodesy}, keywords = {Radioteleskop, Laserteleskop, Referenzpunkt, Deformation, Ring-Fokus-Paraboloid, VLBI, SLR, GGOS, VGOS, ITRF, Local Tie, Sequentielle Quadratische Programmierung, Bias, Unscented Transformation, Parametersch{\"a}tzung, radio telescope, laser telescope, ring-focus paraboloid, sequential quadratic programming, parameter estimation}, web_url = {https://depositonce.tu-berlin.de/handle/11303/12545}, misc2 = {EMPIR 2018: SI Broader Scope}, school = {Technischen Universit{\"a}t Berlin}, language = {43}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {http://dx.doi.org/10.14279/depositonce-11364}, author = {L{\"o}sler, M.} } @Article { ZuccaCBSLCTFP2021, subid = {1918}, title = {Assessment of the Overall Efficiency in WPT Stations for Electric Vehicles}, journal = {Sustainability}, year = {2021}, month = {2}, day = {24}, volume = {13}, number = {5}, number2 = {16ENG08: MICEV: Metrology for inductive charging of electric vehicles}, pages = {2436}, keywords = {electric vehicles; inductive charging; measurement uncertainty; power system measurements}, misc2 = {EMPIR 2016: Energy}, publisher = {MDPI AG}, language = {30}, ISSN = {2071-1050}, DOI = {10.3390/su13052436}, stag_bib_extends_levelofaccess = {NA}, author = {Zucca, M. and Cirimele, V. and Bruna, J. and Signorino, D. and Laporta, E. and Colussi, J. and Tejedor, M.A.A. and Fissore, F. and Pogliano, U.} } @Article { SeegerOCGSSOALGFGKB2021, subid = {2069}, title = {Quantification of Element Mass Concentrations in Ambient Aerosols by Combination of Cascade Impactor Sampling andMobile Total Reflection X-ray Fluorescence Spectroscopy}, journal = {Atmosphere}, year = {2021}, month = {2}, day = {21}, volume = {12}, number = {3}, number2 = {19ENV08: AEROMET II: Advanced aerosol metrology for atmospheric science and air quality}, pages = {309-326}, keywords = {TXRF, reference method, cascade impactor, ambient aerosols, particles, air qualitymonitoring, element mass concentration, size resolved chemical composition, time resolved chemicalcomposition, ICP-MS}, misc2 = {EMPIR 2019: Environment}, publisher = {MDPI}, language = {30}, ISSN = {EISSN 2073-4433}, DOI = {10.3390/atmos12030309}, stag_bib_extends_levelofaccess = {NA}, author = {Seeger, S. and Os{\'a}n, J. and Cz{\"o}mp{\"o}ly, O. and Gross, A. and Sto{\ss}nach, H. and Stabile, L. and Ochsenkuehn-Petropoulou, M. and Areti Tsakanika, L. and Lymperopoulou, T. and Goddard, S. and Fiebig, M. and Gaie-Levrel, F. and Kayser, Y. and Beckhoff, B.} } @Article { SeegerOCGSSOALGFGKB20210, subid = {2069}, title = {Quantification of Element Mass Concentrations in Ambient Aerosols by Combination of Cascade Impactor Sampling andMobile Total Reflection X-ray Fluorescence Spectroscopy}, journal = {Atmosphere}, year = {2021}, month = {2}, day = {21}, volume = {12}, number = {3}, number2 = {16ENV07: AEROMET: Aerosol metrology for atmospheric science and air quality}, pages = {309-326}, keywords = {TXRF, reference method, cascade impactor, ambient aerosols, particles, air qualitymonitoring, element mass concentration, size resolved chemical composition, time resolved chemicalcomposition, ICP-MS}, misc2 = {EMPIR 2016: Environment}, publisher = {MDPI}, language = {30}, ISSN = {EISSN 2073-4433}, DOI = {10.3390/atmos12030309}, stag_bib_extends_levelofaccess = {NA}, author = {Seeger, S. and Os{\'a}n, J. and Cz{\"o}mp{\"o}ly, O. and Gross, A. and Sto{\ss}nach, H. and Stabile, L. and Ochsenkuehn-Petropoulou, M. and Areti Tsakanika, L. and Lymperopoulou, T. and Goddard, S. and Fiebig, M. and Gaie-Levrel, F. and Kayser, Y. and Beckhoff, B.} } @Article { SeegerOCGSSOALGFGKB20211, subid = {2069}, title = {Quantification of Element Mass Concentrations in Ambient Aerosols by Combination of Cascade Impactor Sampling andMobile Total Reflection X-ray Fluorescence Spectroscopy}, journal = {Atmosphere}, year = {2021}, month = {2}, day = {21}, volume = {12}, number = {3}, number2 = {19ENV08: AEROMET II: Advanced aerosol metrology for atmospheric science and air quality}, pages = {309-326}, keywords = {TXRF, reference method, cascade impactor, ambient aerosols, particles, air qualitymonitoring, element mass concentration, size resolved chemical composition, time resolved chemicalcomposition, ICP-MS}, misc2 = {EMPIR 2019: Environment}, publisher = {MDPI}, language = {30}, ISSN = {EISSN 2073-4433}, DOI = {10.3390/atmos12030309}, stag_bib_extends_levelofaccess = {NA}, author = {Seeger, S. and Os{\'a}n, J. and Cz{\"o}mp{\"o}ly, O. and Gross, A. and Sto{\ss}nach, H. and Stabile, L. and Ochsenkuehn-Petropoulou, M. and Areti Tsakanika, L. and Lymperopoulou, T. and Goddard, S. and Fiebig, M. and Gaie-Levrel, F. and Kayser, Y. and Beckhoff, B.} } @Article { SassiKL2012, subid = {2000}, title = {Reproducibility of the Quantification of Reversible Wall Interactions in VOC Sampling Lines}, journal = {Atmosphere}, year = {2021}, month = {2}, day = {20}, volume = {12}, number = {2}, number2 = {19ENV06: MetClimVOC: Metrology for climate relevant volatile organic compounds}, pages = {280}, keywords = {VOC measurements, surface interaction, gas sampling, acetone, Sulfinert®, equilibrium, uncertainty}, misc2 = {EMPIR 2019: Environment}, publisher = {MDPI}, language = {30}, ISSN = {2073-4433}, DOI = {10.3390/atmos12020280}, stag_bib_extends_levelofaccess = {NA}, author = {Sassi, G. and Khan, B.A. and Lecuna, M.} } @Article { PanSPRDRGP2021, subid = {2056}, title = {Direct comparison of ITS-90 and PLTS-2000 from 0.65 K to 1 K at LNE-CNAM}, journal = {Metrologia}, year = {2021}, month = {2}, day = {19}, volume = {58}, number = {2}, number2 = {18SIB02: Real-K: Realising the redefined kelvin}, pages = {025005}, keywords = {temperature range between 0.65 K and 1 K, uncertainty component, resistance thermometer}, web_url = {https://iopscience.iop.org/article/10.1088/1681-7575/abd845/pdf}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/abd845}, stag_bib_extends_levelofaccess = {NA}, author = {Pan, C. and Sparasci, F. and Plimmer, M. and Risegari, L. and Daugas, J-M. and Rouille, G. and Gao, B. and Pitre, L.} } @Article { WundrackMDSPMSSSSB2021, subid = {2491}, title = {Liquid metal intercalation of epitaxial graphene: Large-area gallenene layer fabrication through gallium self-propagation at ambient conditions}, journal = {Physical Review Materials}, year = {2021}, month = {2}, day = {19}, volume = {5}, number = {2}, number2 = {17FUN08: TOPS: Metrology for topological spin structures}, keywords = {graphene, epitaxy, intercalation, 2-dimensional systems, condensed matter}, web_url = {https://arxiv.org/abs/1905.12438}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2475-9953}, DOI = {10.1103/PhysRevMaterials.5.024006}, stag_bib_extends_levelofaccess = {NA}, author = {Wundrack, S. and Momeni, D. and Dempwolf, W. and Schmidt, N. and Pierz, K. and Michaliszyn, L. and Spende, H. and Schmidt, A. and Schumacher, H.W. and Stosch, R. and Bakin, A.} } @Article { MariscottiGSDG2021, subid = {1995}, title = {How Pantograph Electric Arcs affect Energy Efficiency in DC Railway Vehicles}, journal = {2020 IEEE Vehicle Power and Propulsion Conference}, year = {2021}, month = {2}, day = {18}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, keywords = {Electric arc, Energy consumption, Power Quality, Power supply transient, Power system transients, Rail transportation, Rolling Stock}, tags = {SEG}, misc2 = {EMPIR 2016: Energy}, language = {30}, DOI = {10.5281/zenodo.4646848}, stag_bib_extends_levelofaccess = {NA}, author = {Mariscotti, A. and Giordano, D. and Signorino, D. and Delle Femine, A. and Gallo, D.} } @Manual { BrunaRomeroPLHFCBAZZG2021, subid = {1907}, title = {Best practice guide for the assessment of EMF exposure from vehicle Wireless Power Transfer systems}, year = {2021}, month = {2}, day = {17}, number2 = {16ENG08: MICEV: Metrology for inductive charging of electric vehicles}, keywords = {Dosimetry, Guidelines, Magnetic field measurements, Magnetic field calculation, Numerical models, Uncertainty, Wireless Power Transfer, Electric Vehicle}, web_url = {https://www.micev.eu/theme/inrim/assets/doc/BPG_Micev_2021.pdf}, misc2 = {EMPIR 2016: Energy}, publisher = {INRIM}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {ISBN: 978-88-945324-1-8}, author = {Bruna Romero, J. and Pichon, L. and Laporta, E. and Harmon, S. and Freschi, F. and Clarke, B. and Bottauscio, O. and Ankarson, P. and Zilberti, L. and Zucca, M. and Guilizzoni, R.} } @Article { HorenderAQSNDSWAKGV2021, subid = {1901}, title = {Facility for production of ambient-like model aerosols (PALMA) in the laboratory: application in the intercomparison of automated PM monitors with the reference gravimetric method}, journal = {Atmospheric Measurement Techniques}, year = {2021}, month = {2}, day = {16}, number2 = {16ENV07: AEROMET: Aerosol metrology for atmospheric science and air quality}, keywords = {ambient-like aerosols, particulate matter, calibration , PM monitors}, web_url = {https://amt.copernicus.org/articles/14/1225/2021/amt-14-1225-2021.html}, misc2 = {EMPIR 2016: Environment}, language = {30}, DOI = {10.5194/amt-14-1225-2021}, stag_bib_extends_levelofaccess = {NA}, author = {Horender, S. and Auderset, K. and Quincey, P. and Seeger, S. and Nielsen Skov, S. and Dirscherl, K. and Smith, T.O.M. and Williams, K. and Aegerter, C.C. and Kalbermatter, D.M. and Gaie-Levrel, F. and Vasilatou, K.} } @Article { FernandezScarioniBCSHALRCKS2021, subid = {2055}, title = {Thermoelectric Signature of Individual Skyrmions}, journal = {Physical Review Letters}, year = {2021}, month = {2}, day = {16}, volume = {126}, number = {7}, number2 = {17FUN08: TOPS: Metrology for topological spin structures}, pages = {1-6/077202}, keywords = {Magnetism, Nernst effect, Skyrmions, Thermomagnetic effects}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {0031-9007, 1079-7114}, DOI = {10.1103/PhysRevLett.126.077202}, stag_bib_extends_levelofaccess = {NA}, author = {Fern{\'a}ndez Scarioni, A. and Barton, C. and Corte-Le{\'o}n, H. and Sievers, S. and Hu, X. and Ajejas, F. and Legrand, W. and Reyren, N. and Cros, V. and Kazakova, O. and Schumacher, H.W.} } @Article { KuttTSLKSL2021, subid = {2184}, title = {Strengths of Acids in Acetonitrile}, journal = {European Journal of Organic Chemistry}, year = {2021}, month = {2}, day = {16}, volume = {2021}, number = {9}, number2 = {17FUN09: UnipHied: Realisation of a Unified pH Scale}, pages = {1407-1419}, keywords = {acidity;acetonitrile pKa scale}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Wiley}, language = {30}, ISSN = {1434-193X, 1099-0690}, DOI = {10.1002/ejoc.202001649}, stag_bib_extends_levelofaccess = {NA}, author = {K{\"u}tt, A. and Tshepelevitsh, S. and Saame, J. and L{\~o}kov, M. and Kaljurand, I. and Selberg, S. and Leito, I.} } @Article { BenedictoOrenesMMW2021, subid = {2743}, title = {Criticality-enhanced quantum sensing in ferromagnetic Bose-Einstein condensates: Role of readout measurement and detection noise}, journal = {Physical Review A}, year = {2021}, month = {2}, day = {16}, volume = {103}, number = {2}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, keywords = {BEC, Detection noise, quantum sensing}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2469-9926, 2469-9934}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://arxiv.org/abs/2010.13133}, author = {Benedicto Orenes, D. and Mirkhalaf, S.S. and Mitchell, M.W. and Witkowska, E.} } @Article { BuonincontriKKMGCDCCMFMGSRZ2021, subid = {1697}, title = {Three dimensional MRF obtains highly repeatable and reproducible multi-parametric estimations in the healthy human brain at 1.5T and 3T}, journal = {NeuroImage}, year = {2021}, month = {2}, volume = {226}, number2 = {18HLT05: QUIERO: Quantitative MR-based imaging of physical biomarkers}, pages = {117573}, keywords = {MRI, Quantitation, Relaxometry, Brain, MR fingerprinting, Three dimensional, 3D}, web_url = {https://www.sciencedirect.com/science/article/pii/S1053811920310582?via\%3Dihub}, misc2 = {EMPIR 2018: Health}, publisher = {Elsevier BV}, language = {30}, ISSN = {1053-8119}, DOI = {10.1016/j.neuroimage.2020.117573}, stag_bib_extends_levelofaccess = {NA}, author = {Buonincontri, G. and Kurzawski, J.W. and Kaggie, J.D. and Matys, T. and Gallagher, F.A. and Cencini, M. and Donatelli, G. and Cecchi, P. and Cosottini, M. and Martini, N. and Frijia, F. and Montanaro, D. and G{\'o}mez, P.A. and Schulte, R.F. and Retico, A. and Zilberti, L.} } @Article { MelinCW2021, subid = {1908}, title = {The Role of Entropy in Construct Specification Equations (CSE) to Improve the Validity of Memory Tests}, journal = {Entropy}, year = {2021}, month = {2}, volume = {23}, number = {2}, number2 = {18HLT09: Neuromet2: Metrology and innovation for early diagnosis and accurate stratification of patients with neurodegenerative diseases}, pages = {212}, keywords = {entropy, information, metrology, measurement system analysis, Rasch, cognition, memory, task difficulty, person ability, neurodegenerative diseases, cognitive neuroscience}, misc2 = {EMPIR 2018: Health}, publisher = {MDPI AG}, language = {30}, ISSN = {1099-4300}, DOI = {10.3390/e23020212}, stag_bib_extends_levelofaccess = {NA}, author = {Melin, J. and Cano, S. and Webster, W.} } @Article { GarciaAsenjoBAG2021, subid = {1924}, title = {Development of a Submillimetric GNSS-Based Distance Meter for Length Metrology}, journal = {Sensors}, year = {2021}, month = {2}, volume = {21}, number = {4}, number2 = {18SIB01: GeoMetre: Large-scale dimensional measurements for geodesy}, pages = {1145}, keywords = {Global Navigation Satellite Systems (GNSS), length; metrology, multipath}, web_url = {https://www.mdpi.com/1424-8220/21/4/1145}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s21041145}, stag_bib_extends_levelofaccess = {NA}, author = {Garc{\'i}a-Asenjo, L. and Baselga, S. and Atkins, C. and Garrigues, P.} } @Article { ModiniCBIBPFEHMLMG2021, subid = {2010}, title = {Detailed characterization of the CAPS single-scattering albedo monitor (CAPS PMssa) as a field-deployable instrument for measuring aerosol light absorption with the extinction-minus-scattering method}, journal = {Atmospheric Measurement Techniques}, year = {2021}, month = {2}, volume = {14}, number = {2}, number2 = {16ENV02: Black Carbon: Metrology for light absorption by atmospheric aerosols}, pages = {819-851}, keywords = {miniCAST 5201 black carbon (BC) generator; particle morphology; nanostructure; optical properties; photoacoustic absorption coefficient}, misc2 = {EMPIR 2016: Environment}, publisher = {Copernicus GmbH}, language = {30}, ISSN = {1867-8548}, DOI = {10.5194/amt-14-819-2021}, stag_bib_extends_levelofaccess = {NA}, author = {Modini, R.L. and Corbin, J.C. and Brem, B.T. and Irwin, M. and Bert{\`o}, M. and Pileci, R.E. and Fetfatzis, P. and Eleftheriadis, K. and Henzing, B. and Moerman, M.M. and Liu, F. and M{\"u}ller, T. and Gysel-Beer, M.} } @Article { LauchtHUFRSSSKDYYKBPHSOMVLKTCGMMJB2021, subid = {2093}, title = {Roadmap on quantum nanotechnologies}, journal = {Nanotechnology}, year = {2021}, month = {2}, volume = {32}, number = {16}, number2 = {17FUN04: SEQUOIA: Single-electron quantum optics for quantum-enhanced measurements}, pages = {162003}, keywords = {Nanotechnology, metrology, sensing, single-electrons, low-dimensional systems, roadmap}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-4484, 1361-6528}, DOI = {10.1088/1361-6528/abb333}, stag_bib_extends_levelofaccess = {NA}, author = {Laucht, A. and Hohls, F. and Ubbelohde, N. and Fernando Gonzalez-Zalba, M. and Reilly, D.J. and Stobbe, S. and Schr{\"o}der, T. and Scarlino, P. and Koski, J.V. and Dzurak, A. and Yang, C-H. and Yoneda, J. and Kuemmeth, F. and Bluhm, H. and Pla, J. and Hill, C. and Salfi, J. and Oiwa, A. and Muhonen, J.T. and Verhagen, E. and LaHaye, M.D. and Kim, H.H. and Tsen, A.W. and Culcer, D. and Geresdi, A. and Mol, J.A. and Mohan, V. and Jain, P.K. and Baugh, J.} } @Article { ChenSDOLHCC2021, subid = {2425}, title = {Quantitative Assessment of Carrier Density by Cathodoluminescence. I. GaAs thin films and modeling}, journal = {Phys. Rev. Applied}, year = {2021}, month = {2}, volume = {15}, number2 = {19ENG05: NanoWires: High throughput metrology for nanowire energy harvesting devices}, pages = {024006}, keywords = {GaAs, thin films, CL, doping, nanostructures}, misc2 = {EMPIR 2019: Energy}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://arxiv.org/abs/1909.05598}, author = {Chen, H.-L. and Scaccabarozzi, A. and De L{\'e}pinau, R. and Oehler, F. and Lemaıtre, A. and Harmand, J.-C. and Cattoni, A. and Collin, S.} } @Article { ChenDSOHCC2021, subid = {2475}, title = {Quantitative Assessment of Carrier Density by Cathodoluminescence. II. GaAs nanowires}, journal = {Phys. Rev. Applied}, year = {2021}, month = {2}, volume = {15}, number2 = {19ENG05: NanoWires: High throughput metrology for nanowire energy harvesting devices}, pages = {024007}, keywords = {GaAs nanowires, high-resolution cathodoluminescence (CL) mapping}, web_url = {https://journals.aps.org/prapplied/pdf/10.1103/PhysRevApplied.15.024007}, misc2 = {EMPIR 2019: Energy}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://arxiv.org/abs/1909.05602}, author = {Chen, H.-L. and De L{\'e}pinau, R. and Scaccabarozzi, A. and Oehler, F. and Harmand, J.-C. and Cattoni, A. and Collin, S.} } @Article { AsconeKWKK2021, subid = {2540}, title = {A longitudinal, randomized experimental pilot study to investigate the effects of airborne infrasound on human mental health, cognition, and brain structure}, journal = {Scientific Reports}, year = {2021}, month = {2}, volume = {11}, number = {1}, number2 = {15HLT03: Ears II: Metrology for modern hearing assessment and protecting public health from emerging noise sources}, pages = {3190 - 3199}, keywords = {infrasound, long-time study, functional magnetic resonance imaging}, misc2 = {EMPIR 2015: Health}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2045-2322}, DOI = {10.1038/s41598-021-82203-6}, stag_bib_extends_levelofaccess = {NA}, author = {Ascone, L. and Kling, C. and Wieczorek, J. and Koch, C. and K{\"u}hn, S.} } @Article { KoutsourakisEKB2021, subid = {1948}, title = {High resolution linearity measurements of photovoltaic devices using digital light processing projection}, journal = {Measurement Science and Technology}, year = {2021}, month = {1}, day = {29}, number2 = {16ENG02: PV-Enerate: Advanced PV energy rating}, keywords = {digital light processing projection}, misc2 = {EMPIR 2016: Energy}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-0233, 1361-6501}, DOI = {10.1088/1361-6501/abe162}, stag_bib_extends_levelofaccess = {NA}, author = {Koutsourakis, G. and Eales, T.D. and Kroeger, I. and Blakesley, J.} } @Article { SobanskiTSLKIPHE2021, subid = {1916}, title = {Advances in High-Precision NO2 Measurement by Quantum Cascade Laser Absorption Spectroscopy}, journal = {Applied Sciences}, year = {2021}, month = {1}, day = {29}, volume = {11}, number = {3}, number2 = {16ENV05: MetNO2: Metrology for nitrogen dioxide}, pages = {1222}, keywords = {air pollution; trace gas; nitrogen dioxide; laser spectroscopy; mid-infrared; quantum cascade laser; selective detection}, misc2 = {EMPIR 2016: Environment}, publisher = {MDPI AG}, language = {30}, ISSN = {2076-3417}, DOI = {10.3390/app11031222}, stag_bib_extends_levelofaccess = {NA}, author = {Sobanski, N. and Tuzson, B. and Scheidegger, P. and Looser, H. and Kupferschmid, A. and Iturrate, M. and Pascale, C. and H{\"u}glin, C. and Emmenegger, L.} } @Article { Mariscotti2021, subid = {1956}, title = {Experimental characterisation of active and non‐active harmonic power flow of AC rolling stock and interaction with the supply network}, journal = {IET Electrical Systems in Transportation}, year = {2021}, month = {1}, day = {29}, volume = {1}, number = {1}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, pages = {12}, keywords = {no keywords}, web_url = {https://ietresearch.onlinelibrary.wiley.com/doi/10.1049/els2.12009}, misc2 = {EMPIR 2016: Energy}, publisher = {Institution of Engineering and Technology (IET)}, language = {30}, ISSN = {2042-9738, 2042-9746}, DOI = {10.1049/els2.12009}, stag_bib_extends_levelofaccess = {NA}, author = {Mariscotti, A.} } @Article { ShalmZBSSMAAMAFOMNK2021, subid = {2736}, title = {Device-independent randomness expansion with entangled photons}, journal = {Nature Physics}, year = {2021}, month = {1}, day = {28}, volume = {17}, number = {4}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, pages = {452-456}, keywords = {Bell inequality test, Entangled photons}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {1745-2473, 1745-2481}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://arxiv.org/abs/1912.11158}, author = {Shalm, L.K. and Zhang, Y. and Bienfang, J.C. and Schlager, C. and Stevens, M.J. and Mazurek, M.D. and Abell{\'a}n, C. and Amaya, W. and Mitchell, M.W. and Alhejji, M.A. and Fu, H. and Ornstein, J. and Mirin, R.P. and Nam, S.W. and Knill, E.} } @Article { GutierrezRivasTRD2021, subid = {2061}, title = {Enhancing White Rabbit Synchronization Stability and Scalability using P2P Transparent and Hybrid Clocks}, journal = {IEEE Transactions on Industrial Informatics}, year = {2021}, month = {1}, day = {25}, number2 = {17IND14: WRITE: Precision Time for Industry}, pages = {1-1}, keywords = {White RabbitPTPSyncEScalabilityStabilityAcceleratorsTelecom5G}, misc2 = {EMPIR 2017: Industry}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {1551-3203, 1941-0050}, DOI = {10.1109/TII.2021.3054365}, stag_bib_extends_levelofaccess = {NA}, author = {Gutierrez-Rivas, J.L. and Torres-Gonzalez, F. and Ros, E. and Diaz, J.} } @Article { ArduinoZHZBCB2021, subid = {1867}, title = {Heating of hip joint implants in MRI: The combined effect of RF and switched‐gradient fields}, journal = {Magnetic Resonance in Medicine}, year = {2021}, month = {1}, day = {22}, number2 = {17IND01: MIMAS: Procedures allowing medical implant manufacturers to demonstrate compliance with MRI safety regulations}, keywords = {gradient coil heating, hip prosthesis, MRI safety, numerical simulation, radiofrequency heating}, misc2 = {EMPIR 2017: Industry}, publisher = {Wiley}, language = {30}, ISSN = {0740-3194, 1522-2594}, DOI = {10.1002/mrm.28666}, stag_bib_extends_levelofaccess = {NA}, author = {Arduino, A. and Zanovello, U. and Hand, J. and Zilberti, L. and Br{\"u}hl, R. and Chiampi, M. and Bottauscio, O.} } @Article { SmithHEPNMWP2021, subid = {1900}, title = {Traceability of the Sentinel-3 SLSTR Level-1 Infrared Radiometric Processing}, journal = {Remote Sensing}, year = {2021}, month = {1}, day = {22}, volume = {13}, number = {3}, number2 = {16ENV03: MetEOC-3: Further metrology for earth observation and climate}, pages = {374}, keywords = {calibration, uncertainty, traceability, SLSTR, Sentinel-3, temperature, blackbody, radiometer, data processing, Earth observation, metrology}, misc2 = {EMPIR 2016: Environment}, publisher = {MDPI AG}, language = {30}, ISSN = {2072-4292}, DOI = {10.3390/rs13030374}, stag_bib_extends_levelofaccess = {NA}, author = {Smith, D. and Hunt, S.E. and Etxaluze, M. and Peters, D. and Nightingale, T. and Mittaz, J. and Woolliams, E.R. and Polehampton, E.} } @Article { KlussEW2021, subid = {2063}, title = {High-Frequency Current Transformer Design and Implementation Considerations for Wideband Partial Discharge Applications}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2021}, month = {1}, day = {18}, volume = {70}, number = {N/A}, number2 = {19ENG02: FutureEnergy: Metrology for future energy transmission}, pages = {1-9}, keywords = {Current transformers, frequency-domain analysis, high-voltage techniques, partial discharge (PD) measurement, time-domain analysis.}, tags = {SEG}, misc2 = {EMPIR 2019: Energy}, publisher = {IEEE}, language = {30}, ISSN = {N/A}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://zenodo.org/record/4772471}, author = {Kl{\"u}ss, J. and Elg, A-P. and Wingqvist, C.} } @Proceedings { PhungA2021, subid = {2286}, title = {Anomalies in multiline-TRL-corrected measurements of short CPW lines}, journal = {2021 96th ARFTG Microwave Measurement Conference (ARFTG)}, year = {2021}, month = {1}, day = {18}, number2 = {18SIB09: TEMMT: Traceability for electrical measurements at millimetre-wave and terahertz frequencies for communications and electronics technologies}, pages = {1-4}, keywords = {calibration, coplanar waveguides, on-wafer, probes}, web_url = {https://oar.ptb.de/files/download/6189062f8e2a000011003f89}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IEEE}, event_place = {San Diego, CA, USA}, event_name = {2021 96th ARFTG Microwave Measurement Conference (ARFTG)}, event_date = {18-01-2021 to 22-01-2021}, language = {30}, DOI = {10.1109/ARFTG49670.2021.9425345}, stag_bib_extends_levelofaccess = {NA}, author = {Phung, G.N. and Arz, U.} } @Proceedings { SimonotHSCLO2021, subid = {2396}, title = {Study and simulations of speckle effects on BRDF measurements at very high angular resolution}, journal = {Electronic Imaging}, year = {2021}, month = {1}, day = {18}, volume = {2021}, number = {140-1-140-}, number2 = {18SIB03: BxDiff: New quantities for the measurement of appearance}, pages = {1-6}, keywords = {BRDF MeasurementsSpeckleBRDF SimulationsMetrology of appearanceGloss}, web_url = {https://www.ingentaconnect.com/content/ist/ei/2021/00002021/00000005/art00006}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Society for Imaging Science and Technology}, event_place = {Electronic Imaging 2021}, event_name = {Electronic Imaging 2021}, event_date = {16-01-2021 to 29-01-2021}, language = {30}, ISSN = {2470-1173}, stag_bib_extends_levelofaccess = {NA}, author = {Simonot, L. and Hebert, M. and Sortais, Y. and Chavel, P. and Labardens, T. and Obein, G.} } @Article { SeferiBMS2021, subid = {1934}, title = {A Novel Arc Detection Method for DC Railway Systems}, journal = {Energies}, year = {2021}, month = {1}, day = {15}, volume = {14}, number = {2}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, pages = {444}, keywords = {pantograph-catenary system; current collection quality; arc detection; predictive maintenance; railway electrical networks; Hilbert transform; rail transportation; power quality disturbance}, tags = {SEG}, misc2 = {EMPIR 2016: Energy}, publisher = {MDPI AG}, language = {30}, ISSN = {1996-1073}, DOI = {10.3390/en14020444}, stag_bib_extends_levelofaccess = {NA}, author = {Seferi, Y. and Blair, S.M. and Mester, C. and Stewart, B.G.} } @Article { LohvitheeSCS2021, subid = {2409}, title = {Ant Colony-Based Hyperparameter Optimisation in Total Variation Reconstruction in X-ray Computed Tomography}, journal = {Sensors}, year = {2021}, month = {1}, day = {15}, volume = {21}, number = {591}, number2 = {17IND08: AdvanCT: Advanced Computed Tomography for dimensional and surface measurements in industry}, keywords = {hyperparameter tuning, total variation (TV) regularization, iterative reconstruction, ant colony optimization, limited data X-ray CT, computer-aided hyperparameter selection, X-ray computed tomography, image reconstruction}, misc2 = {EMPIR 2017: Industry}, publisher = {MDPI}, language = {30}, DOI = {10.3390/s21020591}, stag_bib_extends_levelofaccess = {NA}, author = {Lohvithee, M. and Sun, W. and Chretien, S. and Soleimani, M.} } @Article { SteierDBTOCC2021, subid = {1871}, title = {Insights from Transient Absorption Spectroscopy into Electron Dynamics Along the Ga‐Gradient in Cu(In,Ga)Se2 Solar Cells}, journal = {Advanced Energy Materials}, year = {2021}, month = {1}, day = {14}, number2 = {16ENG03: HyMet: Hybrid metrology for thin films in energy applications}, pages = {2003446}, keywords = {CIGS, transient absorption spectroscopy}, misc2 = {EMPIR 2016: Energy}, publisher = {Wiley}, language = {30}, ISSN = {1614-6832, 1614-6840}, DOI = {10.1002/aenm.202003446}, stag_bib_extends_levelofaccess = {NA}, author = {Steier, L. and Durrant, J.R. and Bozal‐Ginesta, C. and Tiwari, A.N. and Ochoa, M. and Carron, R. and Chang, Y‐H.} } @Manual { ShangRDG2021, subid = {2128}, title = {Introductory guide to making Planar S-parameter measurements at millimetre-wave frequencies}, year = {2021}, month = {1}, day = {13}, number2 = {19SIP02: PlanarMeT: Knowledge transfer of planar calibration and measurement techniques at millimetre-wave frequencies}, keywords = {Calibration, on-wafer measurement, planar measurement, S-parameters, millimetre-wave, probes, traceability, vector network analyzer (VNA)}, misc2 = {EMPIR 2019: Support for Impact}, publisher = {National Physical Laboratory}, language = {30}, DOI = {10.47120/npl.9001}, stag_bib_extends_levelofaccess = {NA}, author = {Shang, X. and Ridler, N.M. and Ding, J. and Geen, M.} } @Article { PreetzmannEVLR2021, subid = {2667}, title = {Laboratory‐scale liquefiers for natural gas: A design and assessment study}, journal = {AIChE Journal}, year = {2021}, month = {1}, day = {11}, volume = {67}, number = {4}, number2 = {16ENG09: LNG III: Metrological support for LNG and LBG as transport fuel}, pages = {1-12}, keywords = {composition analysis, liquefaction, liquefied natural gas, optical spectroscopy, vapor–liquid-equilibrium}, web_url = {https://aiche.onlinelibrary.wiley.com/doi/epdf/10.1002/aic.17128}, misc2 = {EMPIR 2016: Energy}, publisher = {Wiley}, language = {30}, ISSN = {0001-1541, 1547-5905}, DOI = {10.1002/aic.17128}, stag_bib_extends_levelofaccess = {NA}, author = {Preetzmann, N. and Eckmann, P. and Veen, A.M.H. and Li, J. and Richter, M.} } @Article { JenningerABBDGISJKRSSSTTW2021, subid = {1775}, title = {Development of a design for an ionisation vacuum gauge suitable as a reference standard}, journal = {Vacuum}, year = {2021}, month = {1}, volume = {183}, number2 = {16NRM05: Ion Gauge: Towards a documentary standard for an ionisation vacuum gauge}, pages = {109884}, keywords = {Ionisation gauge, Hot cathode, Sensitivity, Simulation, Reference standard}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {Elsevier BV}, language = {30}, ISSN = {0042-207X}, DOI = {10.1016/j.vacuum.2020.109884}, stag_bib_extends_levelofaccess = {NA}, author = {Jenninger, B. and Anderson, J. and Bernien, M. and Bundaleski, N. and Dimitrova, H. and Granovskij, M. and Illgen, C. and Šetina, J. and Jousten, K. and Kucharski, P. and Reinhardt, C. and Scuderi, F. and Silva, R.A.S. and St{\"o}ltzel, A. and Teodoro, O.M.N.D. and Trzpil-Jurgielewicz, B. and W{\"u}est, M.} } @Article { BagherRENWMZDHBL2021, subid = {1796}, title = {Crosstalk between Mast Cells and Lung Fibroblasts Is Modified by Alveolar Extracellular Matrix and Influences Epithelial Migration}, journal = {International Journal of Molecular Sciences}, year = {2021}, month = {1}, volume = {22}, number = {2}, number2 = {18HLT02: AeroTox: Measurements for mitigating adverse health effects from atmospheric particulate pollutants}, pages = {506}, keywords = {lung fibroblasts, mast cells, epithelial cells, extracellular matrix, IL-6; tryptase, vascular endothelial growth factor, hepatocyte growth factor, idiopathic pulmonary fibrosis}, misc2 = {EMPIR 2018: Health}, publisher = {MDPI AG}, language = {30}, ISSN = {1422-0067}, DOI = {10.3390/ijms22020506}, stag_bib_extends_levelofaccess = {NA}, author = {Bagher, M. and Rosmark, O. and Elowsson Rendin, L. and Nybom, A. and Wasserstrom, S. and M{\"u}ller, C. and Zhou, X-H. and Dellgren, G. and Hallgren, O. and Bjermer, L. and Larsson-Callerfelt, A-K.} } @Article { PietrosantoCL2021, subid = {1802}, title = {Sensitivity of water meters to small leakage}, journal = {Measurement}, year = {2021}, month = {1}, volume = {168}, number = {-}, number2 = {17IND13: Metrowamet: Metrology for real-world domestic water metering}, pages = {108479}, keywords = {Smart water meter, Embedded system, Starting flow rate, Leakage detection, AMI, EMPIR}, misc2 = {EMPIR 2017: Industry}, publisher = {Elsevier BV}, language = {30}, ISSN = {0263-2241}, DOI = {10.1016/j.measurement.2020.108479}, stag_bib_extends_levelofaccess = {NA}, author = {Pietrosanto, A. and Carrat{\`u}, M. and Liguori, C.} } @Article { KrasniqiKLETRT2021, subid = {1827}, title = {Standoff UV-C imaging of alpha particle emitters}, journal = {Nuclear Instruments and Methods in Physics Research Section A: Accelerators, Spectrometers, Detectors and Associated Equipment}, year = {2021}, month = {1}, volume = {987}, number2 = {16ENV09: MetroDecom II: In situ metrology for decommissioning nuclear facilities}, pages = {164821}, keywords = {Optical remote detection, alpha radiation}, misc2 = {EMPIR 2016: Environment}, publisher = {Elsevier BV}, language = {30}, ISSN = {0168-9002}, DOI = {10.1016/j.nima.2020.164821}, stag_bib_extends_levelofaccess = {NA}, author = {Krasniqi, F.S. and Kerst, T. and Leino, M. and Eisheh, J-T. and Toivonen, H. and R{\"o}ttger, A. and Toivonen, J.} } @Article { DorscherHSLBLSPL2021, subid = {1846}, title = {Optical frequency ratio of a 171Yb+ single-ion clock and a 87Sr lattice clock}, journal = {Metrologia}, year = {2021}, month = {1}, volume = {58}, number = {1}, number2 = {18SIB05: ROCIT: Robust Optical Clocks for International Timescales}, pages = {015005}, keywords = {optical clock, ion clock, ytterbium, optical lattice clock, strontium, optical clock comparison, frequency ratio}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/abc86f}, stag_bib_extends_levelofaccess = {NA}, author = {D{\"o}rscher, S. and Huntemann, N. and Schwarz, R. and Lange, R. and Benkler, E. and Lipphardt, B. and Sterr, U. and Peik, E. and Lisdat, C.} } @Article { LangeHRSSLTWP2021, subid = {1854}, title = {Improved Limits for Violations of Local Position Invariance from Atomic Clock Comparisons}, journal = {Physical Review Letters}, year = {2021}, month = {1}, volume = {126}, number = {1}, number2 = {18SIB05: ROCIT: Robust Optical Clocks for International Timescales}, pages = {011102}, keywords = {Optical clocks, Tests of fundamental principles, Time \& frequency standards, Quantum metrology}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {0031-9007, 1079-7114}, DOI = {10.1103/PhysRevLett.126.011102}, stag_bib_extends_levelofaccess = {NA}, author = {Lange, R. and Huntemann, N. and Rahm, J.M. and Sanner, C. and Shao, H. and Lipphardt, B. and Tamm, Chr. and Weyers, S. and Peik, E.} } @Article { LangeHRSSLTWP20210, subid = {1854}, title = {Improved Limits for Violations of Local Position Invariance from Atomic Clock Comparisons}, journal = {Physical Review Letters}, year = {2021}, month = {1}, volume = {126}, number = {1}, number2 = {17FUN07: CC4C: Coulomb Crystals for Clocks}, pages = {011102}, keywords = {Optical clocks, Tests of fundamental principles, Time \& frequency standards, Quantum metrology}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {0031-9007, 1079-7114}, DOI = {10.1103/PhysRevLett.126.011102}, stag_bib_extends_levelofaccess = {NA}, author = {Lange, R. and Huntemann, N. and Rahm, J.M. and Sanner, C. and Shao, H. and Lipphardt, B. and Tamm, Chr. and Weyers, S. and Peik, E.} } @Proceedings { RitzmannWMKDF2021, subid = {1861}, title = {Measurement of 2-150 kHz Conducted Emissions in Power Networks}, journal = {Proceedings of CPEM 2020}, year = {2021}, month = {1}, number2 = {18NRM05: SupraEMI: Grid measurements of 2 kHz - 150 kHz harmonics to support normative emission limits for mass-market electrical goods}, keywords = {Electromagnetic compatibility,measurement standards,measurement techniques,power quality,power system measurements,supraharmonics}, tags = {SEG}, misc2 = {EMPIR 2018: Pre-Co-Normative}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, event_place = {Bolder}, event_name = {Conference of Precession Electromagnetic MeasurementsPEM}, event_date = {01-08-2020 to 07-08-2020}, language = {30}, DOI = {10.36227/techrxiv.13536830.v1}, stag_bib_extends_levelofaccess = {NA}, author = {Ritzmann, D. and Wright, P. and Meyer, J. and Khokhlov, V. and De La Vega, D. and Fernandez, I.} } @Article { PoppeLHWSKP2021, subid = {1843}, title = {Ion collection efficiency of ionization chambers in ultra‐high dose‐per‐pulse electron beams}, journal = {Medical Physics}, year = {2021}, month = {1}, number2 = {18HLT04: UHDpulse: Metrology for advanced radiotherapy using particle beams with ultra-high pulse dose rates}, keywords = {ultra-high pulse dose rates, dosimetry, metrology, FLASH radiation therapy, ionization chambers, ion collection efficiency}, misc2 = {EMPIR 2018: Health}, publisher = {Wiley}, language = {30}, ISSN = {0094-2405, 2473-4209}, DOI = {10.1002/mp.14620}, stag_bib_extends_levelofaccess = {NA}, author = {Poppe, B. and Looe, H.K. and Hackel, T. and Weidner, J. and Sch{\"u}ller, A. and Kranzer, R. and Poppinga, D.} } @Article { Powucha2021, subid = {1919}, title = {POINT-PLANE DISTANCE AS MODEL FOR UNCERTAINTY EVALUATION OF COORDINATE MEASUREMENT}, journal = {METROLOGY AND MEASUREMENT SYSTEMS}, year = {2021}, month = {1}, volume = {27}, number = {n.4}, number2 = {17NRM03: EUCoM: Standards for the evaluation of the uncertainty of coordinate measurements in industry}, pages = {625-639}, keywords = {task specific uncertainty, uncertainty of coordinate measurement, measurement models, Type Bevaluation, sensitivity analysis method}, web_url = {https://journals.pan.pl/Content/117859/PDF/art06.pdf}, misc2 = {EMPIR 2017: Pre-Co-Normative}, language = {30}, ISSN = {0860-8229}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {DOI: 10.24425/mms.2020.13484}, author = {Płowucha, W.} } @Article { PiliaNLBDL2021, subid = {1965}, title = {ECGdeli - An open source ECG delineation toolbox for MATLAB}, journal = {SoftwareX}, year = {2021}, month = {1}, volume = {13}, number2 = {18HLT07: MedalCare: Metrology of automated data analysis for cardiac arrhythmia management}, pages = {100639}, keywords = {ECG waveform boundary detectionECG delineation12 lead ECG processing}, misc2 = {EMPIR 2018: Health}, publisher = {Elsevier BV}, language = {30}, ISSN = {2352-7110}, DOI = {10.1016/j.softx.2020.100639}, stag_bib_extends_levelofaccess = {NA}, author = {Pilia, N. and Nagel, C. and Lenis, G. and Becker, S. and D{\"o}ssel, O. and Loewe, A.} } @Article { BescondOFGQTLO2021, subid = {2140}, title = {Method for Preparation of a Candidate Reference Material of PM10 and PM2.5 Airborne Particulate Filters Loaded with Incineration Ash-Inter Comparison Results for Metal Concentrations}, journal = {Atmosphere}, year = {2021}, month = {1}, volume = {12}, number = {1}, number2 = {19ENV08: AEROMET II: Advanced aerosol metrology for atmospheric science and air quality}, pages = {67}, keywords = {aerosol; ambient air; EU air quality directives; ICP-MS intercomparison; incineration ash; particulate matter (PM); PM10; PM2.5; heavy metal analysis}, web_url = {https://www.mdpi.com/2073-4433/12/1/67}, misc2 = {EMPIR 2019: Environment}, publisher = {MDPI AG}, language = {30}, ISSN = {2073-4433}, DOI = {10.3390/atmos12010067}, stag_bib_extends_levelofaccess = {NA}, author = {Bescond, A. and Oster, C. and Fisicaro, P. and Goddard, S. and Quincey, P. and Tsakanika, L-A. and Lymperopoulou, T. and Ochsenkuehn-Petropoulou, M.} } @Article { MinutoliCCDPV2021, subid = {2344}, title = {How to make FAIR a project: open access to research data and the RaCHy - Radiotherapy Coupled with Hyperthermia (in Italian)}, journal = {Notiziario dell'Istituto Superiore di Sanit{\`a}}, year = {2021}, month = {1}, volume = {34}, number = {1}, number2 = {18HLT06: RaCHy: Radiotherapy coupled with hyperthermia - adapting the biological equivalent dose concept}, pages = {13-16}, keywords = {biomedical research, open science, hyperthermia, radiotherapy, Zenodo}, web_url = {https://www.iss.it/documents/20126/0/Open+Science+Progetto+europeo+RaCHy.pdf/bebb34b6-0b8e-d0e0-c23b-5a3227bd9b7e?t=1613031471672}, misc2 = {EMPIR 2018: Health}, publisher = {Istituto Superiore di Sanit{\`a}}, language = {59}, ISSN = {1827-6296}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://doi.org/10.5281/zenodo.5728941}, author = {Minutoli, D. and CACCIA, B. and Campa, A. and Durando, G. and Pozzi, S. and Valentini, S.} } @Inbook { BELLGAABSIDPSVRIWPNKSD2021, subid = {2552}, title = {A NEW EUROPEAN RADIATION PROTECTION NETWORK DEVELOPED BY THE SUPPORT BSS JOINT NETWORK PROJECT}, year = {2021}, month = {1}, number2 = {19NET03: supportBSS: Support for a European Metrology Network on reliable radiation protection regulation}, keywords = {radiation protection, metrology, national regulation, European regulation, supportBSS, ENM for Radiation Protection}, web_url = {https://vinar.vin.bg.ac.rs/bitstream/handle/123456789/10125/309-314.pdf}, misc2 = {EMPIR 2019: Support for Networks}, booktitle = {RADIATION PROTECTION SOCIETY OF SERBIA AND MONTENEGRO, PROCEEDINGS, XXXI SYMPOSIUM RPSSM, 2021}, language = {30}, ISBN = {78-86-7306-161-0}, stag_bib_extends_levelofaccess = {NA}, author = {Bell, S. and Glavič-Cindro, D. and ALVES, J. and Adam-Guillermin, C. and Bernat, R. and Sabeta, A. and Ioan, M-R. and DERLACINSKI, M. and Pinto, M. and Sochor, V. and Veres, A. and R{\"O}TTGER, .A. and Živanović, M. and Wens, B. and Persson, L. and Nylund, R. and Kržanović, N. and STANKOVIĆ, S. and DIMOVIĆ, S.} } @Article { KrehlikSBSK2021, subid = {1850}, title = {Optical multiplexing of metrological time and frequency signals in a single 100 GHz-grid optical channel}, journal = {IEEE Transactions on Ultrasonics, Ferroelectrics, and Frequency Control}, year = {2021}, number2 = {18SIB06: TiFOON: Advanced time/frequency comparison and dissemination through optical telecommunication networks}, keywords = {Time and frequency transfer, fiber optics, optical interleavers, wavelength multiplexing, Optical fibers, Optical filters, Optical variables control, Optical fiber networks, Ultrafast optics, Optical reflection, Time-frequency analysis}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0885-3010, 1525-8955}, DOI = {10.1109/TUFFC.2021.3053430}, stag_bib_extends_levelofaccess = {NA}, author = {Krehlik, P. and Śliwczyński, L. and Buczek, L. and Schnatz, H. and Kronj{\"a}ger, J.} } @Article { BehrEBGHKKLPPS2020, subid = {1857}, title = {A four-terminal-pair Josephson impedance bridge combined with a graphene quantized Hall resistance}, journal = {Measurement Science and Technology}, year = {2021}, number2 = {18SIB07: GIQS: Graphene impedance quantum standard}, keywords = {impedance measurement,quantized Hall resistor,coaxial impedance bridge,graphene,Josephson arbitrary waveform synthesizer}, web_url = {https://iopscience.iop.org/article/10.1088/1361-6501/abcff3/pdf}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-0233, 1361-6501}, DOI = {10.1088/1361-6501/abcff3}, stag_bib_extends_levelofaccess = {NA}, author = {Bauer, S. and Elmquist, R. and Behr, R. and Goetz, M. and Herick, J. and Kieler, O.F. and Kruskopf, M. and Lee, J. and Palafox, L. and Pimsut, Y. and Schurr, J.} } @Article { LovenDBKTRWI2021, subid = {1897}, title = {Toxicological effects of zinc oxide nanoparticle exposure: an in vitro comparison between dry aerosol air-liquid interface and submerged exposure systems}, journal = {Nanotoxicology}, year = {2021}, number2 = {18HLT02: AeroTox: Measurements for mitigating adverse health effects from atmospheric particulate pollutants}, keywords = {Air-liquid interface; NACIVT, aerosol, cell response, toxicity}, web_url = {https://www.tandfonline.com/doi/full/10.1080/17435390.2021.1884301}, misc2 = {EMPIR 2018: Health}, language = {30}, DOI = {10.1080/17435390.2021.1884301}, stag_bib_extends_levelofaccess = {NA}, author = {Lov{\'e}n , K. and Dobric, J. and B{\"o}l{\"u}kbas, D.A. and K{\aa}redal, M. and Tas, S. and Rissler, J. and Wagner, D.E. and Isaxon, C. } } @Article { LagouanelleBPZ2021, subid = {1923}, title = {Impact of parameters variability on the level of human exposure due to inductive power transfer}, journal = {IEEE Transactions on Magnetics}, year = {2021}, volume = {Early Acce}, number = {ea}, number2 = {16ENG08: MICEV: Metrology for inductive charging of electric vehicles}, pages = {1-4}, keywords = {Inductive power transfer, stochastic methods, human exposure}, web_url = {https://ieeexplore.ieee.org/stamp/stamp.jsp?tp=\&arnumber=9364997}, misc2 = {EMPIR 2016: Energy}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9464, 1941-0069}, DOI = {10.1109/TMAG.2021.3062702}, stag_bib_extends_levelofaccess = {NA}, author = {Lagouanelle, P. and Bottauscio, O. and Pichon, L. and Zucca, M.} } @Article { FanWSS2021, subid = {1938}, title = {Pantograph Arc Location Estimation using Resonant Frequencies in DC Railway Power Systems}, journal = {IEEE Transactions on Transportation Electrification}, year = {2021}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, pages = {1-1}, keywords = {DC traction power supply system, overhead line, pantograph arc location estimation, resonant frequency}, tags = {SEG}, misc2 = {EMPIR 2016: Energy}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {2332-7782, 2372-2088}, DOI = {10.1109/TTE.2021.3062229}, stag_bib_extends_levelofaccess = {NA}, author = {Fan, F. and Wank, A. and Seferi, Y. and Stewart, B.G.} } @Article { OrtolanoMDMRKKMCCKP2021, subid = {2054}, title = {A Comprehensive Analysis of Error Sources in Electronic Fully Digital Impedance Bridges}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2021}, volume = {70}, number2 = {17RPT04: VersICaL: A versatile electrical impedance calibration laboratory based on digital impedance bridges}, pages = {1-14}, keywords = {Impedance measurement, bridge circuits, measurement errors, measurement uncertainty, calibration}, misc2 = {EMPIR 2017: Research Potential}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9456, 1557-9662}, DOI = {10.1109/TIM.2020.3034115}, stag_bib_extends_levelofaccess = {NA}, author = {Ortolano, M. and Marzano, M. and D'Elia, V. and Mai Tran, N.T. and Rybski, R. and Kaczmarek, J. and Koziol, M. and Musiol, K. and Christensen, A.E. and Callegaro, L. and Kucera, J. and Power, O.} } @Article { HaoLG2021, subid = {2060}, title = {Coupled Resonator Calorimeter for Particle Detection}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2021}, volume = {70}, number2 = {17FUN02: MetroMMC: Measurement of fundamental nuclear decay data using metallic magnetic calorimeters}, pages = {1-6}, keywords = {Resonant frequency, Electromagnetic heating, Temperature dependence, Permittivity, Dielectrics, Temperature distribution, Crystals}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9456, 1557-9662}, DOI = {10.1109/TIM.2021.3062171}, stag_bib_extends_levelofaccess = {NA}, author = {Hao, L. and Lorusso, G. and Gallop, J.} } @Article { TiainenVHH2021, subid = {2075}, title = {Analysis of total rotor runout components with multi-probe roundness measurement method}, journal = {Measurement}, year = {2021}, volume = {179}, number = {109422}, number2 = {19ENG07: Met4Wind: Metrology for enhanced reliability and efficiency of wind energy systems}, pages = {109422}, keywords = {Relative shaft displacement,Runout, Roundness, Shaft geometry, Electrical runout,Mechanical runout, Multi-probe roundness}, web_url = {https://www.sciencedirect.com/science/article/pii/S0263224121004115}, misc2 = {EMPIR 2019: Energy}, publisher = {Elsevier}, language = {30}, ISSN = {0263-2241}, DOI = {10.1016/j.measurement.2021.109422}, stag_bib_extends_levelofaccess = {NA}, author = {Tiainen, T. and Viitala, R. and Holopainen, T.P. and Hemming, B.} } @Article { CelepS2021, subid = {2095}, title = {Characterization of a Thermal Isolation Section of a Waveguide Microcalorimeter}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2021}, volume = {70}, number = {N/A}, number2 = {18SIB09: TEMMT: Traceability for electrical measurements at millimetre-wave and terahertz frequencies for communications and electronics technologies}, pages = {1008007}, keywords = {Calibration, measurement uncertainty, microcalorimeter, microwave power measurement, thermal isolation section (TIS)}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9456, 1557-9662}, DOI = {10.1109/TIM.2021.3084306}, stag_bib_extends_levelofaccess = {NA}, author = {Celep, M. and Stokes, D.} } @Article { HaveAHPMSL2021, subid = {2088}, title = {Waveform Model to Characterize Time-Domain Pulses Resulting in EMI on Static Energy Meters}, journal = {IEEE Transactions on Electromagnetic Compatibility}, year = {2021}, number2 = {17NRM02: MeterEMI: Electromagnetic Interference on Static Electricity Meters}, pages = {1-8}, keywords = {Electromagnetic interference (EMI), metering errors, nonlinear, static energy meters, time-domain, waveformmodel}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9375, 1558-187X}, DOI = {10.1109/TEMC.2021.3062948}, stag_bib_extends_levelofaccess = {NA}, author = {Have, B.t. and Azpurua, M.A. and Hartman, T. and Pous, M. and Moonen, N. and Silva, F. and Leferink, F.} } @Article { DavisW2021, subid = {2102}, title = {Validating an Isolator to eliminate grounding issues for high-resolution digitizer measurements}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2021}, volume = {70}, number2 = {17NRM02: MeterEMI: Electromagnetic Interference on Static Electricity Meters}, pages = {1-8}, keywords = {Electromagnetic compatibility,isolators,power measurement,power quality,wattmeters}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9456, 1557-9662}, DOI = {10.1109/TIM.2020.3048517}, stag_bib_extends_levelofaccess = {NA}, author = {Davis, P.N. and Wright, P.S.} } @Article { MagniBSSMKSLGKLO2021, subid = {2136}, title = {Spin Hall magnetoresistance and spin orbit torque efficiency in Pt/FeCoB bilayers}, journal = {IEEE Transactions on Magnetics}, year = {2021}, number2 = {17FUN08: TOPS: Metrology for topological spin structures}, pages = {1-1}, keywords = {spin Hall magnetoresistance, spin Hall effect, spin orbit torque, FeCoB, Pt}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9464, 1941-0069}, DOI = {10.1109/TMAG.2021.3084866}, stag_bib_extends_levelofaccess = {NA}, author = {Magni, A. and Basso, V. and Sola, A. and Soares, G. and Meggiato, N. and Kuepferling, M. and Skowronski, W. and Lazarski, S. and Grochot, K. and Khanjani, M.V. and Langer, J. and Ocker, B.} } @Article { GeislerNSTR2021, subid = {2177}, title = {Analyzing the surface of functional nanomaterials – how to quantify the total and derivatizable number of functional groups and ligands}, journal = {Microchimica Acta}, year = {2021}, volume = {188}, number = {10}, number2 = {18HLT01: METVES II: Standardisation of concentration measurements of extracellular vesicles for medical diagnoses}, pages = {321}, keywords = {Functional group quantification, Surface ligand, Nanomaterial, Nanoparticle, Bead, Dye-based assay, Opticaldetection, Electrochemical titration, Instrumental analysis, Nanosafety, Safe-by-design}, misc2 = {EMPIR 2018: Health}, publisher = {Springer Nature}, language = {30}, DOI = {10.1007/s00604-021-04960-5}, stag_bib_extends_levelofaccess = {NA}, author = {Gei{\ss}ler, D. and Nirmalananthan-Budau, N. and Scholtz, L. and Tavernaro, I. and Resch-Genger, U.} } @Article { GeislerNSTR20210, subid = {2177}, title = {Analyzing the surface of functional nanomaterials – how to quantify the total and derivatizable number of functional groups and ligands}, journal = {Microchimica Acta}, year = {2021}, volume = {188}, number = {10}, number2 = {18HLT02: AeroTox: Measurements for mitigating adverse health effects from atmospheric particulate pollutants}, pages = {321}, keywords = {Functional group quantification, Surface ligand, Nanomaterial, Nanoparticle, Bead, Dye-based assay, Opticaldetection, Electrochemical titration, Instrumental analysis, Nanosafety, Safe-by-design}, misc2 = {EMPIR 2018: Health}, publisher = {Springer Nature}, language = {30}, DOI = {10.1007/s00604-021-04960-5}, stag_bib_extends_levelofaccess = {NA}, author = {Gei{\ss}ler, D. and Nirmalananthan-Budau, N. and Scholtz, L. and Tavernaro, I. and Resch-Genger, U.} } @Article { MertesRR2021, subid = {2225}, title = {D3.3 Approximate Sequential Bayesian Filtering to Estimate Rn-222 Emanation from Ra-226 Sources from Spectra}, journal = {SMSI 2021 - Measurement Science}, year = {2021}, number2 = {19ENV01: traceRadon: Radon metrology for use in climate change observation and radiation protection at the environmental level}, keywords = {State-Space model, switched linear dynamical system, Rn-222, integrating measurements}, misc2 = {EMPIR 2019: Environment}, publisher = {AMA Service GmbH, Von-M{\"u}nchhausen-Str. 49, 31515 Wunstorf, Germany}, language = {30}, DOI = {10.5162/SMSI2021/D3.3}, stag_bib_extends_levelofaccess = {NA}, author = {Mertes, F. and R{\"o}ttger, S. and R{\"o}ttger, A.} } @Article { VentonHSSA2021, subid = {2249}, title = {Robustness of convolutional neural networks to physiological electrocardiogram noise}, journal = {Philosophical Transactions of the Royal Society A: Mathematical, Physical and Engineering Sciences}, year = {2021}, volume = {379}, number = {2212}, number2 = {18HLT07: MedalCare: Metrology of automated data analysis for cardiac arrhythmia management}, pages = {-}, keywords = {electrocardiogram, physiological noise, robustness, deep learning, convolutional neural network, symmetric projection attractor reconstruction}, web_url = {https://royalsocietypublishing.org/doi/10.1098/rsta.2020.0262}, misc2 = {EMPIR 2018: Health}, publisher = {Royal Society Publishing}, language = {30}, ISSN = {-}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://doi.org/10.1098/rsta.2020.0262}, author = {Venton, J. and Harris, P.M. and Sundar, A. and Smith, N.A.S. and Aston, P.J. } } @Thesis { Condio2021, subid = {2247}, title = {Optical lattice clock with an amplified laser diode}, year = {2021}, number2 = {18SIB05: ROCIT: Robust Optical Clocks for International Timescales}, keywords = {Optical lattice clock, SI second}, web_url = {https://sia.unito.it/studenti/intesi/Ricerca_tesi_libera/ricerca_tesi_dettaglio.asp?id_upload=209134\&cdl_tesi=\&cdl=\&matricola=815511}, misc2 = {EMPIR 2018: SI Broader Scope}, school = {University of Torino}, language = {30}, DOI = {10.5281/zenodo.5566671}, stag_bib_extends_levelofaccess = {NA}, author = {Condio, S.} } @Article { DorstSSE2021, subid = {2302}, title = {GUM2ALA – Uncertainty Propagation Algorithm for the Adaptive Linear Approximation According to the GUM}, journal = {SMSI 2021 - System of Units and Metreological Infrastructure}, year = {2021}, volume = {D1 Future}, number = {2021}, number2 = {17IND12: Met4FoF: Metrology for the Factory of the Future}, pages = {314 - 315}, keywords = {machine learning, automation, sensor network, uncertainty}, misc2 = {EMPIR 2017: Industry}, publisher = {AMA Service GmbH, Von-M{\"u}nchhausen-Str. 49, 31515 Wunstorf, Germany}, language = {30}, DOI = {10.5162/SMSI2021/D1.1}, stag_bib_extends_levelofaccess = {NA}, author = {Dorst, T. and Schneider, T. and Sch{\"u}tze, A. and Eichst{\"a}dt, S.} } @Thesis { Pronebner2021, subid = {2283}, title = {An ultrastable laser as optical frequency reference}, year = {2021}, number2 = {17FUN07: CC4C: Coulomb Crystals for Clocks}, keywords = {atomic clock; time and frequency reference; optical metrology; glas fiber links}, web_url = {https://doi.org/10.34726/hss.2021.53321; http://hdl.handle.net/20.500.12708/18346}, misc2 = {EMPIR 2017: Fundamental}, school = {Technische Universit{\"a}t Wien}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://doi.org/10.34726/hss.2021.53321}, author = {Pronebner, T.T.} } @Article { AgustoniF2021, subid = {2321}, title = {Characterization of DAC Phase Offset in IEC 61850-9-2 Calibration Systems}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2021}, volume = {70}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, pages = {1-10}, keywords = {Digital-to-analog converter (DAC) phase offset,discrete Fourier transform (DFT) interpolation, IEC 61850, phasereference signal (PRS), sampled values (SVs)}, misc2 = {EMPIR 2017: Industry}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9456, 1557-9662}, DOI = {10.1109/TIM.2021.3084294}, stag_bib_extends_levelofaccess = {NA}, author = {Agustoni, M. and Frigo, G.} } @Article { FergusonFLBHPR2021, subid = {2378}, title = {Metrology and Standardization of High Speed Pluggable Optical Interconnects}, journal = {Proceedings of the 9th International Conference on Photonics, Optics and Laser Technology}, year = {2021}, volume = {PHOTOPTICS}, number = {PHOTOPTICS}, number2 = {19SIP05: TTPWC: Technology Transfer of Photonic Waveguide Characterisation}, pages = {63-67}, keywords = {Electro Optical Circuit Board (EOCB), Polymer Waveguides, Attenuation, Encircled Flux, BER.}, web_url = {https://zenodo.org/record/5777190}, misc2 = {EMPIR 2019: Support for Impact}, publisher = {SCITEPRESS - Science and Technology Publications}, language = {30}, ISSN = {2184-4364}, DOI = {10.5220/0010171900630067}, stag_bib_extends_levelofaccess = {NA}, author = {Ferguson, R. and Fatadin, I. and Liu, K-M. and Barbeito, I. and Hart, C. and Pitwon, R. and Robinson, D.} } @Proceedings { KhanbabaeeRBRFHZTLdBGGCA2021, subid = {2377}, title = {SUPPORT FOR A EUROPEAN METROLOGY NETWORK ON RELIABLE RADIATION PROTECTION: GAPS IN RADIATION PROTECTION AND RELATED METROLOGY}, journal = {RAD Conference Proceedings}, year = {2021}, number2 = {19NET03: supportBSS: Support for a European Metrology Network on reliable radiation protection regulation}, keywords = {Activity standards, new operational quantities in radiation protection, type testing, calibration, radon,reference field, pulsed radiation, dosimetry, standards, radiological emergency response}, misc2 = {EMPIR 2019: Support for Networks}, publisher = {RAD Centre}, event_place = {Herceg Novi, Montenegro}, event_name = {9th international conference on Radiation in various fields of research}, event_date = {14-06-2021 to 18-06-2021}, language = {30}, DOI = {10.21175/RadProc.2021.04}, stag_bib_extends_levelofaccess = {NA}, author = {Khanbabaee, B. and R{\"o}ttger, A. and Behrens, R. and R{\"o}ttger, S. and Feige, S. and Hupe, O. and Zutz, H. and Toroi, P. and Leonard, P. and de la Fuente Rosales, L. and Burgess, P. and Gressier, V. and Guti{\'e}rrez Villanueva, J–L. and Cruz Su{\'a}rez, R. and Arnold, D.} } @Proceedings { FrigoA2021_2, subid = {2385}, title = {Phasor Measurement Unit and Sampled Values: Measurement and Implementation Challenges}, journal = {Proceedings of 2021 IEEE AMPS}, year = {2021}, volume = {1}, number = {1}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, pages = {1-6}, keywords = {Instrument transformers, Electric potential, Power measurement, Substations, Instruments, Merging, Prototypes}, web_url = {https://zenodo.org/record/5703145}, misc2 = {EMPIR 2017: Industry}, publisher = {IEEE}, address = {Austin}, event_place = {Cagliari}, event_name = {2021 IEEE 11th International Workshop on Applied Measurements for Power Systems (AMPS)}, event_date = {29-09-2021 to 01-10-2021}, language = {30}, ISBN = {978-1-7281-6923-1}, ISSN = {2475-2304}, DOI = {10.5281/zenodo.5703144}, stag_bib_extends_levelofaccess = {NA}, author = {Frigo, G. and Agustoni, M.} } @Article { RehbehnRBBSKMGMSC2021, subid = {2408}, title = {Sensitivity to new physics of isotope-shift studies using the coronal lines of highly charged calcium ions}, journal = {Physical Review A}, year = {2021}, volume = {103}, number = {4}, number2 = {17FUN07: CC4C: Coulomb Crystals for Clocks}, pages = {L040801}, keywords = {research areas, dark matter, electronic transitions, particle interactions, techniques, spectroscopy, nuclear physics, atomic, molecular and optical}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society}, language = {30}, ISSN = {ISSN 2469-9934 (online), 2469-}, DOI = {10.1103/PhysRevA.103.L040801}, stag_bib_extends_levelofaccess = {NA}, author = {Rehbehn, N-H. and Rosner, M.K. and Bekker, H. and Berengut, J.C. and Schmidt, P.O. and King, S.A. and Micke, P. and Gu, M.F. and M{\"u}ller, R. and Surzhykov, A. and Crespo L{\'o}pez-Urrutia, J.R.} } @Article { StarkWBCDKRGNOSSLSKLMSPC2021, subid = {2407}, title = {An ultralow-noise superconducting radio-frequency ion trap for frequency metrology with highly charged ions}, journal = {AIP Review of Scientific Instruments}, year = {2021}, volume = {92}, number = {8}, number2 = {17FUN07: CC4C: Coulomb Crystals for Clocks}, pages = {083203}, keywords = {Radio frequency cavities, radio-frequency quadrupole}, misc2 = {EMPIR 2017: Fundamental}, language = {30}, DOI = {10.1063/5.0046569}, stag_bib_extends_levelofaccess = {NA}, author = {Stark, J. and Warnecke, C. and Bogen, S. and Chen, S. and Dijck, E.A. and K{\"u}hn, S. and Rosner, M. K. and Graf, A. and Nauta, J. and Oelmann, J-H. and Schm{\"o}ger, L. and Schwarz, M. and Liebert, D. and Spie{\ss}, L.J. and King, S.A. and Leopold, T. and Micke, P. and Schmidt, P.O. and Pfeifer, T. and Crespo L{\'o}pez-Urrutia, J.R.} } @Article { YeZR2021, subid = {2533}, title = {Verification of a Capacitive Voltage Divider With 6-\(\mu\)rad Uncertainty Up To 100 kV}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2021}, volume = {70}, number2 = {17NRM01: TrafoLoss: Loss Measurements on Power Transformers and Reactors}, pages = {1-9}, keywords = {Uncertainty, Voltage measurement, Calibration, Capacitors, Current measurement, Power transformers,Loss measurement}, tags = {SEG}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9456, 1557-9662}, DOI = {10.1109/TIM.2021.3056647}, stag_bib_extends_levelofaccess = {NA}, author = {Ye, G. and Zhao, W. and Rietveld, G.} } @Proceedings { JiangPSHHMDOMPG2021, subid = {2553}, title = {Prequalification of Capacitors for High-Precision Voltage Dividers}, journal = {ISH 2021}, year = {2021}, number2 = {19NRM07: HV-com²: Support for standardisation of high voltage testing with composite and combined wave shapes}, keywords = {Voltage Divider, RCR Divider, Capacitor}, tags = {SEG}, misc2 = {EMPIR 2019: Pre-Co-Normative}, publisher = {ISH 2021}, event_place = {online}, event_name = {22nd International Symposium on High Voltage Engineering}, event_date = {21-11-2021 to 25-11-2021}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://zenodo.org/record/6073729}, author = {Jiang, H. and Pischler, O. and Schichler, U. and Havunen, J. and H{\"a}llstr{\"o}m, J. and Merev, A. and Dedeoğlu, S. and {\"O}zer, S. and Meisner, J. and Passon, S. and Gerdinand, F.} } @Article { CrottiDLL2021, subid = {2564}, title = {Measuring Harmonics With Inductive Voltage Transformers in Presence of Subharmonics}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2021}, volume = {70}, number2 = {19NRM05: IT4PQ: Measurement methods and test procedures for assessing accuracy of instrument transformers for power quality measurements}, pages = {1-13}, keywords = {Harmonics, instrument transformer (IT), low-frequency oscillations, power quality (PQ), power system measurements, subharmonics, uncertainty, voltage transformer (VT)}, web_url = {https://ieeexplore.ieee.org/document/9547226}, misc2 = {EMPIR 2019: Pre-Co-Normative}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9456, 1557-9662}, DOI = {10.1109/TIM.2021.3111995}, stag_bib_extends_levelofaccess = {NA}, author = {Crotti, G. and D'Avanzo, G. and Letizia, P.S. and Letizia, P.} } @Proceedings { CrottiMVMCTL2021, subid = {2572}, title = {ASSESSMENT OF INSTRUMENT TRANSFORMER ACCURACY FOR POWER QUALITY MEASUREMENTS IN DISTRIBUTION GRIDS: RECENT ACTIVITIES AND FIRST RESULTS FROM 19NRM05 IT4PQ PROJECT}, journal = {CIRED 2021 - The 26th International Conference and Exhibition on Electricity Distribution}, year = {2021}, number2 = {19NRM05: IT4PQ: Measurement methods and test procedures for assessing accuracy of instrument transformers for power quality measurements}, keywords = {Instrument Transformers, Power Quality Measurements, Calibration, Measurement Technique, Measurement Uncertainty}, misc2 = {EMPIR 2019: Pre-Co-Normative}, publisher = {Institution of Engineering and Technology}, event_place = {Virtual Conference}, event_name = {CIRED 2021}, event_date = {20-09-2021 to 23-09-2021}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://zenodo.org/record/6136940}, author = {Crotti, G. and Meyer, J. and van den Brom, H. and Mohns, E. and Chen, Y. and Tinarelli, R. and Luiso, M.} } @Proceedings { LalauI2021, subid = {2589}, title = {SIMULATION OF RADIOLUMINESCENCE INDUCED BY ALPHA PARTICLES IN THE AIR BY THE MONTE CARLO METHOD}, journal = {RAD Conference Proceedings}, year = {2021}, number2 = {19ENV02: RemoteALPHA: Remote and real-time optical detection of alpha-emitting radionuclides in the environment}, keywords = {Alpha particles, FLUKA, radioluminescence, simulations}, misc2 = {EMPIR 2019: Environment}, publisher = {RAD Centre}, event_place = {Herceg Novi, Montenegro}, event_name = {9th international conference on Radiation in various fields of research}, event_date = {14-06-2021 to 18-06-2021}, language = {30}, DOI = {10.21175/RadProc.2021.07}, stag_bib_extends_levelofaccess = {NA}, author = {Lalau, I. and Ioan, M-R.} } @Article { LalauI2021_2, subid = {2619}, title = {Modelling the radioluminescence of alpha particles in the air by the Monte Carlo method}, journal = {RAD-conference, Book of Abstracts}, year = {2021}, number2 = {19ENV02: RemoteALPHA: Remote and real-time optical detection of alpha-emitting radionuclides in the environment}, keywords = {Alpha particles, Remote detection, Radioluminescence, Simulation, FLUKA}, misc2 = {EMPIR 2019: Environment}, publisher = {RAD Centre}, language = {30}, DOI = {10.21175/rad.abstr.book.2021.30.6}, stag_bib_extends_levelofaccess = {NA}, author = {Lalau, Ioana and Ioan, Mihail-Razvan} } @Article { BernienGIDKBJ2021, subid = {2648}, title = {Traceable low-current measurements for a novel ionization gauge suitable as reference standard}, journal = {Measurement: Sensors}, year = {2021}, volume = {18}, number = {December 2}, number2 = {20SIP01: ISO Gauge: Developing an ISO Technical Specification ''Characteristics for a stable ionisation vacuum gauge''}, pages = {100202}, keywords = {Ionization vacuum gaugeSensitivityLow currentTraceable measurementsMetrology}, misc2 = {EMPIR 2020: Support for Impact}, publisher = {Elsevier Ltd}, language = {30}, ISSN = {2665-9174}, DOI = {10.1016/j.measen.2021.100202}, stag_bib_extends_levelofaccess = {NA}, author = {Bernien, M. and G{\"o}tz, M. and Illgen, C. and Drung, D. and Krause, C. and Bock, T. and Jousten, K.} } @Article { VicarJJIBJBBST2021, subid = {2647}, title = {Electrons on a straight path: A novel ionisation vacuum gauge suitable as reference standard}, journal = {VACUUM}, year = {2021}, volume = {189}, number = {2021}, number2 = {20SIP01: ISO Gauge: Developing an ISO Technical Specification ''Characteristics for a stable ionisation vacuum gauge''}, pages = {110239}, keywords = {Ionisation vacuum gaugeHot cathodeSensitivitySecondary electronsIon induced secondary electron yield}, web_url = {https://arxiv.org/abs/2103.03566}, misc2 = {EMPIR 2020: Support for Impact}, publisher = {Elsevier Ltd}, language = {30}, ISSN = {0042-207X}, DOI = {10.1016/j.vacuum.2021.110239}, stag_bib_extends_levelofaccess = {NA}, author = {Vicar, M. and J{\"o}nnson, G. and Jenninger, B. and Illgen, C. and Bundaleski, N. and Jousten, K. and Boineau, F. and Bernien, M. and Šetina, J. and Teodoro, O.} } @Article { Fatadin2021, subid = {2697}, title = {Metrology of Optical Communication Systems Using Error Vector Magnitude}, journal = {Journal of Applied Mathematics and Physics}, year = {2021}, volume = {09}, number = {11}, number2 = {20SIP05: KTOC: Knowledge Transfer for Optical Communications}, pages = {2918-2926}, keywords = {Carrier Phase Recovery, Error Vector Magnitude (EVM), Quadrature Amplitude Modulation (QAM)}, web_url = {https://www.scirp.org/journal/paperinformation.aspx?paperid=113306}, misc2 = {EMPIR 2020: Support for Impact}, publisher = {Scientific Research Publishing, Inc.}, language = {30}, ISSN = {2327-4352, 2327-4379}, DOI = {10.4236/jamp.2021.911185}, stag_bib_extends_levelofaccess = {NA}, author = {Fatadin, I.} } @Proceedings { FordRA2021, subid = {2705}, title = {A Study of the stability exhibited by hydrophones when exposed to variations in temperature and hydrostatic pressure}, journal = {6th Underwater Acoustics Conference and Exhibition}, year = {2021}, volume = {Volume 44}, number = {1}, number2 = {19ENV03: Infra-AUV: Metrology for low-frequency sound and vibration}, pages = {070024}, keywords = {stability exhibited by hydrophones, variations in temperature, hydrostatic pressure}, web_url = {https://asa.scitation.org/doi/abs/10.1121/2.0001491}, misc2 = {EMPIR 2019: Environment}, publisher = {ASA}, event_place = {Teddington, Surrey}, event_name = {Meetings on Acoustics}, event_date = {03-09-2021 to 04-09-2021}, language = {30}, ISSN = {1939-800X}, DOI = {10.1121/2.0001491}, stag_bib_extends_levelofaccess = {NA}, author = {Ford, B. and Robinson, S. and Ablitt, J.} } @Proceedings { GogyanKBZ2021, subid = {2747}, title = {Theoretical Investigation of Superradiant Lasing in 2-or 3-Level Atoms in an Optical Lattice}, journal = {2021 JOINT CONFERENCE OF THE EUROPEAN FREQUENCY AND TIME FORUM AND IEEE INTERNATIONAL FREQUENCY CONTROL SYMPOSIUM}, year = {2021}, volume = {1}, number = {1}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, keywords = {superradiance 2-3 level atoms}, misc2 = {EMPIR 2017: Fundamental}, event_place = {on line}, event_name = {Joint Conference of the European-Frequency-and-Time-Forum / IEEE International Frequency Control Symposium (EFTF/IFCS)}, event_date = {09-07-2022 to 14-07-2022}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://www.eftf.org/fileadmin/documents/eftf/documents/Proceedings/EFTF-IFCS-2021-Proceedings.zip}, author = {Gogyan, A. and Kazakov, G. and Bober, M. and Zawada, M.} } @Proceedings { SinghTNMKGBBWZ2021, subid = {2732}, title = {Towards a Continuous Active Optical Atomic Clock With Cold Strontium Atoms}, journal = {2021 JOINT CONFERENCE OF THE EUROPEAN FREQUENCY AND TIME FORUM AND IEEE INTERNATIONAL FREQUENCY CONTROL SYMPOSIUM (IEEE EFTF-IFCS 2021)}, year = {2021}, volume = {1}, number = {1}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, keywords = {Contiunous clock,}, web_url = {https://www.eftf.org/fileadmin/documents/eftf/documents/Proceedings/EFTF-IFCS-2021-Proceedings.zip}, misc2 = {EMPIR 2017: Fundamental}, event_place = {on line}, event_name = {Joint Conference of the European-Frequency-and-Time-Forum / IEEE International Frequency Control Symposium (EFTF/IFCS)}, event_date = {09-07-2021 to 14-07-2021}, language = {30}, ISBN = {978-1-6654-3935-0}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {2327-1914}, author = {Singh, V. and Tonoyan, A. and Naroznik, M. and Morzyński, P. and Kovacic, D. and Gogyan, A. and Bilicki, S. and Bober, M. and Witkowski, M. and Zawada, M.} } @Proceedings { ClivatiRRTBCL2021, subid = {2740}, title = {INRIM Sr Optical Clock: An Optically Loaded Apparatus for High-Stability Metrology}, journal = {Proceedings EFTF 2021}, year = {2021}, volume = {1}, number = {1}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, keywords = {OLC, Sr, 2D-MOT}, misc2 = {EMPIR 2017: Fundamental}, event_place = {on line}, event_name = {Joint Conference of the European-Frequency-and-Time-Forum / IEEE International Frequency Control Symposium (EFTF/IFCS)}, event_date = {07-07-2022 to 16-07-2022}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://www.eftf.org/fileadmin/documents/eftf/documents/Proceedings/EFTF-IFCS-2021-Proceedings.zip}, author = {Clivati, C. and Risaro, M. and Rullo, F. and Tarallo, M.G. and Barbiero, M. and Calonico, D. and Levi, F.} } @Proceedings { ClivatiRRTBCL2021_2, subid = {2740}, title = {INRIM Sr Optical Clock: An Optically Loaded Apparatus for High-Stability Metrology}, journal = {Proceedings EFTF 2021}, year = {2021}, volume = {1}, number = {1}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, keywords = {OLC, Sr, 2D-MOT}, misc2 = {EMPIR 2017: Fundamental}, event_place = {on line}, event_name = {Joint Conference of the European-Frequency-and-Time-Forum / IEEE International Frequency Control Symposium (EFTF/IFCS)}, event_date = {07-07-2022 to 16-07-2022}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://www.eftf.org/fileadmin/documents/eftf/documents/Proceedings/EFTF-IFCS-2021-Proceedings.zip}, author = {Clivati, C. and Risaro, M. and Rullo, F. and Tarallo, M.G. and Barbiero, M. and Calonico, D. and Levi, F.} } @Article { SilanderFZZA2020_2, subid = {1785}, title = {An Invar-based Fabry-Perot cavity refractometer with a gallium fixed-point cell for assessment of pressure}, journal = {ACTA IMEKO}, year = {2020}, month = {12}, day = {31}, volume = {9}, number = {5}, number2 = {18SIB04: QuantumPascal: Towards quantum-based realisations of the pascal}, pages = {293-298}, keywords = {Refractometry, Fabry-Perot cavity, Temperature, Gallium, Gas Modulation}, web_url = {https://acta.imeko.org/index.php/acta-imeko/article/view/IMEKO-ACTA-09\%20\%282020\%29-05-60}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IMEKO International Measurement Confederation}, language = {30}, ISSN = {2221-870X}, DOI = {10.21014/acta_imeko.v9i5.987}, stag_bib_extends_levelofaccess = {NA}, author = {Silander, I. and Forss{\'e}n, C. and Zakrisson, J. and Zelan, M. and Axner, O.} } @Article { ZelanSFZA2020, subid = {1784}, title = {Recent advances in Fabry-Perot-based refractometry utilizing gas modulation for assessment of pressure}, journal = {ACTA IMEKO}, year = {2020}, month = {12}, day = {31}, volume = {9}, number = {5}, number2 = {18SIB04: QuantumPascal: Towards quantum-based realisations of the pascal}, pages = {299-304}, keywords = {Refractometry, Gas Modulation, GAMOR, Pressure}, web_url = {https://acta.imeko.org/index.php/acta-imeko/article/view/IMEKO-ACTA-09\%20\%282020\%29-05-61}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IMEKO International Measurement Confederation}, language = {30}, ISSN = {2221-870X}, DOI = {10.21014/acta_imeko.v9i5.988}, stag_bib_extends_levelofaccess = {NA}, author = {Zelan, M. and Silander, I. and Forss{\'e}n, C. and Zakrisson, J. and Axner, O.} } @Article { ForssenSSJBHAZ2020, subid = {1786}, title = {A transportable refractometer for assessment of pressure in the kPa range with ppm level precision}, journal = {ACTA IMEKO}, year = {2020}, month = {12}, day = {31}, volume = {9}, number = {5}, number2 = {18SIB04: QuantumPascal: Towards quantum-based realisations of the pascal}, pages = {287-292}, keywords = {Refractometry; Pressure; Gas Modulation, GAMOR; Transportable}, web_url = {https://acta.imeko.org/index.php/acta-imeko/article/view/IMEKO-ACTA-09\%20\%282020\%29-05-59}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IMEKO International Measurement Confederation}, language = {30}, ISSN = {2221-870X}, DOI = {10.21014/acta_imeko.v9i5.986}, stag_bib_extends_levelofaccess = {NA}, author = {Forss{\'e}n, C. and Silander, I. and Szabo, D. and J{\"o}nsson, G. and Bjerling, M. and Hausmaninger, T. and Axner, O. and Zelan, M.} } @Article { ZakrissonSFSMPKARA2020, subid = {1787}, title = {Simulation of pressure-induced cavity deformation – the 18SIB04 Quantumpascal EMPIR project}, journal = {ACTA IMEKO}, year = {2020}, month = {12}, day = {31}, volume = {9}, number = {5}, number2 = {18SIB04: QuantumPascal: Towards quantum-based realisations of the pascal}, pages = {281-286}, keywords = {EMPIR; QuantumPascal; FEM; Pressure; Refractometry; Deformation.}, web_url = {https://acta.imeko.org/index.php/acta-imeko/article/view/IMEKO-ACTA-09\%20\%282020\%29-05-58}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IMEKO International Measurement Confederation}, language = {30}, ISSN = {2221-870X}, DOI = {10.21014/acta_imeko.v9i5.985}, stag_bib_extends_levelofaccess = {NA}, author = {Zakrisson, J. and Silander, I. and Forss{\'e}n, C. and Silvestri, Z. and Mari, D. and Pasqualin, S. and Kussicke, A. and Asbahr, P. and Rubin, T. and Axner, O.} } @Article { SilvestriBOW2020, subid = {1831}, title = {Towards an improved helium-based refractometer for pressure measurements}, journal = {ACTA IMEKO}, year = {2020}, month = {12}, day = {31}, volume = {9}, number = {5}, number2 = {18SIB04: QuantumPascal: Towards quantum-based realisations of the pascal}, pages = {305}, keywords = {refractometry, Fabry-Perot, pressure measurement, quantum pascal}, web_url = {https://acta.imeko.org/index.php/acta-imeko/article/view/IMEKO-ACTA-09\%20\%282020\%29-05-62}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IMEKO International Measurement Confederation}, language = {30}, ISSN = {2221-870X}, DOI = {10.21014/acta_imeko.v9i5.989}, stag_bib_extends_levelofaccess = {NA}, author = {Silvestri, Z. and Bentouati, D. and Otal, P. and Wallerand, J-P.} } @Proceedings { FurtadoPQSLMAARLBCLA2020, subid = {1898}, title = {First density comparison on viscoelastic samples by oscillation-type densimetry}, journal = {ACTA IMEKO}, year = {2020}, month = {12}, day = {31}, volume = {9}, number = {5}, number2 = {17RPT02: rhoLiq: Establishing traceability for liquid density measurements}, pages = {79}, keywords = {EMPIR rhoLiq Project; oscillation-type density meter; viscoelasticity; comparison}, misc2 = {EMPIR 2017: Research Potential}, publisher = {IMEKO International Measurement Confederation}, event_place = {-}, event_name = {IMEKO TC3, TC5, TC16 and TC2}, event_date = {16-11-2020 to 18-11-2020}, language = {30}, ISSN = {2221-870X}, DOI = {10.21014/acta_imeko.v9i5.943}, stag_bib_extends_levelofaccess = {NA}, author = {Furtado, A. and Pereira, J. and Quendera, R. and Schiebl, M. and Lenard, E. and Malejczyk, E. and Alic, A. and Alisic, S. and Rauch, J. and Lorenz, F. and Bescupschii, A. and Ciubara, A. and Laky, B. and Ams{\"u}ss, R.} } @Article { ZelenkaASHKPPDZCM2020, subid = {2108}, title = {Improvement of the realisation of the mass scale}, journal = {ACTA IMEKO}, year = {2020}, month = {12}, day = {31}, volume = {9}, number = {5}, number2 = {19RPT02: RealMass: Improvement of the realisation of the mass scale}, pages = {4}, keywords = {Mass realisation, kilogram, multiplies and sub-multiplies, subdivision and multiplication, OIML R111}, web_url = {https://acta.imeko.org/index.php/acta-imeko/index}, misc2 = {EMPIR 2019: Research Potential}, publisher = {IMEKO International Measurement Confederation}, language = {30}, ISSN = {2221-870X}, DOI = {10.21014/acta_imeko.v9i5.928}, stag_bib_extends_levelofaccess = {NA}, author = {Zelenka, Z. and Alisic, S. and Stoilkovska, B. and Hanrahan, R. and Kolozinsky, I. and Popa, G. and Pantic, D. and Dikov, V. and Zůda, J. and Coenegrachts, M. and Malengo, A.} } @Article { ChouhanJHBGSBH2020, subid = {2033}, title = {Emerging tri‐s‐triazine‐based graphitic carbon nitride: A potential signal‐transducing nanostructured material for sensor applications}, journal = {Nano Select}, year = {2020}, month = {12}, day = {30}, volume = {2}, number = {4}, number2 = {16ENV01: MercOx: Metrology for oxidised mercury}, pages = {712-743}, keywords = {sorbent traps, tri‐s‐triazine‐based graphitic carbon nitride, nanostructured material, sonsors, mercury}, misc2 = {EMPIR 2016: Environment}, publisher = {Wiley}, language = {30}, ISSN = {2688-4011, 2688-4011}, DOI = {10.1002/nano.202000228}, stag_bib_extends_levelofaccess = {NA}, author = {Chouhan, R.S. and Jerman, I. and Heath, D. and Bohm, S. and Gandhi, S. and Sadhu, V. and Baker, S. and Horvat, M.} } @Article { NaccaratoTMMMZPAPNMWSMMSBPSW2020, subid = {2035}, title = {A field intercomparison of three passive air samplers for gaseous mercury in ambient air}, journal = {Atmospheric Measurement Techniques}, year = {2020}, month = {12}, day = {29}, number2 = {16ENV01: MercOx: Metrology for oxidised mercury}, keywords = {atmnospheric gaseous mercury, passive samplers, intercomparison}, misc2 = {EMPIR 2016: Environment}, publisher = {Copernicus GmbH}, language = {30}, DOI = {10.5194/amt-2020-455}, stag_bib_extends_levelofaccess = {NA}, author = {Naccarato, A. and Tassone, A. and Martino, M. and Moretti, S. and Macagnano, A. and Zampetti, E. and Papa, P. and Avossa, J. and Pirrone, N. and Nerentorp, M. and Munthe, J. and W{\"a}ngberg, I. and Stupple, G.W. and Mitchell, C.P.J. and Martin, A.R. and Steffen, A. and Babi, D. and Prestbo, E.M. and Sprovieri, F. and Wania, F.} } @Article { EberPP2020, subid = {1889}, title = {Re-investigation of the Normal Spectral Emissivity at 684.5 nm of Solid and Liquid Molybdenum}, journal = {International Journal of Thermophysics}, year = {2020}, month = {12}, day = {28}, volume = {42}, number = {2}, number2 = {17IND11: Hi-TRACE: Industrial process optimisation through improved metrology of thermophysical properties}, keywords = {Normal spectral emissivity, Microsecond polarimetry, Molybdenum, Pulse heating, Subsecond thermophysics}, misc2 = {EMPIR 2017: Industry}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {0195-928X, 1572-9567}, DOI = {10.1007/s10765-020-02769-7}, stag_bib_extends_levelofaccess = {NA}, author = {Eber, A. and Pichler, P. and Pottlacher, G.} } @Article { YrjanaSIKLB2020, subid = {2182}, title = {Potentiometric Carboxylate Sensors Based on Carbazole-Derived Acyclic and Macrocyclic Ionophores}, journal = {Chemosensors}, year = {2020}, month = {12}, day = {24}, volume = {9}, number = {1}, number2 = {17FUN09: UnipHied: Realisation of a Unified pH Scale}, pages = {4}, keywords = {ion-selective electrodesanion receptorsionophorescarboxylateelectrode shell material}, misc2 = {EMPIR 2017: Fundamental}, publisher = {MDPI AG}, language = {30}, ISSN = {2227-9040}, DOI = {10.3390/chemosensors9010004}, stag_bib_extends_levelofaccess = {NA}, author = {Yrj{\"a}n{\"a}, V. and Saar, I. and Ilisson, M. and Kadam, S.A. and Leito, I. and Bobacka, J.} } @Article { SeresSSS2020, subid = {2270}, title = {High harmonic generation in AlN due to out-of-surface electron orbitals}, journal = {OSA Continuum}, year = {2020}, month = {12}, day = {24}, volume = {4}, number = {1}, number2 = {17FUN07: CC4C: Coulomb Crystals for Clocks}, pages = {47}, keywords = {VUV frequency comb}, misc2 = {EMPIR 2017: Fundamental}, publisher = {The Optical Society}, language = {30}, ISSN = {2578-7519}, DOI = {10.1364/OSAC.404942}, stag_bib_extends_levelofaccess = {NA}, author = {Seres, J. and Seres, E. and Serrat, C. and Schumm, T.} } @Article { ZuccaSP2020, subid = {1795}, title = {A measurement system for the characterization of wireless charging stations for electric vehicles}, journal = {IEEE Transactions on Instrumentation and measurement}, year = {2020}, month = {12}, day = {23}, volume = {Early Acce}, number = {ea}, number2 = {16ENG08: MICEV: Metrology for inductive charging of electric vehicles}, pages = {pp. 1-10}, keywords = {Measurement, Measurement uncertainty, Inductive charging, Electric vehicles.}, web_url = {https://ieeexplore.ieee.org/stamp/stamp.jsp?tp=\&arnumber=9305232}, misc2 = {EMPIR 2016: Energy}, publisher = {IEEE}, language = {30}, ISSN = {1557-9662}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://ieeexplore.ieee.org/document/9191828}, author = {Zucca, M. and Squillari, P. and Pogliano, U.} } @Article { VisserRSDMW2020, subid = {2009}, title = {A single-beam photothermal interferometer for in situ measurements of aerosol light absorption}, journal = {Atmospheric Measurement Techniques}, year = {2020}, month = {12}, day = {23}, volume = {13}, number = {12}, number2 = {16ENV02: Black Carbon: Metrology for light absorption by atmospheric aerosols}, pages = {7097-7111}, keywords = {single-beam photothermal interferometer; measurement; aerosol light absorption; standard dual-beam photothermal interferometers; light-absorbing gases; NO2; black carbon; concentration; detection limits}, misc2 = {EMPIR 2016: Environment}, publisher = {Copernicus GmbH}, language = {30}, ISSN = {1867-8548}, DOI = {10.5194/amt-13-7097-2020}, stag_bib_extends_levelofaccess = {NA}, author = {Visser, B. and R{\"o}hrbein, J. and Steigmeier, P. and Drinovec, L. and Močnik, G. and Weingartner, E.} } @Article { FerreroFSSSCH2020, subid = {1778}, title = {Fundamental scattering quantities for the determination of reflectance and transmittance}, journal = {Optics Express}, year = {2020}, month = {12}, day = {22}, volume = {29}, number = {1}, number2 = {18SIB03: BxDiff: New quantities for the measurement of appearance}, pages = {219}, keywords = {BRDF, BSSRDF, reflectance, transmittance}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {The Optical Society}, language = {30}, ISSN = {1094-4087}, DOI = {10.1364/OE.410225}, stag_bib_extends_levelofaccess = {NA}, author = {Ferrero, A. and Frisvad, J.R. and Simonot, L. and Santaf{\'e}, P. and Schirmacher, A. and Campos, J. and Hebert, M.} } @Article { MarzanoODMC2020, subid = {1847}, title = {A fully digital bridge towards the realization of the farad from the quantum Hall effect}, journal = {Metrologia}, year = {2020}, month = {12}, day = {22}, volume = {58}, number2 = {18SIB07: GIQS: Graphene impedance quantum standard}, pages = {015002}, keywords = {digital impedance bridges, impedance metrology, quantum hall effect}, web_url = {https://iopscience.iop.org/article/10.1088/1681-7575/abba86}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/abba86}, stag_bib_extends_levelofaccess = {NA}, author = {Marzano, M. and Ortolano, M. and D’Elia, V. and M{\"u}ller, A. and Callegaro, L.} } @Article { DrAmatoVMBMBM2020, subid = {1874}, title = {Spectroscopic Techniques versus Pitot Tube for the Measurement of Flow Velocity in Narrow Ducts}, journal = {Sensors}, year = {2020}, month = {12}, day = {21}, volume = {20}, number = {24}, number2 = {16ENV08: IMPRESS 2: Metrology for air pollutant emissions}, pages = {7349}, keywords = {laser flow meter; Pitot tube; flow speed; time of flight; dilution method; flow simulation; flow turbulence; gas sensing applications}, misc2 = {EMPIR 2016: Environment}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s20247349}, stag_bib_extends_levelofaccess = {NA}, author = {D’Amato, F. and Viciani, S. and Montori, A. and Barucci, M. and Morreale, C. and Bertagna, S. and Migliavacca , G.} } @Article { ChenMSd2020, subid = {2065}, title = {Precise Amplitude and Phase Determination Using Resampling Algorithms for Calibrating Sampled Value Instruments}, journal = {Sensors}, year = {2020}, month = {12}, day = {21}, volume = {20}, number = {24}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, pages = {7345}, keywords = {resampling algorithm; sampled values; SV-based instrumentation; SV-based calibration; phase synchronisation; sinc interpolation}, web_url = {https://www.mdpi.com/1424-8220/20/24/7345}, misc2 = {EMPIR 2017: Industry}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s20247345}, stag_bib_extends_levelofaccess = {NA}, author = {Chen, Y. and Mohns, E. and Seckelmann, M. and de Rose, S.} } @Article { GabrischDLWCGFKPP2020, subid = {1844}, title = {VHEE beam dosimetry at CERN Linear Electron Accelerator for Research under ultra-high dose rate conditions}, journal = {Biomedical Physics \& Engineering Express}, year = {2020}, month = {12}, day = {18}, volume = {7}, number = {1}, number2 = {18HLT04: UHDpulse: Metrology for advanced radiotherapy using particle beams with ultra-high pulse dose rates}, pages = {015012}, keywords = {ultra-high pulse dose rates, dosimetry, metrology, ionization chamber}, misc2 = {EMPIR 2018: Health}, publisher = {IOP Publishing}, language = {30}, ISSN = {2057-1976}, DOI = {10.1088/2057-1976/abcae5}, stag_bib_extends_levelofaccess = {NA}, author = {Gabrisch, L. and Delfs, B. and Looe, H.K. and Wyrwoll, V. and Corsini, R. and Gilardi, A. and Farabolini, W. and Kranzer, R. and Poppinga, D. and Poppe, B.} } @Proceedings { SpositoLS2020, subid = {1975}, title = {Towards an Ultra-High-Speed Combustion Pyrometer}, journal = {International Journal of Turbomachinery, Propulsion and Power}, year = {2020}, month = {12}, day = {15}, volume = {5}, number = {4}, number2 = {17IND07: DynPT: Development of measurement and calibration techniques for dynamic pressures and temperatures}, pages = {31}, keywords = {combustion, temperature, pyrometer, optical sensor}, misc2 = {EMPIR 2017: Industry}, publisher = {MDPI AG}, event_place = {Graz, Austria}, event_name = {9th EVI-GTI International Gas Turbine Instrumentation Conference}, event_date = {20-11-2019 to 21-11-2019}, language = {30}, ISSN = {2504-186X}, DOI = {10.3390/ijtpp5040031}, stag_bib_extends_levelofaccess = {NA}, author = {Sposito, A. and Lowe, D. and Sutton, G.} } @Article { PojtingerNGPPKT2020, subid = {2375}, title = {Experimental determination of magnetic field correction factors for ionization chambers in parallel and perpendicular orientations}, journal = {Physics in Medicine \& Biology}, year = {2020}, month = {12}, day = {15}, volume = {65}, number = {24}, number2 = {19NRM01: MRgRT-DOS: Traceable dosimetry for small fields in MR-guided radiotherapy}, pages = {245044}, keywords = {MR-linac, dosimetry, alanine dosimetry, ionization chambers, magnetic field correction factors}, misc2 = {EMPIR 2019: Pre-Co-Normative}, publisher = {IOP Publishing}, language = {30}, ISSN = {0031-9155, 1361-6560}, DOI = {10.1088/1361-6560/abca06}, stag_bib_extends_levelofaccess = {NA}, author = {Pojtinger, S. and Nachbar, M. and Ghandour, S. and Pisaturo, O. and Pachoud, M. and Kapsch, R-P. and Thorwarth, D.} } @Article { BowdenVHSH2020, subid = {2729}, title = {Improving the Q Factor of an Optical Atomic Clock Using Quantum Nondemolition Measurement}, journal = {Physical Review X}, year = {2020}, month = {12}, day = {15}, volume = {10}, number = {4}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, keywords = {Atomic and Molecular Physics}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2160-3308}, DOI = {10.1103/PhysRevX.10.041052}, stag_bib_extends_levelofaccess = {NA}, author = {Bowden, W. and Vianello, A. and Hill, I.R. and Schioppo, M. and Hobson, R.} } @Article { RidlerSSSSW2020, subid = {1833}, title = {Establishing waveguide lines as primary standards for scattering parameter measurements at submillimetre wavelengths}, journal = {Metrologia}, year = {2020}, month = {12}, day = {14}, volume = {58}, number = {1}, number2 = {18SIB09: TEMMT: Traceability for electrical measurements at millimetre-wave and terahertz frequencies for communications and electronics technologies}, pages = {1-13}, keywords = {metrological traceability, vector network analyser, calibration, waveguide, sub-millimetre-wave measurements, scattering parameters}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/abd371}, stag_bib_extends_levelofaccess = {NA}, author = {Ridler, N. and Susan Johny, A. and Salter, M. and Shang, X. and Sun, W. and Wilson, A.} } @Article { Teir2020, subid = {1896}, title = {Microprobe surface roughness characterization}, journal = {Thesis - Master's Programme in Mechanical Engineering (MEC)}, year = {2020}, month = {12}, day = {14}, number2 = {17IND05: MicroProbes: Multifunctional ultrafast microprobes for on-the-machine measurements}, keywords = {Surface roughness, Microprobe, MicroProbes, Calibration}, web_url = {https://aaltodoc.aalto.fi/bitstream/handle/123456789/97492/master_Teir_Linus_2020.pdf?sequence=1\&isAllowed=y}, misc2 = {EMPIR 2017: Industry}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {http://urn.fi/URN:NBN:fi:aalto-2020122056319}, author = {Teir, L.} } @Article { OlbrichSBSOS2020, subid = {1677}, title = {Identification of coherent structures in horizontal slug flow}, journal = {Flow Measurement and Instrumentation}, year = {2020}, month = {12}, volume = {76}, number2 = {16ENG07: MultiFlowMet II: Multiphase flow reference metrology}, pages = {101814}, keywords = {Slug flow, Coherent structures, Snapshot POD}, misc2 = {EMPIR 2016: Energy}, publisher = {Elsevier BV}, language = {30}, ISSN = {0955-5986}, DOI = {10.1016/j.flowmeasinst.2020.101814}, stag_bib_extends_levelofaccess = {NA}, author = {Olbrich, M. and Schmeyer, E. and B{\"a}r, M. and Sieber, M. and Oberleithner, K. and Schmetler, S.} } @Article { DitaliaTchernijLCSPTBCPPDMAOSMGF2020, subid = {1730}, title = {Fluorine-based color centers in diamond}, journal = {Scientific Reports}, year = {2020}, month = {12}, volume = {10}, number = {1}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {21537}, keywords = {Confocal microscopyOptical properties of diamondQuantum opticsSingle photons and quantum effects}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2045-2322}, DOI = {10.1038/s41598-020-78436-6}, stag_bib_extends_levelofaccess = {NA}, author = {Ditalia Tchernij, S. and L{\"u}hmann, T. and Corte, E. and Sardi, F. and Picollo, F. and Traina, P. and Brajković, M. and Crnjac, A. and Pezzagna, S. and Pastuović, Ž. and Degiovanni, I.P. and Moreva, E. and Apr{\`a}, P. and Olivero, P. and Siketić, Z. and Meijer, J. and Genovese, M. and Forneris, J.} } @Article { SchmelterKOFB2020, subid = {1764}, title = {On the influence of inlet perturbations on slug dynamics in horizontal multiphase flow – a computational study}, journal = {Metrologia}, year = {2020}, month = {12}, number2 = {16ENG07: MultiFlowMet II: Multiphase flow reference metrology}, keywords = {multiphase flow, two-phase flow, gas-liquid flow, slug flow, computational fluid dynamics (CFD), inlet perturbation, random perturbation}, misc2 = {EMPIR 2016: Energy}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/abd1c9}, stag_bib_extends_levelofaccess = {NA}, author = {Schmelter, S. and Knotek, S. and Olbrich, M. and Fiebach, A. and Baer, M.} } @Article { MarschallHWHRKE2020, subid = {1801}, title = {Compressed FTIR spectroscopy using low-rank matrix reconstruction}, journal = {Optics Express}, year = {2020}, month = {12}, volume = {28}, number = {26}, number2 = {18HLT06: RaCHy: Radiotherapy coupled with hyperthermia - adapting the biological equivalent dose concept}, pages = {38762}, keywords = {Fourier transform infrared; FTIR spectroscopy; low-rank matrix reconstruction}, web_url = {https://www.osapublishing.org/oe/fulltext.cfm?uri=oe-28-26-38762\&id=444648}, misc2 = {EMPIR 2018: Health}, publisher = {The Optical Society}, language = {30}, ISSN = {1094-4087}, DOI = {10.1364/OE.404959}, stag_bib_extends_levelofaccess = {NA}, author = {Marschall, M. and Hornemann, A. and W{\"u}bbeler, G. and Hoehl, A. and Ruhl, E. and K{\"a}stner, B. and Elster, C.} } @Article { DitaliaTchernijLCSPTBCPPDMAOSMGF2020_2, subid = {1806}, title = {Fluorine-based color centers in diamond}, journal = {Scientific Reports}, year = {2020}, month = {12}, volume = {10}, number = {1}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, keywords = {Confocal microscopyOptical properties of diamondQuantum opticsSingle photons and quantum effects}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2045-2322}, DOI = {10.1038/s41598-020-78436-6}, stag_bib_extends_levelofaccess = {NA}, author = {Ditalia Tchernij, S. and L{\"u}hmann, T. and Corte, E. and Sardi, F. and Picollo, F. and Traina, P. and Brajković, M. and Crnjac, A. and Pezzagna, S. and Pastuović, Ž. and Degiovanni, I.P. and Moreva, E. and Apr{\`a}, P. and Olivero, P. and Siketić, Z. and Meijer, J. and Genovese, M. and Forneris, J.} } @Article { BukerSdMM2020, subid = {1822}, title = {Investigations on pressure dependence of Coriolis Mass Flow Meters used at Hydrogen Refueling Stations}, journal = {Flow Measurement and Instrumentation}, year = {2020}, month = {12}, volume = {76}, number2 = {16ENG01: MetroHyVe: Metrology for hydrogen vehicles}, pages = {101815}, keywords = {Hydrogen, Coriolis Mass Flow Meter, Flow metering, High pressure, Hydrogen Refueling Station}, tags = {EnG}, misc2 = {EMPIR 2016: Energy}, publisher = {Elsevier BV}, language = {30}, ISSN = {0955-5986}, DOI = {10.1016/j.flowmeasinst.2020.101815}, stag_bib_extends_levelofaccess = {NA}, author = {B{\"u}ker, O. and Stolt, K. and de Huu, M. and MacDonald, M. and Maury, R.} } @Article { SchullerHFSDRPTFKCSBSMGSBLJPBKKBOKPASRV2020, subid = {1841}, title = {The European Joint Research Project UHDpulse – Metrology for advanced radiotherapy using particle beams with ultra-high pulse dose rates}, journal = {Physica Medica}, year = {2020}, month = {12}, volume = {80}, number2 = {18HLT04: UHDpulse: Metrology for advanced radiotherapy using particle beams with ultra-high pulse dose rates}, pages = {134-150}, keywords = {Dosimetry, FLASH beams, Absorbed dose, Traceability, High dose rates, European metrology project}, misc2 = {EMPIR 2018: Health}, publisher = {Elsevier BV}, language = {30}, ISSN = {1120-1797}, DOI = {10.1016/j.ejmp.2020.09.020}, stag_bib_extends_levelofaccess = {NA}, author = {Sch{\"u}ller, A. and Heinrich, S. and Fouillade, C. and Subiel, A. and De Marzi, L. and Romano, F. and Peier, P. and Trachsel, M. and Fleta, C. and Kranzer, R. and Caresana, M. and Salvador, S. and Busold, S. and Sch{\"o}nfeld, A. and McEwen, M. and Gomez, F. and Solc, J. and Bailat, C. and Linhart, V. and Jakubek, J. and Pawelke, J. and Borghesi, M. and Kapsch, R-P. and Knyziak, A. and Boso, A. and Olsovcova, V. and Kottler, C. and Poppinga, D. and Ambrozova, I. and Schmitzer, C-S. and Rossomme, S. and Vozenin, M-C.} } @Article { GiordanoSGvS2020, subid = {1931}, title = {Methodology for the Accurate Measurement of the Power Dissipated by Braking Rheostats}, journal = {Sensors}, year = {2020}, month = {12}, volume = {20}, number = {23}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, pages = {6935}, keywords = {power measurement; braking rheostat; regenerative braking; current transducer; frequency characterization; chopped current; railway system; DC locomotive}, misc2 = {EMPIR 2016: Energy}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s20236935}, stag_bib_extends_levelofaccess = {NA}, author = {Giordano, D. and Signorino, D. and Gallo, D. and van den Brom, H.E. and Š{\'i}ra, M.} } @Article { MeddingsHOLRNSHRGP2020, subid = {1986}, title = {Application of electrochemical impedance spectroscopy to commercial Li-ion cells: A review}, journal = {Journal of Power Sources}, year = {2020}, month = {12}, volume = {480}, number2 = {17IND10: LiBforSecUse: Quality assessment of electric vehicle Li-ion batteries for second use applications}, pages = {228742}, keywords = {Lithium-ion batteryEISInterpretationValidationMetrologyDegradation}, misc2 = {EMPIR 2017: Industry}, publisher = {Elsevier BV}, language = {30}, ISSN = {0378-7753}, DOI = {10.1016/j.jpowsour.2020.228742}, stag_bib_extends_levelofaccess = {NA}, author = {Meddings, N. and Heinrich, M. and Overney, F. and Lee, J-S. and Ruiz, V. and Napolitano, E. and Seitz, S. and Hinds, G. and Raccichini, R. and Gaberšček, M. and Park, J.} } @Article { HancockDBLBTDBHBM2020, subid = {1894}, title = {Arbitrarily large tomography with iterative algorithms on multiple GPUs using the TIGRE toolbox}, journal = {Journal of Parallel and Distributed Computing}, year = {2020}, month = {12}, volume = {146}, number = {1}, number2 = {17IND08: AdvanCT: Advanced Computed Tomography for dimensional and surface measurements in industry}, pages = {52-63}, keywords = {Computed TomographyIterative reconstructionSoftwaremulti-GPU}, web_url = {https://arxiv.org/abs/1905.03748}, misc2 = {EMPIR 2017: Industry}, publisher = {Elsevier BV}, language = {30}, ISSN = {0743-7315}, DOI = {10.1016/j.jpdc.2020.07.004}, stag_bib_extends_levelofaccess = {NA}, author = {Hancock, S. and Dosanjh, M. and Biguri, A. and Lindroos, R. and Bryll, R. and Towsyfyan, H. and Deyhle, H. and Blumensath, T. and Harrane, I.E.K. and Boardman, R. and Mavrogordato, M.} } @Article { PetrovRCG2020, subid = {2037}, title = {Evaluating the performance of oxidized Hg reference gas generators in the range ng m−3 to \(\mu\)g m−3 by improved coupling with ICP-MS}, journal = {Atmospheric Environment: X}, year = {2020}, month = {12}, volume = {8}, number2 = {16ENV01: MercOx: Metrology for oxidised mercury}, pages = {100090}, keywords = {gaseous oxidized mercury, validation, ICP-MS}, misc2 = {EMPIR 2016: Environment}, publisher = {Elsevier BV}, language = {30}, ISSN = {2590-1621}, DOI = {10.1016/j.aeaoa.2020.100090}, stag_bib_extends_levelofaccess = {NA}, author = {Petrov, P. and Rajamaki, T. and Corns, W.T. and Goenaga-Infante, H.} } @Proceedings { ElgGAMMHHLMPMSV2020, subid = {2062}, title = {Research Project EMPIR 19ENG02 Future Energy}, journal = {VDE High Voltage Technology 2020; ETG-Symposium}, year = {2020}, month = {12}, volume = {N/A}, number = {N/A}, number2 = {19ENG02: FutureEnergy: Metrology for future energy transmission}, pages = {N/A}, keywords = {UHVDC, traceability, Lightning Impulse, linearity, voltage dependence, HVAC, DC partial discharge, GIS Partial discharge}, tags = {SEG}, web_url = {https://ieeexplore.ieee.org/servlet/opac?punumber=9275417}, misc2 = {EMPIR 2019: Energy}, publisher = {VDE}, event_place = {Berlin, Germany}, event_name = {VDE High Voltage Technology 2020; ETG-Symposium}, event_date = {09-11-2020 to 11-11-2020}, language = {30}, ISBN = {978-3-8007-5353-6}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://zenodo.org/record/4769653}, author = {Elg, A-P. and Garnacho, F. and Agazar, M. and Meisner, J. and Merev, A. and Houtzager, E. and H{\"a}llstr{\"o}m, J. and Lahti, K. and Mier Escurra, C. and Platinero, C. and Micand, T. and Steiner, T. and Voss, A.} } @Article { ImbraguglioSS2020, subid = {2073}, title = {Comparison of ITS-90 realizations from 13 K to 273 K between LNE-CNAM and INRIM}, journal = {Measurement}, year = {2020}, month = {12}, volume = {166}, number2 = {18SIB02: Real-K: Realising the redefined kelvin}, pages = {108225}, keywords = {Fixed points, ITS-90, CSPRT, Comparison, Cryogenics}, web_url = {https://arxiv.org/abs/2007.11340}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Elsevier BV}, language = {30}, ISSN = {0263-2241}, DOI = {10.1016/j.measurement.2020.108225}, stag_bib_extends_levelofaccess = {NA}, author = {Imbraguglio, D. and Steur, P.P.M. and Sparasci, F.} } @Article { PiliaSRGDKCL2020, subid = {2455}, title = {Quantification and classification of potassium and calcium disorders with the electrocardiogram: What do clinical studies, modeling, and reconstruction tell us?}, journal = {APL Bioengineering}, year = {2020}, month = {12}, volume = {4}, number = {4}, number2 = {18HLT07: MedalCare: Metrology of automated data analysis for cardiac arrhythmia management}, pages = {041501}, keywords = {Electrolytes, Medical diagnosis, Computational models, Wearable technology, Medical tests, Artificial neural networks, Artificial intelligence, Machine learning, Dialysis}, misc2 = {EMPIR 2018: Health}, publisher = {AIP Publishing}, language = {30}, ISSN = {2473-2877}, DOI = {10.1063/5.0018504}, stag_bib_extends_levelofaccess = {NA}, author = {Pilia, N. and Severi, S. and Raimann, J.G. and Genovesi, S. and D{\"o}ssel, O. and Kotanko, P. and Corsi, C. and Loewe, A.} } @Inbook { IoanRZTB2020, subid = {2624}, title = {Proiecte nationale si europene de metrologia radiatiilor, suport pentru implementarea Directivei 2013/59, in sanatate si protectia mediului}, year = {2020}, month = {12}, number2 = {19ENV02: RemoteALPHA: Remote and real-time optical detection of alpha-emitting radionuclides in the environment}, keywords = {Remote detection, optical detection, alpha particles}, web_url = {https://srrp.ro/wp-content/uploads/2020/12/Conf.Nat_._SRRp_-2020-A4-ver.12.pdf}, misc2 = {EMPIR 2019: Environment}, booktitle = {Conferinta Nationala Aniversara a Societatii Romane de Radioprotectie –„SRRp-30”}, language = {30}, ISBN = {978-973-1985-64-0}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {978-973-1985-64-0}, author = {Ioan, M-R. and Radulescu, I. and Zadehrafi, M. and Tugulan, L. and Barna, C.} } @Article { ShakelWGK2020, subid = {1873}, title = {Narrow stack emissions: Errors in flow rate measurement due to disturbances and swirl}, journal = {Journal of the Air \& Waste Management Association}, year = {2020}, month = {11}, day = {30}, volume = {71}, number = {1}, number2 = {16ENV08: IMPRESS 2: Metrology for air pollutant emissions}, pages = {46-59}, keywords = {international standards, methods to measure emissions, industrial stacks, small emission limit values, data, flow disturbances, narrow stacks, policy-makers.}, misc2 = {EMPIR 2016: Environment}, publisher = {Informa UK Limited}, language = {30}, ISSN = {1096-2247, 2162-2906}, DOI = {10.1080/10962247.2020.1832621}, stag_bib_extends_levelofaccess = {NA}, author = {Shakel, D. and Workamp, M. and Gersl, J. and Knotek, S.} } @Article { KrauseBNLS2020, subid = {2733}, title = {Simple and compact diode laser system stabilized to Doppler-broadened iodine lines at 633  nm}, journal = {Applied Optics}, year = {2020}, month = {11}, day = {30}, volume = {59}, number = {34}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, pages = {10808}, keywords = {Iodine cell, laser system}, misc2 = {EMPIR 2017: Fundamental}, publisher = {The Optical Society}, language = {30}, ISSN = {1559-128X, 2155-3165}, DOI = {10.1364/AO.409308}, stag_bib_extends_levelofaccess = {NA}, author = {Krause, F. and Benkler, E. and N{\"o}lleke, C. and Leisching, P. and Sterr, U.} } @Article { LopezMPSGBSCDK2020, subid = {1731}, title = {A study to develop a robust method for measuring the detection efficiency of free-running InGaAs/InP single-photon detectors}, journal = {EPJ Quantum Technology}, year = {2020}, month = {11}, day = {25}, volume = {7}, number = {1}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {14}, keywords = {Quantum technologyQuantum radiometryDetection efficiencySingle-photon detectorsSingle-photon sourcesMetrology}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2662-4400, 2196-0763}, DOI = {10.1140/epjqt/s40507-020-00089-1}, stag_bib_extends_levelofaccess = {NA}, author = {L{\'o}pez, M. and Meda, A. and Porrovecchio, G. and Starkwood, R.A. and Genovese, M. and Brida, G. and Smid, M. and Chunnilall, C.J. and Degiovanni, I.P. and K{\"u}ck, S.} } @Article { BuarMSPSi2020, subid = {1830}, title = {Statistics of a Sharp GP2Y Low-Cost Aerosol PM Sensor Output Signals}, journal = {Sensors}, year = {2020}, month = {11}, day = {24}, volume = {20}, number = {23}, number2 = {19ENV08: AEROMET II: Advanced aerosol metrology for atmospheric science and air quality}, pages = {6707}, keywords = {low-cost sensors; aerosol sensors; air quality sensors}, misc2 = {EMPIR 2019: Environment}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s20236707}, stag_bib_extends_levelofaccess = {NA}, author = {Bučar, K. and Malet, J. and Stabile, L. and Pražnikar, J. and Seeger, S. and Žitnik, M.} } @Article { BuarMSPSi20200, subid = {1830}, title = {Statistics of a Sharp GP2Y Low-Cost Aerosol PM Sensor Output Signals}, journal = {Sensors}, year = {2020}, month = {11}, day = {24}, volume = {20}, number = {23}, number2 = {16ENV07: AEROMET: Aerosol metrology for atmospheric science and air quality}, pages = {6707}, keywords = {low-cost sensors; aerosol sensors; air quality sensors}, misc2 = {EMPIR 2016: Environment}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s20236707}, stag_bib_extends_levelofaccess = {NA}, author = {Bučar, K. and Malet, J. and Stabile, L. and Pražnikar, J. and Seeger, S. and Žitnik, M.} } @Article { SchulteLSSH2020, subid = {2776}, title = {Prospects and challenges for squeezing-enhanced optical atomic clocks}, journal = {Nature Communications}, year = {2020}, month = {11}, day = {24}, volume = {11}, number = {1}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, pages = {5955}, keywords = {entanglement, spin squeezing, optical clocks}, web_url = {https://www.nature.com/articles/s41467-020-19403-7}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2041-1723}, DOI = {10.1038/s41467-020-19403-7}, stag_bib_extends_levelofaccess = {NA}, author = {Schulte, M. and Lisdat, C. and Schmidt, P.O. and Sterr, U. and Hammerer, K.} } @Article { SchulteLSSH2020_2, subid = {2776}, title = {Prospects and challenges for squeezing-enhanced optical atomic clocks}, journal = {Nature Communications}, year = {2020}, month = {11}, day = {24}, volume = {11}, number = {1}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, pages = {5955}, keywords = {entanglement, spin squeezing, optical clocks}, web_url = {https://www.nature.com/articles/s41467-020-19403-7}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2041-1723}, DOI = {10.1038/s41467-020-19403-7}, stag_bib_extends_levelofaccess = {NA}, author = {Schulte, M. and Lisdat, C. and Schmidt, P.O. and Sterr, U. and Hammerer, K.} } @Article { BarreQSDBTESdA2020, subid = {2036}, title = {Comparison of the Isotopic Composition of Hg and Pb in Two Atmospheric Bioaccumulators in a Pyrenean Beech Forest (Iraty Forest, Western Pyrenees, France/Spain)}, journal = {Frontiers in Environmental Chemistry}, year = {2020}, month = {11}, day = {23}, volume = {1}, number2 = {16ENV01: MercOx: Metrology for oxidised mercury}, keywords = {isotopic composition, mercury, biomonitoring}, misc2 = {EMPIR 2016: Environment}, publisher = {Frontiers Media SA}, language = {30}, ISSN = {2673-4486}, DOI = {10.3389/fenvc.2020.582001}, stag_bib_extends_levelofaccess = {NA}, author = {Barre, J.P.G. and Queipo-Abad, S. and Sola-Larra{\~n}aga, C. and Deletraz, G. and B{\'e}rail, S. and Tessier, E. and Elustondo Valencia, D. and Santamar{\'i}a, J.M. and de Diego, A. and Amouroux, D.} } @Article { FinizioWMHLBBMR2020, subid = {2380}, title = {Time-resolved visualization of the magnetization canting induced by field-like spin–orbit torques}, journal = {Applied Physics Letters}, year = {2020}, month = {11}, day = {23}, volume = {117}, number = {21}, number2 = {17FUN08: TOPS: Metrology for topological spin structures}, pages = {212404}, keywords = {X-ray microscopy, Ferromagnetic materials, Time resolved imaging, Spin-orbit interactions, Spin Hall effect}, misc2 = {EMPIR 2017: Fundamental}, publisher = {AIP Publishing}, language = {30}, ISSN = {0003-6951, 1077-3118}, DOI = {10.1063/5.0029816}, stag_bib_extends_levelofaccess = {NA}, author = {Finizio, S. and Wintz, S. and Mayr, S. and Huxtable, A.J. and Langer, M. and Bailey, J. and Burnell, G. and Marrows, C.H. and Raabe, J.} } @Article { FerreroC2020, subid = {1741}, title = {Angular and Spectral Bandwidth Considerations in BRDF Measurements of Interference- and Diffraction-Based Coatings}, journal = {Coatings}, year = {2020}, month = {11}, day = {21}, volume = {10}, number = {11}, number2 = {16NRM08: BiRD: Bidirectional reflectance definitions}, pages = {1128}, keywords = {BRDF measurements; goniochromatism; special effect coatings; colour}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {MDPI AG}, address = {Postfach Basel CH-4005 Switzerland}, language = {30}, ISSN = {2079-6412}, DOI = {10.3390/coatings10111128}, stag_bib_extends_levelofaccess = {NA}, author = {Ferrero, A. and Campos, J.} } @Article { SachsePVSRBBHKSKH2020, subid = {1704}, title = {Assessing Optical and Electrical Properties of Highly Active IrOx Catalysts for the Electrochemical Oxygen Evolution Reaction via Spectroscopic Ellipsometry}, journal = {ACS Catalysis}, year = {2020}, month = {11}, day = {20}, number2 = {16ENG03: HyMet: Hybrid metrology for thin films in energy applications}, pages = {14210-14223}, keywords = {spectroscopic ellipsometry, electrocatalysis, oxygen evolution reaction, mesoporous iridium oxidefilms, non-destructive ambient analysis, intrinsic OER activity, complementary methodology and metrology}, misc2 = {EMPIR 2016: Energy}, publisher = {American Chemical Society (ACS)}, language = {30}, ISSN = {2155-5435, 2155-5435}, DOI = {10.1021/acscatal.0c03800}, stag_bib_extends_levelofaccess = {NA}, author = {Sachse, R. and Pfl{\"u}ger, M. and Velasco-V{\'e}lez, J-J. and Sahre, M. and Radnik, J. and Bernicke, M. and Bernsmeier, D. and Hodoroaba, V-D. and Krumrey, M. and Strasser, P. and Kraehnert, R. and Hertwig, A.} } @Article { LodewyckLPBKK2020, subid = {1834}, title = {Universal formalism for data sharing and processing in clock comparison networks}, journal = {Physical Review Research}, year = {2020}, month = {11}, day = {20}, volume = {2}, number = {4}, number2 = {18SIB05: ROCIT: Robust Optical Clocks for International Timescales}, pages = {043269}, keywords = {atomic clocks, frequency comparison, frequency combs}, web_url = {https://journals.aps.org/prresearch/abstract/10.1103/PhysRevResearch.2.043269}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2643-1564}, DOI = {10.1103/PhysRevResearch.2.043269}, stag_bib_extends_levelofaccess = {NA}, author = {Lodewyck, J. and Le Targat, R. and Pottie, P-E. and Benkler, E. and Koke, S. and Kronj{\"a}ger, J.} } @Article { MaraisvKv2020, subid = {2080}, title = {Reduction of Static Electricity Meter Errors by Broadband Compensation of Voltage and Current Channel Differences}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2020}, month = {11}, day = {20}, volume = {70}, number2 = {17NRM02: MeterEMI: Electromagnetic Interference on Static Electricity Meters}, pages = {1-11}, keywords = {Energy measurement; electromagnetic compatibility; electromagnetic interference; immunity testing; measurement errors; standards; watthour meters;}, tags = {SEG}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9456, 1557-9662}, DOI = {10.1109/TIM.2020.3039631}, stag_bib_extends_levelofaccess = {NA}, author = {Marais, Z. and van den Brom, H.E. and Kok, G. and van Veghel, M.G.A.} } @Article { RitzmannLDKGWMFK2020, subid = {1754}, title = {Comparison of Measurement Methods for 2-150 kHz Conducted Emissions in Power Networks}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2020}, month = {11}, day = {19}, number2 = {18NRM05: SupraEMI: Grid measurements of 2 kHz - 150 kHz harmonics to support normative emission limits for mass-market electrical goods}, pages = {1-1}, keywords = {High frequency distortion,power quality,harmonics,supraharmonics,measurement techniques,voltage distortion}, tags = {SEG}, misc2 = {EMPIR 2018: Pre-Co-Normative}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9456, 1557-9662}, DOI = {10.1109/TIM.2020.3039302}, stag_bib_extends_levelofaccess = {NA}, author = {Ritzmann, D. and Lodetti, S. and De La Vega, D. and Khokhlov, V. and Gallarreta, A. and Wright, P. and Meyer, J. and Fernandez, I. and Klingbeil, D.} } @Article { PezzeS2020, subid = {1811}, title = {Heisenberg-Limited Noisy Atomic Clock Using a Hybrid Coherent and Squeezed State Protocol}, journal = {Physical Review Letters}, year = {2020}, month = {11}, day = {19}, volume = {125}, number = {21}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, keywords = {spin squeezing, Heisenberg limit}, web_url = {https://arxiv.org/abs/2003.10943}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {0031-9007, 1079-7114}, DOI = {10.1103/PhysRevLett.125.210503}, stag_bib_extends_levelofaccess = {NA}, author = {Pezz{\`e}, L. and Smerzi, A.} } @Article { LesiukPJ2020, subid = {1835}, title = {Theoretical determination of polarizability and magnetic susceptibility of neon}, journal = {Physical Review A}, year = {2020}, month = {11}, day = {17}, volume = {102}, number = {5}, number2 = {18SIB04: QuantumPascal: Towards quantum-based realisations of the pascal}, pages = {052816}, keywords = {dielectric properties, noble gases, neon, polarisability, magnetic susceptibility}, web_url = {https://arxiv.org/abs/2006.15448}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2469-9926, 2469-9934}, DOI = {10.1103/PhysRevA.102.052816}, stag_bib_extends_levelofaccess = {NA}, author = {Lesiuk, M. and Przybytek, M. and Jeziorski, B.} } @Article { AqeelSTMMBBGPB2020, subid = {2388}, title = {Microwave Spectroscopy of the Low-Temperature Skyrmion State in Cu2OSeO3}, journal = {Physical Review Letters}, year = {2020}, month = {11}, day = {17}, volume = {126}, number = {1}, number2 = {17FUN08: TOPS: Metrology for topological spin structures}, pages = {017202-1 - 017202-7}, keywords = {Lattice dynamics, Magnetic order, Magnetism, Magnetization dynamics, Skyrmions, Spin waves}, web_url = {https://arxiv.org/abs/2011.07826}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society}, language = {30}, ISSN = {1079-7114}, DOI = {10.1103/PhysRevLett.126.017202}, stag_bib_extends_levelofaccess = {NA}, author = {Aqeel, A. and Sahliger, J. and Taniguchi, T. and M{\"a}ndl, S. and Mettus, D. and Berger, H. and Bauer, A. and Garst, M. and Pfleiderer, C. and Back, C.H.} } @Article { WrightR2020, subid = {1753}, title = {A Digital Heterodyne 2 kHz to 150 kHz Measurement Method based on Multi Resolution Analysis}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2020}, month = {11}, day = {16}, volume = {Early Acce}, number2 = {18NRM05: SupraEMI: Grid measurements of 2 kHz - 150 kHz harmonics to support normative emission limits for mass-market electrical goods}, pages = {1-1}, keywords = {Power system measurements,digital filters,digital signal processing,electromagnetic compatibility \& interference,power quality,wavelets}, tags = {SEG}, misc2 = {EMPIR 2018: Pre-Co-Normative}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, address = {445 Hoes Lane Piscataway NJ 08855-1331 United States}, language = {30}, ISSN = {0018-9456, 1557-9662}, DOI = {10.1109/TIM.2020.3038290}, stag_bib_extends_levelofaccess = {NA}, author = {Wright, P.S. and Ritzmann, D.} } @Article { KokurewiczSBSKHMKJ2020, subid = {1842}, title = {Dosimetry for New Radiation Therapy Approaches Using High Energy Electron Accelerators}, journal = {Frontiers in Physics}, year = {2020}, month = {11}, day = {13}, volume = {8}, number2 = {18HLT04: UHDpulse: Metrology for advanced radiotherapy using particle beams with ultra-high pulse dose rates}, keywords = {Dosimetry, FLASH beams, Absorbed dose, ultra-high pulse dose rates, High Energy Electron Accelerators}, misc2 = {EMPIR 2018: Health}, publisher = {Frontiers Media SA}, language = {30}, ISSN = {2296-424X}, DOI = {10.3389/fphy.2020.568302}, stag_bib_extends_levelofaccess = {NA}, author = {Kokurewicz, K. and Sch{\"u}ller, A. and Brunetti, E. and Subiel, A. and Kranzer, R. and Hackel, T. and Meier, M. and Kapsch, R-P. and Jaroszynsk, D.A.} } @Article { FriedrichC2020, subid = {1748}, title = {Application of contact-resonance AFM methods to polymer samples}, journal = {Beilstein Journal of Nanotechnology}, year = {2020}, month = {11}, day = {12}, volume = {11}, number2 = {17IND05: MicroProbes: Multifunctional ultrafast microprobes for on-the-machine measurements}, pages = {1714-1727}, keywords = {atomic force microscopy, contact resonance, mechanical properties, polymers; wear}, misc2 = {EMPIR 2017: Industry}, publisher = {Beilstein Institut}, language = {30}, ISSN = {2190-4286}, DOI = {10.3762/bjnano.11.154}, stag_bib_extends_levelofaccess = {NA}, author = {Friedrich, S. and Cappella, B.} } @Article { MoskonuDDG2020, subid = {1992}, title = {A Powerful Transmission Line Model for Analysis of Impedance of Insertion Battery Cells: A Case Study on the NMC-Li System}, journal = {Journal of The Electrochemical Society}, year = {2020}, month = {11}, day = {12}, volume = {167}, number = {14}, number2 = {17IND10: LiBforSecUse: Quality assessment of electric vehicle Li-ion batteries for second use applications}, pages = {140539}, keywords = {transmission line modelelectrochemical impedanceLi-ion battery cellsNMC}, misc2 = {EMPIR 2017: Industry}, publisher = {The Electrochemical Society}, language = {30}, ISSN = {1945-7111}, DOI = {10.1149/1945-7111/abc769}, stag_bib_extends_levelofaccess = {NA}, author = {Moškon, J. and Žuntar, J. and Drvarič Talian, S. and Dominko, R. and Gaberšček, M.} } @Article { HeeringBS2020, subid = {1699}, title = {Glass electrode half-cells for measuring unified pH in ethanol–water mixtures}, journal = {Journal of Sensors and Sensor Systems}, year = {2020}, month = {11}, day = {11}, volume = {9}, number = {2}, number2 = {17FUN09: UnipHied: Realisation of a Unified pH Scale}, pages = {383-389}, keywords = {unified pH, pHabs, water-ethanol mixtures, glass electrode half-cells, ionic liquid, [N2225][NTf2]}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Copernicus GmbH}, language = {30}, ISSN = {2194-878X}, DOI = {10.5194/jsss-9-383-2020}, stag_bib_extends_levelofaccess = {NA}, author = {Heering, A. and Bastkowski, F. and Seitz, S.} } @Article { FerreroBCPPPSSVM2020, subid = {1740}, title = {An insight into the present capabilities of national metrology institutes for measuring sparkle}, journal = {Metrologia}, year = {2020}, month = {11}, day = {11}, volume = {57}, number = {6}, number2 = {16NRM08: BiRD: Bidirectional reflectance definitions}, pages = {065029}, keywords = {sparkle, texture, reflectance, contrast threshold, gonio-spectrophotometry}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/abb0a3}, stag_bib_extends_levelofaccess = {NA}, author = {Ferrero, A. and Basic, N. and Campos, J. and Pastuschek, M. and Perales, E. and Porrovecchio, G. and Smid, M. and Schirmacher, A. and Vel{\'a}zquez, J.L. and Mart{\'i}nez-Verd{\'u}, F.} } @Proceedings { MeisnerGSHSEGRMLBOGS2020, subid = {1922}, title = {Support for standardisation of high voltage testing with composite and combined wave shapes}, journal = {VDE High Voltage Technology 2020, ETG-Symposium}, year = {2020}, month = {11}, day = {11}, number2 = {19NRM07: HV-com²: Support for standardisation of high voltage testing with composite and combined wave shapes}, keywords = {Electricity grids, high voltage testing, traceability, combined wave shapes, composite wave shapes, universal dividers, calibration}, tags = {SEG}, web_url = {https://oar.ptb.de/resources/show/10.7795/EMPIR.19NRM07.CA.20210215}, misc2 = {EMPIR 2019: Pre-Co-Normative}, publisher = {VDE}, event_place = {online}, event_name = {VDE High Voltage Technology 2020}, event_date = {09-11-2020 to 11-11-2020}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://oar.ptb.de/resources/show/10.7795/EMPIR.19NRM07.CA.20210215}, author = {Meisner, J. and Gockenbach, E. and Saadeddine, H. and Havunen, J. and Schichler, U. and Elg, A-P. and Garnacho, F. and Roccato, P.E. and Merev, A. and Lahti, K. and Backhaus, K. and Orrea, A. and Gamlin, M. and Steiner, T.} } @Article { HeeringBS2020_2, subid = {2181}, title = {Glass electrode half-cells for measuring unified pH in ethanol–water mixtures}, journal = {Journal of Sensors and Sensor Systems}, year = {2020}, month = {11}, day = {11}, volume = {9}, number = {2}, number2 = {17FUN09: UnipHied: Realisation of a Unified pH Scale}, pages = {383-389}, keywords = {Glass electrode half-cells unified pHethanol–water mixtures}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Copernicus GmbH}, language = {30}, ISSN = {2194-878X}, DOI = {10.5194/jsss-9-383-2020}, stag_bib_extends_levelofaccess = {NA}, author = {Heering, A. and Bastkowski, F. and Seitz, S.} } @Article { IstrateATRG2020, subid = {1755}, title = {Traceable measurements of harmonic (2 to 150) kHz emissions in smart grids: uncertainty calculation}, journal = {Journal of Sensors and Sensor Systems}, year = {2020}, month = {11}, day = {10}, volume = {9}, number = {2}, number2 = {18NRM05: SupraEMI: Grid measurements of 2 kHz - 150 kHz harmonics to support normative emission limits for mass-market electrical goods}, pages = {375-381}, keywords = {Supraharmonics, Measurement, Uncertainty, Smart Grids}, web_url = {https://jsss.copernicus.org/articles/9/375/2020/}, misc2 = {EMPIR 2018: Pre-Co-Normative}, publisher = {Copernicus GmbH}, language = {30}, ISSN = {2194-878X}, DOI = {10.5194/jsss-9-375-2020}, stag_bib_extends_levelofaccess = {NA}, author = {Istrate, D. and Amaripadath, D. and Toutain, E. and Roche, R. and Gao, F.} } @Article { Worton2020, subid = {1915}, title = {Future Adoption of Direct Measurement Techniques for Regulatory Measurements of Nitrogen Dioxide: Drivers and Challenges}, journal = {Environmental Science \& Technology}, year = {2020}, month = {11}, day = {10}, volume = {54}, number = {23}, number2 = {16ENV05: MetNO2: Metrology for nitrogen dioxide}, pages = {14785-14786}, keywords = {NO2; Air Quality Directive 2008/50/EC; chemiluminescence (CLD) method; EN 14211:2012; nitrogen dioxide; nitrogen monoxide; chemiluminescence}, misc2 = {EMPIR 2016: Environment}, publisher = {American Chemical Society (ACS)}, language = {30}, ISSN = {0013-936X, 1520-5851}, DOI = {10.1021/acs.est.0c04709}, stag_bib_extends_levelofaccess = {NA}, author = {Worton, D.R.} } @Article { Sarraf2020, subid = {1972}, title = {A method for assessing the uncertainty of a secondary dynamic pressure standard using shock tube}, journal = {Measurement Science and Technology}, year = {2020}, month = {11}, day = {10}, volume = {32}, number = {1}, number2 = {17IND07: DynPT: Development of measurement and calibration techniques for dynamic pressures and temperatures}, pages = {015013}, keywords = {dynamic pressure, Shock tube, calibration, secondary standard, uncertainty}, misc2 = {EMPIR 2017: Industry}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-0233, 1361-6501}, DOI = {10.1088/1361-6501/aba56a}, stag_bib_extends_levelofaccess = {NA}, author = {Sarraf, C.} } @Miscellaneous { ArduinoPZKC, subid = {1667}, title = {EMUE-D5-3-EPT Tissue Characterization}, year = {2020}, month = {11}, day = {6}, number2 = {17NRM05: EMUE: Advancing measurement uncertainty - comprehensive examples for key international standards}, keywords = {Electric Properties Tomography; Magnetic Resonance Imaging; Variance-covariance matrix; Shrinkage estimation; Law of propagation of uncertainty}, misc2 = {EMPIR 2017: Pre-Co-Normative}, language = {30}, DOI = {10.5281/zenodo.4248879}, stag_bib_extends_levelofaccess = {NA}, author = {Arduino, A. and Pennecchi, F. and Zilberti, L and Katscher, U. and Cox, M.G.} } @Miscellaneous { auseviCG, subid = {1660}, title = {EMUE-RMG-2-Pressure drop measurement}, year = {2020}, month = {11}, day = {3}, number2 = {17NRM05: EMUE: Advancing measurement uncertainty - comprehensive examples for key international standards}, keywords = {Pressure drop measurement, measurement uncertainty, leak test, correlations}, misc2 = {EMPIR 2017: Pre-Co-Normative}, language = {30}, DOI = {10.5281/zenodo.4243049}, stag_bib_extends_levelofaccess = {NA}, author = {Čaušević, M. and Cox, M.G. and Greenwood, J.} } @Miscellaneous { PennecchiRAE, subid = {1659}, title = {EMUE-D2-3-TSP Concentration}, year = {2020}, month = {11}, day = {3}, number2 = {17NRM05: EMUE: Advancing measurement uncertainty - comprehensive examples for key international standards}, keywords = {Conformity assessment; Producer’s and consumer’s risk; Total suspended particulates in air; Mass Concentration; Measurement uncertainty; Log-normal prior distribution}, misc2 = {EMPIR 2017: Pre-Co-Normative}, language = {30}, DOI = {10.5281/zenodo.4242988}, stag_bib_extends_levelofaccess = {NA}, author = {Pennecchi, F. and Rolle, F. and Allard, A. and Ellison, S.L.R.} } @Article { PellegrinoIPSROMHM2020, subid = {1658}, title = {Machine learning approach for elucidating and predicting the role of synthesis parameters on the shape and size of TiO2 nanoparticles}, journal = {Scientific Reports}, year = {2020}, month = {11}, volume = {10}, number = {1}, number2 = {17NRM04: nPSize: Improved traceability chain of nanoparticle size measurements}, pages = {18910-1-11}, keywords = {nanoparticles, titanium dioxide, size, shape, machine learning, synthesis}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2045-2322}, DOI = {10.1038/s41598-020-75967-w}, stag_bib_extends_levelofaccess = {NA}, author = {Pellegrino, F. and Isopescu, R. and Pelluti{\`e}, L. and Sordello, F. and Rossi, A.M. and Ortel, E. and Martra, G. and Hodoroaba, V-D. and Maurino, V.} } @Article { HonickeWWKB2020, subid = {1688}, title = {Towards a calibration of laboratory setups for grazing incidence and total-reflection X-ray fluorescence analysis}, journal = {Spectrochimica Acta Part B: Atomic Spectroscopy}, year = {2020}, month = {11}, volume = {174}, number2 = {17SIP07: Adlab-XMet: Advancing laboratory based X-ray metrology techniques}, pages = {106009}, keywords = {Gracing incidence X-ray fluorescenceLaboratory setupSolid angle characterization}, web_url = {https://arxiv.org/abs/2003.05192}, misc2 = {EMPIR 2017: Support for Impact}, publisher = {Elsevier BV}, language = {30}, ISSN = {0584-8547}, DOI = {10.1016/j.sab.2020.106009}, stag_bib_extends_levelofaccess = {NA}, author = {Honicke, P. and Waldschl{\"a}ger, U. and Wiesner, T. and Kr{\"a}mer, M. and Beckhoff, B.} } @Article { IllgenJTBF2020, subid = {1695}, title = {Influence of ion induced secondary electron emission on the stability of ionisation vacuum gauges}, journal = {Vacuum}, year = {2020}, month = {11}, number2 = {16NRM05: Ion Gauge: Towards a documentary standard for an ionisation vacuum gauge}, pages = {109907}, keywords = {Ion induced secondary electron emissionIonisation vacuum gaugesXPS}, web_url = {https://arxiv.org/abs/2011.08568}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {Elsevier BV}, language = {30}, ISSN = {0042-207X}, DOI = {10.1016/j.vacuum.2020.109907}, stag_bib_extends_levelofaccess = {NA}, author = {Illgen, C. and Jousten, K. and Teodoro, O.M.N.D. and Bundaleski, N. and Figueiredo, I.} } @Article { MitevCPGDMS2020, subid = {1836}, title = {Methods for the experimental study of 220Rn homogeneity in calibration chambers}, journal = {Applied Radiation and Isotopes}, year = {2020}, month = {11}, volume = {165}, number2 = {16ENV10: MetroRADON: Metrology for radon monitoring}, pages = {109259}, keywords = {Thoron (220Rn), Thoron calibration, Thoron homogeneity, LSC, Nuclear track detectors}, web_url = {https://zenodo.org/record/4160815}, misc2 = {EMPIR 2016: Environment}, publisher = {Elsevier BV}, language = {30}, ISSN = {0969-8043}, DOI = {10.1016/j.apradiso.2020.109259}, stag_bib_extends_levelofaccess = {NA}, author = {Mitev, K. and Cassette, P. and Pressyanov, D. and Georgiev, S. and Dutsov, C. and Michielsen, N. and Sabot, B.} } @Article { IstrateKSRFSSG2020, subid = {1960}, title = {Laboratory Calibration of Energy Measurement Systems (EMS) under AC Distorted Waveforms}, journal = {Sensors}, year = {2020}, month = {11}, volume = {20}, number = {21}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, pages = {6301}, keywords = {energy measurement; railway system; calibration setup; fictive power source; distorted regime; harmonic waveform; calibration procedure; energy measuring system}, misc2 = {EMPIR 2016: Energy}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s20216301}, stag_bib_extends_levelofaccess = {NA}, author = {Istrate, D. and Khamlichi, A. and Soccalingame, S. and Rovira, J. and Fortune, D. and Š{\'i}ra, M. and Simon, P. and Garnacho, F.} } @Article { IstrateKSRFSS2020, subid = {1930}, title = {Laboratory Calibration of Energy Measurement Systems (EMS) under AC Distorted Waveforms}, journal = {Sensors}, year = {2020}, month = {11}, volume = {20}, number = {21}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, pages = {6301}, keywords = {energy measurement; railway system; calibration setup; fictive power source; distorted regime; harmonic waveform; calibration procedure; energy measuring system}, misc2 = {EMPIR 2016: Energy}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s20216301}, stag_bib_extends_levelofaccess = {NA}, author = {Istrate, D. and Khamlichi, A. and Soccalingame, S. and Rovira, J. and Fortune, D. and Š{\'i}ra, M. and Simon, P.} } @Article { BlakesleyKDHTMSA2020, subid = {1949}, title = {Effective Spectral Albedo from Satellite Data for Bifacial Gain Calculations of PV Systems}, journal = {37th European Photovoltaic Solar Energy Conference and Exhibition}, year = {2020}, month = {11}, number2 = {16ENG02: PV-Enerate: Advanced PV energy rating}, pages = {1292 - 1297}, keywords = {Albedo, Bificial PV Module}, web_url = {https://zenodo.org/record/4055920}, misc2 = {EMPIR 2016: Energy}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {3-936338-73-6}, author = {Blakesley, J.C. and Koutsourakis, G. and Douglas, S. and Holder, J.K.L. and Torry, J. and Mukadam, F. and Schmid, A. and Abrams, R.S.J.} } @Article { GuilloryTW2020_2, subid = {2003}, title = {Uncertainty assessment of a prototype of multilateration coordinate measurement system}, journal = {Precision Engineering}, year = {2020}, month = {11}, volume = {66}, number = {November}, number2 = {17IND03: LaVA: Large Volume Metrology Applications}, pages = {496-506}, keywords = {dimensional metrology, large volume metrology, absolute distance meters, coordinate measurement systems, multilateration technique with self calibration}, web_url = {https://www.sciencedirect.com/science/article/abs/pii/S0141635920305055?via\%3Dihub}, misc2 = {EMPIR 2017: Industry}, publisher = {Elsevier}, language = {30}, ISSN = {0141-6359}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://hal-cnam.archives-ouvertes.fr/hal-03190544}, author = {Guillory, J. and Truong, D. and Wallerand, J-P.} } @Article { BourgouinSHKPKM2020, subid = {1840}, title = {Calorimeter for Real-Time Dosimetry of Pulsed Ultra-High Dose Rate Electron Beams}, journal = {Frontiers in Physics}, year = {2020}, month = {10}, day = {30}, volume = {8}, number2 = {18HLT04: UHDpulse: Metrology for advanced radiotherapy using particle beams with ultra-high pulse dose rates}, keywords = {ultra-high pulse dose rates, dosimetry, metrology, FLASH radiation therapy, calorimetry}, misc2 = {EMPIR 2018: Health}, publisher = {Frontiers Media SA}, language = {30}, ISSN = {2296-424X}, DOI = {10.3389/fphy.2020.567340}, stag_bib_extends_levelofaccess = {NA}, author = {Bourgouin, A. and Sch{\"u}ller, A. and Hackel, T. and Kranzer, R. and Poppinga, D. and Kapsch, R-P. and McEwen, M. } } @Article { HuggettBBGHKKMMNPSSVVWZ2020, subid = {1862}, title = {Cautionary Note on Contamination of Reagents Used for Molecular Detection of SARS-CoV-2}, journal = {Clinical Chemistry}, year = {2020}, month = {10}, day = {30}, volume = {66}, number = {11}, number2 = {18HLT03: SEPTIMET: Metrology to enable rapid and accurate clinical measurements in acute management of sepsis}, pages = {1369-1372}, keywords = {SARS-CoV-2, RT-qPCR, contamination, false positive, molecular diagnosis}, web_url = {https://academic.oup.com/clinchem/article/66/11/1369/5902447}, misc2 = {EMPIR 2018: Health}, publisher = {Oxford University Press (OUP)}, language = {30}, ISSN = {0009-9147, 1530-8561}, DOI = {10.1093/clinchem/hvaa214}, stag_bib_extends_levelofaccess = {NA}, author = {Huggett, J.F. and Benes, V. and Bustin, S.A. and Garson, J.A. and Harris, K. and Kammel, M. and Kubista, M. and McHugh, T.D. and Moran-Gilad, J. and Nolan, T. and Pfaffl, M.W. and Salit, M. and Shipley, G. and Vallone, P.M. and Vandesompele, J. and Wittwer, C. and Zeichhardt, H.} } @Article { SeferiBMS2020, subid = {1933}, title = {Power Quality Measurement and Active Harmonic Power in 25 kV 50 Hz AC Railway Systems}, journal = {Energies}, year = {2020}, month = {10}, day = {30}, volume = {13}, number = {21}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, pages = {5698}, keywords = {railway electrical networks; traction converter; power quality analysis; active power; harmonic power; electric energy meters}, misc2 = {EMPIR 2016: Energy}, publisher = {MDPI AG}, language = {30}, ISSN = {1996-1073}, DOI = {10.3390/en13215698}, stag_bib_extends_levelofaccess = {NA}, author = {Seferi, Y. and Blair, S.M. and Mester, C. and Stewart, B.G.} } @Article { FavalliS2020, subid = {2727}, title = {Time Observables in a Timeless Universe}, journal = {Quantum}, year = {2020}, month = {10}, day = {29}, volume = {4}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, pages = {354}, keywords = {time, quantum mechanics}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Verein zur Forderung des Open Access Publizierens in den Quantenwissenschaften}, address = {Zurich, Switzerland}, language = {30}, ISSN = {2521-327X}, DOI = {10.22331/q-2020-10-29-354}, stag_bib_extends_levelofaccess = {NA}, author = {Favalli, Tommaso and Smerzi, Augusto} } @Proceedings { DurgutYHMU2020, subid = {1974}, title = {(50-400) MPa Aralığında İzlenebilir Dinamik Basın\c{c}{\"O}l\c{c}{\"u}mleri}, journal = {Academic Perspective Procedia}, year = {2020}, month = {10}, day = {25}, volume = {3}, number = {1}, number2 = {17IND07: DynPT: Development of measurement and calibration techniques for dynamic pressures and temperatures}, pages = {658-664}, keywords = {Dinamik, basın\c{c}, kalibrasyon, dinamik sens{\"o}r, k{\"u}tle d{\"u}ş{\"u}rmesli sistem}, misc2 = {EMPIR 2017: Industry}, publisher = {Academic Perspective}, event_place = {Bursa, Turkey}, event_name = {8th International Symposium on Innovative Technologies in Engineering and Science (ISITES2020)}, event_date = {23-10-2020 to 25-10-2020}, language = {126}, ISSN = {2667-5862}, DOI = {10.33793/acperpro.03.01.120}, stag_bib_extends_levelofaccess = {NA}, author = {Durgut, Y. and Yilmaz, R. and Hamarat, A. and Meral, İ. and Uslukılı\c{c}, U.} } @Article { HuntRSK2020, subid = {1692}, title = {High-speed density measurement for LNG and other cryogenic fluids using electrical capacitance tomography}, journal = {Cryogenics}, year = {2020}, month = {10}, day = {24}, volume = {113}, number2 = {16ENG09: LNG III: Metrological support for LNG and LBG as transport fuel}, pages = {103207}, keywords = {Liquefied natural gasLNGElectrical capacitance tomographyECTDensity measurement}, tags = {EnG}, web_url = {https://doi.org/10.1016/j.cryogenics.2020.103207}, misc2 = {EMPIR 2016: Energy}, publisher = {Elsevier BV}, language = {30}, ISSN = {0011-2275}, DOI = {10.1016/j.cryogenics.2020.103207}, stag_bib_extends_levelofaccess = {NA}, author = {Hunt, A. and Rusli, I. and Schakel, M. and Kenbar, A.} } @Article { Pollinger2020, subid = {1647}, title = {Refractive index of air 2 Group index: comment}, journal = {Applied Optics}, year = {2020}, month = {10}, day = {23}, volume = {59}, number = {31}, number2 = {18SIB01: GeoMetre: Large-scale dimensional measurements for geodesy}, pages = {9771}, keywords = {Group index of refraction, Compensation of the index of refraction}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {The Optical Society}, language = {30}, ISSN = {1559-128X, 2155-3165}, DOI = {10.1364/AO.400796}, stag_bib_extends_levelofaccess = {NA}, author = {Pollinger, F.} } @Article { AlveseSousaGFFMMBA2020, subid = {1674}, title = {Calibration of Syringe Pumps Using Interferometry and Optical Methods}, journal = {International Journal of Biomedical and Biological Engineering}, year = {2020}, month = {10}, day = {23}, volume = {14}, number = {10}, number2 = {18HLT08: MEDDII: Metrology for drug delivery}, pages = {10011517}, keywords = {Calibration, interferometry, syringe pump, optical method, uncertainty}, web_url = {https://publications.waset.org/10011517/pdf}, misc2 = {EMPIR 2018: Health}, publisher = {WASET}, language = {30}, ISSN = {ISNI:0000000091950263}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {ISNI:0000000091950263}, author = {Alves e Sousa, J. and Godinho, I. and Ferreira, M. do C. and Furtado, A. and Mendes, R. and Martins, R. and Batista, E. and Alvares, M.} } @Miscellaneous { auseviCv, subid = {1645}, title = {EMUE-RMG-1-Gas Flow Calibration}, year = {2020}, month = {10}, day = {21}, number2 = {17NRM05: EMUE: Advancing measurement uncertainty - comprehensive examples for key international standards}, keywords = {gas flow measurement, measurement uncertainty, master meter, meter under test, calibration}, misc2 = {EMPIR 2017: Pre-Co-Normative}, language = {30}, DOI = {10.5281/zenodo.4114438}, stag_bib_extends_levelofaccess = {NA}, author = {Čaušević, M. and Cox, M.G. and van der Veen, A.M.H.} } @Article { DorscherABSHSL2020, subid = {1719}, title = {Dynamical decoupling of laser phase noise in compound atomic clocks}, journal = {Communications Physics}, year = {2020}, month = {10}, day = {20}, volume = {3}, number = {1}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, pages = {1-8}, keywords = {optical atomic clocks,dynamic decoupling,coherence time,decoherence}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2399-3650}, DOI = {10.1038/s42005-020-00452-9}, stag_bib_extends_levelofaccess = {NA}, author = {D{\"o}rscher, S. and Al-Masoudi, A. and Bober, M. and Schwarz, R. and Hobson, R. and Sterr, U. and Lisdat, C.} } @Article { HanZGPCSLHKSPLP2020, subid = {1868}, title = {Measurement of thermodynamic temperature between 5 K and 24.5 K with single-pressure refractive-index gas thermometry}, journal = {Metrologia}, year = {2020}, month = {10}, day = {19}, volume = {57}, number = {6}, number2 = {18SIB02: Real-K: Realising the redefined kelvin}, pages = {065006}, keywords = {SPRIGT, Cryostat, Resonator.thermodynamic temperature,}, tags = {SEG}, web_url = {https://iopscience.iop.org/article/10.1088/1681-7575/ab84ca/pdf}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/ab84ca}, stag_bib_extends_levelofaccess = {NA}, author = {Han, D. and Zhang, H. and Gao, B. and Pan, C. and Chen, H. and Song, Y. and Liu, W. and Hu, J. and Kong, X. and Sparasci, F. and Plimmer, M. and Luo, E. and Pitre, L.} } @Article { FurstYKKDLBHPM2020, subid = {1650}, title = {Coherent Excitation of the Highly Forbidden Electric Octupole Transition in Yb+172}, journal = {Physical Review Letters}, year = {2020}, month = {10}, day = {16}, volume = {125}, number = {16}, number2 = {18SIB05: ROCIT: Robust Optical Clocks for International Timescales}, pages = {163001}, keywords = {Atomic spectra, Optical clocks, Coherent control, Cooling \& trapping, Laser spectroscopy, Trapped Ions}, web_url = {https://link.aps.org/doi/10.1103/PhysRevLett.125.163001}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {0031-9007, 1079-7114}, DOI = {10.1103/PhysRevLett.125.163001}, stag_bib_extends_levelofaccess = {NA}, author = {F{\"u}rst, H.A. and Yeh, C.H. and Kalincev, D. and Kulosa, A.P. and Dreissen, L.S. and Lange, R. and Benkler, E. and Huntemann, N. and Peik, E. and Mehlst{\"a}ubler, T.E.} } @Article { ClarkKE2020, subid = {1686}, title = {Mitigating decoherence in hot electron interferometry}, journal = {New Journal of Physics}, year = {2020}, month = {10}, day = {15}, volume = {22}, number = {10}, number2 = {17FUN04: SEQUOIA: Single-electron quantum optics for quantum-enhanced measurements}, pages = {103031}, keywords = {electron quantum optics,mesoscopics,electron transport, quantum Hall effect,electron interferometry}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {1367-2630}, DOI = {10.1088/1367-2630/abb9e5}, stag_bib_extends_levelofaccess = {NA}, author = {Clark, L.A. and Kataoka, M. and Emary, C.} } @Miscellaneous { auseviMvC, subid = {1638}, title = {EMUE-RMG-3-Calibration Gas Mixtures}, year = {2020}, month = {10}, day = {13}, number2 = {17NRM05: EMUE: Advancing measurement uncertainty - comprehensive examples for key international standards}, keywords = {permeation, calibration gas mixtures, uncertainty evaluation}, misc2 = {EMPIR 2017: Pre-Co-Normative}, language = {30}, DOI = {10.5281/zenodo.4084956}, stag_bib_extends_levelofaccess = {NA}, author = {Čaušević, M. and Meuzelaar, H. and van der Veen, A.M.H. and Cox, M.G.} } @Article { CzachorowskiPLPJ2020, subid = {2710}, title = {Second virial coefficients for He4 and He3 from an accurate relativistic interaction potential}, journal = {Physical Review A}, year = {2020}, month = {10}, day = {12}, volume = {102}, number = {4}, number2 = {18SIB02: Real-K: Realising the redefined kelvin}, keywords = {coefficient, Second virial}, web_url = {https://arxiv.org/abs/2007.09767}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2469-9926, 2469-9934}, DOI = {10.1103/PhysRevA.102.042810}, stag_bib_extends_levelofaccess = {NA}, author = {Czachorowski, P. and Przybytek, M. and Lesiuk, M. and Puchalski, M. and Jeziorski, B.} } @Article { MantouvalouJSMKWHWGBGD2020, subid = {1689}, title = {Laboratory grazing-incidence X-ray fluorescence spectroscopy as an analytical tool for the investigation of sub-nanometer CrSc multilayer water window optics}, journal = {Spectrochimica Acta Part B: Atomic Spectroscopy}, year = {2020}, month = {10}, day = {10}, volume = {174}, number2 = {17SIP07: Adlab-XMet: Advancing laboratory based X-ray metrology techniques}, pages = {105995}, keywords = {GIXRFMultilayer characterization}, web_url = {https://arxiv.org/abs/2006.12198}, misc2 = {EMPIR 2017: Support for Impact}, publisher = {Elsevier BV}, language = {30}, ISSN = {0584-8547}, DOI = {10.1016/j.sab.2020.105995}, stag_bib_extends_levelofaccess = {NA}, author = {Mantouvalou, I. and Jonnard, P. and Szwedowski-Rammert, V. and Meltchakov, E. and Kanngie{\ss}er, B. and Wu, M. and Honicke, P. and Waldschl{\"a}ger, U. and Gross, A. and Baumann, J. and Goetzke, G. and Delmotte, F.} } @Article { BergstrandJH2020, subid = {1643}, title = {Quantifying errors in GNSS antenna calibrations}, journal = {Journal of Geodesy}, year = {2020}, month = {10}, volume = {94}, number = {10}, number2 = {18SIB01: GeoMetre: Large-scale dimensional measurements for geodesy}, pages = {105}, keywords = {Antenna, Calibration, GNSS, Local tie, Phase center offset, Phase center variation, Terrestrial reference frame, PCC, PCO, PCV, TRF}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {0949-7714, 1432-1394}, DOI = {10.1007/s00190-020-01433-0}, stag_bib_extends_levelofaccess = {NA}, author = {Bergstrand, S. and Jarlemark, P. and Herbertsson, M.} } @Article { AlajiAGOLGDG2020, subid = {1703}, title = {Design of tunable power detector towards 5G applications}, journal = {Microwave and Optical Technology Letters}, year = {2020}, month = {10}, volume = {-}, number = {-}, number2 = {16ENG06: ADVENT: Metrology for advanced energy-saving technology in next-generation electronics applications}, pages = {-}, keywords = {5G and IoT sensors, 55-nm BiCMOS, tunablepower detector, Millimeterwave, PN diode}, web_url = {https://zenodo.org/record/4300488}, misc2 = {EMPIR 2016: Energy}, publisher = {Wiley}, language = {30}, ISSN = {0895-2477, 1098-2760}, DOI = {10.1002/mop.32685}, stag_bib_extends_levelofaccess = {NA}, author = {Alaji, I. and Aouimeur, W. and Ghanem, H. and Okada, E. and L{\'e}pilliet, S. and Gloria, D. and Ducournau, G. and Gaquiere, C.} } @Article { BremerWFTSKRHSPMGR2020, subid = {1803}, title = {Quantum dot single-photon emission coupled into single-mode fibers with 3D printed micro-objectives}, journal = {APL Photonics}, year = {2020}, month = {10}, volume = {5}, number = {10}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {106101}, keywords = {Quantum dot single-photon emission}, misc2 = {EMPIR 2017: Fundamental}, publisher = {AIP Publishing}, language = {30}, ISSN = {2378-0967}, DOI = {10.1063/5.0014921}, stag_bib_extends_levelofaccess = {NA}, author = {Bremer, L. and Weber, K. and Fischbach, S. and Thiele, S. and Schmidt, M. and Kaganskiy, A. and Rodt, S. and Herkommer, A. and Sartison, M. and Portalupi, S.L. and Michler, P. and Giessen, H. and Reitzenstein, S.} } @Article { RomanoSMLPTMMBMAFGS2020, subid = {1839}, title = {Challenges in dosimetry of particle beams with ultra-high pulse dose rates}, journal = {Journal of Physics: Conference Series}, year = {2020}, month = {10}, volume = {1662}, number2 = {18HLT04: UHDpulse: Metrology for advanced radiotherapy using particle beams with ultra-high pulse dose rates}, pages = {012028}, keywords = {ultra-high pulse dose rates, dosimetry, metrology, electrons}, misc2 = {EMPIR 2018: Health}, publisher = {IOP Publishing}, language = {30}, ISSN = {1742-6588, 1742-6596}, DOI = {10.1088/1742-6596/1662/1/012028}, stag_bib_extends_levelofaccess = {NA}, author = {Romano, F. and Subiel, A. and McManus, M. and Lee, N. D. and Palmans, H. and Thomas, R. and McCallum, S. and Milluzzo, G. and Borghesi, M. and McIlvenny, A. and Ahmed, H. and Farabolini, W. and Gilardi, A. and Sch{\"u}ller, A.} } @Thesis { Santafe2020, subid = {1877}, title = {Medida y transferencia de la unidad de BSSRDF}, year = {2020}, month = {10}, number2 = {18SIB03: BxDiff: New quantities for the measurement of appearance}, keywords = {BSSRDF, spectrophotometry, reflectance, transmittance, translucency, scattering}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Universidad Complutense de Madrid}, address = {Madrid}, school = {Universidad Complutense de Madrid}, language = {112}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://digital.csic.es/handle/10261/226200}, author = {Santaf{\'e}, P.} } @Thesis { Roccato2020, subid = {1921}, title = {Sistema di misura per prove di tensione composite e combinate (Measuring system for composite and combined voltage tests)}, year = {2020}, month = {10}, number2 = {19NRM07: HV-com²: Support for standardisation of high voltage testing with composite and combined wave shapes}, keywords = {High Voltage, Measuring System, Combined waveform, Uncertainty}, misc2 = {EMPIR 2019: Pre-Co-Normative}, school = {Politecnico di Torino}, language = {59}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://webthesis.biblio.polito.it/15631/}, author = {Roccato, P.} } @Article { SlaninaQDHW2020, subid = {1973}, title = {Comparing the adiabatic and isothermal pressure dependence of the index of refraction in a drop-weight apparatus}, journal = {Applied Physics B}, year = {2020}, month = {10}, volume = {126}, number = {11}, number2 = {17IND07: DynPT: Development of measurement and calibration techniques for dynamic pressures and temperatures}, keywords = {drop-weight, dynamic pressure, adiabatic compression, isothermal compression, liquids, index of refraction, calibration}, misc2 = {EMPIR 2017: Industry}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {0946-2171, 1432-0649}, DOI = {10.1007/s00340-020-07519-z}, stag_bib_extends_levelofaccess = {NA}, author = {Slanina, O. and Quabis, S. and Derksen, S. and Herbst, J. and Wynands, R.} } @Article { MeuzelaarLPvv2020, subid = {2156}, title = {Trace level analysis of reactive ISO 14687 impurities in hydrogen fuel using laser-based spectroscopic detection methods}, journal = {International Journal of Hydrogen Energy}, year = {2020}, month = {10}, volume = {45}, number = {58}, number2 = {17IND09: MetAMCII: Metrology for Airborne Molecular Contaminants II}, pages = {34024-34036}, keywords = {Hydrogen, fuel cell vehicles, Hydrogen purity, ISO 14687, ISO 21087, Permeation, Spectroscopy}, misc2 = {EMPIR 2017: Industry}, publisher = {Elsevier}, language = {30}, DOI = {10.1016/j.ijhydene.2020.09.046}, stag_bib_extends_levelofaccess = {NA}, author = {Meuzelaar, H. and Liu, J. and Persijn, S. and van Wijk, J. and van der Veen, A.} } @Article { SekidoTUHNTKKINOTKCBBMCCLMRBNRZRLPPCPI2020, subid = {1664}, title = {Intercontinental comparison of optical atomic clocks through very long baseline interferometry}, journal = {Nature Physics}, year = {2020}, month = {10}, number2 = {18SIB05: ROCIT: Robust Optical Clocks for International Timescales}, keywords = {Astronomy and astrophysicsAtomic and molecular physicsFibre optics and optical communicationsOptical metrology}, web_url = {http://hdl.handle.net/11696/64130}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {1745-2473, 1745-2481}, DOI = {10.1038/s41567-020-01038-6}, stag_bib_extends_levelofaccess = {NA}, author = {Sekido, M. and Takefuji, K. and Ujihara, H. and Hachisu, H. and Nemitz, N. and Tsutsumi, M. and Kondo, T. and Kawai, E. and Ichikawa, R. and Namba, K. and Okamoto, Y. and Takahashi, R. and Komuro, J. and Clivati, C. and Bregolin, F. and Barbieri, P. and Mura, A. and Cantoni, E. and Cerretto, G. and Levi, F. and Maccaferri, G. and Roma, M. and Bortolotti, C. and Negusini, M. and Ricci, R. and Zacchiroli, G. and Roda, J. and Leute, J. and Petit, G. and Perini, F. and Calonico, D. and Pizzocaro, M. and Ido, T.} } @Article { PojtingerNKT2020, subid = {2376}, title = {Influence of beam quality on reference dosimetry correction factors in magnetic resonance guided radiation therapy}, journal = {Physics and Imaging in Radiation Oncology}, year = {2020}, month = {10}, volume = {16}, number2 = {19NRM01: MRgRT-DOS: Traceable dosimetry for small fields in MR-guided radiotherapy}, pages = {95-98}, keywords = {MR-linac, Dosimetry, Ionization chambers, Magnetic field correction factors, EGSnrc, Monte Carlo}, misc2 = {EMPIR 2019: Pre-Co-Normative}, publisher = {Elsevier BV}, language = {30}, ISSN = {2405-6316}, DOI = {10.1016/j.phro.2020.10.005}, stag_bib_extends_levelofaccess = {NA}, author = {Pojtinger, S. and Nachbar, M. and Kapsch, R-P. and Thorwarth, D.} } @Article { SikorskyGHKGEMRDWBRSKSF2020, subid = {1642}, title = {Measurement of the Th229 Isomer Energy with a Magnetic Microcalorimeter}, journal = {Physical Review Letters}, year = {2020}, month = {9}, day = {28}, volume = {125}, number = {14}, number2 = {17FUN07: CC4C: Coulomb Crystals for Clocks}, keywords = {Th229 Isomer Energy, Magnetic Microcalorimeter}, web_url = {https://arxiv.org/abs/2005.13340}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {0031-9007, 1079-7114}, DOI = {10.1103/PhysRevLett.125.142503}, stag_bib_extends_levelofaccess = {NA}, author = {Sikorsky, T. and Geist, J. and Hengstler, D. and Kempf, S. and Gastaldo, L. and Enss, C. and Mokry, C. and Runke, J. and D{\"u}llmann, C.E. and Wobrauschek, P. and Beeks, K. and Rosecker, V. and Sterba, J.H. and Kazakov, G. and Schumm, T. and Fleischmann, A.} } @Article { LangeHSSLTP2020, subid = {1671}, title = {Coherent Suppression of Tensor Frequency Shifts through Magnetic Field Rotation}, journal = {Physical Review Letters}, year = {2020}, month = {9}, day = {28}, volume = {125}, number = {14}, number2 = {17FUN07: CC4C: Coulomb Crystals for Clocks}, keywords = {second-rank tensor frequency shifts, atomic clocks}, web_url = {https://journals.aps.org/prl/abstract/10.1103/PhysRevLett.125.143201}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {0031-9007, 1079-7114}, DOI = {10.1103/PhysRevLett.125.143201}, stag_bib_extends_levelofaccess = {NA}, author = {Lange, R. and Huntemann, N. and Sanner, C. and Shao, H. and Lipphardt, B. and Tamm, Chr. and Peik, E.} } @Article { JandaGOPUHRSMRNCHWEACDMORONJKZ2020, subid = {1683}, title = {Magneto-Seebeck microscopy of domain switching in collinear antiferromagnet CuMnAs}, journal = {Physical Review Materials}, year = {2020}, month = {9}, day = {28}, volume = {4}, number = {9}, number2 = {16ENG06: ADVENT: Metrology for advanced energy-saving technology in next-generation electronics applications}, pages = {094413-1 to 094413-9}, keywords = {-}, web_url = {https://arxiv.org/abs/2004.05460}, misc2 = {EMPIR 2016: Energy}, publisher = {American Physical Society (APS)}, address = {1 Research Rd Attn: Mark Doyle Ridge 11961-9000 United States}, language = {30}, ISSN = {2475-9953}, DOI = {10.1103/PhysRevMaterials.4.094413}, stag_bib_extends_levelofaccess = {NA}, author = {Janda, T. and Godinho, J. and Ostatnicky, T. and Pfitzner, E. and Ulrich, G. and Hoehl, A. and Reimers, S. and Šob{\'a}ň, Z. and Metzger, T. and Reichlov{\'a}, H. and Nov{\'a}k, V. and Campion, R. P. and Heberle, J. and Wadley, P. and Edmonds, K. W. and Amin, O. J. and Chauhan, J. S. and Dhesi, S. S. and Maccherozzi, F. and Otxoa, R. M. and Roy, P. E. and Olejn{\'i}k, K. and Němec, P. and Jungwirth, T. and Kaestner, B. and Ziade, Francois} } @Article { LangeHSSLTP20200, subid = {1671}, title = {Coherent Suppression of Tensor Frequency Shifts through Magnetic Field Rotation}, journal = {Physical Review Letters}, year = {2020}, month = {9}, day = {28}, volume = {125}, number = {14}, number2 = {18SIB05: ROCIT: Robust Optical Clocks for International Timescales}, keywords = {second-rank tensor frequency shifts, atomic clocks}, web_url = {https://journals.aps.org/prl/abstract/10.1103/PhysRevLett.125.143201}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {0031-9007, 1079-7114}, DOI = {10.1103/PhysRevLett.125.143201}, stag_bib_extends_levelofaccess = {NA}, author = {Lange, R. and Huntemann, N. and Sanner, C. and Shao, H. and Lipphardt, B. and Tamm, Chr. and Peik, E.} } @Article { WelshvBCHLLLvNTWWJ2020, subid = {1707}, title = {Towards defining reference materials for measuring extracellular vesicle refractive index, epitope abundance, size and concentration}, journal = {Journal of Extracellular Vesicles}, year = {2020}, month = {9}, day = {24}, volume = {9}, number = {1}, number2 = {18HLT01: METVES II: Standardisation of concentration measurements of extracellular vesicles for medical diagnoses}, pages = {1816641}, keywords = {Calibration; exosomes; extracellular vesicles; microvesicles; optical analysis; reference materials; standardization; quality control; validation}, misc2 = {EMPIR 2018: Health}, language = {30}, ISSN = {2001-3078}, DOI = {10.1080/20013078.2020.1816641}, stag_bib_extends_levelofaccess = {NA}, author = {Welsh, J.A. and van der Pol, E. and Bettin, B.A. and Carter, D.R.F. and Hendrix, A. and Lenassi, M. and Langlois, M-A. and Llorente, A. and van de Nes, A.S. and Nieuwland, R. and Tang, V. and Wang, L. and Witwer, K.W. and Jones, J.C. } } @Article { EckmannvCLvKR2020, subid = {1605}, title = {Density Measurements of (0.99 Methane + 0.01 Butane) and (0.98 Methane + 0.02 Isopentane) over the Temperature Range from (100 to 160) K at Pressures up to 10.8 MPa}, journal = {International Journal of Thermophysics}, year = {2020}, month = {9}, day = {23}, volume = {41}, number = {11}, number2 = {16ENG09: LNG III: Metrological support for LNG and LBG as transport fuel}, pages = {1-19/156}, keywords = {Cryogenic state · Density measurement · Liquefied binary mixtures ·Magnetic-suspension coupling · Single-sinker densimeter}, tags = {EnG}, misc2 = {EMPIR 2016: Energy}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {0195-928X, 1572-9567}, DOI = {10.1007/s10765-020-02728-2}, stag_bib_extends_levelofaccess = {NA}, author = {Eckmann, P. and von Preetzmann, N. and Cavuoto, G. and Li, J. and van der Veen, A. and Kleinrahm, R. and Richter, M.} } @Article { KuipervNVv2020, subid = {1706}, title = {Reliable measurements of extracellular vesicles by clinical flow cytometry}, journal = {American Journal of Reproductive Immunology}, year = {2020}, month = {9}, day = {23}, number2 = {18HLT01: METVES II: Standardisation of concentration measurements of extracellular vesicles for medical diagnoses}, keywords = {calibration,data interpretation,extracellular vesicles,flow cytometry,standardization}, misc2 = {EMPIR 2018: Health}, publisher = {John Wiley \& Sons Ltd}, language = {30}, ISSN = {1046-7408}, DOI = {10.1111/aji.13350}, stag_bib_extends_levelofaccess = {NA}, author = {Kuiper, M. and van de Nes, A. and Nieuwland, R. and Varga, Z. and van de Pol, E.} } @Proceedings { tenHaveHML2020, subid = {2086}, title = {Unfairly Faulty Energy Meter Reading due to Inappropriate Use of the Blondel Theorem}, journal = {2020 International Symposium on Electromagnetic Compatibility - EMC EUROPE}, year = {2020}, month = {9}, day = {23}, number2 = {17NRM02: MeterEMI: Electromagnetic Interference on Static Electricity Meters}, keywords = {Blondel theorem, Distribution system, Energy measurement, Residual current device, Unbalance}, web_url = {https://research.utwente.nl/en/publications/unfairly-faulty-energy-meter-reading-due-to-inappropriate-use-of-}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {IEEE}, event_place = {Barcelona}, event_name = {2020 International Symposium on Electromagnetic Compatibility - EMC EUROPE}, event_date = {23-09-2020 to 25-09-2020}, language = {30}, DOI = {10.1109/EMCEUROPE48519.2020.9245714}, stag_bib_extends_levelofaccess = {NA}, author = {ten Have, B. and Hartman, T. and Moonen, N. and Leferink, F.} } @Proceedings { tenHaveAPSL2020, subid = {2085}, title = {On-Site Waveform Survey in LV Distribution Network using a Photovoltaic Installation}, journal = {2020 International Symposium on Electromagnetic Compatibility - EMC EUROPE}, year = {2020}, month = {9}, day = {23}, number2 = {17NRM02: MeterEMI: Electromagnetic Interference on Static Electricity Meters}, keywords = {Conducted electromagnetic interference, Distribution network, Non-linear, Photovoltaic installation, Static energy meter}, web_url = {https://research.utwente.nl/en/publications/on-site-waveform-survey-in-lv-distribution-network-using-a-photov}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {IEEE}, event_place = {Barcelona}, event_name = {2020 International Symposium on Electromagnetic Compatibility - EMC EUROPE}, event_date = {23-09-2020 to 25-09-2020}, language = {30}, DOI = {10.1109/EMCEUROPE48519.2020.9245831}, stag_bib_extends_levelofaccess = {NA}, author = {ten Have, B. and Azpurua, M.A. and Pous, M. and Silva, F. and Leferink, F.} } @Proceedings { MoonenGHL2020, subid = {2089}, title = {Time-Domain EMI Measurements using a Low Cost Digitizer to Optimize the Total Measurement Time for a Test Receiver}, journal = {2020 International Symposium on Electromagnetic Compatibility - EMC EUROPE}, year = {2020}, month = {9}, day = {23}, number2 = {17NRM02: MeterEMI: Electromagnetic Interference on Static Electricity Meters}, keywords = {-}, web_url = {https://research.utwente.nl/en/publications/time-domain-emi-measurements-using-a-low-cost-digitizer-to-optimi}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {IEEE}, event_place = {Rome}, event_name = {2020 International Symposium on Electromagnetic Compatibility - EMC EUROPE}, event_date = {23-09-2020 to 25-09-2020}, language = {30}, DOI = {10.1109/EMCEUROPE48519.2020.9245801}, stag_bib_extends_levelofaccess = {NA}, author = {Moonen, N. and Grootjans, R. and Hartman, T. and Leferink, F.} } @Article { DixonDLWMS2020, subid = {1722}, title = {Capturing Complex Behavior in Josephson Traveling-Wave Parametric Amplifiers}, journal = {Physical Review Applied}, year = {2020}, month = {9}, day = {22}, volume = {14}, number = {3}, number2 = {17FUN10: ParaWave: Josephson travelling wave parametric amplifier and its application for metrology}, pages = {1-16}, keywords = {Josephson junctions, SQUID, superconducting devices, Josephson traveling-wave parametric amplifier, coupled mode equations}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2331-7019}, DOI = {10.1103/PhysRevApplied.14.034058}, stag_bib_extends_levelofaccess = {NA}, author = {Dixon, T. and Dunstan, J.W. and Long, G.B. and Williams, J.M. and Meeson, P.J. and Shelly, C.D.} } @Article { PellegrinoSMPMH2020, subid = {1609}, title = {Polyethylene Glycol as Shape and Size Controller for the Hydrothermal Synthesis of SrTiO3 Cubes and Polyhedra}, journal = {Nanomaterials}, year = {2020}, month = {9}, day = {21}, volume = {10}, number = {9}, number2 = {17NRM04: nPSize: Improved traceability chain of nanoparticle size measurements}, pages = {1892}, keywords = {polyethylene glycol, strontium titanate, controlled morphology, photoelectrochemistry}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {MDPI AG}, language = {30}, ISSN = {2079-4991}, DOI = {10.3390/nano10091892}, stag_bib_extends_levelofaccess = {NA}, author = {Pellegrino, F. and Sordello, F. and Mino, L. and Prozzi, M. and Mansfeld, U. and Hodoroaba, V-D.} } @Article { deKromBZMBiGFKHE2020, subid = {2032}, title = {Comparability of calibration strategies for measuring mercury concentrations in gas emission sources and the atmosphere}, journal = {Atmospheric Measuremnt Techniques Discussion}, year = {2020}, month = {9}, day = {21}, number2 = {16ENV01: MercOx: Metrology for oxidised mercury}, keywords = {Mercury, emissions, calibration, traceability}, misc2 = {EMPIR 2016: Environment}, publisher = {Copernicus GmbH}, language = {30}, DOI = {10.5194/amt-2020-314}, stag_bib_extends_levelofaccess = {NA}, author = {de Krom, I. and Bavius, W. and Ziel, R. and McGhee, E.A. and Brown, R.J.C. and Živković, I. and Gačnik, J. and Fajon, V. and Kotnik, J. and Horvat, M. and Ent, H.} } @Article { QuNWE2020, subid = {1875}, title = {Towards a dTDLAS-Based Spectrometer for Absolute HCl Measurements in Combustion Flue Gases and a Better Evaluation of Thermal Boundary Layer Effects}, journal = {Flow, Turbulence and Combustion}, year = {2020}, month = {9}, day = {20}, volume = {106}, number = {2}, number2 = {16ENV08: IMPRESS 2: Metrology for air pollutant emissions}, pages = {533-546}, keywords = {Laser diagnostics; Absorption spectroscopy; dTDLAS; Line-of-sight measurements; HCl measurement; Spatial heterogeneity; Thermal boundary layer}, misc2 = {EMPIR 2016: Environment}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {1386-6184, 1573-1987}, DOI = {10.1007/s10494-020-00216-z}, stag_bib_extends_levelofaccess = {NA}, author = {Qu, Z. and Nwaboh, J. and Werhahn, O. and Ebert, V.} } @Article { ChristinckRLHGK2020, subid = {1880}, title = {Characterization of the angular-dependent emission of nitrogen-vacancy centers in nanodiamond}, journal = {Applied Physics B}, year = {2020}, month = {9}, day = {18}, volume = {126}, number = {10}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, keywords = {Single-photon sources}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {0946-2171, 1432-0649}, DOI = {10.1007/s00340-020-07508-2}, stag_bib_extends_levelofaccess = {NA}, author = {Christinck, J. and Rodiek, B. and L{\'o}pez, M. and Hofer, H. and Georgieva, H. and K{\"u}ck, S.} } @Article { ZilbertiZABZ2020, subid = {1668}, title = {RF‐induced heating of metallic implants simulated as PEC: Is there something missing?}, journal = {Magnetic Resonance in Medicine}, year = {2020}, month = {9}, day = {16}, volume = {85}, number = {2}, number2 = {17IND01: MIMAS: Procedures allowing medical implant manufacturers to demonstrate compliance with MRI safety regulations}, pages = {583-586}, keywords = {MR safetyMedical implantsRF-induced heatingMagnetic Resonance ImagingSpecific Absorption Rate}, web_url = {https://onlinelibrary.wiley.com/doi/full/10.1002/mrm.28512}, misc2 = {EMPIR 2017: Industry}, publisher = {Wiley}, language = {30}, ISSN = {0740-3194, 1522-2594}, DOI = {10.1002/mrm.28512}, stag_bib_extends_levelofaccess = {NA}, author = {Zilberti, L. and Zanovello, U. and Arduino, A. and Bottauscio, O. and Zilberti, L.} } @Article { IliBL2020, subid = {2152}, title = {Stability of AC current measurements using AC-DC shunts and the AC Quantum Voltmeter}, journal = {Proceedings 24rd IMEKO TC 4 International Symposium}, year = {2020}, month = {9}, day = {16}, number2 = {17RPT03: DIG-AC: A digital traceability chain for AC voltage and current}, keywords = {AC-DC shunt, AC Quantum Voltmeter, low-frequency AC current, traceability}, misc2 = {EMPIR 2017: Research Potential}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://www.imeko.org/publications/tc4-2020/IMEKO-TC4-2020-69.pdf}, author = {Ilić, D. and Behr, R. and Lee, J.} } @Miscellaneous { CarulloCV, subid = {1597}, title = {EMUE-D6-6-DAQ Board Electrical Quantities}, year = {2020}, month = {9}, day = {14}, number2 = {17NRM05: EMUE: Advancing measurement uncertainty - comprehensive examples for key international standards}, keywords = {Data acquisition systems; Electrical quantities: Measurement uncertainty; Cross Talk}, misc2 = {EMPIR 2017: Pre-Co-Normative}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://zenodo.org/record/4028283}, author = {Carullo, A and Corbellini, S. and Vallan, A.} } @Article { Masla2020, subid = {1987}, title = {High capacitance simulation using mutual inductors}, journal = {IMEKO TC-4 2020}, year = {2020}, month = {9}, day = {14}, number2 = {17IND10: LiBforSecUse: Quality assessment of electric vehicle Li-ion batteries for second use applications}, keywords = {low impedance standardmutual inductors}, misc2 = {EMPIR 2017: Industry}, language = {30}, DOI = {10.5281/zenodo.4630725}, stag_bib_extends_levelofaccess = {NA}, author = {Maslan, S.} } @Article { Masla2020_2, subid = {1988}, title = {Design of digital sampling impedance bridge for battery impedance spectroscopy}, journal = {IMEKO TC-4 2020}, year = {2020}, month = {9}, day = {14}, number2 = {17IND10: LiBforSecUse: Quality assessment of electric vehicle Li-ion batteries for second use applications}, keywords = {digital sampling impdeance bridgelow impedancescharcterisationLi-ion battery cells}, misc2 = {EMPIR 2017: Industry}, language = {30}, DOI = {10.5281/zenodo.4630641}, stag_bib_extends_levelofaccess = {NA}, author = {Maslan, S.} } @Article { CrottiGLDL2020, subid = {2131}, title = {A simplified procedure for the Accurate Frequency Response Identification of Voltage Transformers}, journal = {Proceedings of the 24th IMEKO TC-4 International Symposium, September 14-16, 2020}, year = {2020}, month = {9}, day = {14}, number2 = {19NRM05: IT4PQ: Measurement methods and test procedures for assessing accuracy of instrument transformers for power quality measurements}, keywords = {Power system measurement, Instrument Transformer, Harmonics, Voltage Measurement}, tags = {SEG}, misc2 = {EMPIR 2019: Pre-Co-Normative}, language = {30}, DOI = {10.5281/zenodo.5136702}, stag_bib_extends_levelofaccess = {NA}, author = {Crotti, G. and Giordano, D. and Letizia, P.S. and Delle Femine, A. and Luiso, M.} } @Article { MomeniPakdehiSNZWNSPSTP2020, subid = {1696}, title = {Silicon Carbide Stacking‐Order‐Induced Doping Variation in Epitaxial Graphene}, journal = {Advanced Functional Materials}, year = {2020}, month = {9}, day = {11}, volume = {30}, number = {45}, number2 = {18SIB07: GIQS: Graphene impedance quantum standard}, pages = {2004695}, keywords = {epitaxial graphenes, hexagonal silicon carbides, SiC spontaneous polarization, surface-dependent polarization doping}, web_url = {https://onlinelibrary.wiley.com/doi/10.1002/adfm.202004695}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Wiley}, language = {30}, ISSN = {1616-301X, 1616-3028}, DOI = {10.1002/adfm.202004695}, stag_bib_extends_levelofaccess = {NA}, author = {Momeni Pakdehi, D. and Sch{\"a}dlich, P. and Nguyen, T.T.N. and Zakharov, A.A. and Wundrack, S. and Najafidehaghani, E. and Speck, F. and Pierz, K. and Seyller, T. and Tegenkamp, C. and Pierz, K.} } @Article { WinterSVMRPKHLHDBBBBBBKSR2020, subid = {1950}, title = {Results of the Bifacial PV Cells and PV Modules Power Measurement Round Robin Activity of the PV-Enerate Project}, journal = {37th European Photovoltaic Solar Energy Conference and Exhibition}, year = {2020}, month = {9}, day = {11}, number2 = {16ENG02: PV-Enerate: Advanced PV energy rating}, pages = {877 - 882}, keywords = {Testing, PV Module, Bifacial PV}, misc2 = {EMPIR 2016: Energy}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://zenodo.org/record/4055707}, author = {Winter, S. and Str{\"a}ter, H. and Vegas, A. and Molinero, R.R. and Riechelmann, S. and Pavanello, D. and Kenny, R. and Herrmann, W. and Lopez-Garcia, J. and Hinken, D. and Dittmann, S. and Bonilla, J. and Bliss, M. and Bothe, K. and Blakesley, J.C. and Betts, T.R. and Bellenda, G. and Koutsourakis, G. and Schmid, A. and Rauer, M.} } @Thesis { bb962dc3352020, subid = {2220}, title = {Optimization of epitaxial graphene growth for quantum metrology}, year = {2020}, month = {9}, day = {11}, number2 = {18SIB07: GIQS: Graphene impedance quantum standard}, keywords = {epitaxial graphene, quantum Hall effect, resistance standard, quantum metrology}, misc2 = {EMPIR 2018: SI Broader Scope}, school = {Gottfried Wilhelm Leibniz Universit{\"a}t, Hannover, Germany}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://doi.org/10.15488/10201} } @Proceedings { MubarakMTRS2020, subid = {1723}, title = {Automated Contacting of On-Wafer Devices for RF Testing}, journal = {2020 Conference on Precision Electromagnetic Measurements (CPEM)}, year = {2020}, month = {9}, day = {10}, volume = {N/A}, number = {N/A}, number2 = {18SIB09: TEMMT: Traceability for electrical measurements at millimetre-wave and terahertz frequencies for communications and electronics technologies}, pages = {1-2}, keywords = {On-wafer probing, on-wafer contacting, microwave measurements, measurement techniques, measurement uncertainty, precision measurements, uncertainty}, web_url = {https://zenodo.org/record/4276095}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IEEE}, event_place = {Denver (Aurora), CO, USA, USA}, event_name = {2020 Conference on Precision Electromagnetic Measurements (CPEM)}, event_date = {24-08-2020 to 28-08-2020}, language = {30}, ISBN = {978-1-7281-5899-0}, ISSN = {2160-0171}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://doi.org/10.1109/CPEM49742.2020.9191800}, author = {Mubarak, F. and Martino, C.D. and Toskovic, R. and Rietveld, G. and Spirito, M.} } @Proceedings { CrottiDGGLLS2020, subid = {1962}, title = {Calibration System for DC Power/Energy Measurement chain in Railway applications}, journal = {IEEE}, year = {2020}, month = {9}, day = {10}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, keywords = {Voltage measurement, Uncertainty, Current measurement, Transducers, Phantoms, Calibration, Rail transportation, Combined Transducers, Power Measurement, Phantom Power, DC Railway, Energy Meter}, tags = {SEG}, web_url = {https://zenodo.org/record/4569831}, misc2 = {EMPIR 2016: Energy}, publisher = {IEEE}, event_place = {Denver, CO, USA}, event_name = {2020 Conference on Precision Electromagnetic Measurements}, event_date = {24-08-2020 to 28-08-2020}, language = {30}, ISBN = {978-1-7281-5898-3}, ISSN = {2160-0171}, DOI = {10.1109/CPEM49742.2020.9191718}, stag_bib_extends_levelofaccess = {NA}, author = {Crotti, G. and Delle Femine, A. and Gallo, D. and Giordano, D. and Luiso, M. and Landi, C. and Signorino, D.} } @Article { WilsonSSJR2020, subid = {1581}, title = {Comparing Standardized and Manufacturers’ Interfaces for Waveguides Used at Submillimeter Wavelengths}, journal = {IEEE Transactions on Terahertz Science and Technology}, year = {2020}, month = {9}, volume = {10}, number = {5}, number2 = {18SIB09: TEMMT: Traceability for electrical measurements at millimetre-wave and terahertz frequencies for communications and electronics technologies}, pages = {453-459}, keywords = {Rectangular waveguide, submillimeter-waves, terahertz, waveguide flanges, waveguide interfaces, waveguidestandards}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {2156-342X, 2156-3446}, DOI = {10.1109/TTHZ.2020.3010122}, stag_bib_extends_levelofaccess = {NA}, author = {Wilson, Alan and Sun, Wenjuan and Shang, Xiaobang and Johny, Susan and Ridler, Nick M.} } @Article { WangSRNDHW2020, subid = {1582}, title = {Material Measurements Using VNA-Based Material Characterization Kits Subject to Thru-Reflect-Line Calibration}, journal = {IEEE Transactions on Terahertz Science and Technology}, year = {2020}, month = {9}, volume = {10}, number = {5}, number2 = {18SIB09: TEMMT: Traceability for electrical measurements at millimetre-wave and terahertz frequencies for communications and electronics technologies}, pages = {466-473}, keywords = {Loss tangent, millimeter-wave measurements, relative permittivity, terahertz measurements, time-domain spectrometer (TDS), thru-reflect-line (TRL) calibration, vector network analyzer (VNA)}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {2156-342X, 2156-3446}, DOI = {10.1109/TTHZ.2020.2999631}, stag_bib_extends_levelofaccess = {NA}, author = {Wang, Yi and Shang, Xiaobang and Ridler, Nick M. and Naftaly, Mira and Dimitriadis, Alexandros I. and Huang, Tongde and Wu, Wen} } @Proceedings { RiechelmannSW2020, subid = {1606}, title = {DETERMINATION OF A PV MODULE POWER MATRIX WITH AN LED SOLAR SIMULATOR}, journal = {EUPVSEC-proceedings}, year = {2020}, month = {9}, number2 = {16ENG02: PV-Enerate: Advanced PV energy rating}, keywords = {Energy Rating, Characterization, Electrical Properties, Qualification and Testing, Photovoltaic}, web_url = {https://zenodo.org/record/4049818}, misc2 = {EMPIR 2016: Energy}, event_place = {online conference}, event_name = {EUPVSEC 2020}, event_date = {07-09-2020 to 07-09-2020}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://doi.org/10.5281/zenodo.4049818}, author = {Riechelmann, S. and Straeter, H. and Winter, S.} } @Article { OlbrichBOS2020, subid = {1628}, title = {Statistical Characterization of Horizontal Slug Flow Using Snapshot Proper Orthogonal Decomposition}, journal = {International Journal of Multiphase Flow}, year = {2020}, month = {9}, number2 = {16ENG07: MultiFlowMet II: Multiphase flow reference metrology}, pages = {103453}, keywords = {slug flowcharacterizationproper orthogonal decomposition}, misc2 = {EMPIR 2016: Energy}, publisher = {Elsevier BV}, language = {30}, ISSN = {0301-9322}, DOI = {10.1016/j.ijmultiphaseflow.2020.103453}, stag_bib_extends_levelofaccess = {NA}, author = {Olbrich, M. and B{\"a}r, M. and Oberleithner, K. and Schmelter, S.} } @Article { GunkelDHLKRUBT2020, subid = {1684}, title = {Phonon‐Enhanced Near‐Field Spectroscopy to Extract the Local Electronic Properties of Buried 2D Electron Systems in Oxide Heterostructures}, journal = {Advanced Functional Materials}, year = {2020}, month = {9}, volume = {30}, number = {46}, number2 = {16ENG06: ADVENT: Metrology for advanced energy-saving technology in next-generation electronics applications}, pages = {2004767}, keywords = {2D electron systems, electronic properties, LaAlO/SrTiO, near-field spectroscopy, oxide heterostructure}, misc2 = {EMPIR 2016: Energy}, publisher = {Wiley}, language = {30}, ISSN = {1616-301X, 1616-3028}, DOI = {10.1002/adfm.202004767}, stag_bib_extends_levelofaccess = {NA}, author = {Gunkel, F. and Dittmann, R. and Hoehl, A. and Lewin, M. and K{\"a}stner, B. and Rose, M‐A. and Ulrich, G. and Barnett, J. and Taubner, T.} } @Article { ZakrissonSFZA2020, subid = {1678}, title = {Procedure for robust assessment of cavity deformation in Fabry–P{\'e}rot based refractometers}, journal = {Journal of Vacuum Science \& Technology B}, year = {2020}, month = {9}, volume = {38}, number = {5}, number2 = {18SIB04: QuantumPascal: Towards quantum-based realisations of the pascal}, pages = {054202}, keywords = {Cavity Deformation, Fabry-Perot, refractomtery, Gas Modulation refractomtery (GAMOR)}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {American Vacuum Society}, language = {30}, ISSN = {2166-2746, 2166-2754}, DOI = {10.1116/6.0000375}, stag_bib_extends_levelofaccess = {NA}, author = {Zakrisson, J. and Silander, I. and Forss{\'e}n, C. and Zelan, M. and Axner, O.} } @Article { LuisoLLFCL2020, subid = {1743}, title = {The Role of Supply Conditions on the Measurement of High-Frequency Emissions}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2020}, month = {9}, volume = {69}, number = {9}, number2 = {18NRM05: SupraEMI: Grid measurements of 2 kHz - 150 kHz harmonics to support normative emission limits for mass-market electrical goods}, pages = {6667-6676}, keywords = {High-frequency (HF) distortion,LED lamps,power quality,power system harmonics,power system measurements}, tags = {SEG}, web_url = {https://ieeexplore.ieee.org/document/9094688}, misc2 = {EMPIR 2018: Pre-Co-Normative}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9456, 1557-9662}, DOI = {10.1109/TIM.2020.2992824}, stag_bib_extends_levelofaccess = {NA}, author = {Luiso, M. and Langella, R. and Landi, C. and Femine, A.D. and Collin, A.J. and Luiso, M.} } @Proceedings { Chen2020, subid = {1746}, title = {Entwicklung und Verifikation eines breitbandigen Referenzstromwandlersatzes f{\"u}r Str{\"o}me von 10 A bis 2000 A und 9 kHz}, journal = {316. PTB-Seminar, Aktuelle Fortschritte von Kalibrierverfahren im Nieder- und Hochfrequenzbereich 2020}, year = {2020}, month = {9}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, pages = {7}, keywords = {Breitband, Stromwandler, Kalibrierung, Referenzwandler, Messwandler, Messwiderstand}, web_url = {http://doi.org/10.7795/810.20201113}, misc2 = {EMPIR 2017: Industry}, publisher = {Physikalisch-Technische Bundesanstalt (PTB)}, event_place = {Physikalisch-Technische Bundesanstalt (PTB), Braunschweig, Germany}, event_name = {316. PTB-Seminar, Aktuelle Fortschritte von Kalibrierverfahren im Nieder- und Hochfrequenzbereich 2020}, event_date = {03-09-2020 to 03-09-2020}, language = {43}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {http://doi.org/10.7795/810.20201113}, author = {Chen, Y.} } @Article { BrabH2020, subid = {1763}, title = {Ab initio calculation of the electron capture spectrum of 163Ho: Auger–Meitner decay into continuum states}, journal = {New Journal of Physics}, year = {2020}, month = {9}, volume = {22}, number = {9}, number2 = {17FUN02: MetroMMC: Measurement of fundamental nuclear decay data using metallic magnetic calorimeters}, pages = {093018}, keywords = {electron capture spectrum,line width,continuum,Auger Meitner,163Ho}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Maurits W. Haverkort}, language = {30}, ISSN = {1367-2630}, DOI = {10.1088/1367-2630/abac72}, stag_bib_extends_levelofaccess = {NA}, author = {Bra\(\beta\), M. and Haverkort, M.W.} } @Article { GaiserFH2020, subid = {1794}, title = {Thermodynamic-temperature data from 30 K to 200 K}, journal = {Metrologia}, year = {2020}, month = {9}, volume = {57}, number = {5}, number2 = {15SIB02: InK 2: Implementing the new kelvin 2}, pages = {055003}, keywords = {thermodynamic temperature, primary thermometry, dielectric-constant gasthermometry, International temperature Scale, ITS-90}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/ab9683}, stag_bib_extends_levelofaccess = {NA}, author = {Gaiser, C. and Fellmuth, B. and Haft, N.} } @Article { GeorgievaLHCRSKHRRK2020, subid = {1881}, title = {Radiometric characterization of a triggered narrow-bandwidth single-photon source and its use for the calibration of silicon single-photon avalanche detectors}, journal = {Metrologia}, year = {2020}, month = {9}, volume = {57}, number = {5}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {055001}, keywords = {quantum radiometry, quantum metrology, single-photon source, single-photondetector, quantum dot}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/ab9db6}, stag_bib_extends_levelofaccess = {NA}, author = {Georgieva, H. and L{\'o}pez, M. and Hofer, H. and Christinck, J. and Rodiek, B. and Schnauber, P. and Kaganskiy, A. and Heindel, T. and Rodt, S. and Reitzenstein, S. and K{\"u}ck, S.} } @Proceedings { CascettaCDGGS2020, subid = {1940}, title = {Measuring the impact of reversible substations on energy efficiency in rail transport}, journal = {IMEKO TC-4 2020 PROCEEDINGS}, year = {2020}, month = {9}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, keywords = {Railway braking energy, reversible substation, energy efficiency, voltage-current measurements}, web_url = {https://www.imeko.org/publications/tc4-2020/IMEKO-TC4-2020-24.pdf}, misc2 = {EMPIR 2016: Energy}, event_place = {Palermo, Italy}, event_name = {24th IMEKO TC4 International Symposium 22nd International Workshop on ADC and DAC Modelling and Testing}, event_date = {14-09-2020 to 16-09-2020}, language = {30}, ISBN = {978-92-990084-7-8}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {978-92-990084-7-8}, author = {Cascetta, F. and Cipolletta, G. and Delle Femine, A. and Gallo, D. and Giordano, D. and Signorino, D.} } @Article { HuntMSPYWD2020, subid = {2218}, title = {Comparison of the Sentinel-3A and B SLSTR Tandem Phase Data Using Metrological Principles}, journal = {Remote Sensing}, year = {2020}, month = {9}, volume = {12}, number = {18}, number2 = {16ENV03: MetEOC-3: Further metrology for earth observation and climate}, pages = {2893}, keywords = {Sentinel-3A, Copernicus, Tandem-phase data, Earth Observation}, misc2 = {EMPIR 2016: Environment}, publisher = {MDPI AG}, language = {30}, ISSN = {2072-4292}, DOI = {10.3390/rs12182893}, stag_bib_extends_levelofaccess = {NA}, author = {Hunt, S.E. and Mittaz, J.P.D. and Smith, D. and Polehampton, E. and Yemelyanova, R. and Woolliams, E.R. and Donlon, C.} } @Article { NagelPLD2020, subid = {2454}, title = {Quantification of Interpatient 12-lead ECG Variabilities within a Healthy Cohort}, journal = {Current Directions in Biomedical Engineering}, year = {2020}, month = {9}, volume = {6}, number = {3}, number2 = {18HLT07: MedalCare: Metrology of automated data analysis for cardiac arrhythmia management}, pages = {493-496}, keywords = {ECG variabilities, ECG features, Electrophysio-logical Model Parameterization}, misc2 = {EMPIR 2018: Health}, publisher = {Walter de Gruyter GmbH}, language = {30}, ISSN = {2364-5504}, DOI = {10.1515/cdbme-2020-3127}, stag_bib_extends_levelofaccess = {NA}, author = {Nagel, C. and Pilia, N. and Loewe, A. and D{\"o}ssel, O.} } @Article { CultreraC2020, subid = {1657}, title = {A simple algorithm to find the L-curve corner in the regularisation of ill-posed inverse problems}, journal = {IOP SciNotes}, year = {2020}, month = {8}, day = {28}, volume = {1}, number = {2}, number2 = {16NRM01: GRACE: Developing electrical characterisation methods for future graphene electronics}, pages = {025004}, keywords = {L-curve, regularization, numerical problems, inverse problems, ill-posed problems, iterative, easy implementation}, web_url = {https://iopscience.iop.org/article/10.1088/2633-1357/abad0d}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {IOP Publishing}, language = {30}, ISSN = {2633-1357}, DOI = {10.1088/2633-1357/abad0d}, stag_bib_extends_levelofaccess = {NA}, author = {Cultrera, A. and Callegaro, L.} } @Thesis { Giordano2020, subid = {1693}, title = {CFD simulation of an aerosol mixing chamber}, year = {2020}, month = {8}, day = {27}, number2 = {18HLT02: AeroTox: Measurements for mitigating adverse health effects from atmospheric particulate pollutants}, keywords = {aerosol, mixing chamber, simulation}, web_url = {https://infoscience.epfl.ch/record/280815?ln=en}, misc2 = {EMPIR 2018: Health}, school = {Federal Institute of Technology Lausanne}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://infoscience.epfl.ch/record/280815?ln=en}, author = {Giordano, A.} } @Proceedings { ChenMBR2020, subid = {1765}, title = {Development of a Wideband Current-to-Voltage Transformer Set for Currents up to 2 kA}, journal = {2020 Conference on Precision Electromagnetic Measurements}, year = {2020}, month = {8}, day = {24}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, keywords = {Wideband, current transformers, calibration, measurement uncertainty, instrument transformer}, tags = {SEG}, misc2 = {EMPIR 2017: Industry}, publisher = {Zenodo}, event_place = {Denver (Aurora), CO, USA, USA}, event_name = {2020 Conference on Precision Electromagnetic Measurements}, event_date = {24-08-2020 to 28-08-2020}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://zenodo.org/record/4348461}, author = {Chen, Y. and Mohns, E. and Badura, H. and Raether, P.} } @Article { CrottivMTLSACMMA2020, subid = {2130}, title = {Measurement Methods and Procedures for Assessing Accuracy of Instrument Transformers for Power Quality Measurements}, journal = {Conference on Precision Electromagnetic Measurements CPEM 2020 Proceedings}, year = {2020}, month = {8}, day = {24}, number2 = {19NRM05: IT4PQ: Measurement methods and test procedures for assessing accuracy of instrument transformers for power quality measurements}, keywords = {Instrument transformers, calibration, measurement standards, measurement techniques, measurementuncertainty, precision measurements}, tags = {SEG}, misc2 = {EMPIR 2019: Pre-Co-Normative}, language = {30}, DOI = {10.5281/zenodo.5136547}, stag_bib_extends_levelofaccess = {NA}, author = {Crotti, G. and van den Brom, H.E. and Mohns, E. and Tinarelli, R. and Luiso, M. and Styblikova, R. and Agazar, M. and \c{C}aycı, H. and Mazza, P. and Meyer, J. and Almutairi, M. } } @Article { MustapaaNHV2020, subid = {1670}, title = {Metrological Challenges in Collaborative Sensing: Applicability of Digital Calibration Certificates}, journal = {Sensors}, year = {2020}, month = {8}, day = {21}, volume = {20}, number = {17}, number2 = {17IND02: SmartCom: Communication and validation of smart data in IoT-networks}, pages = {4730}, keywords = {IoT-communication, sensor networks, smart agents, metrology, digital calibration certificate, traceability}, web_url = {https://www.mdpi.com/1424-8220/20/17/4730}, misc2 = {EMPIR 2017: Industry}, publisher = {MDPI AG}, address = {Basel CH-4005 Switzerland}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s20174730}, stag_bib_extends_levelofaccess = {NA}, author = {Mustap{\"a}{\"a}, T. and Nikander, P. and Hutzschenreuter, D. and Viitala, R.} } @Article { PfitznerUHLZSSHKMW2020, subid = {1800}, title = {Thermoelectric nanospectroscopy for the imaging of molecular fingerprints}, journal = {Nanophotonics}, year = {2020}, month = {8}, day = {21}, volume = {9}, number = {14}, number2 = {18HLT06: RaCHy: Radiotherapy coupled with hyperthermia - adapting the biological equivalent dose concept}, pages = {4347-4354}, keywords = {nanospectroscopy; photothermoelectric effect; s-SNOM}, web_url = {https://www.degruyter.com/view/journals/nanoph/ahead-of-print/article-10.1515-nanoph-2020-0316/article-10.1515-nanoph-2020-0316.xml?tab_body=fullHtml-79543}, misc2 = {EMPIR 2018: Health}, publisher = {Walter de Gruyter GmbH}, language = {30}, ISSN = {2192-8614, 2192-8606}, DOI = {10.1515/nanoph-2020-0316}, stag_bib_extends_levelofaccess = {NA}, author = {Pfitzner, E. and Ulrich, G. and Hoehl, A. and Liao, J-W. and Zadvorna, O. and Sirringhaus, H. and Schweicher, G. and Heberle, J. and K{\"a}stner, B. and Minutoli, D. and Wunderlich, J.} } @Article { CainSTLWKBLF2020, subid = {1615}, title = {In Situ Electric-Field Study of Surface Effects in Domain Engineered Pb(In1/2Nb1/2)O3-Pb(Mg1/3Nb2/3)O3-PbTiO3 Relaxor Crystals by Grazing Incidence Diffraction}, journal = {Crystals}, year = {2020}, month = {8}, day = {20}, volume = {10}, number = {9}, number2 = {16ENG06: ADVENT: Metrology for advanced energy-saving technology in next-generation electronics applications}, pages = {728}, keywords = {-}, web_url = {https://electrosciences.co.uk/2020/08/27/grazing_incidence/}, misc2 = {EMPIR 2016: Energy}, publisher = {MDPI AG}, language = {30}, ISSN = {2073-4352}, DOI = {10.3390/cryst10090728}, stag_bib_extends_levelofaccess = {NA}, author = {Cain, M.G. and Staruch, M. and Thompson, P. and Lucas, C. and Wermeille, D. and Kayser, Y. and Beckhoff, B. and Lofland, S.E. and Finkel, P.} } @Article { ClivatiABBDDMMMNLPRRSSSTC2020, subid = {1773}, title = {Common-clock very long baseline interferometry using a coherent optical fiber link}, journal = {Optica}, year = {2020}, month = {8}, day = {20}, volume = {7}, number = {8}, number2 = {18SIB06: TiFOON: Advanced time/frequency comparison and dissemination through optical telecommunication networks}, pages = {1031}, keywords = {fiber links, coherent phase transfer, frequency dissemination with fibers, VLBI}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {The Optical Society}, language = {30}, ISSN = {2334-2536}, DOI = {10.1364/OPTICA.393356}, stag_bib_extends_levelofaccess = {NA}, author = {Clivati, C. and Aiello, R. and Bianco, G. and Bortolotti, C. and De Natale, P. and Di Sarno, V. and Maddaloni, P. and Maccaferri, G. and Mura, A. and Negusini, M. and Levi, F. and Perini, F. and Ricci, R. and Roma, M. and Santamaria Amato, L. and Siciliani de Cumis, M. and Stagni, M. and Tuozzi, A. and Clivati, C.} } @Article { MullerSUT2020, subid = {1616}, title = {Determining nonuniformities of core‐shell nanoparticle coatings by analysis of the inelastic background of X‐ray photoelectron spectroscopy survey spectra}, journal = {Surface and Interface Analysis}, year = {2020}, month = {8}, day = {18}, volume = {1}, number = {1}, number2 = {17SIP03: ESCoShell: An ISO Technical Report on the use of Electron Spectroscopy for Measurement of Core-Shell Nanoparticle Shell Thicknesses}, pages = {1-1}, keywords = {XPS, core-shell nanoparticles}, misc2 = {EMPIR 2017: Support for Impact}, publisher = {Wiley}, language = {30}, ISSN = {0142-2421, 1096-9918}, DOI = {10.1002/sia.6865}, stag_bib_extends_levelofaccess = {NA}, author = {M{\"u}ller, A. and Sparnacci, K. and Unger, W.E.S. and Tougaard, S.} } @Article { Wright2020, subid = {1791}, title = {A Digital Heterodyne 2-150 kHz Measurement Method}, journal = {CPEM 2020}, year = {2020}, month = {8}, day = {18}, number2 = {18NRM05: SupraEMI: Grid measurements of 2 kHz - 150 kHz harmonics to support normative emission limits for mass-market electrical goods}, keywords = {Digital Filters, digital signal processing, electromagnetic compatibility and interference, power quality, quadrature amplitude modulation}, misc2 = {EMPIR 2018: Pre-Co-Normative}, language = {30}, DOI = {10.36227/techrxiv.13525592.v1}, stag_bib_extends_levelofaccess = {NA}, author = {Wright, P.S.} } @Article { SchinkePHWBKNW2020_2, subid = {1604}, title = {Calibrating spectrometers for measurements of the spectral irradiance caused by solar radiation}, journal = {Metrologia}, year = {2020}, month = {8}, day = {17}, number2 = {16ENG02: PV-Enerate: Advanced PV energy rating}, keywords = {spectral irradiance, solar radiation, measurement uncertainty analysis, spectrometer, spectroradiometer, calibration, solar simulator}, misc2 = {EMPIR 2016: Energy}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/abafc5}, stag_bib_extends_levelofaccess = {NA}, author = {Schinke, C. and Pollex, H. and Hinken, D. and Wolf, M. and Bothe, K. and Kroeger, I. and Nevas, S. and Winter, S.} } @Article { deKromBZEvvvvHvDCE2020, subid = {1994}, title = {Primary mercury gas standard for the calibration of mercury measurements}, journal = {Measurement}, year = {2020}, month = {8}, day = {16}, volume = {169}, number = {2021}, number2 = {16ENV01: MercOx: Metrology for oxidised mercury}, pages = {108351}, keywords = {Mercury, Metrology, Primary gas standard, Calibration, SI-traceability, Environmental}, misc2 = {EMPIR 2016: Environment}, publisher = {Elsevier}, language = {30}, ISSN = {0263-2241}, DOI = {10.1016/j.measurement.2020.108351}, stag_bib_extends_levelofaccess = {NA}, author = {de Krom, I. and Bavius, W. and Ziel, R. and Efremov, E. and van Meer, D. and van Otterloo, P. and van Andel, I. and van Osselen, D. and Heemskerk, M. and van der Veen, A.M.H. and Dexter, M.A. and Corns, W.T. and Ent, H.} } @Article { GomezCGSPHFPTMB2020, subid = {1698}, title = {Rapid three-dimensional multiparametric MRI with quantitative transient-state imaging}, journal = {Scientific Reports}, year = {2020}, month = {8}, day = {13}, volume = {10}, number = {1}, number2 = {18HLT05: QUIERO: Quantitative MR-based imaging of physical biomarkers}, keywords = {Magnetic Resonance Imaging (MRI)Quantitative MRIMagnetic Resonance Fingerprinting}, web_url = {https://www.nature.com/articles/s41598-020-70789-2}, misc2 = {EMPIR 2018: Health}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2045-2322}, DOI = {10.1038/s41598-020-70789-2}, stag_bib_extends_levelofaccess = {NA}, author = {G{\'o}mez, P.A. and Cencini, M. and Golbabaee, M. and Schulte, R.F. and Pirkl, C. and Horvath, I. and Fallo, G. and Peretti, L. and Tosetti, M. and Menze, B.H. and Buonincontri, G.} } @Article { KrehlikSB2020, subid = {1738}, title = {Electrical regeneration for long-haul fiber-optic time and frequency distribution systems}, journal = {Transactions on Ultrasonics, Ferroelectrics, and Frequency Control}, year = {2020}, month = {8}, day = {13}, number2 = {18SIB06: TiFOON: Advanced time/frequency comparison and dissemination through optical telecommunication networks}, keywords = {Time and frequency transfer, fiber optics, optical-electrical-optical regeneration}, web_url = {https://ieeexplore.ieee.org/document/9166557}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IEEE}, language = {30}, DOI = {10.1109/TUFFC.2020.3016610}, stag_bib_extends_levelofaccess = {NA}, author = {Krehlik, P. and Śliwczyński, Ł. and Buczek, Ł.} } @Article { SchwarzDABLSWRLL2020, subid = {1570}, title = {Long term measurement of the 87Sr clock frequency at the limit of primary Cs clocks}, journal = {Physical Review Research}, year = {2020}, month = {8}, day = {11}, volume = {2}, number = {3}, number2 = {18SIB05: ROCIT: Robust Optical Clocks for International Timescales}, pages = {033242}, keywords = {Atomic spectra, optical clocks, gravitation}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {American Physical Society (APS)}, address = {Ricklinger Stadtweg 4c}, language = {30}, DOI = {10.1103/PhysRevResearch.2.033242}, stag_bib_extends_levelofaccess = {NA}, author = {Schwarz, R and D{\"o}rscher, S and Al-Masoud, A and Benkler, E and Legero, T and Sterr, U and Weyers, S and Rahm, J and Lipphardt, B and Lisdat, C} } @Article { NiemeierT2020, subid = {1585}, title = {Stochastic Properties of Confidence Ellipsoids after Least Squares Adjustment, Derived from GUM Analysis and Monte Carlo Simulations}, journal = {Mathematics}, year = {2020}, month = {8}, volume = {8}, number = {8}, number2 = {SIB60: Surveying: Metrology for long distance surveying}, pages = {1318}, keywords = {GUM analysis, geodetic network adjustment, stochastic properties, random number generator, Monte Carlo simulation}, misc2 = {EMRP A169: Call 2012 SI Broader scope (II)}, publisher = {MDPI AG}, language = {30}, ISSN = {2227-7390}, DOI = {10.3390/math8081318}, stag_bib_extends_levelofaccess = {NA}, author = {Niemeier, Wolfgang and Tengen, Dieter} } @Article { GarberoglioH2020, subid = {1594}, title = {Path-Integral Calculation of the Second Dielectric and Refractivity Virial Coefficients of Helium, Neon, and Argon}, journal = {Journal of Research of the National Institute of Standards and Technology}, year = {2020}, month = {8}, volume = {125}, number2 = {18SIB04: QuantumPascal: Towards quantum-based realisations of the pascal}, keywords = {second dielectric virial coefficient, helium, neon, argon, path integral}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {National Institute of Standards and Technology (NIST)}, language = {30}, ISSN = {2165-7254}, DOI = {10.6028/jres.125.022}, stag_bib_extends_levelofaccess = {NA}, author = {Garberoglio, G. and Harvey, A.H.} } @Proceedings { KazemipourHWAHRSZ2020, subid = {1663}, title = {VNA-Based Material Characterization in THz Domain without Classic Calibration and Time-Gating}, journal = {2020 Conference on Precision Electromagnetic Measurements (CPEM)}, year = {2020}, month = {8}, volume = {N/A}, number = {N/A}, number2 = {18SIB09: TEMMT: Traceability for electrical measurements at millimetre-wave and terahertz frequencies for communications and electronics technologies}, pages = {1-2}, keywords = {Material characterization, parameter extraction, VNA time-gating, RF metrology, measurement uncertainty}, web_url = {https://doi.org/10.5281/zenodo.4243044}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IEEE}, event_place = {Denver, CO, USA}, event_name = {2020 Conference on Precision Electromagnetic Measurements (CPEM)}, event_date = {24-08-2020 to 28-08-2020}, language = {30}, ISBN = {978-1-7281-5898-3}, ISSN = {2160-0171}, DOI = {10.1109/CPEM49742.2020.9191818}, stag_bib_extends_levelofaccess = {NA}, author = {Kazemipour, A. and Hoffmann, J. and Wollensack, M. and Allal, D. and Hudlicka, M. and Ruefenacht, J. and Stalder, D. and Zeier, M.} } @Article { WeimerSMT2020, subid = {1687}, title = {Energy localization in an atomic chain with a topological soliton}, journal = {Physical Review Research}, year = {2020}, month = {8}, volume = {2}, number = {3}, number2 = {17FUN07: CC4C: Coulomb Crystals for Clocks}, keywords = {cold atoms, ion trapping, soliton, localization}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2643-1564}, DOI = {10.1103/PhysRevResearch.2.033198}, stag_bib_extends_levelofaccess = {NA}, author = {Weimer, H. and Santos, L. and Mehlst{\"a}ubler, T. E. and Timm, L.} } @Proceedings { CrottiFGGLLL2020, subid = {1726}, title = {Traceable Characterization of Low Power Voltage Instrument Transformers for PQ and PMU Applications}, journal = {2020 Conference on Precision Electromagnetic Measurements (CPEM)}, year = {2020}, month = {8}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, keywords = {Low power instrument transformer, power grid, power quality, phasor measurement unit, uncertainty}, tags = {SEG}, misc2 = {EMPIR 2017: Industry}, publisher = {IEEE}, event_place = {Denver (Aurora), CO, USA, USA}, event_name = {2020 Conference on Precision Electromagnetic Measurements (CPEM)}, event_date = {24-08-2020 to 28-08-2020}, language = {30}, DOI = {10.5281/zenodo.4153819}, stag_bib_extends_levelofaccess = {NA}, author = {Crotti, G. and Femine, A.D. and Gallo, D. and Giordano, D. and Landi, C. and Letizia, P.S. and Letizia, P.} } @Article { MauryADdBM2020, subid = {1818}, title = {Hydrogen refuelling station calibration with a traceable gravimetric standard}, journal = {Flow Measurement and Instrumentation}, year = {2020}, month = {8}, volume = {74}, number2 = {16ENG01: MetroHyVe: Metrology for hydrogen vehicles}, pages = {101743}, keywords = {Refuelling station; Hydrogen; Primary standard; Uncertainties; High pressure}, tags = {EnG}, misc2 = {EMPIR 2016: Energy}, publisher = {Elsevier BV}, language = {30}, ISSN = {0955-5986}, DOI = {10.1016/j.flowmeasinst.2020.101743}, stag_bib_extends_levelofaccess = {NA}, author = {Maury, R. and Auclercq, C. and Devilliers, C. and de Huu, M. and B{\"u}ker, O. and MacDonald, M.} } @Proceedings { vandenBromGGWG2020, subid = {1941}, title = {Accurate Measurement of Energy Dissipated in Braking Rheostats in DC Railway Systems}, journal = {2020 Conference on Precision Electromagnetic Measurements (CPEM)}, year = {2020}, month = {8}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, keywords = {Current measurement, energy measurement, rail transportation, transducers, measurement uncertainty}, web_url = {https://www.techrxiv.org/articles/preprint/Accurate_Measurement_of_Energy_Dissipated_in_Braking_Rheostats_in_DC_Railway_Systems/13469739/1}, misc2 = {EMPIR 2016: Energy}, publisher = {IEEE}, event_place = {Denver, CO, USA}, event_name = {Conference on Precision Electromagnetic Measurements (CPEM)}, event_date = {24-08-2020 to 28-08-2020}, language = {30}, ISBN = {978-1-7281-5899-0}, ISSN = {2160-0171}, DOI = {10.1109/CPEM49742.2020.9191917}, stag_bib_extends_levelofaccess = {NA}, author = {van den Brom, Helko and Giordano, Domenico and Gallo, Danielle and Wank, Andreas and Giordano, Domenico} } @Article { SignorinoGMGFBQDB2020, subid = {1935}, title = {Dataset of measured and commented pantograph electric arcs in DC railways}, journal = {Data in Brief}, year = {2020}, month = {8}, volume = {31}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, pages = {105978}, keywords = {Electric arcMeasurement of electrical quantitiesPantographPower qualityRailwaysRolling stock}, misc2 = {EMPIR 2016: Energy}, publisher = {Elsevier BV}, language = {30}, ISSN = {2352-3409}, DOI = {10.1016/j.dib.2020.105978}, stag_bib_extends_levelofaccess = {NA}, author = {Signorino, D. and Giordano, D. and Mariscotti, A. and Gallo, D. and Femine, A.D. and Balic, F. and Quintana, J. and Donadio, L. and Biancucci, A.} } @Proceedings { vandenBromv2020, subid = {1942}, title = {Calibrating Sensors to Measure Braking Chopper Currents in DC Traction Units}, journal = {2020 Conference on Precision Electromagnetic Measurements (CPEM)}, year = {2020}, month = {8}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, keywords = {Current measurement, measurement standards, measurement techniques, precision measurements, transducers}, web_url = {https://www.techrxiv.org/articles/preprint/Calibrating_Sensors_to_Measure_Braking_Chopper_Currents_in_DC_Traction_Units/13469679}, misc2 = {EMPIR 2016: Energy}, publisher = {IEEE}, event_place = {Denver, CO, USA}, event_name = {Conference on Precision Electromagnetic Measurements (CPEM)}, event_date = {24-08-2020 to 28-08-2020}, language = {30}, ISBN = {978-1-7281-5898-3}, ISSN = {2160-0171}, DOI = {10.1109/CPEM49742.2020.9191822}, stag_bib_extends_levelofaccess = {NA}, author = {van den Brom, H. and van Leeuwen, R.} } @Proceedings { vanLeeuwenvRHH2020, subid = {1943}, title = {Measuring the Voltage Dependence of Current Transformers}, journal = {2020 Conference on Precision Electromagnetic Measurements (CPEM)}, year = {2020}, month = {8}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, keywords = {Current measurement, current transformers, measurement standards, precision measurements}, tags = {SEG}, web_url = {https://www.techrxiv.org/articles/preprint/Measuring_the_Voltage_Dependence_of_Current_Transformers/13469673/1}, misc2 = {EMPIR 2016: Energy}, publisher = {IEEE}, event_place = {Denver, CO, USA}, event_name = {Conference on Precision Electromagnetic Measurements (CPEM)}, event_date = {24-08-2020 to 28-08-2020}, language = {30}, ISBN = {978-1-7281-5898-3}, ISSN = {2160-0171}, DOI = {10.1109/CPEM49742.2020.9191845}, stag_bib_extends_levelofaccess = {NA}, author = {van Leeuwen, R. and van den Brom, H. and Rietveld, G. and Houtzager, E. and Hoogenboom, D.} } @Proceedings { vanVeghelSvHRvMK2020, subid = {2103}, title = {Towards improved standardization of electricity meter testing}, journal = {2020 Conference on Precision Electromagnetic Measurements (CPEM)}, year = {2020}, month = {8}, number2 = {17NRM02: MeterEMI: Electromagnetic Interference on Static Electricity Meters}, keywords = {Energy measurement,electromagnetic compatibility,measurement errors,electricity meters}, tags = {SEG}, web_url = {https://www.techrxiv.org/articles/preprint/Towards_improved_standardization_of_electricity_meter_testing/13469622/1}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {IEEE}, event_place = {Bolder}, event_name = {Conference of Precession Electromagnetic MeasurementsPEM}, event_date = {01-08-2020 to 07-08-2020}, language = {30}, DOI = {10.1109/CPEM49742.2020.9191719}, stag_bib_extends_levelofaccess = {NA}, author = {van Veghel, M.G.A. and Sharma, S. and van den Brom, H.E. and Hoogenboom, D. and Rietveld, G. and van Leeuwen, R. and Marais, Z. and Kok, G.J.P.} } @Article { RuutelYKSIDHHTBL2020, subid = {2185}, title = {Design, synthesis and application of carbazole macrocycles in anion sensors}, journal = {Beilstein Journal of Organic Chemistry}, year = {2020}, month = {8}, volume = {16}, number = {2020}, number2 = {17FUN09: UnipHied: Realisation of a Unified pH Scale}, pages = {1901-1914}, keywords = {anion sensors; carboxylates;ionophores; acrocycles; sensor prototype}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Beilstein Institut}, language = {30}, ISSN = {1860-5397}, DOI = {10.3762/bjoc.16.157}, stag_bib_extends_levelofaccess = {NA}, author = {R{\"u}{\"u}tel, A. and Yrj{\"a}n{\"a}, V. and Kadam, S.A. and Saar, I. and Ilisson, M. and Darnell, A. and Haav, K. and Haljasorg, T. and Toom, L. and Bobacka, J. and Leito, I.} } @Proceedings { RietveldZY2020, subid = {2534}, title = {Verification of High Voltage Divider with 10E-6 Uncertainty}, journal = {2020 Conference on Precision Electromagnetic Measurements (CPEM)}, year = {2020}, month = {8}, number2 = {17NRM01: TrafoLoss: Loss Measurements on Power Transformers and Reactors}, keywords = {voltage divider, calibration, high voltage, voltage transformer, uncertainty, loss measurement, power transformer}, tags = {SEG}, web_url = {https://zenodo.org/record/5997015}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {IEEE}, event_place = {Denver, CO, USA}, event_name = {2020 Conference on Precision Electromagnetic Measurements}, event_date = {24-08-2020 to 28-08-2020}, language = {30}, ISSN = {2160-0171}, DOI = {10.1109/CPEM49742.2020.9191889}, stag_bib_extends_levelofaccess = {NA}, author = {Rietveld, G. and Zhao, W. and Ye, G.} } @Miscellaneous { PennecchiRSEv, subid = {1553}, title = {EMUE-D3-2-Low Mass BaP Evaluation}, year = {2020}, month = {7}, day = {31}, number2 = {17NRM05: EMUE: Advancing measurement uncertainty - comprehensive examples for key international standards}, keywords = {Uncertainty evaluation; Monte Carlo method; GUM uncertainty framework;Benzo[a]pyrene; Polycyclic Aromatic Hydrocarbons}, misc2 = {EMPIR 2017: Pre-Co-Normative}, language = {30}, DOI = {10.5281/zenodo.3968940}, stag_bib_extends_levelofaccess = {NA}, author = {Pennecchi, F. and Rolle, F. and Sega, M. and Ellison, S.L.R. and van der Veen, A.M.H.} } @Article { PeiPBL2020, subid = {1892}, title = {Uncertainty quantification in the design of wireless power transfer systems}, journal = {Open Physics}, year = {2020}, month = {7}, day = {30}, volume = {18}, number = {1}, number2 = {16ENG08: MICEV: Metrology for inductive charging of electric vehicles}, pages = {391-396}, keywords = {EMC, wireless transfer, uncertainty quantification, shielding, efficiency}, web_url = {https://www.degruyter.com/document/doi/10.1515/phys-2020-0174/html}, misc2 = {EMPIR 2016: Energy}, publisher = {Walter de Gruyter GmbH}, language = {30}, ISSN = {2391-5471}, DOI = {10.1515/phys-2020-0174}, stag_bib_extends_levelofaccess = {NA}, author = {Pei, Y. and Pichon, L. and Bensetti, M. and Le-Bihan, Y.} } @Article { BatistaGMMR2020, subid = {1571}, title = {Development of an experimental setup for microflow measurement using interferometry}, journal = {Flow measurement instrumentation}, year = {2020}, month = {7}, day = {29}, volume = {75}, number2 = {18HLT08: MEDDII: Metrology for drug delivery}, pages = {101789}, keywords = {Microflow measurement, Interferometry, Calibration, Measurement uncertainty}, misc2 = {EMPIR 2018: Health}, publisher = {Elsevier}, language = {30}, DOI = {10.1016/j.flowmeasinst.2020.101789}, stag_bib_extends_levelofaccess = {NA}, author = {Batista, Elsa and Godinho, Isabel and Martins, Rui and Mendes, Ricardo and Robarts, Jo{\~a}o} } @Article { BiguriLBTDBMDHB2020, subid = {1885}, title = {Arbitrarily large iterative tomographic reconstruction on multiple GPUs using the TIGRE toolbox}, journal = {Journal of Parallel and Distributed Computing}, year = {2020}, month = {7}, day = {29}, volume = {146}, number = {2020}, number2 = {17IND08: AdvanCT: Advanced Computed Tomography for dimensional and surface measurements in industry}, pages = {52-63}, keywords = {Computed Tomography, multi GPU computing, iterative reconstruction}, misc2 = {EMPIR 2017: Industry}, publisher = {Elsevier}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://arxiv.org/abs/1905.03748}, author = {Biguri, A. and Lindroos, R. and Bryll, R. and Towsyfyan, H. and Deyhle, H. and Boardman, R. and Mavrogordato, M. and Dosanjh, M. and Hancock, S. and Blumensath, T.} } @Article { ShuVZAF2020, subid = {1544}, title = {Experimental and Modeling Studies on the Correlation Between Auto-Ignition Delays and the Methane Number of Liquefied Natural Gas (LNG) and Liquefied Biogas (LBG)}, journal = {Frontiers in Mechanical Engineering}, year = {2020}, month = {7}, day = {24}, volume = {6}, number2 = {16ENG09: LNG III: Metrological support for LNG and LBG as transport fuel}, keywords = {liquefied natural gas, liquefied biogas, rapid compression machine, auto-ignition delays, chemical kinetics, modeling, shock tube}, tags = {EnG}, misc2 = {EMPIR 2016: Energy}, publisher = {Frontiers Media SA}, language = {30}, ISSN = {2297-3079}, DOI = {10.3389/fmech.2020.00047}, stag_bib_extends_levelofaccess = {NA}, author = {Shu, B. and Vallabhuni, S.K. and Zheng, J. and Agarwal, S. and Fernandes, R.X.} } @Article { KazemipourWHHYRSGZ2020, subid = {1603}, title = {Analytical Uncertainty Evaluation of Material Parameter Measurements at THz Frequencies}, journal = {Journal of Infrared, Millimeter, and Terahertz Waves}, year = {2020}, month = {7}, day = {24}, volume = {41}, number = {10}, number2 = {18SIB09: TEMMT: Traceability for electrical measurements at millimetre-wave and terahertz frequencies for communications and electronics technologies}, pages = {1199 - 1217}, keywords = {Material characterization, Extraction method, THz domain, Sensitivity coefficient, Measurement uncertainty, RF metrology}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {1866-6892, 1866-6906}, DOI = {10.1007/s10762-020-00723-0}, stag_bib_extends_levelofaccess = {NA}, author = {Kazemipour, A. and Wollensack, M. and Hoffmann, J. and Hudlicka, M. and Yee, S-K. and R{\"u}fenacht, J. and Stalder, D. and G{\"a}umann, G. and Zeier, M.} } @Article { LiuACA2020, subid = {1608}, title = {Reply to “Comment on Liu et al. ‘Discrepancies of Measured SAR between Traditional and Fast Measuring Systems’ Int. J. Environ. Res. Public Health, 2020, 17, 2111”}, journal = {International Journal of Environmental Research and Public Health}, year = {2020}, month = {7}, day = {24}, volume = {17}, number = {15}, number2 = {16NRM07: Vector SAR: SAR measurement using vector probes}, pages = {5355}, keywords = {specific absorption rate; fast SAR measurement; field reconstruction; plane-wave expansion; traditional SAR measurement; measurement discrepancy}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {MDPI AG}, language = {30}, ISSN = {1660-4601}, DOI = {10.3390/ijerph17155355}, stag_bib_extends_levelofaccess = {NA}, author = {Liu, Z. and Allal, D. and Cox, M. and Allal, D.} } @Article { ivkoviBKJH2020, subid = {2030}, title = {Traceable Determination of Atmospheric Mercury Using Iodinated Activated Carbon Traps}, journal = {Atmosphere}, year = {2020}, month = {7}, day = {24}, volume = {11}, number = {8}, number2 = {16ENV01: MercOx: Metrology for oxidised mercury}, pages = {780}, keywords = {Mercury, sorbent traps, atmosphere, traceability}, misc2 = {EMPIR 2016: Environment}, publisher = {MDPI AG}, language = {30}, ISSN = {2073-4433}, DOI = {10.3390/atmos11080780}, stag_bib_extends_levelofaccess = {NA}, author = {Živković, I. and Berisha, S. and Kotnik, J. and Jagodic, M. and Horvat, Milena} } @Article { FerreroBCRFM2020, subid = {1858}, title = {Goniochromatic assessment of gray scales for color change}, journal = {Journal of the Optical Society of America A}, year = {2020}, month = {7}, day = {22}, volume = {37}, number = {8}, number2 = {IND52: xDReflect: Multidimensional reflectometry for industry}, pages = {1266}, keywords = {Color, gray scale, goniochromatism}, web_url = {https://digital.csic.es/bitstream/10261/227636/1/Goniochromatic\%20assessment.pdf}, misc2 = {EMRP A169: Call 2012 Metrology for Industry (II)}, publisher = {The Optical Society}, language = {30}, ISSN = {1084-7529, 1520-8532}, DOI = {10.1364/JOSAA.394170}, stag_bib_extends_levelofaccess = {NA}, author = {Ferrero, A. and Bernad, B. and Campos, J. and Richard, N. and Fern{\'a}ndez-Maloigne, C. and Melgosa, M.} } @Article { MayerBTOPAGMIMSK2020, subid = {1600}, title = {Flexible numerical simulation framework for dynamic PET-MR data}, journal = {Physics in Medicine \& Biology}, year = {2020}, month = {7}, day = {21}, volume = {65}, number = {14}, number2 = {18HLT05: QUIERO: Quantitative MR-based imaging of physical biomarkers}, pages = {145003}, keywords = {PET-MR,motion correction,simulation,image registration,open source}, misc2 = {EMPIR 2018: Health}, publisher = {IOP Publishing}, language = {30}, ISSN = {1361-6560}, DOI = {10.1088/1361-6560/ab7eee}, stag_bib_extends_levelofaccess = {NA}, author = {Mayer, J. and Brown, R. and Thielemans, K. and Ovtchinnikov, E. and Pasca, E. and Atkinson, D. and Gillman, A. and Marsden, P. and Ippoliti, M. and Makowski, M. and Schaeffter, T. and Kolbitsch, C.} } @Article { BodermannBZMKSDHDK2020, subid = {1559}, title = {Quasi-bound states in the continuum for deep subwavelength structural information retrieval for DUV nano-optical polarizers}, journal = {Optics Express}, year = {2020}, month = {7}, day = {20}, volume = {28}, number = {16}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {23122}, keywords = {quasi-bound states}, misc2 = {EMPIR 2017: Fundamental}, publisher = {The Optical Society}, language = {30}, ISSN = {1094-4087}, DOI = {10.1364/OE.396044}, stag_bib_extends_levelofaccess = {NA}, author = {Bodermann, B. and Burger, S. and Zeitner, U. and Meyer, J. and K{\"a}seberg, T. and Siefke, T. and Dickmann, W. and Hurtado, C.B.R. and Dickmann, J. and Kroker, S.} } @Miscellaneous { CoxS, subid = {1538}, title = {EMUE-D1-4-Key Comparison Gauge Blocks}, year = {2020}, month = {7}, day = {16}, number2 = {17NRM05: EMUE: Advancing measurement uncertainty - comprehensive examples for key international standards}, keywords = {Key comparison, calibration and measurement capability (CMC), measurement uncertainty, Bayesian estimation}, misc2 = {EMPIR 2017: Pre-Co-Normative}, language = {30}, DOI = {10.5281/zenodo.3948342}, stag_bib_extends_levelofaccess = {NA}, author = {Cox, M. and Shirono, K.} } @Article { FretwellLBKDLMPRSF2020, subid = {1539}, title = {Direct Measurement of the 7Be L/K Capture Ratio in Ta-Based Superconducting Tunnel Junctions}, journal = {Physical Review Letters}, year = {2020}, month = {7}, day = {14}, volume = {125}, number = {3}, number2 = {17FUN02: MetroMMC: Measurement of fundamental nuclear decay data using metallic magnetic calorimeters}, pages = {032701}, keywords = {7Be, Electron captures, Cryogenic detectors, Theoretical calculations}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {0031-9007, 1079-7114}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://arxiv.org/abs/2003.04921}, author = {Fretwell, S. and Leach, K.G. and Bray, C. and Kim, G.B. and Dilling, J. and Lennarz, A. and Mougeot, X. and Ponce, F. and Ruiz, C. and Stackhouse, J. and Friedrich, S.} } @Thesis { Vadlejch2020, subid = {1720}, title = {Characterization of micro-motion and its influence on systematic frequency shifts of quadrupole transition of Calcium ion trapped in Paul trap}, year = {2020}, month = {7}, day = {14}, number2 = {17FUN07: CC4C: Coulomb Crystals for Clocks}, keywords = {motional systematic frequency shifts, quadrupole transition of calcium ion, micromotion, minimization of micromotion, detection of micromotion, photon-correlation method, linear Paul ion trap}, web_url = {https://dspace.vutbr.cz/xmlui/handle/11012/192380}, misc2 = {EMPIR 2017: Fundamental}, school = {Brno University of Technology}, language = {27}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {http://hdl.handle.net/11012/192380}, author = {Vadlejch, D.} } @Thesis { Grim2020, subid = {1721}, title = {Spectroscopy of a photoionization transition of neutral Calcium atom emitted by laser ablation}, year = {2020}, month = {7}, day = {14}, number2 = {17FUN07: CC4C: Coulomb Crystals for Clocks}, keywords = {This thesis is focused on generating of calcium atoms using laser ablation, which is modern technique for obtaining particles into ion traps. The efficiency of ablation of these atoms was observed. Furthermore, it is focused on the absorption spectrum of the neutral calcium atom, it is the first transition of calcium in two-step photo ionization. Part of the work is the design of experimental settings, which is used for measurement.}, web_url = {https://dspace.vutbr.cz/xmlui/handle/11012/192381}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Brno University of Technology Digital Library}, school = {Brno University of Technology}, language = {27}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {http://hdl.handle.net/11012/192381}, author = {Grim, J.} } @Article { CalderonFC2020, subid = {1779}, title = {Accounting for polarization–related effects in the measurement of the bidirectional reflectance distribution function}, journal = {Metrologia}, year = {2020}, month = {7}, day = {13}, volume = {57}, number = {4}, number2 = {18SIB03: BxDiff: New quantities for the measurement of appearance}, pages = {045003}, keywords = {BRDF, polarization, reflectance.}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/ab804f}, stag_bib_extends_levelofaccess = {NA}, author = {Calder{\'o}n, A. and Ferrero, A. and Campos, J.} } @Article { AlKhafajiGWBV2020, subid = {1714}, title = {Particle Size Distribution of Bimodal Silica Nanoparticles: A Comparison of Different Measurement Techniques}, journal = {Materials}, year = {2020}, month = {7}, day = {11}, volume = {13}, number = {14}, number2 = {18HLT01: METVES II: Standardisation of concentration measurements of extracellular vesicles for medical diagnoses}, pages = {3101}, keywords = {silica nanoparticle; size distribution; light scattering; small-angle X-ray scattering; microfluidic resistive pulse sensing}, misc2 = {EMPIR 2018: Health}, publisher = {MDPI AG}, language = {30}, ISSN = {1996-1944}, DOI = {10.3390/ma13143101}, stag_bib_extends_levelofaccess = {NA}, author = {Al-Khafaji, M.A. and Ga{\'a}l, A. and Wacha, A. and B{\'o}ta, A. and Varga, Z.} } @Article { MengPDU2006, subid = {1592}, title = {Superresolution effect due to a thin dielectric slab for imaging with radially polarized light}, journal = {Optics Express}, year = {2020}, month = {7}, day = {6}, volume = {28}, number = {14}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {20660-20668}, keywords = {super resolution, radial polarization}, web_url = {https://www.osapublishing.org/oe/abstract.cfm?uri=oe-28-14-20660}, misc2 = {EMPIR 2017: Fundamental}, publisher = {OSA}, language = {30}, DOI = {10.1364/OE.390602}, stag_bib_extends_levelofaccess = {NA}, author = {Meng, P. and Pereira, S.F. and Dou, X. and Urbach, H.P.} } @Article { WuHRSW2020, subid = {1516}, title = {Characterization of Dielectric Materials at WR-15 Band (50–75 GHz) Using VNA-Based Technique}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2020}, month = {7}, volume = {69}, number = {7}, number2 = {18SIB09: TEMMT: Traceability for electrical measurements at millimetre-wave and terahertz frequencies for communications and electronics technologies}, pages = {4930-4939}, keywords = {Dielectric constant, dielectric measurements, free-space measurement, loss tangent, millimeter-wave measurements, vector network analyzer (VNA)}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9456, 1557-9662}, DOI = {10.1109/TIM.2019.2954010}, stag_bib_extends_levelofaccess = {NA}, author = {Wang, Y. and Shang, X. and Ridler, N.M. and Huang, T. and Wu, W.} } @Article { IttermannSHPPSW2020, subid = {1535}, title = {Parallel transmission medical implant safety testbed: Real‐time mitigation of RF induced tip heating using time‐domain E‐field sensors}, journal = {Magnetic Resonance in Medicine}, year = {2020}, month = {7}, number2 = {17IND01: MIMAS: Procedures allowing medical implant manufacturers to demonstrate compliance with MRI safety regulations}, keywords = {implant safety, MR safety, interventional MRI, open source Hardware, orthogonal projection, parallel transmission}, misc2 = {EMPIR 2017: Industry}, publisher = {Wiley}, language = {30}, ISSN = {0740-3194, 1522-2594}, DOI = {10.1002/mrm.28379}, stag_bib_extends_levelofaccess = {NA}, author = {Winter, L. and Silemek, B. and Petzold, J. and Pfeiffer, H. and Hoffmann, W. and Seifert, F. and Ittermann, B.} } @Manual { SchonhalsHMHYS2020, subid = {1536}, title = {Good practice guides SmartCom validation}, year = {2020}, month = {7}, number2 = {17IND02: SmartCom: Communication and validation of smart data in IoT-networks}, keywords = {D-SI validation, DCC validation, SmartCom, TraCIM system, online validation, data exchange format, metrology data}, web_url = {https://zenodo.org/record/3816696}, misc2 = {EMPIR 2017: Industry}, publisher = {SmartCom}, language = {30}, DOI = {10.5281/zenodo.3816696}, stag_bib_extends_levelofaccess = {NA}, author = {Sch{\"o}nhals, S. and Hutzschenreuther, D. and Muller, B. and Heindorf, L. and Yuhui, L. and Smith, I.} } @Article { HeeringSCANNQRBBNSLLURVSDRKL2020, subid = {1554}, title = {Symmetric Potentiometric Cells for the Measurement of Unified pH Values}, journal = {Symmetry}, year = {2020}, month = {7}, volume = {12}, number = {7}, number2 = {17FUN09: UnipHied: Realisation of a Unified pH Scale}, pages = {1150}, keywords = {unified pH scale, pHabs, all solvents, differential potentiometry, liquid junction, ionic liquid}, misc2 = {EMPIR 2017: Fundamental}, publisher = {MDPI AG}, language = {30}, ISSN = {2073-8994}, DOI = {10.3390/sym12071150}, stag_bib_extends_levelofaccess = {NA}, author = {Heering, Agnes and Stoica, Daniela and Cam{\~o}es, Filomena and Anes, B{\'a}rbara and Nagy, D{\'a}niel and Nagyn{\'e} Szil{\'a}gyi, Zs{\'o}fia and Quendera, Raquel and Ribeiro, Luis and Bastkowski, Frank and Born, Rasmus and Nerut, Jaak and Saame, Jaan and Lainela, Silvie and Liv, Lokman and Uysal, Emrah and Rozikov{\'a}, Matilda and Vičarov{\'a}, Martina and Snedden, Alan and Deleebeeck, Lisa and Radtke, Valentin and Krossing, Ingo and Leito, Ivo} } @Article { FahrbachFCP2020, subid = {1651}, title = {Calibrating a high-speed contact-resonance profilometer}, journal = {Journal of Sensors and Sensor Systems}, year = {2020}, month = {7}, volume = {9}, number = {2}, number2 = {17IND05: MicroProbes: Multifunctional ultrafast microprobes for on-the-machine measurements}, pages = {179-187}, keywords = {piezoresistive microprobes, AFM}, web_url = {https://jsss.copernicus.org/articles/9/179/2020/\#section11}, misc2 = {EMPIR 2017: Industry}, publisher = {Copernicus GmbH}, language = {30}, ISSN = {2194-878X}, DOI = {10.5194/jsss-9-179-2020}, stag_bib_extends_levelofaccess = {NA}, author = {Fahrbach, M. and Friedrich, S. and Cappella, B. and Peiner, E.} } @Proceedings { DorstE2020, subid = {1711}, title = {Propagation of uncertainty for an Adaptive Linear Approximation algorithm}, journal = {AMA SMSI 2020}, year = {2020}, month = {7}, volume = {E2 Future}, number = {2020}, number2 = {17IND12: Met4FoF: Metrology for the Factory of the Future}, pages = {366 - 367}, keywords = {EMPIR. European Union (EU), Horizon 2020, machine learning, uncertainty, GUM, sensor network}, web_url = {https://www.ama-science.org/proceedings/details/3801}, misc2 = {EMPIR 2017: Industry}, publisher = {AMA}, address = {Wunstorf}, event_place = {virtual}, event_name = {SMSI 2020}, event_date = {21-06-2020 to 24-06-2020}, language = {30}, ISBN = {978-3-9819376-2-6}, ISSN = {none}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://doi.org/10.5162/SMSI2020/E2.3}, author = {Dorst, T. and Eichs{\"a}dt, S.} } @Article { LindgrenBRLGBIM2020, subid = {1856}, title = {Review of road surface photometry methods and devices – Proposal for new measurement geometries}, journal = {Lighting REsearch and technology}, year = {2020}, month = {7}, number = {1}, number2 = {16NRM02: SURFACE: Pavement surface characterisation for smart and efficient road lighting}, pages = {1-17}, keywords = {SURFACE, road surface, asphalt, luminance coefficient, measurement geometries}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {SAGE}, language = {30}, ISSN = {1477-0938}, DOI = {10.1177/1477153520958454}, stag_bib_extends_levelofaccess = {NA}, author = {Lindgren, M. and Blattner, P. and Reber, J. and Liandrat, S. and GREFFIER, F. and Bernasconi, J. and Iacomussi, P. and Muzet, V.} } @Proceedings { DijkstraHML2020, subid = {2090}, title = {An AC Controlled-Current Load for Controllable Waveform Parameters to Quantify Static Energy Meter Errors}, journal = {2020 IEEE International Symposium on Electromagnetic Compatibility \& Signal/Power Integrity (EMCSI)}, year = {2020}, month = {7}, number2 = {17NRM02: MeterEMI: Electromagnetic Interference on Static Electricity Meters}, keywords = {Static Meter, Energy Meter, Controlled-Current, AC Load, Waveform Parameters}, web_url = {https://research.utwente.nl/en/publications/an-ac-controlled-current-load-for-controllable-waveform-parameter}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {IEEE}, event_place = {Reno, NV, USA}, event_name = {2020 IEEE International Symposium on Electromagnetic Compatibility \& Signal/Power Integrity (EMCSI)}, event_date = {28-07-2020 to 28-08-2020}, language = {30}, DOI = {10.1109/EMCSI38923.2020.9191617}, stag_bib_extends_levelofaccess = {NA}, author = {Dijkstra, J. and Hartman, T. and Moonen, N. and Leferink, F.} } @Proceedings { tenHaveML2020, subid = {2084}, title = {On-Site Efficiency Analysis of a Generator in the Millisecond Range}, journal = {2020 IEEE International Symposium on Electromagnetic Compatibility \& Signal/Power Integrity (EMCSI)}, year = {2020}, month = {7}, number2 = {17NRM02: MeterEMI: Electromagnetic Interference on Static Electricity Meters}, pages = {209-212}, keywords = {Efficiency, Generator, Non-linear loads, Power Quality, Time-domain measurements}, web_url = {https://research.utwente.nl/en/publications/on-site-efficiency-analysis-of-a-generator-in-the-millisecond-ran}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {IEEE}, event_place = {Reno, NV, USA}, event_name = {2020 IEEE International Symposium on Electromagnetic Compatibility \& Signal/Power Integrity (EMCSI)}, event_date = {28-07-2020 to 28-08-2020}, language = {30}, DOI = {10.1109/EMCSI38923.2020.9191607}, stag_bib_extends_levelofaccess = {NA}, author = {ten Have, B. and Moonen, N. and Leferink, F.} } @Article { DrAmatoVMLFP2020, subid = {2116}, title = {Optical detection of ammonia inside a stack: Comparison of different techniques}, journal = {Measurement}, year = {2020}, month = {7}, volume = {159}, number2 = {16ENV08: IMPRESS 2: Metrology for air pollutant emissions}, pages = {107746}, keywords = {Ammonia was measured as a target gas in an artificial stack; Optical detection techniques exhibit different resilience to absorption lineshapes; Target gas absorption widths are sensitive to the concentrations of water and CO2; Direct absorption and derivative detection were compared with respect to calibration; An optical multipass cell was used, completely inside an artificial stack at 140 \(^{\circ}\)C.}, web_url = {https://www.sciencedirect.com/science/article/pii/S0263224120302840?via\%3Dihub}, misc2 = {EMPIR 2016: Environment}, publisher = {Elsevier BV}, language = {30}, ISSN = {0263-2241}, DOI = {10.1016/j.measurement.2020.107746}, stag_bib_extends_levelofaccess = {NA}, author = {D’Amato, F. and Viciani, S. and Montori, A. and Lapini, A. and Fraboulet, I. and Poulleau, J.} } @Article { BogoalecKosirCKGZM2020, subid = {2145}, title = {Digital PCR method for detection and quantification of specific antimicrobial drug-resistance mutations in human cytomegalovirus}, journal = {Journal of Virological Methods}, year = {2020}, month = {7}, volume = {281}, number = {/}, number2 = {15HLT07: AntiMicroResist: Novel materials and methods for the detection, traceable monitoring and evaluation of antimicrobial resistance}, pages = {113864}, keywords = {Digital PCR, Antimicrobial-Drug resistance, HCMV, Polymerase chain reaction, Viruses}, misc2 = {EMPIR 2015: Health}, publisher = {Elsevier BV}, language = {30}, ISSN = {0166-0934}, DOI = {10.1016/j.jviromet.2020.113864}, stag_bib_extends_levelofaccess = {NA}, author = {Bogožalec Košir, A. and Cvelbar, T. and Kammel, M. and Grunert, H-P. and Zeichhardt, H. and Milavec, M.} } @Article { MariscottiG2020, subid = {1932}, title = {Experimental Characterization of Pantograph Arcs and Transient Conducted Phenomena in DC Railways}, journal = {ACTA IMEKO}, year = {2020}, month = {6}, day = {30}, volume = {9}, number = {2}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, pages = {10}, keywords = {Arc discharge; electric arc; power quality; rail transportation}, misc2 = {EMPIR 2016: Energy}, publisher = {IMEKO International Measurement Confederation}, language = {30}, ISSN = {2221-870X}, DOI = {10.21014/acta_imeko.v9i2.761}, stag_bib_extends_levelofaccess = {NA}, author = {Mariscotti, A. and Giordano, D.} } @Article { Mariscotti2020, subid = {1929}, title = {Uncertainty of the Energy Measurement Function deriving from Distortion Power Terms for a 16.7 Hz Railway}, journal = {ACTA IMEKO}, year = {2020}, month = {6}, day = {30}, volume = {9}, number = {2}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, pages = {25}, keywords = {Electric transportation systems; energy consumption; power quality; power system harmonics; rail transportation}, misc2 = {EMPIR 2016: Energy}, publisher = {IMEKO International Measurement Confederation}, language = {30}, ISSN = {2221-870X}, DOI = {10.21014/acta_imeko.v9i2.764}, stag_bib_extends_levelofaccess = {NA}, author = {Mariscotti, A.} } @Miscellaneous { ElsterECNKM, subid = {1527}, title = {EMUE-D5-4-Method Comparison With Correlation}, year = {2020}, month = {6}, day = {28}, number2 = {17NRM05: EMUE: Advancing measurement uncertainty - comprehensive examples for key international standards}, keywords = {Measurement uncertainty; Measurement model; GUM; Straight-line regression; Correlation; Weighted total least-squares; Method comparison; Haemoglobin; AHD; HiCN}, misc2 = {EMPIR 2017: Pre-Co-Normative}, language = {30}, DOI = {10.5281/zenodo.3911584}, stag_bib_extends_levelofaccess = {NA}, author = {Elster, C. and Ellison, S. and Cowen, S. and Neukammer, J. and Klauenberg, K. and Martens, S.} } @Article { FlierlRP2020, subid = {1565}, title = {Solution to gas weighing challenge}, journal = {Analytical and Bioanalytical Chemistry}, year = {2020}, month = {6}, day = {27}, volume = {412}, number = {17}, number2 = {16ENV06: SIRS: Metrology for stable isotope reference standards}, pages = {3957-3959}, keywords = {buoyancy correction, gas weighing, gas mixing}, misc2 = {EMPIR 2016: Environment}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {1618-2642, 1618-2650}, DOI = {10.1007/s00216-020-02697-3}, stag_bib_extends_levelofaccess = {NA}, author = {Flierl, Lukas and Rienitz, Olaf and Pramann, Axel} } @Article { SeuntjensDPPOOMMHFDBBAVMKBASTTVZ2020, subid = {1522}, title = {Determination of consensus kQ values for megavoltage photon beams for the update of IAEA TRS-398}, journal = {Physics in Medicine and Biology}, year = {2020}, month = {6}, day = {22}, volume = {65}, number = {9}, number2 = {16NRM03: RTNORM: kQ factors in modern external beam radiotherapy applications to update IAEA TRS-398}, pages = {095011}, keywords = {TRS-398, MV photon beams, dosimetry, ionization chambers, Monte Carlo}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {Institute of Physics}, address = {London}, language = {30}, DOI = {10.5281/zenodo.3903294}, stag_bib_extends_levelofaccess = {NA}, author = {Seuntjens, J. and de Prez, L.A. and Pinto, M. and Pimpinella, M. and Oliver, C.P. and Ojala, J. and Muir, B. and Mirzakhanian, L. and Hanlon, M.D. and Francescon, P. and Delaunay, F. and Borbinha, J. and Ballester, F. and Andersen, C.E. and Vatnitsky, S. and McEwen, M. and Kapsch, R.P. and Burns, D.T. and Andreo, P. and Sommier, L. and Teles, P. and Tikkanen, J. and Vijande, J. and Zink, K.} } @Article { dePooterBdDKKvW2020, subid = {1629}, title = {Reference dosimetry in MRI-linacs: evaluation of available protocols and data to establish a code of practice}, journal = {Physics in Medicine \& Biology}, year = {2020}, month = {6}, day = {22}, volume = {1}, number = {1}, number2 = {19NRM01: MRgRT-DOS: Traceable dosimetry for small fields in MR-guided radiotherapy}, pages = {1}, keywords = {Reference dosimetry, MRI linac, Monte Carlo simulation, MR guided radiotherapy}, misc2 = {EMPIR 2019: Pre-Co-Normative}, publisher = {IOP Publishing}, language = {30}, ISSN = {0031-9155, 1361-6560}, DOI = {10.1088/1361-6560/ab9efe}, stag_bib_extends_levelofaccess = {NA}, author = {de Pooter, J.A. and Billas, I. and de Prez, L.A. and Duane, S. and Kapsch, R-P. and Karger, C.P. and van Asselen, B. and Wolthaus, J.W.H.} } @Article { SixOMLLJHBBLHYTYM2020, subid = {1577}, title = {What can we learn from N2O isotope data? - Analytics, processes and modelling}, journal = {Rapid Communications in Mass Spectrometry}, year = {2020}, month = {6}, day = {16}, volume = {34}, number = {20}, number2 = {16ENV06: SIRS: Metrology for stable isotope reference standards}, pages = {14/e8858}, keywords = {nitrous oxide, isotopic composition, isotope ratio mass spectrometry, laser spectroscopy}, web_url = {https://www.dora.lib4ri.ch/empa/islandora/object/empa:22957}, misc2 = {EMPIR 2016: Environment}, publisher = {John Wiley \& Sons}, language = {30}, DOI = {10.1002/rcm.8858}, stag_bib_extends_levelofaccess = {NA}, author = {Yu, Longfei and Harris, Eliza and Lewicka‐Szczebak, Dominika and Barthel, Matti and Blomberg, Margareta and Harris, Stephen J. and Johnson, Matthew S. and Lehmann, Moritz F. and Liisberg, Jesper and M{\"u}ller, Christoph and Ostrom, Nathaniel E. and Six, Johan and Toyoda, Sakae and Yoshida, Naohiro and Mohn, Joachim} } @Article { BloklandSRB2020, subid = {1517}, title = {Capacitive and Infrared Gas Sensors for the Assessment of the Methane Number of LNG Fuels}, journal = {Sensors}, year = {2020}, month = {6}, day = {12}, volume = {20}, number = {12}, number2 = {16ENG09: LNG III: Metrological support for LNG and LBG as transport fuel}, pages = {3345}, keywords = {energy transition; Methane Number; gas composition sensor; capacitive sensor array; interdigitated electrodes; responsive coatings; tunable filter infrared spectrometer; LNG; biogas}, tags = {EnG}, misc2 = {EMPIR 2016: Energy}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s20123345}, stag_bib_extends_levelofaccess = {NA}, author = {Sweelssen, J. and Blokland, H. and Rajamaki, T. and Boersma, A.} } @Proceedings { RoseLKPMP2020, subid = {1590}, title = {Modulation-based long-range interferometry as basis for an optical two-color temperature sensor}, journal = {Proceedings 20th euspen International Conference and Exhibition}, year = {2020}, month = {6}, day = {12}, number2 = {18SIB01: GeoMetre: Large-scale dimensional measurements for geodesy}, keywords = {2f/3f detection, laser modulation}, web_url = {https://oar.ptb.de/files/download/5f3b86124c93900740005e17}, misc2 = {EMPIR 2018: SI Broader Scope}, event_place = {Online Conference}, event_name = {20th euspen International Conference and Exhibition}, event_date = {08-06-2020 to 12-06-2020}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://www.euspen.eu/euspen-knowledge-base/proceedings-search/\#!/author=Anni\%20Ro\&event=7871}, author = {Rose, A. and Liu, Y. and K{\"o}chert, P. and Prellinger, G. and Manske, E. and Pollinger, F.} } @Article { SalminenSHH2020, subid = {1976}, title = {Advances in traceable calibration of cylinder pressure transducers}, journal = {Metrologia}, year = {2020}, month = {6}, day = {12}, volume = {57}, number = {4}, number2 = {17IND07: DynPT: Development of measurement and calibration techniques for dynamic pressures and temperatures}, pages = {045006}, keywords = {dynamic pressure, cylinder pressure, dynamic reference, pressure reference, pressurecalibration, dynamic calibration}, misc2 = {EMPIR 2017: Industry}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/ab8fb9}, stag_bib_extends_levelofaccess = {NA}, author = {Salminen, J. and Saxholm, S. and H{\"a}m{\"a}l{\"a}inen, J. and H{\"o}gstr{\"o}m, R.} } @Article { SetinaTIBBJVW2020, subid = {1519}, title = {A review on hot cathode ionisation gauges with focus on a suitable design for measurement accuracy and stability}, journal = {Vacuum}, year = {2020}, month = {6}, day = {10}, volume = {179}, number2 = {16NRM05: Ion Gauge: Towards a documentary standard for an ionisation vacuum gauge}, keywords = {Ionisation gauge, Hot cathode, Sensitivity, Secondary electrons, Electron stimulated desorption}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {Elsevier}, address = {Munich}, language = {30}, ISSN = {0042-207X}, DOI = {10.1016/j.vacuum.2020.109545}, stag_bib_extends_levelofaccess = {NA}, author = {Jousten, K. and Boineau, F. and Bundaleski, N. and Illgen, C. and Šetina, J. and Teodoro, O.M.N.D. and Vicar, M. and W{\"u}est, M.} } @Article { BossewCCCDEGPT2020, subid = {1837}, title = {Development of a Geogenic Radon HazardIndex—Concept, History, Experiences}, journal = {International Journal of Environmental Research and Public Health}, year = {2020}, month = {6}, day = {10}, volume = {17}, number = {11}, number2 = {16ENV10: MetroRADON: Metrology for radon monitoring}, pages = {4134}, keywords = {geogenic radon hazard index, geogenic radon potential, European map of geogenic radon}, misc2 = {EMPIR 2016: Environment}, publisher = {MDPI}, language = {30}, ISSN = {EISSN 1660-4601}, DOI = {10.3390/ijerph17114134}, stag_bib_extends_levelofaccess = {NA}, author = {Bossew, P. and Cinelli, G. and Ciotoli, G. and Crowley, Q.G. and De Cort, M. and El{\'i}o Medina, J. and Gruber, V. and Petermann, E. and Tollefsen, T.} } @Miscellaneous { SegaRPSdv, subid = {1509}, title = {EMUE-D3-3-Calibration Gas Mixtures}, year = {2020}, month = {6}, day = {3}, number2 = {17NRM05: EMUE: Advancing measurement uncertainty - comprehensive examples for key international standards}, keywords = {Gas mixtures; Nitrogen oxides; Dynamic dilution; Mass flow controllers; Chemiluminescence analyser; Calibration; Uncertainty and covariance evaluation; Weighted Total Least-Squares}, misc2 = {EMPIR 2017: Pre-Co-Normative}, language = {30}, DOI = {10.5281/zenodo.3875469}, stag_bib_extends_levelofaccess = {NA}, author = {Sega, M. and Rolle, F. and Pennecchi, F. and Spazzini, P. and de Krom, I. and van der Veen, A.M.H.} } @Article { BatistaTB2020, subid = {1478}, title = {Traceability of pulsed flow rates consisting of constant delivered volumes at given time interval}, journal = {Flow Measurement and Instrumentation}, year = {2020}, month = {6}, volume = {73}, number2 = {18HLT08: MEDDII: Metrology for drug delivery}, pages = {101729}, keywords = {Traceability, pulsed flow rate, volume}, misc2 = {EMPIR 2018: Health}, publisher = {Elsevier BV}, language = {30}, ISSN = {0955-5986}, DOI = {10.1016/j.flowmeasinst.2020.101729}, stag_bib_extends_levelofaccess = {NA}, author = {Bissig, H. and Tschannen, M. and de Huu, M} } @Article { BoudaoudCO2020, subid = {1493}, title = {Development of an optical measurement method for “sampled” micro-volumes and nano-flow rates}, journal = {Flow Measurement and Instrumentation}, year = {2020}, month = {6}, volume = {73}, number2 = {18HLT08: MEDDII: Metrology for drug delivery}, pages = {101746}, keywords = {Optical Method, volume, microflow}, misc2 = {EMPIR 2018: Health}, publisher = {Elsevier BV}, language = {30}, ISSN = {0955-5986}, DOI = {10.1016/j.flowmeasinst.2020.101746}, stag_bib_extends_levelofaccess = {NA}, author = {Ogheard, F. and Cassette, P. and Boudaoud, A.} } @Article { HarmonFBAGBLZ2020, subid = {1514}, title = {Assessment of Exposure to Electric Vehicle Inductive Power Transfer Systems: Experimental Measurements and Numerical Dosimetry}, journal = {Sustainability}, year = {2020}, month = {6}, volume = {12}, number = {11}, number2 = {16ENG08: MICEV: Metrology for inductive charging of electric vehicles}, pages = {4573}, keywords = {basic restrictions; electric vehicle; exposure; guidelines; inductive power transfer (IPT); magnetic field measurements; numerical dosimetry}, misc2 = {EMPIR 2016: Energy}, publisher = {MDPI AG}, language = {30}, ISSN = {2071-1050}, DOI = {10.3390/su12114573}, stag_bib_extends_levelofaccess = {NA}, author = {Liorni, I. and Bottauscio, O. and Guilizzoni, R. and Ankarson, P. and Bruna, J. and Fallahi, A. and Harmon, S. and Zucca, M.} } @Article { RoyleGFLRMPS2020, subid = {1510}, title = {The challenge of ionisation chamber dosimetry in ultra-short pulsed high dose-rate Very High Energy Electron beams}, journal = {Scientific Reports}, year = {2020}, month = {6}, volume = {10}, number = {1}, number2 = {18HLT04: UHDpulse: Metrology for advanced radiotherapy using particle beams with ultra-high pulse dose rates}, keywords = {dosimetry, VHEE, uhigh dose-per-pulse, ion recombination}, web_url = {https://www.nature.com/articles/s41598-020-65819-y}, misc2 = {EMPIR 2018: Health}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2045-2322}, DOI = {10.1038/s41598-020-65819-y}, stag_bib_extends_levelofaccess = {NA}, author = {McManus, M. and Romano, F. and Lee, N.D. and Farabolini, W. and Gilardi, A. and Royle, G. and Palmans, H. and Subiel, A.} } @Article { KolovouGCBL2020, subid = {1524}, title = {Procedures to Measure Mean Ambient Dose Equivalent Rates Using Electret Ion Chambers}, journal = {Radiation Protection Dosimetry}, year = {2020}, month = {6}, number2 = {16ENV04: Preparedness: Metrology for mobile detection of ionising radiation following a nuclear or radiological incident}, keywords = {electret ion chambers,ambient dose equivalent rates}, misc2 = {EMPIR 2016: Environment}, publisher = {Oxford University Press (OUP)}, language = {30}, ISSN = {0144-8420, 1742-3406}, DOI = {10.1093/rpd/ncaa061}, stag_bib_extends_levelofaccess = {NA}, author = {Leontaris, F. and Boziari, A. and Clouvas, A. and Kolovou, M. and Guilhot, J.} } @Thesis { Plag2020, subid = {1525}, title = {Integral methods of measurement for photovoltaics}, year = {2020}, month = {6}, number2 = {16ENG02: PV-Enerate: Advanced PV energy rating}, keywords = {photovoltaic metrology ; calibration ; angle of incidence ; spectral responsivity ; diffuse irradiance ; optical losses ; energy rating ; EMPIR ENG02 PV-Enerate}, web_url = {https://oar.ptb.de/resources/show/10.7795/110.20200615}, misc2 = {EMPIR 2016: Energy}, publisher = {Physikalisch-Technische Bundesanstalt (PTB)}, school = {TU Braunschweig}, language = {30}, ISBN = {978-3-95606-497-5}, ISSN = {0341-6712}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {ISBN 978-3-95606-497-5}, author = {Plag, F.} } @Article { PradyumnaLRTZJADGG2020, subid = {1574}, title = {Twin beam quantum-enhanced correlated interferometry for testing fundamental physics}, journal = {Communications Physics}, year = {2020}, month = {6}, volume = {3}, number = {1}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {104}, keywords = {Optical physicsQuantum metrologyQuantum optics}, web_url = {https://www.nature.com/articles/s42005-020-0368-5\#Bib1}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Nature Research}, address = {233 Spring St. New York NY 10013 United States}, language = {30}, ISSN = {2399-3650}, DOI = {10.1038/s42005-020-0368-5}, stag_bib_extends_levelofaccess = {NA}, author = {Pradyumna, S. T. and Losero, E. and Ruo-Berchera, I. and Traina, P. and Zucco, M. and Jacobsen, C. S. and Andersen, U. L. and Degiovanni, I. P. and Genovese, M. and Gehring, T.} } @Article { FlierlPNRR2020, subid = {1562}, title = {UncorK – A Monte Carlo simulation tool for calculating combined uncertainties associated with mass bias calibration factors for isotope ratio measurements}, journal = {Spectrochimica Acta Part B: Atomic Spectroscopy}, year = {2020}, month = {6}, volume = {168}, number2 = {16ENV06: SIRS: Metrology for stable isotope reference standards}, pages = {105866}, keywords = {Mass bias correction, Uncertainty propagation, SI traceability, Metrology, Absolute isotope ratio}, misc2 = {EMPIR 2016: Environment}, publisher = {Elsevier BV}, address = {Elsevier BV Radarweg 29 Amsterdam NX 1043 Netherlands}, language = {30}, ISSN = {0584-8547}, DOI = {10.1016/j.sab.2020.105866}, stag_bib_extends_levelofaccess = {NA}, author = {Flierl, Lukas and Pramann, Axel and Noordmann, Janine and R{\"o}thke, Anita and Rienitz, Olaf} } @Article { SamantarayRB2020, subid = {1596}, title = {Single-phase and correlated-phase estimation with multiphoton annihilated squeezed vacuum states: An energy-balancing scenario}, journal = {Physical Review A}, year = {2020}, month = {6}, volume = {101}, number = {6}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {063810}, keywords = {quantum optics, quantum metrology, non-gaussian states}, web_url = {https://arxiv.org/abs/1809.10706}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2469-9926, 2469-9934}, DOI = {10.1103/PhysRevA.101.063810}, stag_bib_extends_levelofaccess = {NA}, author = {Samantaray, N. and Ruo-Berchera, I. and Berchera, I.} } @Article { SchmelterOSB2020, subid = {1627}, title = {Numerical simulation, validation, and analysis of two-phase slug flow in large horizontal pipes}, journal = {Flow Measurement and Instrumentation}, year = {2020}, month = {6}, volume = {73}, number2 = {16ENG07: MultiFlowMet II: Multiphase flow reference metrology}, pages = {101722}, keywords = {Multiphase flow, slug flow, CFD, frequency analysis}, misc2 = {EMPIR 2016: Energy}, publisher = {Elsevier BV}, language = {30}, ISSN = {0955-5986}, DOI = {10.1016/j.flowmeasinst.2020.101722}, stag_bib_extends_levelofaccess = {NA}, author = {Schmelter, S. and Olbrich, M. and Schmeyer, E. and B{\"a}r, M.} } @Proceedings { FahrbachP2020, subid = {1652}, title = {Higher-Mode Contact Resonance Operation of a High-Aspect-Ratio Piezoresistive Cantilever Microprobe}, journal = {SMSI 2020 - Sensors and Instrumentation}, year = {2020}, month = {6}, volume = {Chapter A6}, number = {2020}, number2 = {17IND05: MicroProbes: Multifunctional ultrafast microprobes for on-the-machine measurements}, pages = {89-90}, keywords = {MEMS, microprobe, thermal actuator, piezoresistive cantilever, contact resonance}, misc2 = {EMPIR 2017: Industry}, publisher = {AMA Association for Sensors and Measurement}, event_place = {Nuremberg, Germany}, event_name = {SMSI 2020}, event_date = {22-06-2020 to 25-06-2020}, language = {30}, ISBN = {978-3-9819376-2-6}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://www.ama-science.org/proceedings/details/3656}, author = {Fahrbach, M. and Peiner, E.} } @Proceedings { BosseEZCBOYBMRF2020, subid = {1665}, title = {AdvManuNet: a networking project on metrology for advanced manufacturing}, journal = {Proceedings 20th euspen International Conference and Exhibition}, year = {2020}, month = {6}, volume = {2020}, number2 = {19NET01: AdvManuNet: Support for a European Metrology Network on advanced manufacturing}, keywords = {Advanced Manufacturing, Key Enabling Technology (KET), Strategic Research Agenda (SRA), European Metrology Network (EMN)}, misc2 = {EMPIR 2019: Support for Networks}, event_place = {Online Conference}, event_name = {20th euspen International Conference and Exhibition}, event_date = {08-06-2020 to 12-06-2020}, language = {30}, ISBN = {978-0-9957751-7-6}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://www.euspen.eu/knowledge-base/ICE20374.pdf}, author = {Bosse, H. and Evans, A. and Zelen{\'y}, V. and Czulek, D. and Balsamo, A. and O'Connor, D. and Yandayan, T. and Billington, D. and Meli, F. and Ragusa, C. and Flys, O.} } @Proceedings { BehleB2020, subid = {1654}, title = {Mode analysis for long, undamped cantilevers with added diamond tips of varying length for fast roughness measurements}, journal = {SMSI 2020 - Sensors and Instrumentation}, year = {2020}, month = {6}, volume = {Chapter P2}, number = {2020}, number2 = {17IND05: MicroProbes: Multifunctional ultrafast microprobes for on-the-machine measurements}, pages = {238-239}, keywords = {FEM, Mode analysis, diamond tips, piezoresistive Si-cantilever, roughness measurements}, misc2 = {EMPIR 2017: Industry}, publisher = {AMA Association for Sensors and Measurement}, event_place = {Nuremberg, Germany}, event_name = {SMSI 2020}, event_date = {22-06-2020 to 25-06-2020}, language = {30}, ISBN = {978-3-9819376-2-6}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://www.ama-science.org/proceedings/details/3729}, author = {Behle, H. and Brand, U.} } @Proceedings { ReuterRFPBHR2020, subid = {1653}, title = {Applications of Tactile Microprobes for Surface Metrology}, journal = {SMSI 2020 - Sensors and Instrumentation}, year = {2020}, month = {6}, volume = {Chapter A6}, number = {2020}, number2 = {17IND05: MicroProbes: Multifunctional ultrafast microprobes for on-the-machine measurements}, pages = {87-88}, keywords = {piezoresistive cantilever, MEMS, atomic force microscopy, contact resonance, surfaceroughness}, misc2 = {EMPIR 2017: Industry}, publisher = {AMA Association for Sensors and Measurement}, event_place = {Nuremberg, Germany}, event_name = {SMSI 2020}, event_date = {22-06-2020 to 25-06-2020}, language = {30}, ISBN = {978-3-9819376-2-6}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://www.ama-science.org/proceedings/details/3655}, author = {Reuter, C. and Reum, A. and Fahrbach, M. and Peiner, E. and Brand, U. and Hofmann, M. and Rangelow, I.} } @Article { LucasCTDABLYSMPF2020, subid = {1611}, title = {Dynamic piezoelectric response of relaxor single crystal under electrically driven inter-ferroelectric phase transformations}, journal = {Applied Physics Letters}, year = {2020}, month = {6}, volume = {116}, number = {22}, number2 = {16ENG06: ADVENT: Metrology for advanced energy-saving technology in next-generation electronics applications}, pages = {222903}, keywords = {-}, web_url = {https://livrepository.liverpool.ac.uk/3091334/}, misc2 = {EMPIR 2016: Energy}, publisher = {AIP Publishing}, language = {30}, ISSN = {0003-6951, 1077-3118}, DOI = {10.1063/5.0007820}, stag_bib_extends_levelofaccess = {NA}, author = {Lucas, C.A. and Cain, M.G. and Thompson, P.B.J. and Damjanovic, D. and Antonelli, L. and Blackmon, F. and Lofland, S.E. and Young, S. and Staruch, M. and Matis, B.R. and Patterson, E.A. and Finkel, P.} } @Article { BlakesleyHMGFBH2020, subid = {1733}, title = {Accuracy, cost and sensitivity analysis of PV energy rating}, journal = {Solar Energy}, year = {2020}, month = {6}, volume = {203}, number2 = {16ENG02: PV-Enerate: Advanced PV energy rating}, pages = {91-100}, keywords = {Photovoltaics, Energy rating, Uncertainty}, misc2 = {EMPIR 2016: Energy}, publisher = {Elsevier BV}, language = {30}, ISSN = {0038-092X}, DOI = {10.1016/j.solener.2020.03.088}, stag_bib_extends_levelofaccess = {NA}, author = {Blakesley, J.C. and Huld, T. and M{\"u}llejans, H. and Gracia-Amillo, A. and Friesen, G. and Betts, T.R. and Hermann, W.} } @Proceedings { BircherMKT2020, subid = {1758}, title = {METAS-CT: Metrological X-ray computed tomography at sub-micrometre precision}, journal = {Proceedings 20th euspen International Conference and Exhibition}, year = {2020}, month = {6}, number2 = {17IND08: AdvanCT: Advanced Computed Tomography for dimensional and surface measurements in industry}, keywords = {Industrial X-ray computed tomography, dimensional metrology, high-resolution, microtechnology, micro-parts, additive manufacturing}, web_url = {https://www.euspen.eu/knowledge-base/ICE20131.pdf}, misc2 = {EMPIR 2017: Industry}, event_place = {Online Conference}, event_name = {20th euspen International Conference and Exhibition}, event_date = {08-06-2020 to 12-06-2020}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://www.euspen.eu/knowledge-base/ICE20131.pdf}, author = {Bircher, B. and Meli, F. and K{\"u}ng, A. and Thalmann, R.} } @Article { deHuuTBSBMMNPR2020, subid = {1819}, title = {Design of gravimetric primary standards for field-testing of hydrogen refuelling stations}, journal = {Flow Measurement and Instrumentation}, year = {2020}, month = {6}, volume = {73}, number2 = {16ENG01: MetroHyVe: Metrology for hydrogen vehicles}, pages = {101747}, keywords = {Hydrogen calibration, Hydrogen dispenser, Gravimetric method}, tags = {EnG}, misc2 = {EMPIR 2016: Energy}, publisher = {Elsevier BV}, language = {30}, ISSN = {0955-5986}, DOI = {10.1016/j.flowmeasinst.2020.101747}, stag_bib_extends_levelofaccess = {NA}, author = {de Huu, M. and Tschannen, M. and Bissig, H. and Stadelmann, P. and B{\"u}ker, O. and MacDonald, M. and Maury, R. and Neuvonen, P.T. and Petter, H.T. and RASMUSSEN, K.} } @Article { LiuLL2020, subid = {1866}, title = {A comprehensive assessment of correlations for two-phase flow through Venturi tubes}, journal = {Journal of Natural Gas Science and Engineering}, year = {2020}, month = {6}, volume = {78}, number = {2020}, number2 = {16ENG07: MultiFlowMet II: Multiphase flow reference metrology}, pages = {103323}, keywords = {Venturi tubeTwo-phase flow meteringCorrelation performance}, web_url = {https://www.sciencedirect.com/science/article/pii/S1875510020301773}, misc2 = {EMPIR 2016: Energy}, publisher = {Elsevier BV}, language = {30}, ISSN = {1875-5100}, DOI = {10.1016/j.jngse.2020.103323}, stag_bib_extends_levelofaccess = {NA}, author = {Liu, X. and Lao, L. and Falcone, G.} } @Article { ColauttiLTPPTNCWT2020, subid = {1882}, title = {A 3D Polymeric Platform for Photonic Quantum Technologies}, journal = {Advanced Quantum Technologies}, year = {2020}, month = {6}, volume = {3}, number = {7}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {2000004}, keywords = {direct laser writingintegrated opticsquantum emitters single molecules single photon sources}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Wiley}, language = {30}, ISSN = {2511-9044, 2511-9044}, DOI = {10.1002/qute.202000004}, stag_bib_extends_levelofaccess = {NA}, author = {Colautti, M. and Lombardi, P. and Trapuzzano, M. and Piccioli, F.S. and Pazzagli, S. and Tiribilli, B. and Nocentini, S. and Cataliotti, F.S. and Wiersma, D.S. and Toninelli, C.} } @Proceedings { FanS2020, subid = {1937}, title = {Power Flow Simulation of DC Railway Power Supply Systems with Regenerative Braking}, journal = {2020 IEEE 20th Mediterranean Electrotechnical Conference ( MELECON)}, year = {2020}, month = {6}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, keywords = {DC railway power supply system, power exchange, power flow simulation, regenerative braking, reversible substation}, web_url = {https://strathprints.strath.ac.uk/71741/1/Fan_Stewart_MELECON_2020_Power_flow_simulation_of_DC_railway_power.pdf}, misc2 = {EMPIR 2016: Energy}, publisher = {IEEE}, event_place = {Palermo, Italy}, event_name = {2020 IEEE 20th Mediterranean Electrotechnical Conference (MELECON) - Palermo, Italy}, event_date = {16-06-2020 to 18-06-2020}, language = {30}, DOI = {10.1109/MELECON48756.2020.9140462}, stag_bib_extends_levelofaccess = {NA}, author = {Fan, F. and Stewart, B.G.} } @Proceedings { LuchkovNV2020, subid = {2020}, title = {Unmanned Aircraft Based Gamma Spectrometry System for Radiological Surveillance}, journal = {SMSI 2020 Conference Proceedings - Sensor and Measurement Science International}, year = {2020}, month = {6}, number2 = {16ENV04: Preparedness: Metrology for mobile detection of ionising radiation following a nuclear or radiological incident}, keywords = {Radiation monitoring, spectro-dosemeter, cerium bromide, UAV, ''Preparedness''}, web_url = {https://www.ama-science.org/proceedings/details/3775}, misc2 = {EMPIR 2016: Environment}, event_place = {Nuremberg}, event_name = {Sensor and Measurement Science International}, event_date = {22-06-2020 to 25-06-2020}, language = {30}, ISBN = {978-3-9819376-2-6}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {978-3-9819376-2-6}, author = {Luchkov, M. and Neumaier, S. and Vargas, A.} } @Article { Losler2020, subid = {1859}, title = {Zur Parametersch{\"a}tzung mit unterschiedlichen Koordinatendarstellungen}, journal = {Zeitschrift f{\"u}r Geod{\"a}sie, Geoinformatik und Landmanagement (ZfV)}, year = {2020}, month = {6}, volume = {145 (6)}, number2 = {18SIB01: GeoMetre: Large-scale dimensional measurements for geodesy}, pages = {385-392}, keywords = {Parametersch{\"a}tzung, polare Koordinaten, kartesische Koordinaten, sequenzielle quadratische Pro­grammierung, Orthogonal-Distance-Fit}, web_url = {https://geodaesie.info/zfv/heftbeitrag/8628}, misc2 = {EMPIR 2018: SI Broader Scope}, language = {43}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://doi.org/10.12902/zfv-0319-2020}, author = {L{\"o}sler, M.} } @Article { HarrisLXWZYBWKCBSM2020, subid = {1578}, title = {N2O isotopocule measurements using laser spectroscopy: analyzer characterization and intercomparison}, journal = {Atmospheric Measurement Techniques}, year = {2020}, month = {5}, day = {28}, volume = {13}, number = {-}, number2 = {16ENV06: SIRS: Metrology for stable isotope reference standards}, pages = {2797–2831}, keywords = {nitrous oxide, isotopic composition, laser spectroscopy, spectral interference, matrix effect}, web_url = {https://www.dora.lib4ri.ch/empa/islandora/object/empa\%3A22186}, misc2 = {EMPIR 2016: Environment}, publisher = {Copernicus Gesellschaft mbH}, address = {G{\"o}ttingen}, language = {30}, DOI = {10.5194/amt-13-2797-2020}, stag_bib_extends_levelofaccess = {NA}, author = {Harris, Stephen J. and Liisberg, Jesper and Xia, Longlong and Wei, Jing and Zeyer, Kerstin and Yu, Longfei and Barthel, Matti and Wolf, Benjamin and Kelly, Bryce F. J. and Cend{\'o}n, Dioni I. and Blunier, Thomas and Six, Johan and Mohn, Joachim} } @Miscellaneous { ElsterKM, subid = {1501}, title = {EMUE-D6-2-Calibration Uncertainty GUM vs Bayesian}, year = {2020}, month = {5}, day = {26}, number2 = {17NRM05: EMUE: Advancing measurement uncertainty - comprehensive examples for key international standards}, keywords = {Measurement uncertainty; Measurement model; GUM; Bayesian inference; Calibration; Straight-line regression, Least-squares estimation; Torque measuring device; VDI/VDE 2600 Blatt 2}, misc2 = {EMPIR 2017: Pre-Co-Normative}, language = {30}, DOI = {10.5281/zenodo.3858121}, stag_bib_extends_levelofaccess = {NA}, author = {Elster, C. and Klauenberg, K. and Martens, S.} } @Article { RuoBercheraMLASG2020, subid = {1576}, title = {Improving resolution-sensitivity trade off in sub-shot noise quantum imaging}, journal = {Applied Physics Letters}, year = {2020}, month = {5}, day = {26}, volume = {116}, number = {21}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {214001}, keywords = {Optical metrology, Quantum correlations, Signal processing, Quantum efficiency, Quantum limit, Charge coupled devices}, misc2 = {EMPIR 2017: Fundamental}, publisher = {AIP Publishing}, language = {30}, ISSN = {0003-6951, 1077-3118}, DOI = {10.1063/5.0009538}, stag_bib_extends_levelofaccess = {NA}, author = {Ruo-Berchera, I. and Meda, A. and Losero, E. and Avella, A. and Samantaray, N. and Genovese, M.} } @Article { WinterSZMI2020, subid = {1694}, title = {MRI‐Related Heating of Implants and Devices: A Review}, journal = {Journal of Magnetic Resonance Imaging}, year = {2020}, month = {5}, day = {26}, number2 = {17IND01: MIMAS: Procedures allowing medical implant manufacturers to demonstrate compliance with MRI safety regulations}, keywords = {magnetic resonance imaging, implant safety, MR safety, parallel transmission}, misc2 = {EMPIR 2017: Industry}, publisher = {Wiley}, language = {30}, ISSN = {1053-1807, 1522-2586}, DOI = {10.1002/jmri.27194}, stag_bib_extends_levelofaccess = {NA}, author = {Winter, L. and Seifert, F. and Zilberti, L. and Murbach, M. and Ittermann, B.} } @Article { MaZWDWLLWGLT2020, subid = {1899}, title = {Uncertainty Analysis for RadCalNet Instrumented Test Sites Using the Baotou Sites BTCN and BSCN as Examples}, journal = {Remote Sensing}, year = {2020}, month = {5}, day = {26}, volume = {12}, number = {11}, number2 = {16ENV03: MetEOC-3: Further metrology for earth observation and climate}, pages = {1696}, keywords = {RadCalNet, Cal/Val, calibration, uncertainty, metrology, Baotou, CEOS, interoperability, BTCN, BSCN}, misc2 = {EMPIR 2016: Environment}, publisher = {MDPI AG}, language = {30}, ISSN = {2072-4292}, DOI = {10.3390/rs12111696}, stag_bib_extends_levelofaccess = {NA}, author = {Ma, Lingling and Zhao, Yongguang and Woolliams, Emma R. and Dai, Caihong and Wang, Ning and Liu, Yaokai and Li, Ling and Wang, Xinhong and Gao, Caixia and Li, Chuanrong and Tang, Lingli} } @Article { GenoveseG2020, subid = {1580}, title = {Special Issue on Quantum Optics for Fundamental Quantum Mechanics}, journal = {Applied Sciences}, year = {2020}, month = {5}, day = {25}, volume = {10}, number = {10}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {3655}, keywords = {quantum correlationsquantum non-localityentanglementbell measurements}, misc2 = {EMPIR 2017: Fundamental}, publisher = {MDPI AG}, language = {30}, ISSN = {2076-3417}, DOI = {10.3390/app10103655}, stag_bib_extends_levelofaccess = {NA}, author = {Genovese, Marco and Gramegna, Marco} } @Article { CiobanuOTOZLI2020, subid = {1771}, title = {MetroMC research group: Computational physics in ionizing radiation metrology}, journal = {Romanian Journal of Physics}, year = {2020}, month = {5}, day = {25}, volume = {65}, number = {3-4}, number2 = {16ENV10: MetroRADON: Metrology for radon monitoring}, pages = {808}, keywords = {“MetroMC”, Monte Carlo, ionizing radiation metrology}, misc2 = {EMPIR 2016: Environment}, publisher = {Editura Academiei Romane}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {http://www.nipne.ro/rjp/2020_65_3-4/RomJPhys.65.808.pdf}, author = {Ciobanu, S. and Ormenisan, G. and Tugulan, L.C. and Olaru, C. and Zadehrafi, M. and Luca, A. and Ioan, M.R.} } @Article { WagnerSBKLSS2020, subid = {1968}, title = {PTB-XL, a large publicly available electrocardiography dataset}, journal = {Scientific Data}, year = {2020}, month = {5}, day = {25}, volume = {7}, number = {1}, number2 = {18HLT07: MedalCare: Metrology of automated data analysis for cardiac arrhythmia management}, keywords = {electrocardiography, cardiovascular system, 12 lead electrocardiography, presence of co-occurring diseases}, misc2 = {EMPIR 2018: Health}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2052-4463}, DOI = {10.1038/s41597-020-0495-6}, stag_bib_extends_levelofaccess = {NA}, author = {Wagner, P. and Strodthoff, N. and Bousseljot, R-D. and Kreiseler, D. and Lunze, F.I. and Samek, W. and Schaeffter, T.} } @Article { QueleverGAJ2020, subid = {1530}, title = {Validation of a Broadband Tissue-Equivalent Liquid for SAR Measurement and Monitoring of Its Dielectric Properties for Use in a Sealed Phantom}, journal = {Sensors}, year = {2020}, month = {5}, day = {23}, volume = {20}, number = {10}, number2 = {16NRM07: Vector SAR: SAR measurement using vector probes}, pages = {2956}, keywords = {dielectric measurement; process monitoring; open-ended coaxial probe; specificabsorption rate (SAR); tissue-equivalent materials}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s20102956}, stag_bib_extends_levelofaccess = {NA}, author = {Gregory, Andrew P. and Qu{\'e}l{\'e}ver, Kristell and Allal, Djamel and Jawad, Ourouk } } @Article { RadtkePHK2020, subid = {1634}, title = {The Inverted Philosopher’s Stone: how to turn silver to a base metal}, journal = {Journal of Solid State Electrochemistry}, year = {2020}, month = {5}, day = {23}, number2 = {17FUN09: UnipHied: Realisation of a Unified pH Scale}, keywords = {Hydrogen electrode . Ionic liquid . Ion solvation . Protoelectric Potential Map}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {1432-8488, 1433-0768}, DOI = {10.1007/s10008-020-04633-y}, stag_bib_extends_levelofaccess = {NA}, author = {Radtke, V. and P{\"u}tz, K. and Himmel, D. and Krossing, I.} } @Article { MorevaBTSTFPBPDOG2020, subid = {1710}, title = {Practical Applications of Quantum Sensing: A Simple Method to Enhance the Sensitivity of Nitrogen-Vacancy-Based Temperature Sensors}, journal = {Physical Review Applied}, year = {2020}, month = {5}, day = {22}, volume = {13}, number = {5}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {054057}, keywords = {color centers, diamond, quantum sensing}, web_url = {https://arxiv.org/abs/1912.10887}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, address = {1 Research Rd Attn: Mark Doyle Ridge 11961-9000 United States}, language = {30}, ISSN = {2331-7019}, DOI = {10.1103/PhysRevApplied.13.054057}, stag_bib_extends_levelofaccess = {NA}, author = {Moreva, E. and Bernardi, E. and Traina, P. and Sosso, A. and Tchernij, S.D. and Forneris, J. and Picollo, F. and Brida, G. and Pastuović, Ž. and Degiovanni, I. P. and Olivero, P. and Genovese, M.} } @Article { MorevaBTSTFPBPDOG20200, subid = {1710}, title = {Practical Applications of Quantum Sensing: A Simple Method to Enhance the Sensitivity of Nitrogen-Vacancy-Based Temperature Sensors}, journal = {Physical Review Applied}, year = {2020}, month = {5}, day = {22}, volume = {13}, number = {5}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {054057}, keywords = {color centers, diamond, quantum sensing}, web_url = {https://arxiv.org/abs/1912.10887}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, address = {1 Research Rd Attn: Mark Doyle Ridge 11961-9000 United States}, language = {30}, ISSN = {2331-7019}, DOI = {10.1103/PhysRevApplied.13.054057}, stag_bib_extends_levelofaccess = {NA}, author = {Moreva, E. and Bernardi, E. and Traina, P. and Sosso, A. and Tchernij, S.D. and Forneris, J. and Picollo, F. and Brida, G. and Pastuović, Ž. and Degiovanni, I. P. and Olivero, P. and Genovese, M.} } @Miscellaneous { vanderVeen, subid = {1499}, title = {Bayesian evaluation of the mass calibration example from EA 4/02}, year = {2020}, month = {5}, day = {20}, number2 = {17NRM05: EMUE: Advancing measurement uncertainty - comprehensive examples for key international standards}, keywords = {Mass, calibration}, web_url = {https://zenodo.org/record/3836190\#.XsZdEmhKg2w}, misc2 = {EMPIR 2017: Pre-Co-Normative}, language = {30}, DOI = {10.5281/zenodo.3836190}, stag_bib_extends_levelofaccess = {NA}, author = {van der Veen, A.} } @Article { PeterekM2020, subid = {1561}, title = {Prototype for dual digital traceability of metrology data using X.509 and IOTA}, journal = {CIRP Annals}, year = {2020}, month = {5}, day = {20}, volume = {69}, number = {1}, number2 = {17IND03: LaVA: Large Volume Metrology Applications}, pages = {449-452}, keywords = {metrology, calibration, digital manufacturing systems}, web_url = {https://www.sciencedirect.com/science/article/pii/S0007850620301268}, misc2 = {EMPIR 2017: Industry}, publisher = {Elsevier BV}, language = {30}, ISSN = {0007-8506}, DOI = {10.1016/j.cirp.2020.04.104}, stag_bib_extends_levelofaccess = {NA}, author = {Peterek, Martin and Montavon, Benjamin} } @Article { YamakawaBATBSNKYD2020, subid = {2039}, title = {Hg isotopic composition and total Hg mass fraction in NIES Certified Reference Material No. 28 Urban Aerosols}, journal = {Analytical and Bioanalytical Chemistry}, year = {2020}, month = {5}, day = {18}, volume = {412}, number = {19}, number2 = {16ENV01: MercOx: Metrology for oxidised mercury}, pages = {4483-4493}, keywords = {Hg isotopic composition, Certified Reference Material, Urban Aerosols}, misc2 = {EMPIR 2016: Environment}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {1618-2642, 1618-2650}, DOI = {10.1007/s00216-020-02691-9}, stag_bib_extends_levelofaccess = {NA}, author = {Yamakawa, A. and B{\'e}rail, S. and Amouroux, D. and Tessier, E. and Barre, J. and Sano, T. and Nagano, K. and Kanwal, S. and Yoshinaga, J. and Donard, O.F.X.} } @Article { KongJTLTM2020, subid = {2746}, title = {Measurement-induced, spatially-extended entanglement in a hot, strongly-interacting atomic system}, journal = {Nature Communications}, year = {2020}, month = {5}, day = {15}, volume = {11}, number = {1}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, keywords = {Sensing beyond QSL, entanglement, hot atoms}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2041-1723}, DOI = {10.1038/s41467-020-15899-1 |}, stag_bib_extends_levelofaccess = {NA}, author = {Kong, J. and Jim{\'e}nez-Mart{\'i}nez, R. and Troullinou, C. and Lucivero, V.G. and T{\'o}th, G. and Mitchell, M.W.} } @Article { BilousBBSvTPLP2020, subid = {1541}, title = {Electronic Bridge Excitation in Highly Charged Th229 Ions}, journal = {Physical Review Letters}, year = {2020}, month = {5}, day = {12}, volume = {124}, number = {19}, number2 = {17FUN07: CC4C: Coulomb Crystals for Clocks}, keywords = {highly charged Ionshigh-intensity optical laserHighly Charged 229Th Ions}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {0031-9007, 1079-7114}, DOI = {10.1103/PhysRevLett.124.192502}, stag_bib_extends_levelofaccess = {NA}, author = {Bilous, P.V. and Bekker, H. and Berengut, J.C. and Seiferle, B. and von der Wense, L. and Thirolf, P.G. and Pfeifer, T. and L{\'o}pez-Urrutia, J.R.C. and P{\'a}lffy, A.} } @Article { WeituschatDGRKP2020, subid = {1983}, title = {Photonic and Thermal Modelling of Microrings in Silicon, Diamond and GaN for Temperature Sensing}, journal = {Nanomaterials}, year = {2020}, month = {5}, day = {12}, volume = {10}, number = {5}, number2 = {17FUN05: PhotOQuant: Photonic and Optomechanical Sensors for Nanoscaled and Quantum Thermometry}, pages = {934}, keywords = {finite-element-simulation; optical ring resonator; diamond; silicon; gallium nitride;temperature sensor; thermal modelling; two-photon absorption; self-heating}, misc2 = {EMPIR 2017: Fundamental}, publisher = {MDPI AG}, language = {30}, ISSN = {2079-4991}, DOI = {10.3390/nano10050934}, stag_bib_extends_levelofaccess = {NA}, author = {Weituschat, L.M. and Dickmann, W. and Guimbao, J. and Ramos, D. and Kroker, S. and Postigo, P-A.} } @Article { WeituschatDGRKP2020_2, subid = {2238}, title = {Photonic and Thermal Modelling of Microrings in Silicon, Diamond and GaN for Temperature Sensing}, journal = {Nanomaterials}, year = {2020}, month = {5}, day = {12}, volume = {10}, number = {5}, number2 = {17FUN05: PhotOQuant: Photonic and Optomechanical Sensors for Nanoscaled and Quantum Thermometry}, pages = {934}, keywords = {finite-element-simulation; optical ring resonator; diamond; silicon; gallium nitride;temperature sensor; thermal modelling; two-photon absorption; self-heating}, misc2 = {EMPIR 2017: Fundamental}, publisher = {MDPI AG}, language = {30}, ISSN = {2079-4991}, DOI = {10.3390/nano10050934}, stag_bib_extends_levelofaccess = {NA}, author = {Weituschat, L.M. and Dickmann, W. and Guimbao, J. and Ramos, D. and Kroker, S. and Postigo, P.A.} } @Article { CouplandPBDLTSL2020, subid = {1523}, title = {Lens aberration compensation in interference microscopy}, journal = {Optics and Lasers in Engineering}, year = {2020}, month = {5}, volume = {128}, number2 = {15SIB01: FreeFORM: Reference algorithms and metrology on aspherical and freeform lenses}, pages = {106015}, keywords = {Lens aberration interference microscopy}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {Elsevier BV}, address = {Elsevier BV Radarweg 29 Amsterdam NX 1043 Netherlands}, language = {30}, ISSN = {0143-8166}, DOI = {10.1016/j.optlaseng.2020.106015}, stag_bib_extends_levelofaccess = {NA}, author = {Su, R. and Thomas, M. and Liu, M. and Drs, J. and Bellouard, Y. and Pruss, C. and Coupland, J. and Leach, R.} } @Article { OsanBCDGSH2020, subid = {1569}, title = {Experimental evaluation of the in-the-field capabilities of total-reflection X-ray fluorescence analysis to trace fine and ultrafine aerosol particles in populated areas}, journal = {Spectrochimica Acta Part B: Atomic Spectroscopy}, year = {2020}, month = {5}, volume = {167}, number2 = {16ENV07: AEROMET: Aerosol metrology for atmospheric science and air quality}, pages = {105852}, keywords = {Atmospheric aerosols, Ultrafine particles, Cascade impactor, TXRF, Elemental size distribution}, misc2 = {EMPIR 2016: Environment}, publisher = {Elsevier BV}, address = {Elsevier BV Radarweg 29 Amsterdam NX 1043 Netherlands}, language = {30}, ISSN = {0584-8547}, DOI = {10.1016/j.sab.2020.105852}, stag_bib_extends_levelofaccess = {NA}, author = {Os{\'a}n, J{\'a}nos and B{\"o}rcs{\"o}k, Endre and Cz{\"o}mp{\"o}ly, Ott{\'o} and Dian, Csenge and Groma, Veronika and Stabile, Luca and Hensey, Garry} } @Article { KasebergSKB2020, subid = {1595}, title = {Inverted plasmonic lens design for nanometrology applications}, journal = {Measurement Science and Technology}, year = {2020}, month = {5}, volume = {31}, number = {7}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {074013}, keywords = {Plasmonics, Metrology, Plasmonic lens, Microscopy, Nanostructures, Finite Element Method}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-0233, 1361-6501}, DOI = {10.1088/1361-6501/ab7e6b}, stag_bib_extends_levelofaccess = {NA}, author = {K{\"a}seberg, T. and Siefke, T. and Kroker, S. and Bodermann, B.} } @Article { WangJW2020, subid = {1621}, title = {Fuzzy Logic Based Multi-Dimensional Image Fusion for Gas–Oil-Water Flows With Dual-Modality Electrical Tomography}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2020}, month = {5}, volume = {69}, number = {5}, number2 = {16ENG07: MultiFlowMet II: Multiphase flow reference metrology}, pages = {1948-1961}, keywords = {gas-oil-water three phase, measurement, visualisation, data fusion, fuzzy logic method}, web_url = {http://eprints.whiterose.ac.uk/149072/}, misc2 = {EMPIR 2016: Energy}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9456, 1557-9662}, DOI = {10.1109/TIM.2019.2923864}, stag_bib_extends_levelofaccess = {NA}, author = {Wang, Q. and Jia, X. and Wang, M.} } @Article { MoranMezaDAP2020, subid = {1613}, title = {A substitution method for nanoscale capacitance calibration using scanning microwave microscopy}, journal = {Measurement Science and Technology}, year = {2020}, month = {5}, volume = {31}, number = {7}, number2 = {16ENG06: ADVENT: Metrology for advanced energy-saving technology in next-generation electronics applications}, pages = {074009}, keywords = {-}, misc2 = {EMPIR 2016: Energy}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-0233, 1361-6501}, DOI = {10.1088/1361-6501/ab82c1}, stag_bib_extends_levelofaccess = {NA}, author = {Mor{\'a}n-Meza, J.A. and Delvall{\'e}e, A. and Allal, D. and Piquemal, F.} } @Proceedings { SilvaPA2020, subid = {1612}, title = {Uncertainty Analysis in the Measurement of Switching Losses in GaN FETs Power Converters}, journal = {2020 IEEE International Instrumentation and Measurement Technology Conference (I2MTC)}, year = {2020}, month = {5}, volume = {2020}, number = {-}, number2 = {16ENG06: ADVENT: Metrology for advanced energy-saving technology in next-generation electronics applications}, pages = {1-6}, keywords = {-}, web_url = {https://ieeexplore.ieee.org/document/9129552}, misc2 = {EMPIR 2016: Energy}, publisher = {IEEE}, event_place = {Dubrovnik, Croatia}, event_name = {2020 IEEE International Instrumentation and Measurement Technology Conference (I2MTC)}, event_date = {25-05-2020 to 28-05-2020}, language = {30}, ISBN = {Electronic ISBN: 978-1-7281-44}, ISSN = {Electronic ISSN: 2642-2077}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {http://hdl.handle.net/2117/328678}, author = {Silva, F. and Pous, M. and Azpurua, M.A.} } @Proceedings { PhungA2020, subid = {1646}, title = {Parasitic Probe Effects in Measurements of Coplanar Waveguides with Narrow Ground Width}, journal = {2020 IEEE 24th Workshop on Signal and Power Integrity (SPI)}, year = {2020}, month = {5}, number2 = {18SIB09: TEMMT: Traceability for electrical measurements at millimetre-wave and terahertz frequencies for communications and electronics technologies}, keywords = {calibration, coplanar waveguides, multiline Thru-Reflect Line (mTRL), probes}, web_url = {https://oar.ptb.de/files/download/5f92a12a4c93902ba0000843}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IEEE}, event_place = {Cologne}, event_name = {2020 IEEE 24th Workshop on Signal and Power Integrity}, event_date = {17-05-2020 to 20-05-2020}, language = {30}, DOI = {10.1109/SPI48784.2020.9218166}, stag_bib_extends_levelofaccess = {NA}, author = {Phung, G.N. and Arz, U.} } @Article { KatiFS2020, subid = {1655}, title = {Investigation of Temperature-Induced Errors in XCT Metrology}, journal = {International Journal of Automation Technology}, year = {2020}, month = {5}, volume = {14}, number = {3}, number2 = {17IND08: AdvanCT: Advanced Computed Tomography for dimensional and surface measurements in industry}, pages = {484-490}, keywords = {length metrology, computed tomography, traceability, temperature measurement}, web_url = {https://www.fujipress.jp/ijat/au/ijate001400030484/}, misc2 = {EMPIR 2017: Industry}, publisher = {Fuji Technology Press Ltd.}, language = {30}, ISSN = {1883-8022, 1881-7629}, DOI = {10.20965/ijat.2020.p0484}, stag_bib_extends_levelofaccess = {NA}, author = {Katić, M. and Ferdelji, N. and Sestan, D.} } @Proceedings { CrottiGDFGLLLBMP2020, subid = {1727}, title = {Measurement of Dynamic Voltage Variation Effect on Instrument Transformers for Power Grid Applications}, journal = {2020 IEEE International Instrumentation and Measurement Technology Conference (I2MTC)}, year = {2020}, month = {5}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, keywords = {Instrument transformers, power grid, power quality, phasor measurement unit, uncertainty}, tags = {SEG}, web_url = {https://zenodo.org/record/4154617\#.X9DyOthKguU}, misc2 = {EMPIR 2017: Industry}, publisher = {IEEE}, event_place = {Dubrovnik, Croatia, Croatia}, event_name = {2020 IEEE International Instrumentation and Measurement Technology Conference (I2MTC)}, event_date = {25-05-2020 to 28-05-2020}, language = {30}, DOI = {10.5281/zenodo.4154617}, stag_bib_extends_levelofaccess = {NA}, author = {Crotti, G. and Giordano, D. and D'Avanzo, G. and Femine, A.D. and Gallo, D. and Landi, C. and Luiso, M. and Letizia, P.S. and Barbieri, L. and Mazza, P. and Palladini, D.} } @Article { PollathLLZZB2020, subid = {1761}, title = {Spin structure relation to phase contrast imaging of isolated magnetic Bloch and N{\'e}el skyrmions}, journal = {Ultramicroscopy}, year = {2020}, month = {5}, volume = {212}, number2 = {17FUN08: TOPS: Metrology for topological spin structures}, pages = {112973}, keywords = {SkyrmionLorentz TEMPhase contrastMagnetic imaging}, web_url = {https://arxiv.org/pdf/2002.12469.pdf}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Elsevier BV}, language = {30}, ISSN = {0304-3991}, DOI = {10.1016/j.ultramic.2020.112973}, stag_bib_extends_levelofaccess = {NA}, author = {P{\"o}llath, S. and Lin, T. and Lei, N. and Zhao, W. and Zweck, J. and Back, C.H.} } @Article { ArrheniusBFPM2020, subid = {1821}, title = {Development and evaluation of a novel analyser for ISO14687 hydrogen purity analysis}, journal = {Measurement Science and Technology}, year = {2020}, month = {5}, volume = {31}, number = {7}, number2 = {16ENG01: MetroHyVe: Metrology for hydrogen vehicles}, pages = {075010}, keywords = {hydrogen, hydrogen purity, analyser, OFCEAS, gas chromatography}, tags = {EnG}, misc2 = {EMPIR 2016: Energy}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-0233, 1361-6501}, DOI = {10.1088/1361-6501/ab7cf3}, stag_bib_extends_levelofaccess = {NA}, author = {Arrhenius, K. and B{\"u}ker, O. and Fischer, A. and Persijn, S. and Murugan, A.} } @Article { FrisvadJMCYGMH2020, subid = {1849}, title = {Survey of Models for Acquiring the Optical Properties of Translucent Materials}, journal = {Computer Graphics Forum}, year = {2020}, month = {5}, volume = {39}, number = {2}, number2 = {18SIB03: BxDiff: New quantities for the measurement of appearance}, pages = {729-755}, keywords = {Appearance, graphics, BRDF, BTDF, BSSRDF,}, web_url = {https://diglib.eg.org/handle/10.1111/cgf14023}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Wiley}, language = {30}, ISSN = {0167-7055, 1467-8659}, DOI = {10.1111/cgf.14023}, stag_bib_extends_levelofaccess = {NA}, author = {Frisvad, J.R. and Jensen, S.A. and Madsen, J.S. and Correia, A. and Yang, L. and Gregersen, S.K.S. and Meuret, Y. and Hansen, P‐E.} } @Article { HuggettHMMZ2020, subid = {1863}, title = {Diagnostic tests for covid-19—improving accuracy and global harmonisation}, journal = {BMJ Opinion}, year = {2020}, month = {5}, number2 = {18HLT03: SEPTIMET: Metrology to enable rapid and accurate clinical measurements in acute management of sepsis}, keywords = {SARS-CoV-2, RT-qPCR, molecular diagnosis}, web_url = {https://blogs.bmj.com/bmj/2020/05/06/diagnostic-tests-for-covid-19-improving-accuracy-and-global-harmonisation/}, misc2 = {EMPIR 2018: Health}, publisher = {BMJ Publishing Group Limited}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://blogs.bmj.com/bmj/2020/05/06/diagnostic-tests-for-covid-19-improving-accuracy-and-global-harmonisation/}, author = {Huggett, J. and Harris, K. and McHugh, T. and Moran-Gilad, J. and Zumla, A.} } @Article { FemineGGLLG2020, subid = {1928}, title = {Power Quality Assessment in Railway Traction Supply Systems}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2020}, month = {5}, volume = {69}, number = {5}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, pages = {2355-2366}, keywords = {Voltage measurement, Rail transportation, Substations, Indexes, Monitoring, standards, power supply quality, power system measurement, railway electrification, substations, traction power supplies}, misc2 = {EMPIR 2016: Energy}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9456, 1557-9662}, DOI = {10.1109/TIM.2020.2967162}, stag_bib_extends_levelofaccess = {NA}, author = {Femine, A.D. and Gallo, D. and Giordano, D. and Landi, C. and Luiso, M. and Giordano, D.} } @Proceedings { MariscottiGFS2020, subid = {1944}, title = {Filter Transients onboard DC Rolling Stock and Exploitation for the Estimate of the Line Impedance}, journal = {2020 IEEE International Instrumentation and Measurement Technology Conference (I2MTC)}, year = {2020}, month = {5}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, keywords = {Harmonics, Power Quality, Power supply transient, Railways, Rolling stock}, web_url = {https://zenodo.org/record/4569878}, misc2 = {EMPIR 2016: Energy}, publisher = {IEEE}, event_place = {Dubrovnik, Croatia}, event_name = {2020 IEEE International Instrumentation and Measurement Technology Conference (I2MTC)}, event_date = {25-05-2020 to 28-05-2020}, language = {30}, DOI = {10.1109/I2MTC43012.2020.9128903}, stag_bib_extends_levelofaccess = {NA}, author = {Mariscotti, A. and Giordano, D. and Femine, A.D. and Signorino, D.} } @Proceedings { CipollettaFGLLGPBFGG2020, subid = {1939}, title = {Monitoring a DC Train Supplied by a Reversible Substation}, journal = {2020 IEEE International Instrumentation and Measurement Technology Conference (I2MTC)}, year = {2020}, month = {5}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, keywords = {Railway system, DC Reversible Substations, Inverting Substations, DC Power Quality, Energy measurement, Energy Savings, Power System Measurement}, web_url = {https://zenodo.org/record/4570008\#.YESU4WhKiCo}, misc2 = {EMPIR 2016: Energy}, publisher = {IEEE}, event_place = {Dubrovnik, Croatia}, event_name = {2020 IEEE International Instrumentation and Measurement Technology Conference (I2MTC)}, event_date = {25-05-2020 to 28-05-2020}, language = {30}, ISBN = {978-1-7281-4461-0}, ISSN = {2642-2077}, DOI = {10.1109/I2MTC43012.2020.9128644}, stag_bib_extends_levelofaccess = {NA}, author = {Cipolletta, G. and Femine, A.D. and Gallo, D. and Landi, C. and Luiso, M. and Gallo, A. and Pastena, L. and Balic, F. and Fernandez, J.Q. and Giordano, D. and Giordano, Domenico} } @Article { PfeiferMFW2020_2, subid = {2098}, title = {The influence of the baseline drift on the resulting extinction values of a cavity attenuated phase shift-based extinction monitor (CAPS PMex)}, journal = {Atmospheric Measurement Techniques}, year = {2020}, month = {5}, volume = {13}, number = {5}, number2 = {16ENV02: Black Carbon: Metrology for light absorption by atmospheric aerosols}, pages = {2161-2167}, keywords = {baseline drift; extinction values; cavity attenuated phase shift-based extinction monitors (CAPS PMex); NO2 ; ambient air; particle extinction; simple linear interpolation; cubic smoothing splines; effective scattering.}, web_url = {https://amt.copernicus.org/articles/13/2161/2020/}, misc2 = {EMPIR 2016: Environment}, publisher = {Copernicus GmbH}, language = {30}, ISSN = {1867-8548}, DOI = {10.5194/amt-13-2161-2020}, stag_bib_extends_levelofaccess = {NA}, author = {Pfeifer, S. and M{\"u}ller, T. and Freedman, A. and Wiedensohler, A.} } @Article { SchumacherSG2020, subid = {2122}, title = {Inhomogeneous field calibration of a magneto-optical indicator film device}, journal = {Measurement Science and Technology}, year = {2020}, month = {5}, volume = {31}, number = {7}, number2 = {15SIB06: NanoMag: Nano-scale traceable magnetic field measurements}, pages = {075009}, keywords = {magneto-optic indicator film (MOIF),microscopic calibration,quantitative,traceable,Faraday effect,magnetic microstructures,stray field measurement}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-0233, 1361-6501}, DOI = {10.1088/1361-6501/ab816e}, stag_bib_extends_levelofaccess = {NA}, author = {Schumacher, H.W. and Sievers, S. and Gerken, M.} } @Article { FinizioWMHLBBMR2020_2, subid = {2379}, title = {Current-induced dynamical tilting of chiral domain walls in curved microwires}, journal = {Applied Physics Letters}, year = {2020}, month = {5}, volume = {116}, number = {18}, number2 = {17FUN08: TOPS: Metrology for topological spin structures}, pages = {182404}, keywords = {domain wall, spin-orbit torque, x-ray microscopy}, misc2 = {EMPIR 2017: Fundamental}, publisher = {AIP Publishing}, language = {30}, ISSN = {0003-6951, 1077-3118}, DOI = {10.1063/5.0005186}, stag_bib_extends_levelofaccess = {NA}, author = {Finizio, S. and Wintz, S. and Mayr, S. and Huxtable, A.J. and Langer, M. and Bailey, J. and Burnell, G. and Marrows, C.H. and Raabe, J.} } @Article { Mitchell2020, subid = {2739}, title = {Scale-invariant spin dynamics and the quantum limits of field sensing}, journal = {New Journal of Physics}, year = {2020}, month = {5}, volume = {22}, number = {5}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, pages = {053041}, keywords = {Fundamental constants, quantum limit}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {1367-2630}, DOI = {10.1088/1367-2630/ab81b8}, stag_bib_extends_levelofaccess = {NA}, author = {Mitchell, M.W.} } @Manual { CultreraCF2020, subid = {1507}, title = {Electrical characterisation of graphene using non-contact and high-throughput methods}, year = {2020}, month = {4}, day = {30}, number2 = {16NRM01: GRACE: Developing electrical characterisation methods for future graphene electronics}, keywords = {graphene, electrical, characterization, standardization}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {INRIM}, language = {30}, ISBN = {978-88-945324-2-5}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://arxiv.org/abs/2007.14047}, author = {Fabricius, A. and Cultrera, A. and Catanzaro, A.} } @Manual { CultreraCF2020_2, subid = {1506}, title = {Electrical characterisation of graphene using contact methods}, year = {2020}, month = {4}, day = {30}, number2 = {16NRM01: GRACE: Developing electrical characterisation methods for future graphene electronics}, keywords = {graphene, eletrical, characterisation, standardization}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {INRIM, Torino, Italy}, language = {30}, ISBN = {978-88-945324-0-1}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://arxiv.org/abs/2007.13348}, author = {Fabricius, A. and Catanzaro, A. and Cultrera, A.} } @Article { SilanderFZZA2020, subid = {1679}, title = {Invar-based refractometer for pressure assessments}, journal = {Optics Letters}, year = {2020}, month = {4}, day = {30}, volume = {45}, number = {9}, number2 = {18SIB04: QuantumPascal: Towards quantum-based realisations of the pascal}, pages = {2652}, keywords = {Gas Modulation Refractometry (GAMOR), Fabry-Perot, Invar}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {The Optical Society}, language = {30}, ISSN = {0146-9592, 1539-4794}, DOI = {10.1364/OL.391708}, stag_bib_extends_levelofaccess = {NA}, author = {Silander, I. and Forss{\'e}n, C. and Zakrisson, J. and Zelan, M. and Axner, O.} } @Article { GomezMMBPM2020, subid = {2738}, title = {Bose-Einstein Condensate Comagnetometer}, journal = {Physical Review Letters}, year = {2020}, month = {4}, day = {29}, volume = {124}, number = {17}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, keywords = {Comagnetometer, BEC}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {0031-9007, 1079-7114}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://arxiv.org/abs/1910.06642}, author = {Gomez, P. and Martin, F. and Mazzinghi, C. and Benedicto Orenes, D. and Palacios, S. and Mitchell, M.W.} } @Article { MitchellP2020, subid = {2742}, title = {Quantum limits to the energy resolution of magnetic field sensors}, journal = {Reviews of Modern Physics}, year = {2020}, month = {4}, day = {28}, volume = {92}, number = {2}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, keywords = {magnetometer, quantum limit}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {0034-6861, 1539-0756}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://arxiv.org/abs/1905.00618}, author = {Mitchell, M.W. and Palacios Alvarez, S.} } @Article { MartinezABNVJHKVKL2020, subid = {1488}, title = {Step height standards based on self-assembly for 3D metrology of biological samples}, journal = {Measurement Science and Technology}, year = {2020}, month = {4}, day = {23}, number2 = {15SIB09: 3DNano: Traceable three-dimensional nanometrology}, keywords = {nanometrology, transfer standard, calibration, CSI, SWLI, AFM, traceability}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-0233, 1361-6501}, DOI = {10.1088/1361-6501/ab8c6a}, stag_bib_extends_levelofaccess = {NA}, author = {Heikkinen, V. and Kassamakov, I. and Viitala, T. and J{\"a}rvinen, M. and Vainikka, T. and Nolvi, A. and Bermudez, C. and Artigas, R. and Martinez, P. and Korpelainen, V. and Lassila, A.} } @Article { SundarapandianL2020, subid = {1797}, title = {On using converging shock waves for pressure amplification in shock tubes}, journal = {Metrologia}, year = {2020}, month = {4}, day = {22}, volume = {57}, number = {3}, number2 = {17IND07: DynPT: Development of measurement and calibration techniques for dynamic pressures and temperatures}, pages = {035008}, keywords = {dynamic pressure amplification,converging shock wave,shock tube,dynamic pressure calibration}, web_url = {https://iopscience.iop.org/article/10.1088/1681-7575/ab7f99/pdf}, misc2 = {EMPIR 2017: Industry}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394}, DOI = {10.1088/1681-7575/ab7f99}, stag_bib_extends_levelofaccess = {NA}, author = {Sundarapandian, S. and Liverts, M.} } @Miscellaneous { SilvaALSCRMBS_2, subid = {1486}, title = {EMUE-D6-4-Mobile Optical Measurement}, year = {2020}, month = {4}, day = {18}, number2 = {17NRM05: EMUE: Advancing measurement uncertainty - comprehensive examples for key international standards}, keywords = {Measurement uncertainty; Calibration; Mobile optical measurement system}, misc2 = {EMPIR 2017: Pre-Co-Normative}, language = {30}, DOI = {10.5281/zenodo.3756658}, stag_bib_extends_levelofaccess = {NA}, author = {Silva, M.A. and Almeida, M.C. and Loureiro, D. and Sousa, J.A. and Cox, M.G. and Ribeiro, A.S. and Martins, L.L. and Brito, R. and Soares, A.C.} } @Article { GedRHO2020, subid = {1739}, title = {Assessing gloss under diffuse and specular lighting}, journal = {Color Research \& Application}, year = {2020}, month = {4}, day = {16}, volume = {45}, number = {4}, number2 = {16NRM08: BiRD: Bidirectional reflectance definitions}, pages = {591-602}, keywords = {Gloss, diffuse lighting, specular lighting, environmental effect, MLDS, Visual perception}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {Wiley}, language = {30}, ISSN = {0361-2317, 1520-6378}, DOI = {10.1002/col.22510}, stag_bib_extends_levelofaccess = {NA}, author = {Ged, G. and Rabal‐Almazor, A‐M. and Himbert, M.E. and Obein, G.} } @Article { ObsilSiiLP2020, subid = {1832}, title = {Optical frequency analysis on dark state of a single trapped ion}, journal = {Optics Express}, year = {2020}, month = {4}, day = {16}, volume = {28}, number = {9}, number2 = {17FUN07: CC4C: Coulomb Crystals for Clocks}, pages = {13091}, keywords = {Optical frequency analysis, dark state of a single trapped ion}, misc2 = {EMPIR 2017: Fundamental}, publisher = {The Optical Society}, language = {30}, ISSN = {1094-4087}, DOI = {10.1364/OE.389411}, stag_bib_extends_levelofaccess = {NA}, author = {Obšil, P. and Slodička, L. and Č{\'i}p, O. and Č{\'i}žek, M. and Lešund{\'a}k, A. and Pham, T.M.} } @Article { RonnbergBGMK2020, subid = {1492}, title = {Comparison of Measurement Methods for the Frequency Range 2–150 kHz (Supraharmonics) Based on the Present Standards Framework}, journal = {IEEE Access}, year = {2020}, month = {4}, day = {15}, volume = {8}, number2 = {18NRM05: SupraEMI: Grid measurements of 2 kHz - 150 kHz harmonics to support normative emission limits for mass-market electrical goods}, pages = {77618-77630}, keywords = {Distortion measurement, electromagnetic compatibility, measurement standards, powerquality, supraharmonics, frequency domain analysis}, web_url = {https://ieeexplore.ieee.org/stamp/stamp.jsp?tp=\&arnumber=9067844}, misc2 = {EMPIR 2018: Pre-Co-Normative}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {2169-3536}, DOI = {10.1109/ACCESS.2020.2987996}, stag_bib_extends_levelofaccess = {NA}, author = {Khokhlov, V. and Meyer, J. and Grevener, A. and Busatto, T. and Ronnberg, S.} } @Miscellaneous { SilvaALSCRMBS, subid = {1484}, title = {EMUE-D1-3-Single Burning Item}, year = {2020}, month = {4}, day = {1}, number2 = {17NRM05: EMUE: Advancing measurement uncertainty - comprehensive examples for key international standards}, keywords = {Measurement uncertainty; Measurement model; SBI – Single Burning Item; Reaction to fire test}, misc2 = {EMPIR 2017: Pre-Co-Normative}, language = {30}, DOI = {10.5281/zenodo.3736602}, stag_bib_extends_levelofaccess = {NA}, author = {Silva, M.A. and Almeida, M.C. and Loureiro, D. and Sousa, J.A. and Cox, M.G. and Ribeiro, A.S. and Martins, L.L. and Brito, R. and Soares, A.C.} } @Techreport { EbertWQ2020_2, subid = {1411}, title = {Towards a TDLAS based optical gas standard for the absolute HCl measurements in flue gases from combustion process}, journal = {HostingInstitution: Physikalisch-Technische Bundesanstalt (PTB)}, year = {2020}, month = {4}, number2 = {16ENV08: IMPRESS 2: Metrology for air pollutant emissions}, keywords = {We present our new dTDLAS based HCl spectrometer, specially designed and optimized to measure traceable HCl concentration in different matrices (high temperature, high water vapor and CO2 contents) motivated by large-scale power stations or biomass burning domestic boilers. This system is designed to serve as an optical gas standard (OGS) and thus as a traceable transfer standard to directly quantify HCl emissions or calibrate HCl sensors or dynamically generated gas standards in the field. It employs a mid-infrared interband cascade laser (ICL) and is targeting the HCl transition lines in the fundamental band to achieve less 1 ppm (at 1 meter) sensitivity and meet the compatibility goal set by lowered HCl ELVs in the European legislation such as the Industrial Emissions Directive (IED).}, web_url = {https://oar.ptb.de/resources/show/10.7795/810.20191105}, misc2 = {EMPIR 2016: Environment}, publisher = {Physikalisch-Technische Bundesanstalt}, language = {30}, ISSN = {ISNI: 0000 0001 2186 1887}, DOI = {10.7795/810.20191105}, stag_bib_extends_levelofaccess = {NA}, author = {Ebert, V. and Werhahn, O. and Qu, Z.} } @Article { AlveseSousaTNGBFPFBO2020, subid = {1468}, title = {New EMPIR project – Metrology for Drug Delivery}, journal = {Flow Measurement and Instrumentation}, year = {2020}, month = {4}, volume = {72}, number = {Special Is}, number2 = {18HLT08: MEDDII: Metrology for drug delivery}, pages = {101716}, keywords = {Microflow, drug delivery, calibration, health}, misc2 = {EMPIR 2018: Health}, publisher = {Elsevier BV}, language = {30}, ISSN = {0955-5986}, DOI = {10.1016/j.flowmeasinst.2020.101716}, stag_bib_extends_levelofaccess = {NA}, author = {Batista, E. and Furtado, A. and Pereira, J. and Ferreira, M. and Bissig, H. and Graham, E. and Niemann, A. and Timmerman, A. and Sousa, J.A. and Ogheard, F.} } @Article { ZhuKPRLP2020, subid = {1480}, title = {Combining Harmonic Laser Beams by Fiber Components for Refractivity–Compensating Two-Color Interferometry}, journal = {Journal of Lightwave Technology}, year = {2020}, month = {4}, volume = {38}, number = {7}, number2 = {18SIB01: GeoMetre: Large-scale dimensional measurements for geodesy}, pages = {1945-1952}, keywords = {Beam properties, photonics crystal fiber (PCF), two–color interferometry, wavelength division multiplexing (WDM)}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0733-8724, 1558-2213}, DOI = {10.1109/JLT.2019.2960473}, stag_bib_extends_levelofaccess = {NA}, author = {Liu, Y. and Rose, A. and Prellinger, G. and K{\"o}chert, P. and Zhu, J. and Pollinger, F.} } @Article { YacootKHDDRVN2020, subid = {1489}, title = {Multiple fibre interferometry setup for probe sample interaction measurements in atomic force microscopy}, journal = {Measurement Science and Technology}, year = {2020}, month = {4}, number2 = {15SIB09: 3DNano: Traceable three-dimensional nanometrology}, keywords = {atomic force microscopy, Fibre interferometry, probe sample interaction, nanometrology}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-0233, 1361-6501}, DOI = {10.1088/1361-6501/ab85d8}, stag_bib_extends_levelofaccess = {NA}, author = {Klapetek, P. and Yacoot, A. and Hortv{\'i}k, V. and Duchoň, V. and Dongmo, H. and Rerucha, S. and Valtr, M. and Nečas, D.} } @Article { PimonSKGMM2020, subid = {1500}, title = {DFT calculation of 229thorium-doped magnesium fluoride for nuclear laser spectroscopy}, journal = {Journal of Physics: Condensed Matter}, year = {2020}, month = {4}, volume = {32}, number = {25}, number2 = {17FUN07: CC4C: Coulomb Crystals for Clocks}, pages = {255503}, keywords = {DFT, thorium,MgF2, nuclear clock}, web_url = {https://iopscience.iop.org/article/10.1088/1361-648X/ab7c90/pdf}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {0953-8984, 1361-648X}, DOI = {10.1088/1361-648X/ab7c90}, stag_bib_extends_levelofaccess = {NA}, author = {Pimon, M. and Gugler, J. and Mohn, P. and Kazakov, G.A. and Mauser, N. and Schumm, T.} } @Article { GeislerH2020, subid = {1567}, title = {Direct approach to determine the size setting error and size resolution of an optical particle counter}, journal = {Review of Scientific Instruments}, year = {2020}, month = {4}, volume = {91}, number = {4}, number2 = {16ENV07: AEROMET: Aerosol metrology for atmospheric science and air quality}, pages = {045105}, keywords = {cleanroom, light scattering, airborne particle counters, particle contamination, quality assurance, size resolution, calibration}, misc2 = {EMPIR 2016: Environment}, publisher = {AIP Publishing}, language = {30}, ISSN = {0034-6748, 1089-7623}, DOI = {10.1063/1.5142907}, stag_bib_extends_levelofaccess = {NA}, author = {Geisler, Mathias and Hensey, Garry} } @Article { D039AvanzoDGLL2020, subid = {1742}, title = {Impact of inductive current transformers on synchrophasor measurement in presence of modulations}, journal = {Measurement}, year = {2020}, month = {4}, volume = {155}, number = {1}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, pages = {107535}, keywords = {Current transformer (CT), Power system measurements, Synchrophasor measurement, Phasor measurement unit (PMU), Amplitude modulation, Phase modulation, Frequency modulation}, tags = {SEG}, misc2 = {EMPIR 2017: Industry}, publisher = {Elsevier BV}, language = {30}, ISSN = {0263-2241}, DOI = {10.1016/j.measurement.2020.107535}, stag_bib_extends_levelofaccess = {NA}, author = {D'Avanzo, G. and Delle Femine, A. and Gallo, D. and Landi, C. and Luiso, M.} } @Article { ChretienLSS2020, subid = {1756}, title = {Efficient Hyper-Parameter Selection in Total Variation-Penalised XCT Reconstruction Using Freund and Shapire’s Hedge Approach}, journal = {Mathematics}, year = {2020}, month = {4}, volume = {8}, number = {4}, number2 = {17IND08: AdvanCT: Advanced Computed Tomography for dimensional and surface measurements in industry}, pages = {493}, keywords = {hyper-parameter selection, image reconstruction, limited data reconstruction, total variation regularisation, cone-beam computed tomography}, web_url = {https://www.mdpi.com/2227-7390/8/4/493}, misc2 = {EMPIR 2017: Industry}, publisher = {MDPI AG}, language = {30}, ISSN = {2227-7390}, DOI = {10.3390/math8040493}, stag_bib_extends_levelofaccess = {NA}, author = {Chretien, S. and Lohvithee, M. and Sun, W. and Soleimani, M.} } @Article { SliwczynskiKIESPB2020, subid = {1851}, title = {Fiber-Based UTC Dissemination Supporting 5G Telecommunications Networks}, journal = {IEEE Communications Magazine}, year = {2020}, month = {4}, volume = {58}, number2 = {18SIB06: TiFOON: Advanced time/frequency comparison and dissemination through optical telecommunication networks}, pages = {67-73}, keywords = {time transfer, frequency transfer, fiber optic, 5G, network synchronization, synchronization supervision}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IEEE}, language = {30}, DOI = {10.5281/zenodo.3903158}, stag_bib_extends_levelofaccess = {NA}, author = {Śliwczyński, L. and Krehlik, P. and Imlau, H. and Ender, H. and Schnatz, H. and Piester, D. and Bauch, A.} } @Miscellaneous { RibeiroCSM, subid = {1485}, title = {EMUE-D4-5-Thermal Comfort}, year = {2020}, month = {3}, day = {30}, number2 = {17NRM05: EMUE: Advancing measurement uncertainty - comprehensive examples for key international standards}, keywords = {Measurement uncertainty; Thermal comfort; Implicit model formulation; Monte Carlo model}, misc2 = {EMPIR 2017: Pre-Co-Normative}, language = {30}, DOI = {10.5281/zenodo.3733403}, stag_bib_extends_levelofaccess = {NA}, author = {Ribeiro, A.S. and Cox, M.G. and Sousa, J.A. and Martins, L.L.} } @Article { GalloDCLL2020, subid = {2308}, title = {Design and Characterization of a Stand-Alone Merging Unit}, journal = {ACTA IMEKO}, year = {2020}, month = {3}, day = {30}, volume = {9}, number = {1}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, pages = {40}, keywords = {power system measurement, power system diagnostics, stand-alone merging unit, time synchronisation, analogue-to-digital converter}, misc2 = {EMPIR 2017: Industry}, publisher = {IMEKO International Measurement Confederation}, language = {30}, ISSN = {2221-870X}, DOI = {10.21014/acta_imeko.v9i1.753}, stag_bib_extends_levelofaccess = {NA}, author = {Gallo, D. and Delle Femine, A. and Cipolletta, G. and Landi, C. and Luiso, M.} } @Article { UbbelohdeHPWRGF2020, subid = {1470}, title = {Trapping and Counting Ballistic Nonequilibrium Electrons}, journal = {Physical Review Letters}, year = {2020}, month = {3}, day = {27}, volume = {124}, number = {12}, number2 = {17FUN04: SEQUOIA: Single-electron quantum optics for quantum-enhanced measurements}, pages = {127701}, keywords = {Ballistic transport, Electron relaxation, Semiconductor quantum optics, Full counting statistics}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society}, language = {30}, ISSN = {1079-7114}, DOI = {10.1103/PhysRevLett.124.127701}, stag_bib_extends_levelofaccess = {NA}, author = {Freise, L. and Gerster, T. and Reifert, D. and Weimann, T. and Pierz, K. and Hohls, F. and Ubbelohde, N.} } @Article { OjalaBTPZTSGP2020, subid = {1496}, title = {Calculated beam quality correction factors for ionization chambers in MV photon beams}, journal = {Physics in Medicine \& Biology}, year = {2020}, month = {3}, day = {26}, volume = {65}, number = {7}, number2 = {16NRM03: RTNORM: kQ factors in modern external beam radiotherapy applications to update IAEA TRS-398}, pages = {075003}, keywords = {kQ factors, radiotherapy dosimetry, Monte Carlo}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {IOP Publishing}, language = {30}, ISSN = {1361-6560}, DOI = {10.1088/1361-6560/ab7107}, stag_bib_extends_levelofaccess = {NA}, author = {Tikkanen, J. and Zink, K. and Pimpinella, M. and Teles, P. and Borbinha, J. and Ojala, J. and Siiskonen, T. and Gom{\`a}, C. and Pinto, M.} } @Miscellaneous { SousaPvCFDBKE, subid = {1467}, title = {EMUE-D1-2-Bayesian Mass Calibration}, year = {2020}, month = {3}, day = {25}, number2 = {17NRM05: EMUE: Advancing measurement uncertainty - comprehensive examples for key international standards}, keywords = {Bayesian statistics, measurement uncertainty, prior knowledge, calibration}, misc2 = {EMPIR 2017: Pre-Co-Normative}, language = {30}, DOI = {10.5281/zenodo.3726908}, stag_bib_extends_levelofaccess = {NA}, author = {Sousa, J.A. and Pellegrino, O. and van der Veen, A.M.H. and Cox, M.G. and Fischer, N. and Demeyer, S. and Bošnjakovic, A. and Karahodžić, V. and Elster, C.} } @Article { PeregoDS2020, subid = {1700}, title = {Electro-Optical Ion Trap for Experiments with Atom-Ion Quantum Hybrid Systems}, journal = {Applied Sciences}, year = {2020}, month = {3}, day = {25}, volume = {10}, number = {7}, number2 = {17FUN07: CC4C: Coulomb Crystals for Clocks}, pages = {2222}, keywords = {Paul traps; ion optical trapping; atom-ion interactions; atom-ion mixtures}, web_url = {https://www.mdpi.com/2076-3417/10/7/2222}, misc2 = {EMPIR 2017: Fundamental}, publisher = {MDPI AG}, language = {30}, ISSN = {2076-3417}, DOI = {10.3390/app10072222}, stag_bib_extends_levelofaccess = {NA}, author = {Perego, E. and Duca, L. and Sias, C.} } @Article { Pearce2020, subid = {1708}, title = {A validated physical model of the thermoelectric drift of Pt-Rh thermocouples above 1200 \(^{\circ}\)C}, journal = {Metrologia}, year = {2020}, month = {3}, day = {25}, volume = {57}, number = {2}, number2 = {17IND04: EMPRESS 2: Enhancing process efficiency through improved temperature measurement 2}, pages = {025009}, keywords = {thermocouple, Pt-Rh, thermoelectric drift, calibration}, misc2 = {EMPIR 2017: Industry}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/ab71b3}, stag_bib_extends_levelofaccess = {NA}, author = {Pearce, J.} } @Miscellaneous { vanderVeenHCPE, subid = {1459}, title = {EMUE-D2-1-Muticomponent Materials}, year = {2020}, month = {3}, day = {22}, number2 = {17NRM05: EMUE: Advancing measurement uncertainty - comprehensive examples for key international standards}, keywords = {Conformity assessment; Multicomponent material; Measurement uncertainty; Risk of false decision; Correlated test results}, misc2 = {EMPIR 2017: Pre-Co-Normative}, language = {30}, DOI = {10.5281/zenodo.3723507}, stag_bib_extends_levelofaccess = {NA}, author = {van der Veen, A.M.H and Harris, P and Cox, M.G and Pennecchi, F and Ellison, S.L.R} } @Article { WiartCAL2020, subid = {1529}, title = {Discrepancies of Measured SAR between Traditional and Fast Measuring Systems}, journal = {International Journal of Environmental Research and Public Health}, year = {2020}, month = {3}, day = {22}, volume = {17}, number = {6}, number2 = {16NRM07: Vector SAR: SAR measurement using vector probes}, pages = {2111}, keywords = {specific absorption rate; fast SARmeasurement; field reconstruction; plane-wave expansion;traditional SAR measurement; measurement discrepancy; uncertainty analysis}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {MDPI AG}, language = {30}, ISSN = {1660-4601}, DOI = {10.3390/ijerph17062111}, stag_bib_extends_levelofaccess = {NA}, author = {Liu, Z. and Allal, D. and Cox, M. and Wiart, J.} } @Article { KueraKPBV2020, subid = {1607}, title = {Characterization of a precision modular sinewave generator}, journal = {Measurement Science and Technology}, year = {2020}, month = {3}, day = {17}, volume = {31}, number = {6}, number2 = {17RPT04: VersICaL: A versatile electrical impedance calibration laboratory based on digital impedance bridges}, pages = {064002}, keywords = {signal generator, synthesizer, voltage, calibration, metrology, impedance,AC Josephson effect}, misc2 = {EMPIR 2017: Research Potential}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-0233, 1361-6501}, DOI = {10.1088/1361-6501/ab6f2e}, stag_bib_extends_levelofaccess = {NA}, author = {Kucera, J. and Kov{\'a}č, J. and Palafox, L. and Behr, R. and Voj{\'a}čkov{\'a}, L.} } @Article { MengPPU2016, subid = {1593}, title = {Demonstration of lateral resolution enhancement by focusing amplitude modulated radially polarized light in a confocal imaging system}, journal = {Journal of Optics}, year = {2020}, month = {3}, day = {16}, volume = {22}, number = {4}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {045605}, keywords = {resolution, confocal imaging, polarization}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Science}, language = {30}, DOI = {10.1088/2040-8986/ab7aeb}, stag_bib_extends_levelofaccess = {NA}, author = {Meng, P. and Pham, H-L. and Pereira, S.F. and Urbach, H.P.} } @Thesis { Lindstedt2020, subid = {2367}, title = {Mechanical integration of microprobe as surface roughness tester on roll measuring device}, year = {2020}, month = {3}, day = {16}, number2 = {17IND05: MicroProbes: Multifunctional ultrafast microprobes for on-the-machine measurements}, keywords = {surface roughness, microprobe, roll measuring device, grinding, roll}, web_url = {https://aaltodoc.aalto.fi/handle/123456789/43527}, misc2 = {EMPIR 2017: Industry}, school = {Aalto University}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {http://urn.fi/URN:NBN:fi:aalto-202003222560}, author = {Lindstedt, T.} } @Article { FialovaOVM2020, subid = {2042}, title = {Equipment for Testing Measuring Devices at a Low-Level Radon Activity Concentration}, journal = {International Journal of Environmental Research and Public Health}, year = {2020}, month = {3}, day = {15}, volume = {17}, number = {6}, number2 = {16ENV10: MetroRADON: Metrology for radon monitoring}, pages = {1904}, keywords = {radon; radon chamber; radon source; low-level radon activity concentration}, web_url = {https://www.mdpi.com/1660-4601/17/6/1904}, misc2 = {EMPIR 2016: Environment}, publisher = {MDPI AG}, language = {30}, ISSN = {1660-4601}, DOI = {10.3390/ijerph17061904}, stag_bib_extends_levelofaccess = {NA}, author = {Fialova, E. and Otahal, P.P.S. and Vosahlik, J. and Mazanova, E.} } @Article { ElGawharyvU2020, subid = {1450}, title = {Electromagnetic scattering beyond the weak regime: Solving the problem of divergent Born perturbation series by Pad{\'e} approximants}, journal = {Physical Review Research}, year = {2020}, month = {3}, day = {13}, volume = {2}, number = {1}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {013308}, keywords = {Strong scattering, Born series, perturbation methods, inverse problems, optical metrology, Pad{\'e} approximants}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2643-1564}, DOI = {10.1103/PhysRevResearch.2.013308}, stag_bib_extends_levelofaccess = {NA}, author = {van der Sijs, T. A. and El Gawhary, O. and Urbach, H. P.} } @Article { KorpelainenXD2020, subid = {1476}, title = {Accurate tip characterization in critical dimension atomic force microscopy}, journal = {Measurement Science and Technology}, year = {2020}, month = {3}, day = {13}, number2 = {15SIB09: 3DNano: Traceable three-dimensional nanometrology}, keywords = {atomic force microscopy (AFM), critical dimension (CD), tip characterization, tip correction, morphological operation, dimensional nanometrology, 3D nanometrology}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-0233, 1361-6501}, DOI = {10.1088/1361-6501/ab7fd2}, stag_bib_extends_levelofaccess = {NA}, author = {Dai, G. and Xu, L. and Hahm, K.} } @Techreport { QuNWE2020_2, subid = {1879}, title = {Effects of the spatial heterogeneity of gas matrix and thermal boundary layers on absolute TDLAS HCl measurements in hot flue gases}, journal = {HostingInstitution: Physikalisch-Technische Bundesanstalt}, year = {2020}, month = {3}, day = {13}, number2 = {16ENV08: IMPRESS 2: Metrology for air pollutant emissions}, note = {ISNI: 0000 0001 2186 1887}, keywords = {HCl-dTDLAS ; boundary layer ; temperature gradient ; gas matrix}, web_url = {https://oar.ptb.de/files/download/5e6b76214c9390106c007858}, misc2 = {EMPIR 2016: Environment}, publisher = {Physikalisch-Technische Bundesanstalt}, language = {30}, stag_bib_extends_levelofaccess = {NA}, author = {Qu, Z. and Nwaboh, J. and Werhahn, O. and Ebert, V.} } @Article { GaudinoCASCPC2020, subid = {1537}, title = {Robust optical frequency dissemination with a dual-polarization coherent receiver}, journal = {Optics Express}, year = {2020}, month = {3}, day = {10}, volume = {28}, number = {6}, number2 = {18SIB06: TiFOON: Advanced time/frequency comparison and dissemination through optical telecommunication networks}, pages = {8494}, keywords = {Frequency dissemination, optical fiber, polarization}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {The Optical Society}, language = {30}, ISSN = {1094-4087}, DOI = {10.1364/OE.378602}, stag_bib_extends_levelofaccess = {NA}, author = {Clivati, C. and Savio, P. and Abrate, S. and Curri, V. and Gaudino, R. and Pizzocaro, M. and Calonico, D.} } @Article { ChaeKP2004, subid = {1451}, title = {Realization of 5h/e\verb=^=2 with graphene quantum Hall resistance array}, journal = {Applied Physics Letters}, year = {2020}, month = {3}, day = {4}, volume = {116}, number = {-}, number2 = {18SIB07: GIQS: Graphene impedance quantum standard}, pages = {093102}, keywords = {Quantum Hall effect, quantum Hall array resistance standard, graphene}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {American Institute of Physics}, language = {30}, ISSN = {0003-6951 (print) 1077-3118 (w}, DOI = {10.1063/1.5139965}, stag_bib_extends_levelofaccess = {NA}, author = {Park, J. and Kim, W.-S. and Chae, D.-H.} } @Article { SalmiCVWVYKHS2020, subid = {1354}, title = {AlOx surface passivation of black silicon by spatial ALD: Stability under light soaking and damp heat exposure}, journal = {Journal of Vacuum Science \& Technology A}, year = {2020}, month = {3}, volume = {38}, number = {2}, number2 = {16ENG03: HyMet: Hybrid metrology for thin films in energy applications}, pages = {022401}, keywords = {Spatial Atomic Layer Deposition, aluminum oxide, surface passivation, light soaking, damp heat}, misc2 = {EMPIR 2016: Energy}, publisher = {American Vacuum Society}, language = {30}, ISSN = {0734-2101, 1520-8559}, DOI = {10.1116/1.5133896}, stag_bib_extends_levelofaccess = {NA}, author = {Heikkinen, I.T.S. and Koutsourakis, G. and Virtanen, S. and Yli-Koski, M. and Wood, S. and V{\"a}h{\"a}nissi, V. and Salmi, E. and Castro, F.A. and Savin, H.} } @Article { LucasTECSZ2020, subid = {1449}, title = {Magnetic and multiferroic properties of dilute Fe-doped BaTiO3 crystals}, journal = {APL Materials}, year = {2020}, month = {3}, volume = {8}, number = {3}, number2 = {16ENG06: ADVENT: Metrology for advanced energy-saving technology in next-generation electronics applications}, pages = {031109}, keywords = {multiferroic, X-ray absorption spectroscopy, magnetic measurements}, web_url = {https://aip.scitation.org/doi/10.1063/5.0002863}, misc2 = {EMPIR 2016: Energy}, publisher = {AIP Publishing}, language = {30}, ISSN = {2166-532X}, DOI = {10.1063/5.0002863}, stag_bib_extends_levelofaccess = {NA}, author = {Staruch, M. and ElBidweihy, H. and Cain, M.G. and Thompson, P. and Lucas, C.A. and Finkel, P.} } @Article { RussellPavierPPDYHK2020, subid = {1477}, title = {Bringing real-time traceability to high-speed atomic force microscopy}, journal = {Measurement Science and Technology}, year = {2020}, month = {3}, number2 = {15SIB09: 3DNano: Traceable three-dimensional nanometrology}, keywords = {Metrology, high-speed atomic force microscopy, traceability, nanometrology, nanotechnology}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-0233, 1361-6501}, DOI = {10.1088/1361-6501/ab7ca9}, stag_bib_extends_levelofaccess = {NA}, author = {Heaps, E. and Yacoot, A. and Dongmo, H. and Picco, L. and Payton, O.D. and Russell-Pavier, F.S and Klapetek, P} } @Article { LerouxHHJA2020, subid = {1483}, title = {Number-resolved imaging of 88 Sr atoms in a long working distance optical tweezer}, journal = {SciPost Physics}, year = {2020}, month = {3}, volume = {8}, number = {3}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, keywords = {optical tweezers, atomic imaging}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Stichting SciPost}, language = {30}, ISSN = {2542-4653}, DOI = {10.21468/SciPostPhys.8.3.038}, stag_bib_extends_levelofaccess = {NA}, author = {Jackson, N. and Hanley, R. and Hill, M. and Leroux, F. and Adams, C.} } @Article { BaumannBKEZ2020, subid = {1497}, title = {Monte Carlo calculation of beam quality correction factors in proton beams using TOPAS/GEANT4}, journal = {Physics in Medicine \& Biology}, year = {2020}, month = {3}, volume = {65}, number = {5}, number2 = {16NRM03: RTNORM: kQ factors in modern external beam radiotherapy applications to update IAEA TRS-398}, pages = {055015}, keywords = {radiotherapy dosimetry, protons}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {IOP Publishing}, language = {30}, ISSN = {1361-6560}, DOI = {10.1088/1361-6560/ab6e53}, stag_bib_extends_levelofaccess = {NA}, author = {Baumann, K-S. and Kaupa, S. and Bach, C. and Engenhart-Cabillic, R. and Zink, K.} } @Article { LohHCF2020, subid = {1556}, title = {An Assessment of the Radio Frequency Electromagnetic Field Exposure from A Massive MIMO 5G Testbed}, journal = {2020 14th European Conference on Antennas and Propagation (EuCAP)}, year = {2020}, month = {3}, number2 = {18SIP02: 5GRFEX: Metrology for RF exposure from massive MIMO 5G base station: Impact on 5G network deployment}, pages = {1-5}, keywords = {radio frequency, electromagnetic fieldexposure, software defined radio, massive mimo, testbed}, web_url = {https://arxiv.org/abs/2008.04345}, misc2 = {EMPIR 2018: Support for Impact}, publisher = {IEEE}, language = {30}, DOI = {10.23919/EuCAP48036.2020.9135291}, stag_bib_extends_levelofaccess = {NA}, author = {Loh, T. H. and Heliot, F. and Cheadle, D. and Fielder, T.} } @Inbook { EschelbachLHG2020, subid = {1637}, title = {Untersuchung von Hauptreflektordeformationen an VGOS-Teleskopen mittels UAS}, year = {2020}, month = {3}, number2 = {18SIB01: GeoMetre: Large-scale dimensional measurements for geodesy}, pages = {pp. 411-424}, keywords = {VGOS, VLBI, Radioteleskop Reflektor, Paraboloid, Ring-Fokus-Paraboloid, Unmanned Aircraft System, Deformation, Photogrammetrie, GeoMetre, JRP 18SIB01}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Wichmann Verlag}, booktitle = {Ingenieurvermessung 20: Beitr{\"a}ge zum 19. Internationalen Ingenieurvermessungskurs}, language = {43}, ISBN = {978-3-87907-672-7}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {http://doi.org/10.5281/zenodo.4081146}, author = {Eschelbach, C. and L{\"o}sler, M. and Haas, R. and Greiwe, A.} } @Proceedings { TeniouJPA2020, subid = {1617}, title = {A Fast and Rigorous Assessment of the Specific Absorption Rate (SAR) for MIMO Cellular Equipment Based on Vector Near-Field Measurements}, journal = {2020 14th European Conference on Antennas and Propagation (EuCAP)}, year = {2020}, month = {3}, number = {2020 14th}, number2 = {16NRM07: Vector SAR: SAR measurement using vector probes}, pages = {1-5}, keywords = {SAR, RF Exposure, MIMO, Planar near field measurement, Vector field measurements, Active- Antenna Measurement}, web_url = {https://hal.archives-ouvertes.fr/hal-02954816}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {IEEE}, event_place = {Copenhagen}, event_name = {2020 14th European Conference on Antennas and Propagation (EuCAP)}, event_date = {15-03-2020 to 20-03-2020}, language = {30}, DOI = {10.23919/EuCAP48036.2020.9135506}, stag_bib_extends_levelofaccess = {NA}, author = {Teniou, M. and Jawad, O. and Pannetrat, S. and Aberbour, L.} } @Article { PressyanovD2020, subid = {1752}, title = {THE PROBLEM WITH TEMPERATURE DEPENDENCE OF RADON DIFFUSION CHAMBERS WITH ANTI-THORON BARRIER}, journal = {Romanian Journal of Physics}, year = {2020}, month = {3}, volume = {65}, number = {1-2}, number2 = {16ENV10: MetroRADON: Metrology for radon monitoring}, pages = {801}, keywords = {radon, diffusion chambers, radon permeability, compensated temperaturebias}, web_url = {http://www.nipne.ro/rjp/index.php}, misc2 = {EMPIR 2016: Environment}, publisher = {Publishing house of Romanian Academy}, language = {30}, ISSN = {ISSN 1221-146X}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {http://www.nipne.ro/rjp/2020_65_1-2/RomJPhys.65.801.pdf}, author = {Pressyanov, D. and Dimitrov, D.} } @Article { LanevskiMVHKMAKI2020, subid = {1876}, title = {Determining the shape of reflectance reference samples for curved surface reflectors}, journal = {Measurement Science and Technology}, year = {2020}, month = {3}, volume = {31}, number = {5}, number2 = {16NRM06: EMIRIM: Improvement of emissivity measurements on reflective insulation materials}, pages = {054010}, keywords = {reflectance, Monte-Carlo, reflective insulators, foil, curved surface, reference sample,additive manufacturing}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-0233, 1361-6501}, DOI = {10.1088/1361-6501/ab68bf}, stag_bib_extends_levelofaccess = {NA}, author = {Lanevski, D. and Manoocheri, F. and Vaskuri, A. and Hameury, J. and Kersting, R. and Monte, C. and Adibekyan, A. and Kononogova, E. and Ikonen, E.} } @Article { OtahalF2020, subid = {2043}, title = {Remarks to history of radon activity concentration metrology}, journal = {Nukleonika}, year = {2020}, month = {3}, volume = {65}, number = {1}, number2 = {16ENV10: MetroRADON: Metrology for radon monitoring}, pages = {45-49}, keywords = {Intercomparison; Metrology; Radon; Radon chamber}, web_url = {http://www.nukleonika.pl/www/back/full/vol65_2020/v65n1p045f.pdf}, misc2 = {EMPIR 2016: Environment}, publisher = {Walter de Gruyter GmbH}, language = {30}, ISSN = {1508-5791}, DOI = {10.2478/nuka-2020-0006}, stag_bib_extends_levelofaccess = {NA}, author = {Otahal, P.P.S. and Fialova, E.} } @Article { RabagoFCFFQPCQS2020, subid = {2029}, title = {Intercomparison of Indoor Radon Measurements Under Field Conditions In the Framework of MetroRADON European Project}, journal = {International Journal of Environmental Research and Public Health}, year = {2020}, month = {3}, volume = {17}, number = {5}, number2 = {16ENV10: MetroRADON: Metrology for radon monitoring}, pages = {1780}, keywords = {radon, proficiency test, quality assurance, metrology, interlaboratory comparison}, web_url = {https://www.mdpi.com/1660-4601/17/5/1780}, misc2 = {EMPIR 2016: Environment}, publisher = {MDPI AG}, language = {30}, ISSN = {1660-4601}, DOI = {10.3390/ijerph17051780}, stag_bib_extends_levelofaccess = {NA}, author = {Rabago, D. and Fuente, I. and Celaya, S. and Fernandez , A. and Fernandez, E. and Quindos, J. and Pol, R. and Cinelli, G. and Quindos, L. and Sainz, C.} } @Article { JonesPS2020, subid = {2731}, title = {Probing new physics using Rydberg states of atomic hydrogen}, journal = {Physical Review Research}, year = {2020}, month = {3}, volume = {2}, number = {1}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, keywords = {Rydberg states, Standard Model, new physics beyond SM}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2643-1564}, DOI = {10.1103/PhysRevResearch.2.013244}, stag_bib_extends_levelofaccess = {NA}, author = {Jones, M.P.A. and Potvliege, R.M. and Spannowsky, M.} } @Article { TangSLKNBMSCKMKBNMKKSSDPvM2020, subid = {1473}, title = {Clinical quantitative cardiac imaging for the assessment of myocardial ischaemia}, journal = {Nature Reviews Cardiology}, year = {2020}, month = {2}, day = {24}, number2 = {15HLT05: PerfusImaging: Metrology for multi-modality imaging of impaired tissue perfusion}, keywords = {cardiac imaging, myocardial ischaemia}, misc2 = {EMPIR 2015: Health}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {1759-5002, 1759-5010}, DOI = {10.1038/s41569-020-0341-8}, stag_bib_extends_levelofaccess = {NA}, author = {Dewey, M. and Siebes, M. and Kachelrie{\ss}, M. and Kofoed, K.F. and Maurovich-Horvat, P. and Nikolaou, K. and Bai, W. and Kofler, A. and Manka, R. and Kozerke, S. and Chiribiri, A. and Schaeffter, T. and Michallek, F. and Bengel, F. and Nekolla, S. and Knaapen, P. and Lubberink, M. and Senior, R. and Tang, M-X. and Piek, J.J. and van de Hoef, T. and Martens, J. and Schreiber, L.} } @Article { GogyanKBZ2020, subid = {1481}, title = {Characterisation and feasibility study for superradiant lasing in 40Ca atoms}, journal = {Optics Express}, year = {2020}, month = {2}, day = {24}, volume = {28}, number = {5}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, pages = {6881}, keywords = {optical clock, superradiance}, misc2 = {EMPIR 2017: Fundamental}, publisher = {The Optical Society}, language = {30}, ISSN = {1094-4087}, DOI = {10.1364/OE.381991}, stag_bib_extends_levelofaccess = {NA}, author = {Gogyan, A. and Kazakov, G. and Bober, M. and Zawada, M.} } @Article { PichonLD2020, subid = {1512}, title = {Assessment of Human Exposure in Case of Wireless Power Transfer for Automotive Applications using Stochastic Models}, journal = {Applied Computational Electromagnetics Society Journal}, year = {2020}, month = {2}, day = {22}, volume = {35}, number = {3}, number2 = {16ENG08: MICEV: Metrology for inductive charging of electric vehicles}, pages = {6 pages}, keywords = {Human exposure, Stochastic models, Wireless power transfer.}, web_url = {https://hal.archives-ouvertes.fr/hal-02568258}, misc2 = {EMPIR 2016: Energy}, publisher = {ACES Journal}, language = {30}, ISSN = {1054-4887}, stag_bib_extends_levelofaccess = {NA}, author = {Pichon, L. and Lagouanelle, P. and Deshmukh, S.} } @Article { TxoperenaRLFERAPCCCCHMZK2020, subid = {1505}, title = {Towards standardisation of contact and contactless electrical measurements of CVD graphene at the macro-, micro- and nano-scale}, journal = {Scientific Reports}, year = {2020}, month = {2}, day = {21}, volume = {10}, number = {1}, number2 = {16NRM01: GRACE: Developing electrical characterisation methods for future graphene electronics}, pages = {3223}, keywords = {Characterization and analytical techniques,Electronic properties and devices,Imaging techniques,Materials science,Nanoscience and technology,Physics,Graphene}, web_url = {https://www.nature.com/articles/s41598-020-59851-1}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2045-2322}, DOI = {10.1038/s41598-020-59851-1}, stag_bib_extends_levelofaccess = {NA}, author = {Melios, C. and Huang, N. and Callegaro, L. and Centeno, A. and Cultrera, A. and Cordon, A. and Panchal, V. and Arnedo, I. and Redo-Sanchez, A. and Etayo, D. and Fernandez, M. and Lopez, A. and Rozhko, S. and Txoperena, O. and Zurutuza, A. and Kazakova, O.} } @Article { BehlerU2020, subid = {2542}, title = {Activation in human auditory cortex in relation to the loudness and unpleasantness of low-frequency and infrasound stimuli}, journal = {PLOS ONE}, year = {2020}, month = {2}, day = {21}, volume = {15}, number = {2}, number2 = {15HLT03: Ears II: Metrology for modern hearing assessment and protecting public health from emerging noise sources}, pages = {e0229088}, keywords = {loudness, infrasound, functional resonance imaging, annoyance}, misc2 = {EMPIR 2015: Health}, publisher = {Public Library of Science (PLoS)}, language = {30}, ISSN = {1932-6203}, DOI = {10.1371/journal.pone.0229088}, stag_bib_extends_levelofaccess = {NA}, author = {Behler, O. and Uppenkamp, S.} } @Article { PeralesMHV2020, subid = {1725}, title = {Evaluating the Graininess Attribute by Visual Scaling for Coatings with Special-Effect Pigments}, journal = {Coatings}, year = {2020}, month = {2}, day = {20}, volume = {10}, number = {316}, number2 = {16NRM08: BiRD: Bidirectional reflectance definitions}, pages = {1-10}, keywords = {special-effect pigments, graininess, psychophysical experiment, visual perception}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {MDPI}, address = {Basel (Switzerland)}, language = {30}, ISSN = {2079-6412}, DOI = {10.3390/coatings10040316}, stag_bib_extends_levelofaccess = {NA}, author = {Perales, E. and Mic{\'o}-Vicent, B. and Huraibat, K. and Viqueira, V.} } @Article { MingottiPT2020, subid = {2346}, title = {Calibration Procedure to Test the Effects of Multiple Influence Quantities on Low-Power Voltage Transformers}, journal = {Sensors}, year = {2020}, month = {2}, day = {20}, volume = {20}, number = {4}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, pages = {1172}, keywords = {accuracy, voltage transformer, influence quantities, calibration procedure, temperature, electric field, frequency, ratio error, phase displacement}, web_url = {https://www.mdpi.com/1424-8220/20/4/1172}, misc2 = {EMPIR 2017: Industry}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s20041172}, stag_bib_extends_levelofaccess = {NA}, author = {Mingotti, A. and Peretto, L. and Tinarelli, R.} } @Article { WallerandTG2020, subid = {1424}, title = {Assessment of the mechanical errors of a prototype of an optical multilateration system}, journal = {Review of Scientific Instruments}, year = {2020}, month = {2}, day = {18}, volume = {91}, number = {2}, number2 = {17IND03: LaVA: Large Volume Metrology Applications}, pages = {025004}, keywords = {-}, web_url = {https://aip.scitation.org/doi/figure/10.1063/1.5132933}, misc2 = {EMPIR 2017: Industry}, publisher = {AIP Publishing}, address = {1305 Walt Whitman Road Suite 300 Suite 300 Melville NY 11747 United States}, language = {30}, ISSN = {0034-6748, 1089-7623}, DOI = {10.1063/1.5132933}, stag_bib_extends_levelofaccess = {NA}, author = {Guillory, J. and Truong, D. and Wallerand, J.-P.} } @Article { JeziorskiLSP2020, subid = {1437}, title = {QED calculation of the dipole polarizability of helium atom}, journal = {Physical Review A}, year = {2020}, month = {2}, day = {18}, volume = {101}, number = {2}, number2 = {18SIB04: QuantumPascal: Towards quantum-based realisations of the pascal}, pages = {022505}, keywords = {Electron correlation calculations for atoms \& ionsElectronic structure of atoms \& moleculesFine \& hyperfine structureRelativistic \& quantum electrodynamic effects in atoms, molecules,\& ions}, web_url = {https://arxiv.org/abs/1912.12242}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2469-9926, 2469-9934}, DOI = {10.1103/PhysRevA.101.022505}, stag_bib_extends_levelofaccess = {NA}, author = {Puchalski, M. and Szalewicz, K. and Lesiuk, M. and Jeziorski, B.} } @Techreport { WeberHSRDBMHKMENHSW2020, subid = {1431}, title = {Document specifying rules for the secure use of DCC covering legal aspects of metrology}, journal = {Zenodo}, year = {2020}, month = {2}, day = {12}, number2 = {17IND02: SmartCom: Communication and validation of smart data in IoT-networks}, keywords = {digital calibration certificate (DCC) cryptography minimum requirements data communication IoT-communication IoT-networking SmartCom}, web_url = {https://zenodo.org/record/3664211\#.XlO2QTFKhaR}, misc2 = {EMPIR 2017: Industry}, publisher = {Zenodo}, language = {30}, DOI = {10.5281/zenodo.3664211}, stag_bib_extends_levelofaccess = {NA}, author = {Weber, H. and Hutzschenreuter, D. and Smith, I. and Rhodes, S. and Dawkins, J. and Brown, C. and Maennel, O. and Hovhannisyan, K. and Kuosmanen, P. and Mustap{\"a}{\"a}, T. and Elo, T. and Nikander, P. and Heeren, W. and Sch{\"o}nhals, S. and Wiedenh{\"o}fer, Th.} } @Article { HuynhMOKABKI2020, subid = {1432}, title = {Measurement setup for differential spectral responsivity of solar cells}, journal = {Optical Review}, year = {2020}, month = {2}, day = {12}, number2 = {16ENG02: PV-Enerate: Advanced PV energy rating}, keywords = {Radiometry, Solar cell, Spectral responsivity, Efficacy, Electricity, Bifacial}, web_url = {https://link.springer.com/article/10.1007\%2Fs10043-020-00584-x}, misc2 = {EMPIR 2016: Energy}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {1340-6000, 1349-9432}, DOI = {10.1007/s10043-020-00584-x}, stag_bib_extends_levelofaccess = {NA}, author = {K{\"a}rh{\"a}, P. and Baumgartner, H. and Askola, J. and Kylm{\"a}nen, K. and Oksanen, B. and Maham, K. and Huynh, V. and Ikonen, E.} } @Article { BeyerKP2020, subid = {1356}, title = {An unfolding algorithm for high resolution microcalorimetric beta spectrometry}, journal = {Nuclear Instruments and Methods in Physics Research Section A: Accelerators, Spectrometers, Detectors and Associated Equipment}, year = {2020}, month = {2}, volume = {953}, number2 = {15SIB10: MetroBeta: Radionuclide beta spectra metrology}, pages = {163128}, keywords = {Beta spectrometry, Unfolding, Deconvolution, Microcalorimeter, Monte Carlo Simulation, Bremsstrahlung}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {Elsevier BV}, language = {30}, ISSN = {0168-9002}, DOI = {10.1016/j.nima.2019.163128}, stag_bib_extends_levelofaccess = {NA}, author = {Paulsen, M. and Kossert, K. and Beyer, J.} } @Techreport { EBERTWQ2020_3, subid = {1410}, title = {Mid-IR ICL based TDLAS spectrometer dedicated to monitor HCl concentration in combustion emissions}, journal = {HostingInstitution: Physikalisch-Technische Bundesanstalt (PTB)}, year = {2020}, month = {2}, number2 = {16ENV08: IMPRESS 2: Metrology for air pollutant emissions}, pages = {1-5}, keywords = {direct tunable diode laser absorption spectroscopy (dTDLAS), approach targeting accurate HCl measurements in different matrices motivated by combustion emissions, large-scale power stations, biomass burning domestic boilers, Mid-IR interband cascade laser (ICL), absolute HCl concentrations,hot gas plumes}, web_url = {https://oar.ptb.de/resources/show/10.7795/810.20191119A}, misc2 = {EMPIR 2016: Environment}, publisher = {Physikalisch-Technische Bundesanstalt}, language = {30}, ISSN = {ISNI: 0000 0001 2186 1887}, DOI = {10.7795/810.20191119A}, stag_bib_extends_levelofaccess = {NA}, author = {Ebert, V. and Werhahn, O. and Qu, Z.} } @Techreport { EbertWQ2020_4, subid = {1412}, title = {The spatial heterogeneity effects on dTDLAS-based CO sensor for industrial emission monitoring applications}, journal = {HostingInstitution: Physikalisch-Technische Bundesanstalt (PTB)}, year = {2020}, month = {2}, number2 = {16ENV08: IMPRESS 2: Metrology for air pollutant emissions}, keywords = {Accurate measurement of emissions to the atmosphere is vital to control and reduce air pollution. Industry needs to measure and report emissions for regulatory purposes including assessing stack emissions against concentration limit values. IMPRESS 1 and IMPRESS 2 projects [1] go beyond state of the art in measuring the emissions of critical pollutants with lower emission limit values, requiring detection limits and uncertainties unachievable with current Standard Reference Methods, enabling traceability and directly traceable measurements. Laser-based optical gas sensors provide powerful tools for industrial emission monitoring.Tunable diode laser absorption spectroscopy (TDLAS) is frequently used in science and industry for online and in situ gas analysis. We present our direct TDLAS (dTDLAS) method for absolute gas concentration measurement [2]. Note that the TDLAS is one of the line-of-sight (LOS) absorption spectroscopy techniques, and its application is normally limited to uniform conditions with constant or negligible temperature and/or concentration gradients along the LOS. However, in many applications, for example, combustion diagnostic and cross-stack emission measurements, temperature and concentration gradients along the LOS may occur. In those scenarios, special care should be taken to spectral fitting, line width and concentration quantification [3].This contribution covers a 4.6 \(\mu\)m EC-QCL based TDLAS CO spectrometer. The two gas cells configuration enables to investigate the heterogeneity effects on dTDLAS applications. The CO concentration and line width were measured under different heterogeneous conditions and compared to those under uniform settings. Currently the dTDLAS method is implemented for HCl measurements as a principle technique for cross-stack emission control.The research was supported by IMPRESS2 within EMPIR. The EMPIR initiative is co-funded by the European Union’s Horizon 2020 research and innovation programme and the EMPIR Participating States.}, web_url = {https://oar.ptb.de/resources/show/10.7795/810.20200114}, misc2 = {EMPIR 2016: Environment}, publisher = {Physikalisch-Technische Bundesanstalt}, language = {30}, ISSN = {ISNI: 0000 0001 2186 1887}, DOI = {10.7795/810.20200114}, stag_bib_extends_levelofaccess = {NA}, author = {Ebert, V. and Werhahn, O. and Qu, Z.} } @Article { WallerandTG2020_2, subid = {1423}, title = {Assessment of the mechanical errors of a prototype of an optical multilateration system}, journal = {Review of Scientific Instruments}, year = {2020}, month = {2}, volume = {91}, number = {2}, number2 = {18SIB01: GeoMetre: Large-scale dimensional measurements for geodesy}, pages = {025004}, keywords = {Optical multilateration system, large volume metrology, laser tracker, absolute distance meter,}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {AIP Publishing}, language = {30}, ISSN = {0034-6748, 1089-7623}, DOI = {10.1063/1.5132933}, stag_bib_extends_levelofaccess = {NA}, author = {Guillory, J. and Truong, D. and Wallerand, J.-P.} } @Article { DryakS2020, subid = {1549}, title = {Measurement of the branching ratio related to the internal pair production of Y-90}, journal = {Applied Radiation and Isotopes}, year = {2020}, month = {2}, volume = {156}, number2 = {15HLT06: MRTDosimetry: Metrology for clinical implementation of dosimetry in molecular radiotherapy}, pages = {108942}, keywords = {Measurement of the branching ratio related to the internal pair production of Y-90}, misc2 = {EMPIR 2015: Health}, publisher = {Elsevier BV}, language = {30}, ISSN = {0969-8043}, DOI = {10.1016/j.apradiso.2019.108942}, stag_bib_extends_levelofaccess = {NA}, author = {Dry{\'a}k, P. and Solc, J.} } @Article { CaraFFDTGSH2020, subid = {1568}, title = {Directed Self-Assembly of Polystyrene Nanospheres by Direct Laser-Writing Lithography}, journal = {Nanomaterials}, year = {2020}, month = {2}, volume = {10}, number = {2}, number2 = {16ENV07: AEROMET: Aerosol metrology for atmospheric science and air quality}, pages = {280}, keywords = {directed self-assembly; nanospheres lithography; colloidal nanospheres; directlaser-writing}, web_url = {https://www.researchgate.net/publication/339105418_Directed_Self-Assembly_of_Polystyrene_Nanospheres_by_Direct_Laser-Writing_Lithography/link/5e3d9bbd458515072d88c1ab/download}, misc2 = {EMPIR 2016: Environment}, publisher = {MDPI AG}, address = {Postfach Basel CH-4005 Switzerland}, language = {30}, ISSN = {2079-4991}, DOI = {10.3390/nano10020280}, stag_bib_extends_levelofaccess = {NA}, author = {Cara, Eleonora and Ferrarese Lupi, Federico and Fretto, Matteo and De Leo, Natascia and Tortello, Mauro and Gonnelli, Renato and Sparnacci, Katia and Hensey, Garry} } @Proceedings { ObatonKRMBACD2020, subid = {1759}, title = {Reference standards for XCT measurements of additively manufactured parts }, journal = {Proceedings of the 10th Conference on Industrial Computed Tomography (iCT) 2020}, year = {2020}, month = {2}, number2 = {17IND08: AdvanCT: Advanced Computed Tomography for dimensional and surface measurements in industry}, pages = {152}, keywords = {X-ray computed tomography (XCT), dimensional metrology, reference standards, additive manufacturing}, web_url = {https://www.ndt.net/article/ctc2020/papers/ICT2020_paper_id152.pdf}, misc2 = {EMPIR 2017: Industry}, event_place = {Wels, Austria}, event_name = {10th Conference on Industrial Computed Tomography (iCT 2020)}, event_date = {04-02-2020 to 07-02-2020}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://www.ndt.net/article/ctc2020/papers/ICT2020_paper_id152.pdf}, author = {Obaton, A. and Klingaa, C. and Rivet, C. and Mohaghegh, K. and Baier, S. and Andreasen, J. and Carli, L. and De Chiffre, L.} } @Proceedings { BircherMT2020, subid = {1757}, title = {X-ray source tracking to compensate focal spot drifts for dimensional CT measurements}, journal = {Proceedings of the 10th Conference on Industrial Computed Tomography (iCT) 2020}, year = {2020}, month = {2}, number2 = {17IND08: AdvanCT: Advanced Computed Tomography for dimensional and surface measurements in industry}, pages = {110}, keywords = {industrial CT, X-ray tube, focal spot drift, CT geometry compensation, dimensional metrology}, web_url = {https://www.ndt.net/article/ctc2020/papers/ICT2020_paper_id110.pdf}, misc2 = {EMPIR 2017: Industry}, event_place = {Wels, Austria}, event_name = {10th Conference on Industrial Computed Tomography (iCT 2020)}, event_date = {04-02-2020 to 07-02-2020}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://www.ndt.net/article/ctc2020/papers/ICT2020_paper_id110.pdf}, author = {Bircher, B. and Meli, F. and Thalmann, R.} } @Manual { PearceABEdIKS2020, subid = {1766}, title = {Guidelines on the Calibration of Thermocouples: EURAMET Calibration Guide No. 8}, year = {2020}, month = {2}, number2 = {17IND04: EMPRESS 2: Enhancing process efficiency through improved temperature measurement 2}, keywords = {Thermocouples, calibration, thermoelectric, thermometry, ITS-90, EMPRESS 2}, web_url = {https://www.euramet.org/publications-media-centre/calibration-guidelines/}, misc2 = {EMPIR 2017: Industry}, publisher = {EURAMET}, address = {Braunschweig}, language = {30}, ISBN = {ISBN 978-3-942992-57-2}, ISSN = {N/A}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {ISBN 978-3-942992-57-2}, author = {Pearce, J. and Arifovic, N. and Bojkovski, J. and Edler, F. and de Groot, M. and Izquierdo, G.G. and Kalemci, M. and Strnad, R.} } @Article { BiaekVGAGFU2020, subid = {1904}, title = {Monte Carlo–Based Quantification of Uncertainties in Determining Ocean Remote Sensing Reflectance from Underwater Fixed-Depth Radiometry Measurements}, journal = {Journal of Atmospheric and Oceanic Technology}, year = {2020}, month = {2}, volume = {37}, number = {2}, number2 = {16ENV03: MetEOC-3: Further metrology for earth observation and climate}, pages = {177-196}, keywords = {Monte Carlo, Ocean colour, Uncertainty evaluation, Radiometry}, misc2 = {EMPIR 2016: Environment}, publisher = {American Meteorological Society}, language = {30}, ISSN = {0739-0572, 1520-0426}, DOI = {10.1175/JTECH-D-19-0049.1}, stag_bib_extends_levelofaccess = {NA}, author = {Białek, A. and Vellucci, V. and Gentil, B. and Antoine, D. and Gorro{\~n}o, J. and Fox, N. and Underwood, C.} } @Proceedings { IurlaroSMIBMCFMIPD2020, subid = {2019}, title = {DOSE RATE DATA OF MEASURING INSTRUMENTS USED IN NONGOVERNMENTAL NETWORKS (MINNs) IN THE FRAMEWORK OF PREPAREDNESS EMPIR PROJECT}, journal = {EUROSAFE}, year = {2020}, month = {2}, number2 = {16ENV04: Preparedness: Metrology for mobile detection of ionising radiation following a nuclear or radiological incident}, keywords = {dose rate, measuring instruments, non-governmental networks, preparedness}, web_url = {http://www.etson.eu/sites/default/files/eurosafes/2019/EUROSAFE2019_Proceedings.pdf}, misc2 = {EMPIR 2016: Environment}, event_place = {Cologne}, event_name = {EUROSAFE 2019}, event_date = {04-11-2019 to 05-11-2019}, language = {30}, ISBN = {978-3-947685-51-6}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {978-3-947685-51-6}, author = {Iurlaro, G. and Sperandio, L. and Morosh, V. and ŽIivanovic, M. and Bell, S. and Mariotti, F. and Campani, L. and Ferrari, P. and Morelli, B. and Ioannidis, S. and Pantelić, G. and De Cort, M.} } @Proceedings { ZaniniSSC2020, subid = {2609}, title = {Uncertainty of CT dimensional measurements performed on metal additively manufactured lattice structures}, journal = {Proceeding - 10th Conference on Industrial Computed Tomography, Wels, Austria (iCT 2020), www.ict-conference.com/2020}, year = {2020}, month = {2}, number2 = {17NRM03: EUCoM: Standards for the evaluation of the uncertainty of coordinate measurements in industry}, keywords = {X-ray computed tomography, additive manufacturing, lattice structures, dimensional metrology, uncertainty}, web_url = {https://www.ndt.net/search/docs.php3?id=25084}, misc2 = {EMPIR 2017: Pre-Co-Normative}, event_place = {Wels, Austria}, event_name = {10th Conference on Industrial Computed Tomography 2020}, event_date = {04-02-2020 to 07-02-2020}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://zenodo.org/record/4746036}, author = {Zanini, F. and Sorgato, M. and Savio, E. and Carmignato, S.} } @Article { OverneyPBKBJ2020, subid = {1546}, title = {Load compensation bridge for Josephson arbitrary waveform synthesizers}, journal = {Measurement Science and Technology}, year = {2020}, month = {1}, day = {31}, volume = {31}, number = {5}, number2 = {15SIB04: QuADC: Waveform metrology based on spectrally pure Josephson voltages}, pages = {055004}, keywords = {Load compensation bridge for Josephson arbitrary}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-0233, 1361-6501}, DOI = {10.1088/1361-6501/ab62c7}, stag_bib_extends_levelofaccess = {NA}, author = {Overney, F. and Pimsut, Y. and Bauer, S. and Kieler, O. and Behr, R. and Jeanneret, B.} } @Article { EbertWQ2020, subid = {1407}, title = {The thermal boundary layer effects on line-of-sight TDLAS gas concentration measurements}, journal = {HostingInstitution: Physikalisch-Technische Bundesanstalt}, year = {2020}, month = {1}, day = {30}, number2 = {16ENV08: IMPRESS 2: Metrology for air pollutant emissions}, keywords = {thermal boundary layers, tunable diode laser absorption spectroscopy (TDLAS), spectral collisional widths, gas concentration measurements}, web_url = {https://oar.ptb.de/files/download/5e32e0934c9390355c0049d6}, misc2 = {EMPIR 2016: Environment}, publisher = {Physikalisch-Technische Bundesanstalt}, language = {30}, ISSN = {ISNI: 0000 0001 2186 1887}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://doi.org/10.7795/EMPIR.16ENV08.JA.20200130}, author = {Ebert, V. and Werhahn, O. and Qu, Z.} } @Article { WiekhorstLMSJB2020, subid = {1504}, title = {Quantitative 2D Magnetorelaxometry Imaging of Magnetic Nanoparticles Using Optically Pumped Magnetometers}, journal = {Sensors}, year = {2020}, month = {1}, day = {29}, volume = {20}, number = {3}, number2 = {16NRM04: MagNaStand: Towards an ISO standard for magnetic nanoparticles}, pages = {753}, keywords = {magnetic nanoparticles; optically pumped magnetometers; magnetorelaxometry imaging}, web_url = {https://www.mdpi.com/1424-8220/20/3/753/htm}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s20030753}, stag_bib_extends_levelofaccess = {NA}, author = {Jaufenthaler, A. and Schier, P. and Middelmann, T. and Liebl, M. and Wiekhorst, F. and Baumgarten, D.} } @Article { SchwarzSSBKLMCS2020, subid = {1540}, title = {Coherent laser spectroscopy of highly charged ions using quantum logic}, journal = {Nature}, year = {2020}, month = {1}, day = {29}, volume = {578}, number = {7793}, number2 = {17FUN07: CC4C: Coulomb Crystals for Clocks}, pages = {60-65}, keywords = {spectroscopy highly charged ions atomic clocks3}, web_url = {https://arxiv.org/abs/2010.15984}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {0028-0836, 1476-4687}, DOI = {10.1038/s41586-020-1959-8}, stag_bib_extends_levelofaccess = {NA}, author = {Schwarz, M. and Schm{\"o}ger, L. and Spie{\ss}, L.J. and Benkler, E. and King, S.A. and Leopold, T. and Micke, P. and Crespo L{\'o}pez-Urrutia, J.R. and Schmidt, P.O.} } @Proceedings { Iacomussi2020, subid = {2023}, title = {Metrology Impact of Advanced Driver Assistance Systems}, journal = {Electronic Imaging}, year = {2020}, month = {1}, day = {26}, volume = {2020}, number = {16}, number2 = {16NRM02: SURFACE: Pavement surface characterisation for smart and efficient road lighting}, pages = {202-1-202-6}, keywords = {metrology; mobile laboratory; road maintenance}, web_url = {https://www.ingentaconnect.com/content/ist/ei/2020/00002020/00000016/art00018;jsessionid=eetahr1g8q21.x-ic-live-03}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {Society for Imaging Science \& Technology}, event_place = {Burlingame}, event_name = {Electronic Imaging, Autonomous Vehicles and Machines 2020}, event_date = {26-02-2020 to 30-01-2020}, language = {30}, ISSN = {2470-1173}, DOI = {10.2352/ISSN.2470-1173.2020.16.AVM-202}, stag_bib_extends_levelofaccess = {NA}, author = {Iacomussi, P.} } @Article { HatanoMKTIGFTHGGB2020, subid = {1394}, title = {Spectroscopic investigations of negatively charged tin-vacancy centres in diamond}, journal = {New Journal of Physics}, year = {2020}, month = {1}, day = {23}, volume = {22}, number = {1}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {013048}, keywords = {colour centres, diamond, tin-vacancy centre, single photons,Fourier-limited Emission lines,electron–Phonon scattering}, web_url = {https://iopscience.iop.org/article/10.1088/1367-2630/ab6631/pdf}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {1367-2630}, DOI = {10.1088/1367-2630/ab6631}, stag_bib_extends_levelofaccess = {NA}, author = {G{\"o}rlitz, J. and Herrmann, D. and Thiering, G. and Fuchs, P. and Gandil, M. and Iwasaki, T. and Taniguchi, T. and Kieschnick, M. and Meijer, J. and Hatano, M. and Gali, A. and Becher, C.} } @Article { BurnellLRvHBNSRMHBFZM2020, subid = {1425}, title = {Diameter-independent skyrmion Hall angle observed in chiral magnetic multilayers}, journal = {Nature Communications}, year = {2020}, month = {1}, day = {22}, volume = {11}, number = {1}, number2 = {17FUN08: TOPS: Metrology for topological spin structures}, keywords = {skyrmion motion, spin-orbit torque}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2041-1723}, DOI = {10.1038/s41467-019-14232-9}, stag_bib_extends_levelofaccess = {NA}, author = {Zeissler, K. and Finizio, S. and Barton, C. and Huxtable, A.J. and Massey, J. and Raabe, J. and Sadovnikov, A.V. and Nikitov, S.A. and Brearton, R. and Hesjedal, T. and van der Laan, G. and Rosamond, M.C. and Linfield, E.H. and Burnell, G. and Marrows, C.H.} } @Article { SetionoBNXFKUDFSWP2020, subid = {2362}, title = {In-Plane and Out-of-Plane MEMS Piezoresistive Cantilever Sensors for Nanoparticle Mass Detection}, journal = {Sensors}, year = {2020}, month = {1}, day = {22}, volume = {20}, number = {3}, number2 = {17IND05: MicroProbes: Multifunctional ultrafast microprobes for on-the-machine measurements}, pages = {618}, keywords = {MEMS piezoresistive cantilever sensors, dynamic mode, carbon nanoparticle, particle mass measurement}, misc2 = {EMPIR 2017: Industry}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s20030618}, stag_bib_extends_levelofaccess = {NA}, author = {Setiono, A. and Bertke, M. and Nyang’au, W.O. and Xu, J. and Fahrbach, M. and Kirsch, I. and Uhde, E. and Deutschinger, A. and Fantner, E.J. and Schwalb, C. H. and Wasisto, H.S. and Peiner, E.} } @Article { SarjonenRBSB2020, subid = {1391}, title = {A Versatile Capacitive Sensing Platform for the Assessment of the Composition in Gas Mixtures}, journal = {Micromachines}, year = {2020}, month = {1}, day = {21}, volume = {11}, number = {2}, number2 = {16ENG09: LNG III: Metrological support for LNG and LBG as transport fuel}, pages = {116}, keywords = {energy  transition;  gas  composition  sensor;  capacitive  sensor  array;  interdigitated  electrodes; responsive coatings; tunable filter infrared spectrometer; LNG; biogas}, tags = {EnG}, web_url = {https://www.mdpi.com/2072-666X/11/2/116/pdf}, misc2 = {EMPIR 2016: Energy}, publisher = {MDPI AG}, address = {Postfach Basel CH-4005 Switzerland}, language = {30}, ISSN = {2072-666X}, DOI = {10.3390/mi11020116}, stag_bib_extends_levelofaccess = {NA}, author = {Sweelssen, J. and Blokland, H. and Rajamaki, T. and Sarjonen, R. and Boersma, A.} } @Thesis { Marzano2020, subid = {2221}, title = {Novel devices and methods for quantum resistance and impedance metrology}, year = {2020}, month = {1}, day = {13}, number2 = {18SIB07: GIQS: Graphene impedance quantum standard}, keywords = {resistance metrology, impedance metrology, quantum Hall effect, impedance bridge, fully-digital impedance bridge}, misc2 = {EMPIR 2018: SI Broader Scope}, school = {Politecnico di Torino, Torino, Italy}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {http://hdl.handle.net/11583/2779393}, author = {Marzano, M.} } @Article { PierreRS2020, subid = {1246}, title = {Experimental facility for the production of reference atmosphere of radioactive gases (Rn, Xe, Kr, and H isotopes)}, journal = {Applied Radiation and Isotopes}, year = {2020}, month = {1}, volume = {155}, number2 = {16ENV10: MetroRADON: Metrology for radon monitoring}, pages = {108934}, keywords = {Calibration, Radioactive Gas, Metrology, Radon, Xenon, Tritium, Krypton}, misc2 = {EMPIR 2016: Environment}, publisher = {Elsevier BV}, language = {30}, ISSN = {0969-8043}, DOI = {10.1016/j.apradiso.2019.108934}, stag_bib_extends_levelofaccess = {NA}, author = {Sabot, B. and Rodrigues, M. and Pierre, S.} } @Article { SantosCMGPAMI2020, subid = {1338}, title = {Overview and calculation of X‐ray K‐shell transition yields for comprehensive data libraries}, journal = {X-Ray Spectrometry}, year = {2020}, month = {1}, number2 = {17FUN02: MetroMMC: Measurement of fundamental nuclear decay data using metallic magnetic calorimeters}, keywords = {X-ray K-shell transition yields}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Wiley}, language = {30}, ISSN = {0049-8246, 1097-4539}, DOI = {10.1002/xrs.3123}, stag_bib_extends_levelofaccess = {NA}, author = {Martins, L. and Amaro, P. and Pessanha, S. and Guerra, M. and Machado, J. and Carvalho, M. L. and Santos, J. P. and Indelicato, P.} } @Article { MatousekSPFLD2020, subid = {1375}, title = {Influence of mounting on the optical surface figure in optical reference surfaces}, journal = {Journal of Instrumentation}, year = {2020}, month = {1}, volume = {15}, number = {01}, number2 = {15SIB01: FreeFORM: Reference algorithms and metrology on aspherical and freeform lenses}, pages = {P01005}, keywords = {Optics; Overall mechanics design (support structures and materials, vibration analysisetc); Manufacturing; Interferometry}, web_url = {https://iopscience.iop.org/article/10.1088/1748-0221/15/01/P01005\#back-to-top-target}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {1748-0221}, DOI = {10.1088/1748-0221/15/01/P01005}, stag_bib_extends_levelofaccess = {NA}, author = {L{\'e}dl, V. and Fortmeier, I. and Psota, P. and Schulz, M. and Matoušek, O. and Doleček, R.} } @Article { FortmeierSLMSHBBKSE2020, subid = {1374}, title = {Round robin comparison study on the form measurement of optical freeform surfaces}, journal = {Journal of the European Optical Society-Rapid Publications}, year = {2020}, month = {1}, volume = {16}, number = {1}, number2 = {15SIB01: FreeFORM: Reference algorithms and metrology on aspherical and freeform lenses}, keywords = {Freeform optical surfaces, Metrology, Interlaboratory comparison}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {1990-2573}, DOI = {10.1186/s41476-019-0124-1}, stag_bib_extends_levelofaccess = {NA}, author = {Fortmeier, I. and Schachtschneider, R. and L{\'e}dl, V. and Matoušek, O. and Siepmann, J. and Harsch, A. and Beisswanger, R. and Bitou, Y. and Kondo, Y. and Schulz, M. and Elster, C.} } @Article { MinkMFMZSBSMNAAL2020, subid = {1399}, title = {Experimental Low-Latency Device-Independent Quantum Randomness}, journal = {Physical Review Letters}, year = {2020}, month = {1}, volume = {124}, number = {1}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, keywords = {quantum randomness}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, address = {1 Research Rd Attn: Mark Doyle Ridge 11961-9000 United States}, language = {30}, ISSN = {0031-9007, 1079-7114}, DOI = {10.1103/PhysRevLett.124.010505}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://arxiv.org/abs/1812.07786}, author = {Zhang, Y. and Shalm, L.K. and Bienfang, J.C. and Stevens, M.J. and Mazurek, M.D. and Nam, S.W. and Abell{\'a}n, C. and Amaya, W. and Mitchell, M.W. and Fu, H. and Miller, C.A. and Mink, A. and Knill, E.} } @Article { LeviBTCLL2020, subid = {1397}, title = {Sideband-Enhanced Cold Atomic Source for Optical Clocks}, journal = {Physical Review Applied}, year = {2020}, month = {1}, volume = {13}, number = {1}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, pages = {014013}, keywords = {Optical Lattice Clock,cold atomic sources}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, address = {1 Research Rd Attn: Mark Doyle Ridge 11961-9000 United States}, language = {30}, ISSN = {2331-7019}, DOI = {10.1103/PhysRevApplied.13.014013}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://arxiv.org/abs/1909.05810}, author = {Barbiero, M. and Tarallo, M.G. and Calonico, D. and Levi, F. and Lamporesi, G. and Ferrari, G.} } @Article { ChristensenJHTS2020, subid = {1498}, title = {Lasing on a narrow transition in a cold thermal strontium ensemble}, journal = {Physical Review A}, year = {2020}, month = {1}, volume = {101}, number = {1}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, keywords = {superradiant laser, optical clock, ultra narrow laser}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2469-9926, 2469-9934}, DOI = {10.1103/PhysRevA.101.013819}, stag_bib_extends_levelofaccess = {NA}, author = {Sch{\"a}ffer, S.A. and Tang, M. and Henriksen, M.R. and J{\o}rgensen, A.A. and Christensen, B.T.R.} } @Article { D039ArienzoPDCFMIUS2020, subid = {1548}, title = {Absorbed dose measurements from a 90Y radionuclide liquid solution using LiF:Mg,Cu,P thermoluminescent dosimeters}, journal = {Physica Medica}, year = {2020}, month = {1}, volume = {69}, number2 = {15HLT06: MRTDosimetry: Metrology for clinical implementation of dosimetry in molecular radiotherapy}, pages = {127-133}, keywords = {Absorbed dose measurements from a 90Y}, misc2 = {EMPIR 2015: Health}, publisher = {Elsevier BV}, language = {30}, ISSN = {1120-1797}, DOI = {10.1016/j.ejmp.2019.11.010}, stag_bib_extends_levelofaccess = {NA}, author = {D'Arienzo, M. and Pimpinella, M. and De Coste, V. and Capogni, M. and Ferrari, P. and Mariotti, F. and Iaccarino, G. and Ungania, S. and Strigari, L.} } @Article { CavuotoLGS2020, subid = {1591}, title = {Speed of sound measurements in liquid methane (CH4) at cryogenic temperatures between (130 and 162) K and at pressures up to 10 MPa}, journal = {The Journal of Chemical Thermodynamics}, year = {2020}, month = {1}, volume = {142}, number2 = {16ENG09: LNG III: Metrological support for LNG and LBG as transport fuel}, pages = {106007}, keywords = {Speed of soundMethaneLngNatural gasCryogenic conditions}, tags = {EnG}, misc2 = {EMPIR 2016: Energy}, publisher = {Elsevier BV}, language = {30}, ISSN = {0021-9614}, DOI = {10.1016/j.jct.2019.106007}, stag_bib_extends_levelofaccess = {NA}, author = {Cavuoto, G. and Lago, S. and Giuliano Albo, P.A. and Serazio, D.} } @Article { FlierlRP2020_2, subid = {1564}, title = {Gas weighing challenge}, journal = {Analytical and Bioanalytical Chemistry}, year = {2020}, month = {1}, volume = {412}, number = {1}, number2 = {16ENV06: SIRS: Metrology for stable isotope reference standards}, pages = {1-3}, keywords = {buoyancy correction, gas weighing, gas mixing}, misc2 = {EMPIR 2016: Environment}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {1618-2642, 1618-2650}, DOI = {10.1007/s00216-019-02168-4}, stag_bib_extends_levelofaccess = {NA}, author = {Flierl, Lukas and Rienitz, Olaf and Pramann, Axel} } @Article { ZilbertiKLGCBAZ2020, subid = {1334}, title = {Accuracy Assessment of Numerical Dosimetry for the Evaluation of Human Exposure to Electric Vehicle Inductive Charging Systems}, journal = {IEEE Transactions on Electromagnetic Compatibility}, year = {2020}, volume = {ea}, number = {ea}, number2 = {16ENG08: MICEV: Metrology for inductive charging of electric vehicles}, pages = {1-12}, keywords = {Basic restrictions, electric vehicles, electro-magnetic fields, inductive charging, numerical dosimetry, safety}, misc2 = {EMPIR 2016: Energy}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9375, 1558-187X}, DOI = {10.1109/TEMC.2019.2954111}, stag_bib_extends_levelofaccess = {NA}, author = {Arduino, A. and Bottauscio, O. and Chiampi, M. and Giaccone, L. and Liorni, I. and Kuster, N. and Zilberti, L. and Zucca, M.} } @Article { VilloneVMDSFD2020, subid = {1418}, title = {Mutual Inductance Behavioral Modeling for Wireless Power Transfer System Coils}, journal = {IEEE Transactions on Industrial Electronics}, year = {2020}, volume = {ea}, number = {ea}, number2 = {16ENG08: MICEV: Metrology for inductive charging of electric vehicles}, pages = {1-11}, keywords = {This paper derives low-complexity behavioral analytical models of the mutual inductance between the coupling coils of Wireless Power Transfer Systems (WPTSs), as functions of their reciprocal position. These models are extremely useful in the characterization and design optimization of WPTSs. Multi-Objective Genetic Programming (MOGP) algorithm is adopted to generate models ensuring an optimal trade-off between accuracy and complexity. The training and validation data sets needed for the generation of the models are here obtained by performing numerical full-3D electromagnetic simulations. The resulting behavioral models allow accurate and fast evaluation of the WPTS coils mutual inductance, over a wide range of misalignment conditions, enabling easier system analysis and optimization.}, web_url = {https://ieeexplore.ieee.org/document/8994192}, misc2 = {EMPIR 2016: Energy}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0278-0046, 1557-9948}, DOI = {10.1109/TIE.2019.2962432}, stag_bib_extends_levelofaccess = {NA}, author = {Di Capua, G. and Femia, N. and Stoyka, K. and Di Mambro, G. and Maffucci, A. and Ventre, S. and Villone, F.} } @Article { GoenagaInfantePRdBAC2020, subid = {1417}, title = {The accurate determination of number concentration of inorganic nanoparticles using spICP-MS with the dynamic mass flow approach}, journal = {Journal of Analytical Atomic Spectrometry}, year = {2020}, number2 = {17NRM04: nPSize: Improved traceability chain of nanoparticle size measurements}, keywords = {nanoparticles, nanoparticle number concentration, spICP-MS, inorganic nanoparticles, Au nanoparticles, TiO2 nanoparticles}, web_url = {https://pubs.rsc.org/en/content/articlepdf/2020/ja/c9ja00415g}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {Royal Society of Chemistry (RSC)}, language = {30}, DOI = {10.1039/c9ja00415g}, stag_bib_extends_levelofaccess = {NA}, author = {Cuello-Nu{\~n}ez, S. and Abad-{\'A}lvaro, I. and Bartczak, D. and del Castillo Busto, M.E. and Ramsay, D.A. and Pellegrino, F. and Goenaga-Infante, H.} } @Article { KendigVUMZ2020, subid = {1438}, title = {Dynamic Temperature Measurements of a GaN DC/DC Boost Converter at MHz Frequencies}, journal = {IEEE Transactions on Power Electronics}, year = {2020}, volume = {Not yet pr}, number = {Not yet pr}, number2 = {16ENG06: ADVENT: Metrology for advanced energy-saving technology in next-generation electronics applications}, pages = {1-1}, keywords = {Thermoreflectance measurement , boost converter , gallium nitride, power transistor}, web_url = {http://epubs.surrey.ac.uk/853825/}, misc2 = {EMPIR 2016: Energy}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0885-8993, 1941-0107}, DOI = {10.1109/TPEL.2020.2964996}, stag_bib_extends_levelofaccess = {NA}, author = {Matei, C. and Urbonas, J. and Votsi, H. and Kendig, D. and Aaen, P.H.} } @Article { TummonLKCCCAZSV2020, subid = {1472}, title = {Real-time pollen monitoring using digital holography}, journal = {Atmospheric Measurement Techniques}, year = {2020}, volume = {13}, number2 = {16ENV07: AEROMET: Aerosol metrology for atmospheric science and air quality}, pages = {1539–1550}, keywords = {pollen monitoring, digital holography,}, web_url = {https://www.atmos-meas-tech.net/13/1539/2020/}, misc2 = {EMPIR 2016: Environment}, publisher = {Copernicus Publications}, language = {30}, DOI = {10.5194/amt-13-1539-2020}, stag_bib_extends_levelofaccess = {NA}, author = {Sauvageat , E. and Zeder, Y. and Auderset, K. and Calpini, B. and Clot, B. and Crouzy, B. and Konzelmann, T. and Lieberherr, G. and Tummon, F. and Vasilatou, K.} } @Proceedings { Tarallo2020, subid = {1482}, title = {Toward a quantum-enhanced strontium optical lattice clock at INRIM}, journal = {EPJ Web of Conferences}, year = {2020}, volume = {230}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, pages = {00011}, keywords = {optical clock, entanglement}, misc2 = {EMPIR 2017: Fundamental}, publisher = {EDP Sciences}, event_place = {Catania}, event_name = {fismat 2019}, event_date = {30-09-2019 to 04-10-2019}, language = {30}, ISSN = {2100-014X}, DOI = {10.1051/epjconf/202023000011}, stag_bib_extends_levelofaccess = {NA}, author = {Tarallo, M.G.} } @Article { GuoPBGPKHU2020, subid = {1494}, title = {Interaction of nanoparticle properties and X-ray analytical techniques}, journal = {Journal of Analytical Atomic Spectrometry}, year = {2020}, volume = {35}, number = {5}, number2 = {16ENV07: AEROMET: Aerosol metrology for atmospheric science and air quality}, pages = {1022-1033}, keywords = {X-ray Standing Wavefield, GIXRF, TXRF, NEXAFS, Core-Shell Nanoparticles}, web_url = {https://arxiv.org/abs/2004.02955}, misc2 = {EMPIR 2016: Environment}, publisher = {Royal Society of Chemistry (RSC)}, language = {30}, ISSN = {0267-9477, 1364-5544}, DOI = {10.1039/D0JA00049C}, stag_bib_extends_levelofaccess = {NA}, author = {Unterumsberger, R. and Honicke, P. and Kayser, Y. and Pollakowski-Herrmann, B. and Gholhaki, S. and Guo, Q. and Palmer, R.E. and Beckhoff, B.} } @Article { BinkowskiBCHZB2020, subid = {1557}, title = {Quasinormal mode expansion of optical far-field quantities}, journal = {Physical Review B}, year = {2020}, volume = {102}, number = {3}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {035432}, keywords = {near field to far field transformation, numerical simulation}, web_url = {https://arxiv.org/abs/2003.11305}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2469-9950, 2469-9969}, DOI = {10.1103/PhysRevB.102.035432}, stag_bib_extends_levelofaccess = {NA}, author = {Binkowski, F. and Betz, F. and Colom, R. and Hammerschmidt, M. and Zschiedrich, L. and Burger, S.} } @Article { FlierlRBMS2020, subid = {1598}, title = {Absolute isotope ratios of carbon dioxide – a feasibility study}, journal = {Journal of Analytical Atomic Spectrometry}, year = {2020}, number2 = {16ENV06: SIRS: Metrology for stable isotope reference standards}, keywords = {Gas Metrology, SI traceability, Carbon Dioxide refrence maerial}, web_url = {https://pubs.rsc.org/is/content/articlelanding/2020/ja/d0ja00318b\#!divAbstract}, misc2 = {EMPIR 2016: Environment}, publisher = {Royal Society of Chemistry (RSC)}, language = {30}, ISSN = {0267-9477, 1364-5544}, DOI = {10.1039/d0ja00318b}, stag_bib_extends_levelofaccess = {NA}, author = {Flierl, L. and Rienitz, O. and Brewer, P.J. and Meijer, H.A.J. and Steur, F.M.} } @Proceedings { ShlomaSKNPP2020, subid = {1528}, title = {Analysis of accuracy requirements to the meteorological sensors used to compensate for the influence of the Earth’s atmosphere in high precision length measurement}, journal = {SMSI Sensor and Measurement Science International}, year = {2020}, volume = {SMSI 2020}, number = {2020}, number2 = {18SIB01: GeoMetre: Large-scale dimensional measurements for geodesy}, pages = {279 - 280}, keywords = {length measurement, meteorological sensors, refractive index, gradient method, GeoMetre}, web_url = {https://www.ama-science.org/proceedings/details/3759}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {AMA Association for Sensors and Measurement}, address = {Berlin}, event_place = {Nuremberg, Germany}, event_name = {SMSI 2020}, event_date = {22-06-2020 to 25-06-2020}, language = {30}, ISBN = {978-3-9819376-2-6}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {dx.doi.org/10.5162/SMSI2020/D3.3}, author = {Shloma, A. and Skliarov, V. and Kupko, V. and Neyezhmakov, P. and Panasenko, T. and Prokopov, A.} } @Article { ArrheniusFBAELR2020, subid = {1602}, title = {Analytical methods for the determination of oil carryover from CNG/biomethane refueling stations recovered in a solvent}, journal = {RSC Advances}, year = {2020}, volume = {10}, number = {20}, number2 = {16ENG05: Biomethane: Metrology for biomethane}, pages = {11907-11917}, keywords = {Biomethane oilcarryoveranaytical method}, tags = {EnG}, misc2 = {EMPIR 2016: Energy}, publisher = {Royal Society of Chemistry (RSC)}, language = {30}, ISSN = {2046-2069}, DOI = {10.1039/D0RA01399D}, stag_bib_extends_levelofaccess = {NA}, author = {Arrhenius, K. and Fischer, A. and B{\"u}ker, O. and Adrien, H. and El Masri, A. and Lestremau, F. and Robinson, T.} } @Article { LofdahlJFKKL2020, subid = {1619}, title = {Silver Nanoparticles Alter Cell Viability Ex Vivo and in Vitro and Induce Proinflammatory Effects in Human Lung Fibroblasts}, journal = {Nanomaterials}, year = {2020}, volume = {10}, number = {9}, number2 = {18HLT02: AeroTox: Measurements for mitigating adverse health effects from atmospheric particulate pollutants}, pages = {1868}, keywords = {silver nanoparticles; human lung fibroblasts; precision-cut lung slices; toxicity;extracellular matrix; procollagen; growth factors; cytokines}, misc2 = {EMPIR 2018: Health}, language = {30}, DOI = {10.3390/nano10091868}, stag_bib_extends_levelofaccess = {NA}, author = {L{\"o}fdahl, A. and Jern, A. and Flyman, S. and K{\aa}redal, M. and Karlsson, H.L. and Larsson-Callerfelt , A-K.} } @Article { BurkeUK2020, subid = {1644}, title = {A psychoacoustical study to investigate the perceived unpleasantness of infrasound combined with audio-frequency sound}, journal = {Acta Acustica}, year = {2020}, volume = {4}, number = {5}, number2 = {15HLT03: Ears II: Metrology for modern hearing assessment and protecting public health from emerging noise sources}, pages = {20}, keywords = {Infrasound / Unpleasantness / Psychoacoustic scaling methods / Detection threshold}, misc2 = {EMPIR 2015: Health}, publisher = {EDP Sciences}, language = {30}, ISSN = {2681-4617}, DOI = {10.1051/aacus/2020019}, stag_bib_extends_levelofaccess = {NA}, author = {Burke, E. and Uppenkamp, S. and Koch, C.} } @Article { AkoWHS2020, subid = {1673}, title = {Communication and validation of smart data in IoT-networks}, journal = {Advances in Production Engineering \& Management}, year = {2020}, volume = {15}, number = {Number 1}, number2 = {17IND02: SmartCom: Communication and validation of smart data in IoT-networks}, pages = {pp 107–117}, keywords = {Metrology; Measurement metadata; Information and communication technology (ICT); Smart Data; Data communication; IoT-communication; IoT-networking; Digital calibration certificate}, web_url = {http://apem-journal.org/Archives/2020/Abstract-APEM15-1_107-117.html}, misc2 = {EMPIR 2017: Industry}, publisher = {Advances in Production Engineering \& Management}, language = {30}, DOI = {10.14743/apem2020.1.353}, stag_bib_extends_levelofaccess = {NA}, author = {Acko, B. and Weber, H. and Hutzschenreuter, D. and Smith, I.} } @Article { WanslebenVWBHBK2020, subid = {1685}, title = {Speciation of iron sulfide compounds by means of X-ray emission spectroscopy using a compact full-cylinder von Hamos spectrometer}, journal = {Journal of Analytical Atomic Spectrometry}, year = {2020}, volume = {35}, number = {11}, number2 = {16ENG06: ADVENT: Metrology for advanced energy-saving technology in next-generation electronics applications}, pages = {2679-2685}, keywords = {-}, web_url = {https://arxiv.org/abs/2005.09509}, misc2 = {EMPIR 2016: Energy}, publisher = {Royal Society of Chemistry (RSC)}, language = {30}, ISSN = {0267-9477, 1364-5544}, DOI = {10.1039/D0JA00244E}, stag_bib_extends_levelofaccess = {NA}, author = {Wansleben, M. and Vinson, J. and W{\"a}hlisch, A. and Bzheumikhova, K. and Honicke, P. and Beckhoff, B. and Kayser, Y.} } @Article { WodarczykKl2020, subid = {1691}, title = {A MAINTENANCE-FREE SOLUTION FOR OPTICAL FREQUENCY TRANSFER}, journal = {Metrology and Measurement Systems}, year = {2020}, volume = {27}, number = {3}, number2 = {18SIB06: TiFOON: Advanced time/frequency comparison and dissemination through optical telecommunication networks}, pages = {441–450}, keywords = {fiber-optics, optical frequency transfer, tracking filter, automatic startup}, web_url = {https://zenodo.org/record/4110659\#.X7zfu2j7Q2x}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Polish Academy of Sciences Committee on Metrology and Scientific Instrumentation}, language = {30}, ISSN = {ISSN 0860-8229}, DOI = {10.24425/mms.2020.134586}, stag_bib_extends_levelofaccess = {NA}, author = {Włodarczyk, P. and Krehlik, P. and Śliwczyński, Ł.} } @Article { RuhleH2020, subid = {1718}, title = {Towards Automated Electron Microscopy Image Segmentation for Nanoparticles of Complex Shape by Convolutional Neural Networks}, journal = {Microscopy and Microanalysis}, year = {2020}, volume = {26}, number = {S2}, number2 = {17NRM04: nPSize: Improved traceability chain of nanoparticle size measurements}, pages = {1188}, keywords = {nanoparticles, automation, particle size distribution, convolutional neural networks}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {Cambridge University Press}, address = {Cambridge}, language = {30}, ISSN = {1435-8115}, DOI = {10.1017/S1431927620017262}, stag_bib_extends_levelofaccess = {NA}, author = {R{\"u}hle, B. and Hodoroaba, V-D.} } @Article { PetriniMBTTCDG2020, subid = {1713}, title = {Is a Quantum Biosensing Revolution Approaching? Perspectives in NV‐Assisted Current and Thermal Biosensing in Living Cells}, journal = {Advanced Quantum Technologies}, year = {2020}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {2000066}, keywords = {color centers, diamond, biosensing}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Wiley}, language = {30}, DOI = {10.1002/qute.202000066}, stag_bib_extends_levelofaccess = {NA}, author = {Petrini, G. and Moreva, E. and Bernardi, E. and Traina, P. and Tomagra, G. and Carabelli, V. and Degiovanni, I.P. and Genovese, M.} } @Article { BernardiMTPDFPDOG2020, subid = {1712}, title = {A biocompatible technique for magnetic field sensing at (sub)cellular scale using Nitrogen-Vacancy centers}, journal = {EPJ Quantum Technology}, year = {2020}, volume = {7}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {13}, keywords = {NV centers, Quantum sensing, Magnetic measurements}, misc2 = {EMPIR 2017: Fundamental}, language = {30}, DOI = {10.1140/epjqt/s40507-020-00088-2}, stag_bib_extends_levelofaccess = {NA}, author = {Bernardi, E. and Moreva, E. and Traina, P. and Petrini, G. and Ditalia Tchernij, S. and Forneris, J. and Pastuović, Ž. and Degiovanni, I.P. and Olivero, P. and Genovese, M.} } @Article { HorenzTBNAGV2020, subid = {1716}, title = {A Study on the Analysis of Particle Size Distribution for Bimodal Model Nanoparticles by Electron Microscopy}, journal = {Microscopy and Microanalysis}, year = {2020}, volume = {26}, number = {S2}, number2 = {17NRM04: nPSize: Improved traceability chain of nanoparticle size measurements}, pages = {2282}, keywords = {nanoparticles, size traceability, bi-modal distribution, silica, gold, electron microscoopy}, web_url = {https://www.cambridge.org/core/journals/microscopy-and-microanalysis/article/study-on-the-analysis-of-particle-size-distribution-for-bimodal-model-nanoparticles-by-electron-microscopy/B9157A370AC198219A734770694340F3}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {Cambridge University Press}, address = {Cambridge}, language = {30}, ISSN = {1435-8115}, DOI = {10.1017/S1431927620021054}, stag_bib_extends_levelofaccess = {NA}, author = {H{\"o}renz, C. and Tache, O. and Bartczak, D. and Nunez, S. and Abad Alvaro, I. and Goenaga-Infante, H. and Vasile-Dan Hodoroaba, V-D.} } @Article { HodoroabaCTMOMPM2020, subid = {1717}, title = {Towards 3D Understanding of Non-spherical Nanoparticles by Transmission Kikuchi Diffraction (TKD) for Improved Particle Size Distribution by Electron Microscopy}, journal = {Microscopy and Microanalysis}, year = {2020}, volume = {26}, number = {S2}, number2 = {17NRM04: nPSize: Improved traceability chain of nanoparticle size measurements}, pages = {260}, keywords = {nanoparticles, 3D, Transmission Kikuchi Diffraction (TKD), TiO2, electron microscopy, size, shape}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {Cambridge University Press}, address = {Cambridge}, language = {30}, ISSN = {1435-8115}, DOI = {10.1017/S1431927620013999}, stag_bib_extends_levelofaccess = {NA}, author = {Hodoroaba, V.-D. and Cios, G. and Tokarski, T. and Mansfeld, U. and Ortel, E. and Mielke, J. and Pellegrino, F. and Maurino, V.} } @Article { FidelusC2020, subid = {1788}, title = {Study on short-term creep effect and hysteresis for the HBM Z4A force transducer under compressive and tensile forces}, journal = {ACTA IMEKO}, year = {2020}, volume = {9}, number = {5}, number2 = {18SIB08: ComTraForce: Comprehensive traceability for force metrology services}, keywords = {creep tests, compressive and tensile forces, HBM Z4A force transducer, Force Standard Machine (FSM)}, web_url = {https://acta.imeko.org/index.php/acta-imeko/article/view/IMEKO-ACTA-09\%20\%282020\%29-05-30}, misc2 = {EMPIR 2018: SI Broader Scope}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {http://dx.doi.org/10.21014/acta_imeko.v9i5.956}, author = {Fidelus, J. and Cybul, K.} } @Article { LinYCWGCLXSHCFCTYC2020, subid = {1760}, title = {Perpendicular Magnetic Anisotropy and Dzyaloshinskii-Moriya Interaction at an Oxide/Ferromagnetic Metal Interface}, journal = {Physical Review Letters}, year = {2020}, volume = {124}, number = {21}, number2 = {17FUN08: TOPS: Metrology for topological spin structures}, pages = {217202}, keywords = {DMI, spin waves}, web_url = {https://arxiv.org/abs/2006.14268}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {0031-9007}, DOI = {10.1103/PhysRevLett.124.217202}, stag_bib_extends_levelofaccess = {NA}, author = {Lin , W. and Yang, B. and Chen, A.P. and Wu, X. and Guo, R. and Chen, S. and Liu, L. and Xie, Q. and Shu, X. and Hui, Y. and Chow, G.M. and Feng, Y. and Carlotti, G. and Tacchi, S. and Yang, H. and Chen, J.} } @Article { FidelusK2020, subid = {1793}, title = {GUM’s Rockwell hardness standard machines after modernization}, journal = {ACTA IMEKO}, year = {2020}, volume = {9}, number = {5}, number2 = {18SIB08: ComTraForce: Comprehensive traceability for force metrology services}, pages = {240-246}, keywords = {twin deadweight-type Rockwell hardness standard machines, GUM, hydraulic pump, displacement measuring system,}, web_url = {https://acta.imeko.org/index.php/acta-imeko/article/view/IMEKO-ACTA-09\%20\%282020\%29-05-50}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {ACTA IMEKO}, language = {30}, DOI = {10.21014/acta_imeko.v9i5.977}, stag_bib_extends_levelofaccess = {NA}, author = {Fidelus, J. and Kozuchowski, M. } } @Article { Klaus2020, subid = {1792}, title = {Static and dynamic bridge amplifiercalibration according to ISO 4965-2}, journal = {Acta IMEKO}, year = {2020}, volume = {9}, number = {5}, number2 = {18SIB08: ComTraForce: Comprehensive traceability for force metrology services}, pages = {200-204}, keywords = {Dynamic measurement, International standard ISO 4965, dynamic calibration, force transducers}, web_url = {https://acta.imeko.org/index.php/acta-imeko/article/view/IMEKO-ACTA-09\%20\%282020\%29-05-42}, misc2 = {EMPIR 2018: SI Broader Scope}, language = {30}, DOI = {10.21014/acta_imeko.v9i5.969}, stag_bib_extends_levelofaccess = {NA}, author = {Klaus, L.} } @Article { Roske2020, subid = {1789}, title = {Linear regression analysis and the GUM: example of temperature influence on force transfer transducers}, journal = {ACTA IMEKO}, year = {2020}, volume = {9}, number = {5}, number2 = {18SIB08: ComTraForce: Comprehensive traceability for force metrology services}, keywords = {strain-gauge force, torque transducers, ambient temperature, high-precision force transfer transducers, special temperature chambers}, web_url = {https://acta.imeko.org/index.php/acta-imeko/article/view/IMEKO-ACTA-09\%20\%282020\%29-05-83}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {ACTA IMEKO}, language = {30}, DOI = {10.21014/acta_imeko.v9i5.1010}, stag_bib_extends_levelofaccess = {NA}, author = {R{\"o}ske, D.} } @Proceedings { HahtelaKLMMPYBGKMMPP2020, subid = {1810}, title = {Coulomb Blockade Thermometry on a Wide Temperature Range}, journal = {Proceedings of 2020 Conference on Precision Electromagnetic Measurements (CPEM 2020)}, year = {2020}, number2 = {18SIB02: Real-K: Realising the redefined kelvin}, keywords = {Temperature measurement, thermometers, cryogenics, nanoelectronics, tunneling, single electron devices}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IEEE}, event_place = {Denver (Aurora), CO, USA}, event_name = {2020 Conference on Precision Electromagnetic Measurements (CPEM 2020)}, event_date = {24-08-2020 to 28-08-2020}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://arxiv.org/abs/2101.03932}, author = {Hahtela, O.M. and Kemppinen, A. and Lehtinen, J. and Manninen, A.J. and Mykk{\"a}nen, E. and Prunnila, M. and Yurttag{\"u}l, N. and Blanchet, F. and Gramich, M. and Karimi, B. and Mannila, E.T. and Muhojoki, J. and Peltonen, J.T. and Pekola, J.P.} } @Article { CuelloNunezABdRPG2020, subid = {1848}, title = {The accurate determination of number concentration of inorganic nanoparticles using spICP-MS with the dynamic mass flow approach}, journal = {Journal of Analytical Atomic Spectrometry}, year = {2020}, volume = {35}, number = {9}, number2 = {18SIP01: ISOCONCur: An ISO Technical Report on Nanoparticle Concentration}, pages = {1832-1839}, keywords = {number concentration, spICP-MS, nanoparticle}, misc2 = {EMPIR 2018: Support for Impact}, publisher = {Royal Society of Chemistry (RSC)}, language = {30}, ISSN = {0267-9477, 1364-5544}, DOI = {10.1039/C9JA00415G}, stag_bib_extends_levelofaccess = {NA}, author = {Cuello-Nu{\~n}ez, S. and Abad-{\'A}lvaro, I. and Bartczak, D. and Del Castillo Busto, M.E. and Ramsay, D.A. and Pellegrino, F. and Goenaga-Infante, H.} } @Article { CaraMSGRCDHKBMZCLBF2020, subid = {1829}, title = {Towards a traceable enhancement factor in surface-enhanced Raman spectroscopy}, journal = {Journal of Materials Chemistry C}, year = {2020}, volume = {8}, number = {46}, number2 = {16ENV07: AEROMET: Aerosol metrology for atmospheric science and air quality}, pages = {16513-16519}, keywords = {Raman spectroscopy (SERS)}, misc2 = {EMPIR 2016: Environment}, publisher = {Royal Society of Chemistry (RSC)}, language = {30}, ISSN = {2050-7526, 2050-7534}, DOI = {10.1039/D0TC04364H}, stag_bib_extends_levelofaccess = {NA}, author = {Cara, E. and Mandrile, L. and Sacco, A. and Giovannozzi, A.M. and Rossi, A.M. and Celegato, F. and De Leo, N. and Honicke, P. and Kayser, Y. and Beckhoff, B. and Marchi, D. and Zoccante, A. and Cossi, M. and Laus, M. and Boarino, L. and Ferrarese Lupi, F.} } @Article { OchoaBTC2020, subid = {1870}, title = {Challenges and opportunities for an efficiency boost of next generation Cu(In,Ga)Se2 solar cells: prospects for a paradigm shift}, journal = {Energy \& Environmental Science}, year = {2020}, volume = {13}, number = {7}, number2 = {16ENG03: HyMet: Hybrid metrology for thin films in energy applications}, pages = {2047-2055}, keywords = {CIGS, metrology}, misc2 = {EMPIR 2016: Energy}, publisher = {Royal Society of Chemistry (RSC)}, language = {30}, ISSN = {1754-5692, 1754-5706}, DOI = {10.1039/D0EE00834F}, stag_bib_extends_levelofaccess = {NA}, author = {Ochoa, M. and Buecheler, S. and Tiwari, A.N. and Carron, R.} } @Proceedings { NedialkovSA2020, subid = {1890}, title = {MetForTC Traceable Measurement Capabilities for Monitoring Thermocouple Performance}, journal = {Metrology and Metrology Assurance 2020 - Proceedings}, year = {2020}, volume = {30th Inter}, number = {130 Issues}, number2 = {18RPT03: MetForTC: Traceable measurement capabilities for monitoring thermocouple performance}, pages = {15-18}, keywords = {metrology, thermocouple, traceable measurement, MetForTC}, web_url = {http://metrology-bg.org/fulltextpapers/Proceedings_MMO_2020.pdf}, misc2 = {EMPIR 2018: Research Potential}, publisher = {Sasho Nedialkov; Snezhana Spasova; Kostadin Aldev}, event_place = {Sozopol, Bulgaria}, event_name = {Metrology and Metrology Assurance 2020}, event_date = {07-09-2020 to 11-09-2020}, language = {30}, ISSN = {ISSN 2603-3194}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {ISSN: 2603-3194}, author = {Nedialkov, S. and Spasova, S. and Aldev, K.} } @Miscellaneous { GarberoglioH, subid = {1886}, title = {Calculated values of the second dielectric and refractivity virial coefficients of helium, neon, and argon.}, journal = {J Res Natl Inst Stan}, year = {2020}, volume = {125}, number2 = {18SIB04: QuantumPascal: Towards quantum-based realisations of the pascal}, pages = {125022}, keywords = {argon, dielectric virials, helium, neon, path-integral Monte Carlo, pressure, refractivity virials, thermometry.}, web_url = {https://doi.org/10.6028/jres.125.022}, misc2 = {EMPIR 2018: SI Broader Scope}, language = {1}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://doi.org/10.18434/m32225}, author = {Garberoglio, G. and Harvey, A.} } @Proceedings { GiordanoSLLDC2020, subid = {1963}, title = {Power quality in DC railway system: A facility to characterize the on-board detection systems}, journal = {IMEKO Proceedings}, year = {2020}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, keywords = {DC power quality, DC railway system, electric arcs}, web_url = {https://www.imeko.org/publications/tc4-2020/IMEKO-TC4-2020-22.pdf}, misc2 = {EMPIR 2016: Energy}, event_place = {Palermo, Italy}, event_name = {International Measurement Confederation 2020}, event_date = {14-09-2020 to 16-09-2020}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://zenodo.org/record/4589149}, author = {Giordano, D. and Signorino, D. and Landi, C. and Luiso, M. and Delle Femine, A. and Crotti, G.} } @Article { StrodthoffWSS2020, subid = {1967}, title = {Deep Learning for ECG Analysis: Benchmarks and Insights from PTB-XL}, journal = {IEEE Journal of Biomedical and Health Informatics}, year = {2020}, number2 = {18HLT07: MedalCare: Metrology of automated data analysis for cardiac arrhythmia management}, pages = {1-1}, keywords = {Electrocardiography, Task analysis, Benchmark testing, Prediction algorithms, Time series analysis, Machine learning, Uncertainty}, misc2 = {EMPIR 2018: Health}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {2168-2194, 2168-2208}, DOI = {10.1109/JBHI.2020.3022989}, stag_bib_extends_levelofaccess = {NA}, author = {Strodthoff, N. and Wagner, P. and Schaeffter, T. and Samek, W.} } @Proceedings { 70e4e2b97d2020, subid = {1984}, title = {Photonic Thermometry at PTB – Challenges and Perspectives for Contact Temperature Metrology Utilizing Optical Sensors}, journal = {SMSI 2020 Conference – Sensor and Measurement Science International}, year = {2020}, volume = {SMSI 2020}, number = {E1 Traditi}, number2 = {17FUN05: PhotOQuant: Photonic and Optomechanical Sensors for Nanoscaled and Quantum Thermometry}, pages = {360 - 361}, keywords = {photonic thermometry, temperature sensor, sapphire, fiber Bragg grating, whispering galleryresonator}, web_url = {https://www.ama-science.org/proceedings/details/3799}, misc2 = {EMPIR 2017: Fundamental}, publisher = {AMA}, event_place = {online}, event_name = {Sensor and Measurement Science International}, event_date = {12-05-2020 to 14-05-2020}, language = {30}, ISBN = {978-3-9819376-2-6}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {10.5162/SMSI2020/E1.4} } @Article { GuilloryTW2020, subid = {2005}, title = {Uncertainty assessment of a prototype of multilateration coordinate measurement system}, journal = {Precision Engineering}, year = {2020}, volume = {66}, number2 = {18SIB01: GeoMetre: Large-scale dimensional measurements for geodesy}, pages = {496-506}, keywords = {dimensional metrology, Large Volume Metrology, Absolute Distance Metre, coordinate measurement system, multilateration technique with self-calibration}, web_url = {https://doi.org/10.1016/j.precisioneng.2020.08.002}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Elsevier}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://hal-cnam.archives-ouvertes.fr/hal-03190544}, author = {Guillory, J. and Truong, D. and Wallerand, J-P.} } @Article { HertwigNOYFGTC2020, subid = {2016}, title = {ALD-ZnMgO and absorber surface modifications to substitute CdS buffer layers in co-evaporated CIGSe solar cells}, journal = {EPJ Photovoltaics}, year = {2020}, volume = {11}, number = {12}, number2 = {16ENG03: HyMet: Hybrid metrology for thin films in energy applications}, pages = {12}, keywords = {Thin film solar cells Cu(In,Ga)Se2 bufferZnMgO ALDsurface treatment}, misc2 = {EMPIR 2016: Energy}, publisher = {EDP Sciences}, language = {30}, ISSN = {2105-0716}, DOI = {10.1051/epjpv/2020010}, stag_bib_extends_levelofaccess = {NA}, author = {Hertwig, R. and Nishiwaki, S. and Ochoa, M. and Yang, S-C. and Feurer, T. and Gilshtein, E. and Tiwari, A.N. and Carron, R.} } @Article { SachseBSHHKNL2020, subid = {2015}, title = {Colloidal bimetallic platinum–ruthenium nanoparticles in ordered mesoporous carbon films as highly active electrocatalysts for the hydrogen evolution reaction}, journal = {Catalysis Science \& Technology}, year = {2020}, volume = {10}, number = {7}, number2 = {16ENG03: HyMet: Hybrid metrology for thin films in energy applications}, pages = {2057-2068}, keywords = {Hydrogen, Nanoparticles, Hyrdrogen evolution reaction (HER)}, web_url = {https://pubs.rsc.org/en/content/articlelanding/2020/CY/C9CY02285F\#!divAbstract}, misc2 = {EMPIR 2016: Energy}, publisher = {Royal Society of Chemistry (RSC)}, language = {30}, ISSN = {2044-4753, 2044-4761}, DOI = {10.1039/C9CY02285F}, stag_bib_extends_levelofaccess = {NA}, author = {Sachse, R. and Bernsmeier, D. and Schmack, R. and H{\"a}usler, I. and Hertwig, A. and Kraffert, K. and Nissen, J. and Lewis, H.} } @Article { NeyezhmakovPPTS2020, subid = {1860}, title = {Comparative analysis of quadrature formulas for the mean integral refractive index of air in high-precision ranging}, journal = {Modern achievements of geodesic science and industry}, year = {2020}, volume = {1(39)}, number = {2020}, number2 = {18SIB01: GeoMetre: Large-scale dimensional measurements for geodesy}, pages = {69-73}, keywords = {gradient method, mean integral indicator of atmospheric depressions, Earth's atmosphere}, web_url = {http://zgt.com.ua/wp-content/uploads/2021/01/\%D0\%A1\%D1\%82\%D0\%B0\%D1\%82\%D1\%82\%D1\%8F-\%D0\%9F\%D0\%9E\%D0\%A0\%D0\%86\%D0\%92\%D0\%9D\%D0\%AF\%D0\%9B\%D0\%AC\%D0\%9D\%D0\%98\%D0\%99-\%D0\%90\%D0\%9D\%D0\%90\%D0\%9B\%D0\%86\%D0\%97-\%D0\%9A\%D0\%92\%D0\%90\%D0\%94\%D0\%A0\%D0\%90\%D0\%A2\%D0\%A3\%D0\%A0\%D0\%9D\%D0}, misc2 = {EMPIR 2018: SI Broader Scope}, language = {130}, DOI = {10.33841/1819-1339-1-39-13}, stag_bib_extends_levelofaccess = {NA}, author = {Neyezhmakov, P. and Prokopov, O. and Panasenko, T. and Trevoho, I. and Shloma, A.} } @Article { TassoneMMPSN2020, subid = {2040}, title = {Modification of the EPA method 1631E for the quantification of total mercury in natural waters}, journal = {MethodsX}, year = {2020}, volume = {7}, number2 = {16ENV01: MercOx: Metrology for oxidised mercury}, pages = {100987}, keywords = {EPA method 1631E, total mercury, waters}, misc2 = {EMPIR 2016: Environment}, publisher = {Elsevier BV}, language = {30}, ISSN = {2215-0161}, DOI = {10.1016/j.mex.2020.100987}, stag_bib_extends_levelofaccess = {NA}, author = {Tassone, A. and Moretti, S. and Martino, M. and Pirrone, N. and Sprovieri, F. and Naccarato, A.} } @Proceedings { YilmazDH2020, subid = {2257}, title = {Calibration of Digital Dynamic Pressure Sensors}, journal = {SMSI 2020 Conference – Sensor and Measurement Science International}, year = {2020}, volume = {SMSI 2020}, number = {-}, number2 = {17IND12: Met4FoF: Metrology for the Factory of the Future}, pages = {376-377}, keywords = {Dynamic, pressure, calibration, digital, sensor, DTI}, web_url = {https://www.ama-science.org/proceedings/details/3805}, misc2 = {EMPIR 2017: Industry}, publisher = {AMA Association for Sensors and Measurement}, event_place = {-}, event_name = {SMSI 2020 Conference – Sensor and Measurement Science International}, event_date = {22-06-2020 to 25-06-2020}, language = {30}, ISBN = {-}, ISSN = {-}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {978-3-9819376-2-6}, author = {Yilmaz, R. and Durgut, Y. and Hamarat, A.} } @Article { BernardiMTPDFPDOG20200, subid = {1712}, title = {A biocompatible technique for magnetic field sensing at (sub)cellular scale using Nitrogen-Vacancy centers}, journal = {EPJ Quantum Technology}, year = {2020}, volume = {7}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {13}, keywords = {NV centers, Quantum sensing, Magnetic measurements}, misc2 = {EMPIR 2017: Fundamental}, language = {30}, DOI = {10.1140/epjqt/s40507-020-00088-2}, stag_bib_extends_levelofaccess = {NA}, author = {Bernardi, E. and Moreva, E. and Traina, P. and Petrini, G. and Ditalia Tchernij, S. and Forneris, J. and Pastuović, Ž. and Degiovanni, I.P. and Olivero, P. and Genovese, M.} } @Article { SchoneweisKK2020, subid = {2545}, title = {A laboratory study for occupational safety and health on the structure of airborne ultrasound fields}, journal = {Acta Acustica}, year = {2020}, volume = {4}, number = {4}, number2 = {15HLT03: Ears II: Metrology for modern hearing assessment and protecting public health from emerging noise sources}, pages = {12}, keywords = {occupational safety, aorborne-ultrasound, noise,}, misc2 = {EMPIR 2015: Health}, publisher = {EDP Sciences}, language = {30}, ISSN = {2681-4617}, DOI = {10.1051/aacus/2020013}, stag_bib_extends_levelofaccess = {NA}, author = {Sch{\"o}newei{\ss}, R. and Kling, C. and Koch, C.} } @Article { BurkeUK2020_2, subid = {2543}, title = {A psychoacoustical study to investigate the perceived unpleasantness of infrasound combined with audio-frequency sound}, journal = {Acta Acustica}, year = {2020}, volume = {4}, number = {5}, number2 = {15HLT03: Ears II: Metrology for modern hearing assessment and protecting public health from emerging noise sources}, pages = {20}, keywords = {annoyance, infrasound, unpleaseantness, hearing experiment}, misc2 = {EMPIR 2015: Health}, publisher = {EDP Sciences}, language = {30}, ISSN = {2681-4617}, DOI = {10.1051/aacus/2020019}, stag_bib_extends_levelofaccess = {NA}, author = {Burke, E. and Uppenkamp, S. and Koch, C.} } @Proceedings { ZhangHLBAJN2019, subid = {1422}, title = {Deep Learning Applied to Attractor Images Derived from ECG Signals for Detection of Genetic Mutation}, journal = {2019 Computing in Cardiology Conference (CinC)}, year = {2019}, month = {12}, day = {30}, volume = {46}, number2 = {18HLT07: MedalCare: Metrology of automated data analysis for cardiac arrhythmia management}, pages = {097}, keywords = {Symmetric Projection Attractor Reconstruction, ECG signals, transfer learning}, web_url = {http://www.cinc.org/archives/2019/pdf/CinC2019-097.pdf}, misc2 = {EMPIR 2018: Health}, publisher = {Computing in Cardiology}, event_place = {Singapore}, event_name = {Computing in Cardiology}, event_date = {08-09-2019 to 11-09-2019}, language = {30}, ISSN = {2325-887X}, DOI = {10.22489/CinC.2019.097}, stag_bib_extends_levelofaccess = {NA}, author = {Aston, P. and Lyle, J. and Bonet-Luz, E. and Huang, C. and Zhang, Y. and Jeevaratnam, K. and Nandi, M.} } @Article { ArrheniusBBdHM2019, subid = {1820}, title = {Hydrogen Purity Analysis: Suitability of Sorbent Tubes for Trapping Hydrocarbons, Halogenated Hydrocarbons and Sulphur Compounds}, journal = {Applied Sciences}, year = {2019}, month = {12}, day = {23}, volume = {10}, number = {1}, number2 = {16ENG01: MetroHyVe: Metrology for hydrogen vehicles}, pages = {120}, keywords = {hydrogen; fuel cells; hydrogen vehicle; sorbent; thermal desorption; hydrogen quality}, tags = {EnG}, misc2 = {EMPIR 2016: Energy}, publisher = {MDPI AG}, language = {30}, ISSN = {2076-3417}, DOI = {10.3390/app10010120}, stag_bib_extends_levelofaccess = {NA}, author = {Arrhenius, Karine and Bohlen, Haleh and B{\"u}ker, Oliver and de Krom, Iris and Heikens, Dita and Murugan, Arul} } @Article { CalinALSSR2019, subid = {1770}, title = {Education and training tradition at IFIN-HH in radon measurement and evaluation of radiological impact}, journal = {Romanian Reports in Physics}, year = {2019}, month = {12}, day = {20}, volume = {71}, number = {4}, number2 = {16ENV10: MetroRADON: Metrology for radon monitoring}, pages = {906}, keywords = {Radon measurement, 222Rn standard system, Radon chamber, Indoor and outdoor radon, education and training, ANNETTE, EU project}, misc2 = {EMPIR 2016: Environment}, publisher = {Editura Academiei Romane}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {http://www.rrp.infim.ro/2019/AN71906.pdf}, author = {Calin, M.R. and Antohe, A. and Luca, A. and Stanescu, G. and Sahagia, M. and Radulescu, I.} } @Article { BrunoGCBPL2019, subid = {1400}, title = {Narrowband photon pairs with independent frequency tuning for quantum light-matter interactions}, journal = {Optics Express}, year = {2019}, month = {12}, day = {18}, volume = {27}, number = {26}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, pages = {38463}, keywords = {Parametric Down-conversion, Photon correlation, photon entnglement}, misc2 = {EMPIR 2017: Fundamental}, publisher = {The Optical Society}, language = {30}, ISSN = {1094-4087}, DOI = {10.1364/OE.382474}, stag_bib_extends_levelofaccess = {NA}, author = {Prakash, V. and Bianchet, Lorena C. and Cuairan, M.T. and Gomez, P. and Bruno, N. and Mitchell, M.W.} } @Thesis { Furtado2019, subid = {1959}, title = {Metrological traceability of density measurements and rheological determinations of liquids}, year = {2019}, month = {12}, day = {18}, number2 = {17RPT02: rhoLiq: Establishing traceability for liquid density measurements}, keywords = {Liquids’ Metrology; Metrological Traceability; Density; Viscosity; Viscoelasticity; Rheology}, misc2 = {EMPIR 2017: Research Potential}, publisher = {NOVA School of Science and Technology}, address = {Caparica}, school = {NOVA School of Science and Technology}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {http://hdl.handle.net/10362/92677}, author = {Furtado, A.} } @Article { ZilbertiCBBA2019, subid = {1328}, title = {In silico evaluation of the thermal stress induced by MRI switched gradient fields in patients with metallic hip implant}, journal = {Physics in Medicine \& Biology}, year = {2019}, month = {12}, day = {13}, volume = {64}, number = {24}, number2 = {17IND01: MIMAS: Procedures allowing medical implant manufacturers to demonstrate compliance with MRI safety regulations}, pages = {245006}, keywords = {dosimetry, magnetic resonance imaging (MRI), MR safety, gradient coils, medical implants, prostheses, numerical simulation}, misc2 = {EMPIR 2017: Industry}, publisher = {IOP Publishing}, language = {30}, ISSN = {1361-6560}, DOI = {10.1088/1361-6560/ab5428}, stag_bib_extends_levelofaccess = {NA}, author = {Arduino, A. and Bottauscio, O. and Br{\"u}hl, R. and Chiampi, M. and Zilberti, L.} } @Article { KlenovskyCSRCLHR2019, subid = {1360}, title = {Single-particle-picture breakdown in laterally weakly confining GaAs quantum dots}, journal = {Physical Review B}, year = {2019}, month = {12}, day = {13}, volume = {100}, number = {23}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, keywords = {GaAs, quantum dot}, web_url = {https://journals.aps.org/prb/pdf/10.1103/PhysRevB.100.235425}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2469-9950, 2469-9969}, DOI = {10.1103/PhysRevB.100.235425}, stag_bib_extends_levelofaccess = {NA}, author = {Huber, D. and Lehner, B.U. and Csontosov{\'a}, D. and Reindl, M. and Schuler, S. and Covre Da Silva, S.F. and Klenovsk{\'y}, P. and Rastelli, A.} } @Article { PottieAQCLRWKKG2019, subid = {1393}, title = {Combining fiber Brillouin amplification with a repeater laser station for fiber-based optical frequency dissemination over 1400 km}, journal = {New Journal of Physics}, year = {2019}, month = {12}, day = {13}, volume = {21}, number = {.}, number2 = {18SIB06: TiFOON: Advanced time/frequency comparison and dissemination through optical telecommunication networks}, pages = {123017}, keywords = {optical frequency dissemination}, web_url = {https://iopscience.iop.org/article/10.1088/1367-2630/ab5d95}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IOPscience}, language = {30}, ISSN = {1367-2630}, DOI = {10.1088/1367-2630/ab5d95}, stag_bib_extends_levelofaccess = {NA}, author = {Koke, S. and Kuhl, A. and Waterholter, T. and Raupach, S.M.F. and Lopez, O. and Cantin, E. and Quintin, N. and Amy-Klein, A. and Pottie, P.-E. and Grosche, G.} } @Article { SchinkeFBN2019, subid = {1641}, title = {Implementation and uncertainty evaluation of spectral stray light correction by Zong’s method}, journal = {Applied Optics}, year = {2019}, month = {12}, day = {13}, volume = {58}, number = {36}, number2 = {16ENG02: PV-Enerate: Advanced PV energy rating}, pages = {9998}, keywords = {spectral stray light, spectrometer, measurement uncertainty analysis}, misc2 = {EMPIR 2016: Energy}, publisher = {The Optical Society}, language = {30}, ISSN = {1559-128X, 2155-3165}, DOI = {10.1364/AO.58.009998}, stag_bib_extends_levelofaccess = {NA}, author = {Schinke, C. and Franke, M. and Bothe, K. and Nevas, S.} } @Article { KungBM2019, subid = {1762}, title = {Low-Cost 2D Index and Straightness Measurement System Based on a CMOS Image Sensor}, journal = {Sensors}, year = {2019}, month = {12}, day = {11}, volume = {19}, number = {24}, number2 = {17IND08: AdvanCT: Advanced Computed Tomography for dimensional and surface measurements in industry}, pages = {5461}, keywords = {2D position sensor, 2D index sensor, straightness sensor, machine tool geometry correction}, misc2 = {EMPIR 2017: Industry}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s19245461}, stag_bib_extends_levelofaccess = {NA}, author = {K{\"u}ng, A. and Bircher, B.A. and Meli, F.} } @Article { RodtHSSHKFSR2019, subid = {1359}, title = {Deterministically fabricated spectrally-tunable quantum dot based single-photon source}, journal = {Optical Materials Express}, year = {2019}, month = {12}, day = {10}, volume = {10}, number = {1}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {76}, keywords = {quantum dot, single-photon source}, web_url = {https://arxiv.org/ftp/arxiv/papers/1805/1805.10623.pdf}, misc2 = {EMPIR 2017: Fundamental}, publisher = {The Optical Society}, language = {30}, ISSN = {2159-3930}, DOI = {10.1364/OME.10.000076}, stag_bib_extends_levelofaccess = {NA}, author = {Schmidt, R. and Schmidt, M. and Helversen, M.V. and Fischbach, S. and Kaganskiy, A. and Schliwa, A. and Heindel, T. and Rodt, S. and Reitzenstein, S.} } @Article { JeneiPZTRTCSMD2019, subid = {1545}, title = {Waiting time distributions in a two-level fluctuator coupled to a superconducting charge detector}, journal = {Physical Review Research}, year = {2019}, month = {12}, day = {10}, volume = {1}, number = {3}, number2 = {15SIB08: e-SI-Amp: Quantum realisation of the SI ampere}, keywords = {Waiting time distributions in a two-level fluctuator coupled to a superconducting charge detector}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2643-1564}, DOI = {10.1103/physrevresearch.1.033163}, stag_bib_extends_levelofaccess = {NA}, author = {Jenei, M. and Potanina, E. and Zhao, R. and Tan, K.Y. and Rossi, A. and Tanttu, T. and Chan, K.W. and Sevriuk, V. and M{\"o}tt{\"o}nen, M. and Dzurak, A.} } @Article { GenoveseG2019, subid = {1579}, title = {Quantum Correlations and Quantum Non-Locality: A Review and a Few New Ideas}, journal = {Applied Sciences}, year = {2019}, month = {12}, day = {10}, volume = {9}, number = {24}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {5406}, keywords = {quantum correlations, quantum non-locality, entanglement, bell measurements}, misc2 = {EMPIR 2017: Fundamental}, publisher = {MDPI AG}, language = {30}, ISSN = {2076-3417}, DOI = {10.3390/app9245406}, stag_bib_extends_levelofaccess = {NA}, author = {Genovese, Marco and Gramegna, Marco} } @Article { LoseroRMASG2019, subid = {1573}, title = {Quantum differential ghost microscopy}, journal = {Physical Review A}, year = {2019}, month = {12}, day = {10}, volume = {100}, number = {6}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {063818}, keywords = {Quantum Optics, Ghost Imaging, Quantum Correlations}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2469-9926, 2469-9934}, DOI = {10.1103/PhysRevA.100.063818}, stag_bib_extends_levelofaccess = {NA}, author = {Losero, E. and Ruo-Berchera, I. and Meda, A. and Avella, A. and Sambataro, O. and Genovese, M.} } @Article { Mougeot2019, subid = {1233}, title = {Towards high-precision calculation of electron capture decays}, journal = {Applied Radiation and Isotopes}, year = {2019}, month = {12}, volume = {154}, number2 = {17FUN02: MetroMMC: Measurement of fundamental nuclear decay data using metallic magnetic calorimeters}, pages = {108884}, keywords = {Electron capture, Theoretical calculations, Nuclear decay data, Radionuclide metrology}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Elsevier BV}, language = {30}, ISSN = {0969-8043}, DOI = {10.1016/j.apradiso.2019.108884}, stag_bib_extends_levelofaccess = {NA}, author = {Mougeot, X.} } @Article { GomezFGLDBMFMMGARPABCDH2019, subid = {1260}, title = {Hydrogen fuel quality from two main production processes: Steam methane reforming and proton exchange membrane water electrolysis}, journal = {Journal of Power Sources}, year = {2019}, month = {12}, volume = {444}, number2 = {15NRM03: Hydrogen: Metrology for sustainable hydrogen energy applications}, pages = {227170}, keywords = {Fuel cell electrical vehicles, ISO14687, Gas analysis, Hydrogen production, Hydrogen quality}, web_url = {https://www.sciencedirect.com/science/article/pii/S0378775319311632}, misc2 = {EMPIR 2015: Pre-Co-Normative}, publisher = {Elsevier BV}, language = {30}, ISSN = {0378-7753}, DOI = {10.1016/j.jpowsour.2019.227170}, stag_bib_extends_levelofaccess = {NA}, author = {Bacquart, T. and Arrhenius, K. and Persijn, S. and Rojo, A. and Aupr{\^e}tre, F. and Gozlan, B. and Moore, N. and Morris, A. and Fischer, A. and Murugan, A. and Bartlett, S. and Doucet, G. and Laridant, F. and Gernot, E. and Fern{\'a}ndez, T. E. and G{\'o}mez, C. and Carr{\'e}, M. and De Reals, G. and Haloua, F.} } @Article { PanuJTS2019, subid = {1309}, title = {Dynamic calibration method for reactive gases}, journal = {Measurement Science and Technology}, year = {2019}, month = {12}, volume = {31}, number = {3}, number2 = {16ENV01: MercOx: Metrology for oxidised mercury}, pages = {034001}, keywords = {evaporation, traceability, reference gas, gas generator, gas flow, reactivecompounds, mercury}, misc2 = {EMPIR 2016: Environment}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-0233, 1361-6501}, DOI = {10.1088/1361-6501/ab4d68}, stag_bib_extends_levelofaccess = {NA}, author = {Sari, S. and Timo, R. and Jussi, H. and Panu, H.} } @Article { TrusheimFGBA2019, subid = {1315}, title = {Quantum nanophotonics with group IV defects in diamond}, journal = {Nature Communications}, year = {2019}, month = {12}, volume = {10}, number = {1}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {5625}, keywords = {diamond, photonics, quantum optics, color centers, quantum technologies}, web_url = {https://www.nature.com/articles/s41467-019-13332-w}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2041-1723}, DOI = {10.1038/s41467-019-13332-w}, stag_bib_extends_levelofaccess = {NA}, author = {Bradac, C. and Gao, W. and Forneris, J. and Trusheim, M. E. and Aharonovich, I.} } @Article { LeviHVBH2019, subid = {1398}, title = {Cavity-enhanced non-destructive detection of atoms for an optical lattice clock}, journal = {Optics Express}, year = {2019}, month = {12}, volume = {27}, number = {26}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, pages = {37099}, keywords = {Non destructive measurement, Optical Lattice Clocks}, misc2 = {EMPIR 2017: Fundamental}, publisher = {The Optical Society}, language = {30}, ISSN = {1094-4087}, DOI = {10.1364/OE.27.037099}, stag_bib_extends_levelofaccess = {NA}, author = {Hobson, R. and Bowden, W. and Vianello, A. and Hill, I.R. and Gill, P.} } @Article { PraakSSP2019, subid = {1386}, title = {Changing the status of mmHg}, journal = {Accreditation and Quality Assurance}, year = {2019}, month = {12}, volume = {n/a}, number = {n/a}, number2 = {16RPT03: inTENSE: Developing research capabilities for traceable intraocular pressure measurements}, pages = {1-2}, keywords = {SI, Pressure units, Sphygmomanometry, Eye tonometry}, web_url = {https://link.springer.com/article/10.1007/s00769-019-01414-7}, misc2 = {EMPIR 2016: Research Potential}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {0949-1775, 1432-0517}, DOI = {10.1007/s00769-019-01414-7}, stag_bib_extends_levelofaccess = {NA}, author = {Praž{\'a}k, D. and Sedl{\'a}k, V. and Sınır, E. and Pluh{\'a}ček, F.} } @Article { SliwczynskiKT2019, subid = {1471}, title = {Stability limitations of optical frequency transfer in telecommunication DWDM networks}, journal = {IEEE Transactions on Ultrasonics, Ferroelectrics, and Frequency Control}, year = {2019}, month = {12}, number2 = {18SIB06: TiFOON: Advanced time/frequency comparison and dissemination through optical telecommunication networks}, pages = {1-1}, keywords = {optical frequency transfer, DWDM network, optical fiber, alien wavelength}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0885-3010, 1525-8955}, DOI = {10.1109/TUFFC.2019.2957176}, stag_bib_extends_levelofaccess = {NA}, author = {Śliwczyński, L. and Krehlik, P. and Turza, K.} } @Article { OrtolanoRP2019, subid = {1575}, title = {Quantum enhanced imaging of nonuniform refractive profiles}, journal = {International Journal of Quantum Information}, year = {2019}, month = {12}, volume = {17}, number = {08}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {1941010}, keywords = {Quantum imaging, non-classical correlations, gradient-index}, misc2 = {EMPIR 2017: Fundamental}, publisher = {World Scientific Pub Co Pte Lt}, language = {30}, ISSN = {0219-7499, 1793-6918}, DOI = {10.1142/S0219749919410107}, stag_bib_extends_levelofaccess = {NA}, author = {Ortolano, Giuseppe and Ruo-Berchera, Ivano and Predazzi, Enrico} } @Article { BenklerLPWRS2019, subid = {1661}, title = {End-to-end topology for fiber comb based optical frequency transfer at the 10−21 level}, journal = {Optics Express}, year = {2019}, month = {12}, volume = {27}, number = {25}, number2 = {18SIB05: ROCIT: Robust Optical Clocks for International Timescales}, pages = {36886}, keywords = {optical frequency combs, stability transfer}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {The Optical Society}, language = {30}, ISSN = {1094-4087}, DOI = {10.1364/OE.27.036886}, stag_bib_extends_levelofaccess = {NA}, author = {Benkler, E. and Lipphardt, B. and Puppe, T. and Wilk, R. and Rohde, F. and Sterr, U.} } @Proceedings { KazemipourWHYRGHZ2019, subid = {1662}, title = {Material Parameter Extraction in THz Domain, Simplifications and Sensitivity Analysis}, journal = {2019 IEEE Asia-Pacific Microwave Conference (APMC)}, year = {2019}, month = {12}, volume = {N/A}, number = {N/A}, number2 = {18SIB09: TEMMT: Traceability for electrical measurements at millimetre-wave and terahertz frequencies for communications and electronics technologies}, pages = {276-278}, keywords = {material characterization, extraction method, THz domain, sensitivity coefficient, measurement uncertainty}, web_url = {https://doi.org/10.5281/zenodo.4243025}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IEEE}, event_place = {Singapore}, event_name = {019 IEEE Asia-Pacific Microwave Conference (APMC)}, event_date = {10-12-2019 to 13-12-2019}, language = {30}, ISBN = {978-1-7281-3517-5}, ISSN = {N/A}, DOI = {10.1109/APMC46564.2019.9038523}, stag_bib_extends_levelofaccess = {NA}, author = {Kazemipour, A. and Wollensack, M. and Hoffmann, J. and Yee, S-K. and R{\"u}fenacht, J. and G{\"a}umann, G. and Hudlicka, M. and Zeier, M.} } @Article { RanitzschABBBEKKLMNPRW2019, subid = {1729}, title = {MetroMMC: Electron-Capture Spectrometry with Cryogenic Calorimeters for Science and Technology}, journal = {Journal of Low Temperature Physics}, year = {2019}, month = {12}, volume = {199}, number = {1-2}, number2 = {17FUN02: MetroMMC: Measurement of fundamental nuclear decay data using metallic magnetic calorimeters}, pages = {441-450}, keywords = {Electron-capture decay, Metallic magnetic calorimeter, Radionuclide metrology}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {0022-2291, 1573-7357}, DOI = {10.1007/s10909-019-02278-4}, stag_bib_extends_levelofaccess = {NA}, author = {Ranitzsch, P.C-O. and Arnold, D. and Beyer, J. and Bockhorn, L. and Bonaparte, J.J. and Enss, C. and Kossert, K. and Kempf, S. and Loidl, M. and Mariam, R. and N{\"a}hle, O. J. and Paulsen, M. and Rodrigues, M. and Wegner, M.} } @Thesis { Simoes2019, subid = {1958}, title = {Optimization and automation of the hydrostatic weighing system for the determination of the liquid density of IPQ}, year = {2019}, month = {12}, number2 = {17RPT02: rhoLiq: Establishing traceability for liquid density measurements}, keywords = {Optimization; Hydrostatic weighing apparatus; Density of liquids; Design of automated mechanisms; Uncertainty in measurements; Calibration}, misc2 = {EMPIR 2017: Research Potential}, publisher = {Diogo Sim{\~o}es}, school = {Faculty of Science and Technology of the Universidade Nova de Lisboa}, language = {92}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {http://hdl.handle.net/10362/92306}, author = {Sim{\~o}es, D.} } @Article { BockhornPBKLNRR2019, subid = {1355}, title = {Improved Source/Absorber Preparation for Radionuclide Spectrometry Based on Low-Temperature Calorimetric Detectors}, journal = {Journal of Low Temperature Physics}, year = {2019}, month = {11}, day = {30}, number2 = {17FUN02: MetroMMC: Measurement of fundamental nuclear decay data using metallic magnetic calorimeters}, keywords = {Beta spectrometry, Preparation techniques, Low-temperature detectors}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {0022-2291, 1573-7357}, DOI = {10.1007/s10909-019-02274-8}, stag_bib_extends_levelofaccess = {NA}, author = {Bockhorn, L. and Paulsen, M. and Beyer, J. and Kossert, K. and Loidl, M. and N{\"a}hle, O. J. and Ranitzsch, P. C.-O. and Rodrigues, M.} } @Article { RibeiroPBAM2019, subid = {1427}, title = {Method selection to evaluate measurement uncertainty in microflow applications}, journal = {Journal of Physics: Conference Series}, year = {2019}, month = {11}, day = {29}, volume = {1379}, number2 = {18HLT08: MEDDII: Metrology for drug delivery}, pages = {012033}, keywords = {Uncertainty, microflow, Monte Carlo method, Bayesian method}, web_url = {https://iopscience.iop.org/article/10.1088/1742-6596/1379/1/012033/pdf}, misc2 = {EMPIR 2018: Health}, publisher = {IOP science}, language = {30}, ISSN = {17426588}, DOI = {10.1088/1742-6596/1379/1/012033}, stag_bib_extends_levelofaccess = {NA}, author = {Sousa, J.A. and Batista, E. and Pellegrino, O. and Ribeiro, {\'A}. and Martins, L.} } @Article { HorenderSIDVA2019, subid = {1333}, title = {Calibration of optical particle counters: First comprehensive inter-comparison for particle sizes up to 5 \(\mu\)m and number concentrations up to 2 cm−3}, journal = {Metrologia}, year = {2019}, month = {11}, day = {27}, number2 = {16ENV07: AEROMET: Aerosol metrology for atmospheric science and air quality}, keywords = {aerosol, optical particle counter, calibration, clean room, counting efficiency}, misc2 = {EMPIR 2016: Environment}, publisher = {IOP Publishing}, booktitle = {Calibration of optical particle counters: First comprehensive inter-comparison for particle sizes up to 5 \(\mu\)m and number concentrations up to 2 cm\(^{−3}\)}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/ab5c84}, stag_bib_extends_levelofaccess = {NA}, author = {Vasilatou, Konstantina and Dirscherl, Kai and Iida, Kenjiro and Sakurai, Hiromu and Horender, Stefan and Auderset, Kevin} } @Article { GroblacherNG2019, subid = {1389}, title = {Feedback cooling of a room temperature mechanical oscillator close to its motional groundstate}, journal = {Physical Review Letters}, year = {2019}, month = {11}, day = {27}, volume = {123}, number = {1}, number2 = {17FUN05: PhotOQuant: Photonic and Optomechanical Sensors for Nanoscaled and Quantum Thermometry}, pages = {223602}, keywords = {Light-matter interactionOptomechanicsPhotonicsMicromechanical \& Nanomechanical Oscillators}, web_url = {https://arxiv.org/abs/1911.01586\&\#10;https://journals.aps.org/prl/abstract/10.1103/PhysRevLett.123.223602}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society}, address = {Washington DC, USA}, language = {30}, ISSN = {1079-7114}, DOI = {10.1103/PhysRevLett.123.223602}, stag_bib_extends_levelofaccess = {NA}, author = {Guo, Jingkun and Norte, Richard and Gr{\"o}blacher, Simon} } @Article { FitzGeraldMSH2019, subid = {1547}, title = {Development of a new primary humidity measurement standard}, journal = {Measurement Science and Technology}, year = {2019}, month = {11}, day = {27}, volume = {31}, number = {2}, number2 = {15RPT03: HUMEA: Expansion of European research capabilities in humidity measurement}, pages = {024007}, keywords = {Development of a new primary humidity}, misc2 = {EMPIR 2015: Research Potential}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-0233, 1361-6501}, DOI = {10.1088/1361-6501/ab4a54}, stag_bib_extends_levelofaccess = {NA}, author = {FitzGerald, C. and Mac Lochlainn, D. and Strnad, R. and Hodzic, N.} } @Article { GuoNG2019, subid = {1985}, title = {Feedback Cooling of a Room Temperature Mechanical Oscillator close to its Motional Ground State}, journal = {Physical Review Letters}, year = {2019}, month = {11}, day = {27}, volume = {123}, number = {22}, number2 = {17FUN05: PhotOQuant: Photonic and Optomechanical Sensors for Nanoscaled and Quantum Thermometry}, keywords = {quantum optomechnaics, room tempertaure, quantum ground state, mechanical resonator, feedbacl laser coolling}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {0031-9007, 1079-7114}, DOI = {10.1103/PhysRevLett.123.223602}, stag_bib_extends_levelofaccess = {NA}, author = {Guo, J. and Norte, R. and Gr{\"o}blacher, S.} } @Article { GeislerNBHSRKWHTHMSU2019, subid = {1316}, title = {Determining the Thickness and Completeness of the Shell of Polymer Core–Shell Nanoparticles by X-ray Photoelectron Spectroscopy, Secondary Ion Mass Spectrometry, and Transmission Scanning Electron Microscopy}, journal = {The Journal of Physical Chemistry C}, year = {2019}, month = {11}, day = {26}, number2 = {17SIP03: ESCoShell: An ISO Technical Report on the use of Electron Spectroscopy for Measurement of Core-Shell Nanoparticle Shell Thicknesses}, keywords = {Nanoparticles, core-shell, XPS, SIMS, T-SEM, polymer}, misc2 = {EMPIR 2017: Support for Impact}, publisher = {American Chemical Society (ACS)}, language = {30}, ISSN = {1932-7447, 1932-7455}, DOI = {10.1021/acs.jpcc.9b09258}, stag_bib_extends_levelofaccess = {NA}, author = {M{\"u}ller, A. and Heinrich, T. and Tougaard, S. and Werner, W. S. M. and Hronek, M. and Kunz, V. and Radnik, J. and Stockmann, J. M. and Hodoroaba, V-D. and Benemann, S. and Nirmalananthan-Budau, N. and Gei{\ss}ler, D. and Sparnacci, K. and Unger, W. E. S } } @Article { SimovskiM2019, subid = {1351}, title = {Dual-metasurface superlens: A comprehensive study}, journal = {Physical Review B}, year = {2019}, month = {11}, day = {25}, volume = {100}, number = {20}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {205426}, keywords = {Subwavelength resolution, superlens, metasurface, hybridization of plasmons, bandgap, nanoimaging205426}, web_url = {https://arxiv.org/pdf/1910.14295v1.pdf}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2469-9950, 2469-9969}, DOI = {10.1103/PhysRevB.100.205426}, stag_bib_extends_levelofaccess = {NA}, author = {Mollaei, M.S.M. and Simovski, C.} } @Article { KashcheyevsFBJLSGFRK2019, subid = {1312}, title = {Continuous-variable tomography of solitary electrons}, journal = {Nature Communications}, year = {2019}, month = {11}, day = {22}, volume = {10}, number = {1}, number2 = {17FUN04: SEQUOIA: Single-electron quantum optics for quantum-enhanced measurements}, keywords = {Single electron, Electron wave packet, Tomography}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2041-1723}, DOI = {10.1038/s41467-019-13222-1}, stag_bib_extends_levelofaccess = {NA}, author = {Fletcher, J. D. and Johnson, N. and Locane, E. and See, P. and Griffiths, J. P. and Farrer, I. and Ritchie, D. A. and Brouwer, P. W. and Kashcheyevs, V. and Kataoka, M.} } @Article { ARFOVC2019, subid = {2772}, title = {“T{\"U}BİTAK UME’de Yeni EMPIR Projesi: Isıl\c{c}ift Performansının G{\"o}zlenmesi i\c{c}in İzlenebilir {\"O}l\c{c}{\"u}m Yeteneklerinin Geliştirilmesi”}, journal = {Symposium and Exhibition of Measurement Science-Proceedings}, year = {2019}, month = {11}, day = {22}, volume = {E/MMO/710}, number = {TMMOB Maki}, number2 = {18RPT03: MetForTC: Traceable measurement capabilities for monitoring thermocouple performance}, pages = {100-104}, keywords = {EMPIR, MetForTC Projesi, Isıl\c{c}iftin Performansının izlenmesi}, web_url = {http://www.olcumbilim.org/wp-content/uploads/bildiriler/2019-15.rev.pdf}, misc2 = {EMPIR 2018: Research Potential}, publisher = {TMMOB Makina M{\"u}hendisleri Odasıİzmir Şubesi}, language = {126}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {ISBN 978-605-01-1315-0}, author = { ARİFOVİ\c{C}, N.} } @Article { BeckACCFGHJKKLLMMOQRSSTTTTVVVWW2019, subid = {2340}, title = {The Metrological Traceability, Performance and Precision of European Radon Calibration Facilities}, journal = {International Journal of Environmental Research and Public Health}, year = {2019}, month = {11}, day = {21}, number2 = {16ENV10: MetroRADON: Metrology for radon monitoring}, keywords = {radon; interlaboratory comparison; radon activity concentration; calibration; metrological traceability}, misc2 = {EMPIR 2016: Environment}, language = {30}, DOI = {10.3390/ijerph182212150}, stag_bib_extends_levelofaccess = {NA}, author = {Beck, T.R. and Antohe, A. and Cardellini, F. and Cucoş, A. and Fialova, E. and Grossi, C. and Hening, K. and Jensen, J. and Kastratović, D. and Krivoš{\'i}k, M. and Lobner, P. and Luca, A. and Maringer, F.J. and Michielsen, N. and Otahal, P.P.S. and Quindos, L. and Rabago, D. and Sainz, C. and Sz{\"u}cs, L. and Teodorescu, T. and Tolinsson, C. and Tugulan, C.L. and Turtiainen, T. and Vargas, A. and Vosahlik, J. and Vukoslavovic, G. and Wiedner, H. and Wołoszczuk, K.} } @Article { SchneiderHHCFKRSTR2019, subid = {1362}, title = {Resolving the temporal evolution of line broadening in single quantum emitters}, journal = {Optics Express}, year = {2019}, month = {11}, day = {18}, volume = {27}, number = {24}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {35290}, keywords = {single quantum emitter, GaAs and In(Ga)As quantum dots}, web_url = {https://www.osapublishing.org/DirectPDFAccess/0872F4C8-F64C-1DD3-BF83A9359A9A78C7_423274/oe-27-24-35290.pdf?da=1\&id=423274\&seq=0\&mobile=no}, misc2 = {EMPIR 2017: Fundamental}, publisher = {The Optical Society}, language = {30}, ISSN = {1094-4087}, DOI = {10.1364/OE.27.035290}, stag_bib_extends_levelofaccess = {NA}, author = {Schimpf, C. and Reindl, M. and Klenovsk{\'y}, P. and Fromherz, T. and Covre Da Silva, S.F. and Hofer, J. and Schneider, C. and H{\"o}fling, S. and Trotta, R. and Rastelli, A.} } @Article { KlauiJPDGVCC2019, subid = {1308}, title = {Individual skyrmion manipulation by local magnetic field gradients}, journal = {Communications Physics}, year = {2019}, month = {11}, day = {15}, volume = {2}, number = {1}, number2 = {17FUN08: TOPS: Metrology for topological spin structures}, pages = {145}, keywords = {Skyrmion, MFM}, web_url = {https://www.nature.com/articles/s42005-019-0242-5\#article-info}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2399-3650}, DOI = {10.1038/s42005-019-0242-5}, stag_bib_extends_levelofaccess = {NA}, author = {Casiraghi, A. and Corte-Le{\'o}n, H. and Vafaee, M. and Garcia-Sanchez, F. and Durin, G. and Pasquale, M. and Jakob, G. and Kl{\"a}ui, M.} } @Article { KlauiJPDGVCC20190, subid = {1308}, title = {Individual skyrmion manipulation by local magnetic field gradients}, journal = {Communications Physics}, year = {2019}, month = {11}, day = {15}, volume = {2}, number = {1}, number2 = {15SIB06: NanoMag: Nano-scale traceable magnetic field measurements}, pages = {145}, keywords = {Skyrmion, MFM}, web_url = {https://www.nature.com/articles/s42005-019-0242-5\#article-info}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2399-3650}, DOI = {10.1038/s42005-019-0242-5}, stag_bib_extends_levelofaccess = {NA}, author = {Casiraghi, A. and Corte-Le{\'o}n, H. and Vafaee, M. and Garcia-Sanchez, F. and Durin, G. and Pasquale, M. and Jakob, G. and Kl{\"a}ui, M.} } @Article { GeorgievMDBD2019, subid = {1560}, title = {Partition Coefficients and Diffusion Lengths of 222Rn in Some Polymers at Different Temperatures}, journal = {International Journal of Environmental Research and Public Health}, year = {2019}, month = {11}, day = {15}, volume = {16}, number = {22}, number2 = {16ENV10: MetroRADON: Metrology for radon monitoring}, pages = {4523}, keywords = {Partition Coefficients and Diffusion Lengths of 222Rn in Some Polymers at Different Temperatures}, misc2 = {EMPIR 2016: Environment}, publisher = {MDPI AG}, address = {Postfach Basel CH-4005 Switzerland}, language = {30}, ISSN = {1660-4601}, DOI = {10.3390/ijerph16224523}, stag_bib_extends_levelofaccess = {NA}, author = {Georgiev, Strahil and Mitev, Krasimir and Dutsov, Chavdar and Boshkova, Tatiana and Dimitrova, Ivelina} } @Article { MingottiPT2019, subid = {1751}, title = {Effects of Multiple Influence Quantities on Rogowski-Coil-Type Current Transformers}, journal = {Transaction on Instrumentation and Measurement}, year = {2019}, month = {11}, day = {15}, volume = {69}, number = {7}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, pages = {8}, keywords = {automatic measurement system, multiple influence, passive current transformer, position, Rogowski coil, temperature, Standard tests}, tags = {SEG}, web_url = {https://zenodo.org/record/4322652\#.X9jKvy1aY1I}, misc2 = {EMPIR 2017: Industry}, publisher = {IEEE}, language = {30}, ISSN = {1557-9662}, DOI = {10.5281/zenodo.4322652}, stag_bib_extends_levelofaccess = {NA}, author = {Mingotti, A. and Peretto, L. and Tinarelli, R.} } @Article { StoschGZPFM2019, subid = {1299}, title = {Step‐by‐step monitoring of a magnetic and SERS‐active immunosensor assembly for purification and detection of tau protein}, journal = {Journal of Biophotonics}, year = {2019}, month = {11}, day = {13}, number2 = {15HLT02: ReMIND: Role of metals and metal containing biomolecules in neurodegenerative diseases such as Alzheimer’s disease}, keywords = {synthesis of iron oxide, tau protein, diagnosis of Alzheimer's disease, SERS‐active immunosensor, purification and detection of tau protein}, web_url = {https://onlinelibrary.wiley.com/doi/abs/10.1002/jbio.201960090}, misc2 = {EMPIR 2015: Health}, publisher = {Wiley}, language = {30}, ISSN = {1864-063X, 1864-0648}, DOI = {10.1002/jbio.201960090}, stag_bib_extends_levelofaccess = {NA}, author = {Maurer, V. and Frank, C. and Porsiel, J. C. and Zellmer, S. and Garnweitner, G. and Stosch, R.} } @Manual { SmithHWB2019, subid = {1448}, title = {Document describing a universal and flexible structure for digital calibration certificates (DCC)}, year = {2019}, month = {11}, day = {11}, number2 = {17IND02: SmartCom: Communication and validation of smart data in IoT-networks}, keywords = {digital calibration certificate (DCC), data communication, IoT-communication, IoT-networking SmartCom, minimum requirements}, misc2 = {EMPIR 2017: Industry}, publisher = {SmartCom}, language = {30}, DOI = {10.5281/zenodo.3696567}, stag_bib_extends_levelofaccess = {NA}, author = {Smith, I. and Hutzschenreuter, D. and Wiedenh{\"o}fer, T. and Brown, C.} } @Article { RanitzschPNMKKEBBLRS2019, subid = {1234}, title = {Beta spectrometry with metallic magnetic calorimeters in the framework of the European EMPIR project MetroBeta}, journal = {Applied Radiation and Isotopes}, year = {2019}, month = {11}, volume = {153}, number2 = {15SIB10: MetroBeta: Radionuclide beta spectra metrology}, pages = {108830}, keywords = {Beta spectrometry; Metallic magnetic calorimeter; Ionizing radiation metrology}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {Elsevier BV}, language = {30}, ISSN = {0969-8043}, DOI = {10.1016/j.apradiso.2019.108830}, stag_bib_extends_levelofaccess = {NA}, author = {Loidl, M. and Beyer, J. and Bockhorn, L. and Enss, C. and Kempf, S. and Kossert, K. and Mariam, R. and N{\"a}hle, O. and Paulsen, M. and Ranitzsch, P. and Rodrigues, M. and Schmidt, M.} } @Article { KhabipovDL2019, subid = {1256}, title = {DC measurement of dressed states in a coupled 100 GHz resonator system using a single quasiparticle transistor as a sensitive microwave detector}, journal = {Applied Physics Letters}, year = {2019}, month = {11}, volume = {115}, number = {19}, number2 = {17FUN10: ParaWave: Josephson travelling wave parametric amplifier and its application for metrology}, pages = {192601}, keywords = {microwave detectors, single-electron tunneling, photon-assisted tunneling, Josephson generation, superconducting coplanar resonators, quantum oscillators, circuit QED, Josephson qubit, transmon qubit}, misc2 = {EMPIR 2017: Fundamental}, publisher = {AIP Publishing}, language = {30}, ISSN = {0003-6951, 1077-3118}, DOI = {10.1063/1.5119220}, stag_bib_extends_levelofaccess = {NA}, author = {Lotkhov, S. V. and Dolata, R. and Khabipov, M.} } @Article { GuarnizoMRFS2019, subid = {1272}, title = {Validation of Emission Spectroscopy Gas Temperature Measurements Using a Standard Flame Traceable to the International Temperature Scale of 1990 (ITS-90)}, journal = {International Journal of Thermophysics}, year = {2019}, month = {11}, volume = {40}, number = {11}, number2 = {17IND04: EMPRESS 2: Enhancing process efficiency through improved temperature measurement 2}, pages = {99}, keywords = {Combustion, Emission spectroscopy, ITS-90, Rayleigh scattering, Standard Temperature}, web_url = {https://link.springer.com/content/pdf/10.1007\%2Fs10765-019-2557-6.pdf}, misc2 = {EMPIR 2017: Industry}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {0195-928X, 1572-9567}, DOI = {10.1007/s10765-019-2557-6}, stag_bib_extends_levelofaccess = {NA}, author = {Sutton, G. and Fateev, A. and Rodr{\'i}guez-Conejo, M.A. and Mel{\'e}ndez, J. and Guarnizo, G.} } @Article { IkonenKOB2019, subid = {1286}, title = {Optical Characterization of III-V Multijunction Solar Cells for Temperature-Independent Band Gap Features}, journal = {IEEE Journal of Photovoltaics}, year = {2019}, month = {11}, volume = {9}, number = {6}, number2 = {16ENG02: PV-Enerate: Advanced PV energy rating}, pages = {1631-1636}, keywords = {Band gap, light-emitting diode (LED), spectral response, temperature, III-V solar cells}, misc2 = {EMPIR 2016: Energy}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {2156-3381, 2156-3403}, DOI = {10.1109/JPHOTOV.2019.2933190}, stag_bib_extends_levelofaccess = {NA}, author = {Baumgartner, H. and Oksanen, B. and K{\"a}rh{\"a}, P. and Ikonen, E.} } @Article { CidadePNGFF2019, subid = {1300}, title = {Density measurements of viscoelastic samples with oscillation-type density meters}, journal = {Journal of Physics: Conference Series}, year = {2019}, month = {11}, volume = {1379}, number = {Joint IMEK}, number2 = {17RPT02: rhoLiq: Establishing traceability for liquid density measurements}, pages = {012020}, keywords = {density, harmonic oscillator, viscoelasticity, damping}, web_url = {https://iopscience.iop.org/article/10.1088/1742-6596/1379/1/012020/pdf}, misc2 = {EMPIR 2017: Research Potential}, publisher = {IOP Publishing}, language = {30}, ISSN = {1742-6588, 1742-6596}, DOI = {10.1088/1742-6596/1379/1/012020}, stag_bib_extends_levelofaccess = {NA}, author = {Furtado, A. and Furtado, A. and Gavina, J. and Napole{\~a}o, A. and Pereira, J. and Cidade, M.T.} } @Article { KlenovskyBMASS2019, subid = {1361}, title = {Optical response of (InGa)(AsSb)/GaAs quantum dots embedded in a GaP matrix}, journal = {Physical Review B}, year = {2019}, month = {11}, volume = {100}, number = {19}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, keywords = {electronic structure, quantum dot}, web_url = {https://arxiv.org/abs/1906.09842}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2469-9950, 2469-9969}, DOI = {10.1103/PhysRevB.100.195407}, stag_bib_extends_levelofaccess = {NA}, author = {Steindl, P. and Sala, E.M. and Al{\'e}n, B. and Marr{\'o}n, D.F. and Bimberg, D. and Klenovsk{\'y}, P.} } @Article { LandiGDL2019_2, subid = {1347}, title = {Uncertainty Evaluation on the Absolute Phase Error of Digitizers}, journal = {Transactions of the Institute of Measurement and Control}, year = {2019}, month = {11}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, pages = {1-10}, keywords = {Phase Measurement,Digitizer,Calibration,Discrete Fourier Transform,Phasor Measurement Unit,Synchrophasor,Digital Low Power Instrument Transformer}, web_url = {https://zenodo.org/record/3600435}, misc2 = {EMPIR 2017: Industry}, publisher = {SAGE Journals}, language = {30}, ISSN = {0142-3312}, DOI = {10.5281/zenodo.3600435}, stag_bib_extends_levelofaccess = {NA}, author = {Landi, C. and Gallo, D. and Delle Femine, A. and Luiso, M.} } @Thesis { Rosner2019, subid = {1368}, title = {Production and preparation of highly charged ions for re-trapping in ultra-cold environments,Master Thesis, Ruprecht-Karls-Universitat, Heidelberg (2019)}, year = {2019}, month = {11}, number2 = {17FUN07: CC4C: Coulomb Crystals for Clocks}, keywords = {Optical ClockTrapped Ions}, web_url = {https://pure.mpg.de/rest/items/item_3182118_1/component/file_3182119/content}, misc2 = {EMPIR 2017: Fundamental}, school = {Ruprecht-Karls-Universit{\"a}t, Heidelberg}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {http://hdl.handle.net/21.11116/0000-0005-5B37-8}, author = {Rosner, M.K.} } @Article { KipperHLBPHLV2019, subid = {1406}, title = {Retention of acidic and basic analytes in reversed phase column using fluorinated and novel eluent additives for liquid chromatography-tandem mass spectrometry}, journal = {Journal of Chromatography A}, year = {2019}, month = {11}, volume = {in press}, number = {in press}, number2 = {17FUN09: UnipHied: Realisation of a Unified pH Scale}, pages = {460667}, keywords = {Eluent additivesHFIPHFTBPPNFTBRetention mechanisms}, web_url = {https://www.sciencedirect.com/search/advanced?qs=Retention\%20of\%20acidic\%20and\%20basic\&pub=Journal\%20of\%20Chromatography\%20A\&cid=271409\&volumes=0\&lastSelectedFacet=volumes}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Elsevier BV}, language = {30}, ISSN = {0021-9673}, DOI = {10.1016/j.chroma.2019.460667}, stag_bib_extends_levelofaccess = {NA}, author = {Veigure, R. and Lossmann, K. and Hecht, M. and Parman, E. and Born, R. and Leito, I. and Herodes, K. and Kipper, K.} } @Article { RibeiroPBSM2019, subid = {1419}, title = {Method selection to evaluate measurement uncertainty in microflow applications}, journal = {Journal of Physics: Conference Series}, year = {2019}, month = {11}, volume = {1379}, number = {2019}, number2 = {17NRM05: EMUE: Advancing measurement uncertainty - comprehensive examples for key international standards}, pages = {012033}, keywords = {microflow, medicine, neonatology, oncology, measurement uncertainty, GUM, Monte Carlo}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {IOP Publishing}, language = {30}, ISSN = {1742-6588, 1742-6596}, DOI = {10.1088/1742-6596/1379/1/012033}, stag_bib_extends_levelofaccess = {NA}, author = {Sousa, J.A. and Batista, E. and Pellegrino, O. and Ribeiro, A.S. and Martins, L.L.} } @Manual { EloKnKALSZSFRBSHWHHHNHMMHP2019, subid = {1433}, title = {SmartCom Digital System of Units (D-SI) Guide for the use of the metadata-format used in metrology for the easy-to-use, safe, harmonised and unambiguous digital transfer of metrological data}, year = {2019}, month = {11}, number2 = {17IND02: SmartCom: Communication and validation of smart data in IoT-networks}, keywords = {Digital-SI (D-SI) metrology data digital exchange format SmartCom data communication IoT-networking IoT-communication}, web_url = {https://zenodo.org/record/3522631\#.XlTbaTFKhaQ}, misc2 = {EMPIR 2017: Industry}, publisher = {Zenodo}, language = {30}, DOI = {10.5281/zenodo.3522631}, stag_bib_extends_levelofaccess = {NA}, author = {Elo, T. and Kuosmanen, P. and  Mustap{\"a}{\"a}, T. and Klobucar, R. and Acko, B. and Linkeov{\'a}, I. and S{\'y}kora, J. and Zelen{\'y}, V. and Smith, I. and Forbes, A. and Rhodes, S. and Brown, C. and Scheibner, A. and Hackel, S.G. and Wiedenh{\"o}fer, T. and Heeren, W. and Haertig, F. and Hutschenreuter, D. and Nikander, P. and Hovhannisyan, K. and Maennel, O. and Muller, B. and Heindorf, L. and Paciello, V.} } @Techreport { SmithWHHB2019, subid = {1434}, title = {D-SI in Short - Digital brochure on establishing the use of units in digitalised communication}, journal = {Zenodo}, year = {2019}, month = {11}, volume = {1}, number2 = {17IND02: SmartCom: Communication and validation of smart data in IoT-networks}, keywords = {Digital-SI (D-SI) data communication IoT-communication IoT-networking metrology data SmartCom digital exchange format}, web_url = {https://zenodo.org/record/3522074\#.XlTiRTFKhaQ}, misc2 = {EMPIR 2017: Industry}, publisher = {SmartCom}, language = {30}, DOI = {10.5281/zenodo.3522074}, stag_bib_extends_levelofaccess = {NA}, author = {Smith, I. and Wiedenh{\"o}fer, T. and Haertig, F. and Hutschenreuter, D. and Brown, C.} } @Article { AlveseSousaMB2019, subid = {1426}, title = {Calibration of insulin pumps}, journal = {Journal of Diabetes and Treatment}, year = {2019}, month = {11}, volume = {4}, number = {3}, number2 = {18HLT08: MEDDII: Metrology for drug delivery}, pages = {1075}, keywords = {Calibration, measurement, microflow, insulin pump, gravimetry, optical method}, misc2 = {EMPIR 2018: Health}, publisher = {Gavin Publishers}, language = {30}, ISSN = {2574-7568}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://www.gavinpublishers.com/assets/articles_pdf/1575449809article_pdf938882132.pdf}, author = {Sousa, J.A. and Martins, R. and Batista, E.} } @Proceedings { 30d35f7f4b2019, subid = {1420}, title = {A Modified Approach for Process-Integrated Reference Point Determination}, journal = {Proceedings of the 24th European VLBI Group for Geodesy and Astrometry Working Meeting}, year = {2019}, month = {11}, volume = {24}, number = {2019}, number2 = {18SIB01: GeoMetre: Large-scale dimensional measurements for geodesy}, pages = {172-176}, keywords = {Reference Point Determination, SLR, VLBI, Laser Tracker, Least-Squares Adjustment, In-Process Metrology, GGOS, VGOS}, web_url = {http://www.oan.es/evga2019/\&\#10;http://www.ign.es/web/ign/portal/publicaciones-boletines-y-libros-digitales\#DA-European-VLBI-Group-Geodesy-and-Astrometry-Working}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Centro Nacional de Informaci{\'o}n Geogr{\'a}fica (CNIG). 2019.}, event_place = {Las Palmas de Gran Canaria, Spain}, event_name = {24th European VLBI Group for Geodesy and Astrometry}, event_date = {17-03-2019 to 19-03-2019}, language = {30}, ISBN = {978-84-416-5634-5}, DOI = {10.7419/162.08.2019}, stag_bib_extends_levelofaccess = {NA} } @Proceedings { EschelbachLHG2019, subid = {1421}, title = {Measuring Focal Length Variations of VGOS TelescopesUsing Unmanned Aerial Systems}, journal = {Proceedings of the 24th European VLBI Group for Geodesy and Astrometry Working Meeting}, year = {2019}, month = {11}, volume = {24}, number = {2019}, number2 = {18SIB01: GeoMetre: Large-scale dimensional measurements for geodesy}, pages = {17-21}, keywords = {VGOS, Ring-focus paraboloid, Antennadeformation, Focal length, Unmanned aircraft system}, web_url = {http://www.oan.es/evga2019/24_EVGA_2019_Las_Palmas.pdf}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Centro Nacional de Informaci{\'o}n Geogr{\'a}fica (CNIG). 2019.}, address = {Madrid}, event_place = {Las Palmas de Gran Canaria, Spain}, event_name = {24th European VLBI Group for Geodesy and Astrometry}, event_date = {17-03-2019 to 19-03-2019}, language = {30}, ISBN = {978-84-416-5634-5}, DOI = {10.7419/162.08.2019}, stag_bib_extends_levelofaccess = {NA}, author = {Eschelbach, C. and Loesler, M. and Haas, R. and Greiwe, A.} } @Article { ProdromakisKKPCK2019, subid = {1479}, title = {Impact of Line Edge Roughness on ReRAM Uniformity and Scaling}, journal = {Materials}, year = {2019}, month = {11}, volume = {12}, number = {23}, number2 = {15SIB09: 3DNano: Traceable three-dimensional nanometrology}, pages = {3972}, keywords = {Resistive Random Access Memory (ReRAM); Line Edge Roughness (LER); variability; uniformity; modeling; lithography}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {MDPI AG}, language = {30}, ISSN = {1996-1944}, DOI = {10.3390/ma12233972}, stag_bib_extends_levelofaccess = {NA}, author = {Constantoudis, V. and Papavieros, G. and Karakolis, P. and Khiat, A. and Prodromakis, T. and Dimitrakis, P.} } @Article { SantosCMGPAM2019, subid = {1337}, title = {Multiconfiguration Dirac–Fock calculations of Zn K‐shell radiative and nonradiative transitions}, journal = {X-Ray Spectrometry}, year = {2019}, month = {10}, day = {29}, volume = {49}, number = {1}, number2 = {17FUN02: MetroMMC: Measurement of fundamental nuclear decay data using metallic magnetic calorimeters}, pages = {192-199}, keywords = {Dirac–Fock method, Zn K‐shell}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Wiley}, language = {30}, ISSN = {0049-8246, 1097-4539}, DOI = {10.1002/xrs.3089}, stag_bib_extends_levelofaccess = {NA}, author = {Martins, L. and Amaro, P. and Pessanha, S. and Guerra, M. and Machado, J. and Carvalho, M. L. and Santos, J. P.} } @Thesis { Bogen2019, subid = {1367}, title = {Frequenz-, Leistungs- und Positionsstabilisierung von UV-Lasersystemen fur Frequenzmetrologie mit hochgeladenen Ionen, Master Thesis, Ruprecht-Karls-Universitat, Heidelberg (2019)}, year = {2019}, month = {10}, day = {28}, number2 = {17FUN07: CC4C: Coulomb Crystals for Clocks}, keywords = {Optical ClockTrapped Ions}, web_url = {https://pure.mpg.de/rest/items/item_3175862_1/component/file_3175863/content}, misc2 = {EMPIR 2017: Fundamental}, school = {Ruprecht-Karls-Universit{\"a}t, Heidelberg}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {http://hdl.handle.net/21.11116/0000-0005-1733-8}, author = {Bogen, S.} } @Article { BinghamWSTMFZSRKH2019, subid = {1353}, title = {Formation of N{\'e}el-type skyrmions in an antidot lattice with perpendicular magnetic anisotropy}, journal = {Physical Review B}, year = {2019}, month = {10}, day = {25}, volume = {100}, number = {14}, number2 = {17FUN08: TOPS: Metrology for topological spin structures}, pages = {144435}, keywords = {Skyrmions, DMI, spin waves}, web_url = {https://arxiv.org/abs/1910.04515}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2469-9950, 2469-9969}, DOI = {10.1103/PhysRevB.100.144435}, stag_bib_extends_levelofaccess = {NA}, author = {Saha, S. and Zelent, M. and Finizio, S. and Mruczkiewicz, M. and Tacchi, S. and Suszka, A. K. and Wintz, S. and Bingham, N. S. and Raabe, J. and Krawczyk, M. and Heyderman, L. J.} } @Article { CalonicoLRBBP2019, subid = {1443}, title = {Absolute frequency measurement of the1S0 –3P0 transition of171Yb with a link to International Atomic Time}, journal = {Metrologia}, year = {2019}, month = {10}, day = {24}, number2 = {18SIB05: ROCIT: Robust Optical Clocks for International Timescales}, keywords = {optical lattice clock, SI second, frequency metrology}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/ab50e8}, stag_bib_extends_levelofaccess = {NA}, author = {Pizzocaro, M. and Bregolin, F. and Barbieri, P. and Rauf, . and Levi, F. and Calonico, D.} } @Article { Zorin2019, subid = {1254}, title = {Flux-Driven Josephson Traveling-Wave Parametric Amplifier}, journal = {Physical Review Applied}, year = {2019}, month = {10}, day = {23}, volume = {12}, number = {4}, number2 = {17FUN10: ParaWave: Josephson travelling wave parametric amplifier and its application for metrology}, pages = {1-16}, keywords = {Josephson junctions, SQUID, superconducting qubits, traveling waves, parametric amplifiers, Quantum information with solid state qubits}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2331-7019}, DOI = {10.1103/PhysRevApplied.12.044051}, stag_bib_extends_levelofaccess = {NA}, author = {Zorin, A.B.} } @Article { KuckLDMCTLT2019_2, subid = {1444}, title = {A Molecule‐Based Single‐Photon Source Applied in Quantum Radiometry}, journal = {Advanced Quantum Technologies}, year = {2019}, month = {10}, day = {22}, volume = {3}, number = {2}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {1900083}, keywords = {quantum radiometrysingle moleculessingle‐photon detectorssingle‐photon sources}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Wiley}, language = {30}, ISSN = {2511-9044, 2511-9044}, DOI = {10.1002/qute.201900083}, stag_bib_extends_levelofaccess = {NA}, author = {Lombardi, P. and Trapuzzano, M. and Colautti, M. and Margheri, G. and Degiovanni, I.P. and L{\'o}pez, M. and K{\"u}ck, S. and Toninelli, C.} } @Article { LombardiTCMDLKT2019, subid = {1807}, title = {A Molecule‐Based Single‐Photon Source Applied in Quantum Radiometry}, journal = {Advanced Quantum Technologies}, year = {2019}, month = {10}, day = {22}, volume = {3}, number = {2}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {1900083}, keywords = {quantum radiometry single molecules single‐photon detectors single‐photon sources}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Wiley}, language = {30}, ISSN = {2511-9044, 2511-9044}, DOI = {10.1002/qute.201900083}, stag_bib_extends_levelofaccess = {NA}, author = {Lombardi, P. and Trapuzzano, M. and Colautti, M. and Margheri, G. and Degiovanni, I.P. and L{\'o}pez, M. and K{\"u}ck, S. and Toninelli, C.} } @Article { KayserUWBWHH2019, subid = {1269}, title = {Experimental determination of line energies, line widths and relative transition probabilities of the Gadolinium L x-ray emission spectrum}, journal = {Metrologia}, year = {2019}, month = {10}, day = {21}, volume = {56}, number = {6}, number2 = {16ENV07: AEROMET: Aerosol metrology for atmospheric science and air quality}, pages = {065007}, keywords = {x-ray spectrometry, von Hamos spectrometer, rare earth metal, x-ray metrology, HAPG, gadolinium, atomic fundamental parameters}, web_url = {https://arxiv.org/abs/1903.08085}, misc2 = {EMPIR 2016: Environment}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/ab40d2}, stag_bib_extends_levelofaccess = {NA}, author = {Wansleben, M. and Kayser, Y. and Honicke, P. and Holfelder, I. and W{\"a}hlisch, A. and Unterumsberger, R. and Beckhoff, B.} } @Article { MarcqMHGFCBBTBMWW2019, subid = {1248}, title = {RadCalNet: A Radiometric Calibration Network for Earth Observing Imagers Operating in the Visible to Shortwave Infrared Spectral Range}, journal = {Remote Sensing}, year = {2019}, month = {10}, day = {16}, volume = {11}, number = {2401}, number2 = {16ENV03: MetEOC-3: Further metrology for earth observation and climate}, pages = {20}, keywords = {RadCalNet, CEOS, radiometric calibration, SI-traceable, surface reflectance, network, instrument}, web_url = {https://doi.org/10.3390/rs11202401\&\#160;}, misc2 = {EMPIR 2016: Environment}, publisher = {MDPI AG}, language = {30}, ISSN = {2072-4292}, DOI = {10.3390/rs11202401}, stag_bib_extends_levelofaccess = {NA}, author = {Bouvet, M. and Thome, K. and Berthelot, B. and Bialek, A. and Czapla-Myers, J. and Fox, N. and Goryl, P. and Henry, P. and Ma, L. and Marcq, S. and Meygret, A. and Wenny, B. and Woolliams, E.} } @Thesis { Warnecke2019, subid = {1365}, title = {Imaging of Coulomb crystals in a cryogenic Paul trap experiment, Master Thesis, Ruprecht-Karls-Universitat, Heidelberg (2019)}, year = {2019}, month = {10}, day = {15}, number2 = {17FUN07: CC4C: Coulomb Crystals for Clocks}, keywords = {Optical ClockTrapped Ions}, web_url = {https://pure.mpg.de/rest/items/item_3173887_1/component/file_3173888/content}, misc2 = {EMPIR 2017: Fundamental}, school = {University Heidelberg}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {http://hdl.handle.net/21.11116/0000-0004-F47D-D}, author = {Warnecke, C.} } @Article { PfleidererRRLBAPWB2019, subid = {1313}, title = {Ferromagnetic Resonance with Magnetic Phase Selectivity by Means of Resonant Elastic X-Ray Scattering on a Chiral Magnet}, journal = {Physical Review Letters}, year = {2019}, month = {10}, day = {14}, volume = {123}, number = {16}, number2 = {17FUN08: TOPS: Metrology for topological spin structures}, keywords = {Skyrmions, X-ray scattering, Ferromagnetic resonance}, web_url = {https://arxiv.org/abs/1909.08293}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {0031-9007, 1079-7114}, DOI = {10.1103/PhysRevLett.123.167201}, stag_bib_extends_levelofaccess = {NA}, author = {P{\"o}llath, S. and Aqeel, A. and Bauer, A. and Luo, C. and Ryll, H. and Radu, F. and Pfleiderer, C. and Woltersdorf, G. and Back, C. H.} } @Proceedings { HoogenboomHRY2019, subid = {1301}, title = {Reliable Power Transformer Efficiency Tests}, journal = {Proceedings 5th International Colloquium “Transformer Research and Asset Management” Opatija/Croatia, October 09 – 12, 2019}, year = {2019}, month = {10}, day = {11}, number2 = {17NRM01: TrafoLoss: Loss Measurements on Power Transformers and Reactors}, keywords = {power transformers, efficiency, loss, loss measurement, reliability, calibration, accuracy, uncertainty}, tags = {SEG}, misc2 = {EMPIR 2017: Pre-Co-Normative}, event_place = {Opatija, Croatia}, event_name = {5th International Colloquium “Transformer Research and Asset Management” Opatija/Croatia}, event_date = {09-10-2019 to 12-10-2019}, language = {30}, DOI = {10.5281/zenodo.3559845}, stag_bib_extends_levelofaccess = {NA}, author = {Hoogenboom, D. and Houtzager, E. and Rietveld, G. and Ye, G.} } @Article { AlvesBLLPB2019, subid = {1401}, title = {Maltese cross coupling to individual cold atoms in free space}, journal = {Optics Express}, year = {2019}, month = {10}, day = {11}, volume = {27}, number = {21}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, pages = {31042}, keywords = {Sub-Pissonian statistics, photon anti bounching}, misc2 = {EMPIR 2017: Fundamental}, publisher = {The Optical Society}, address = {2010 Massachusetts Ave, NW NW Washington DC 20036-1023 United States}, language = {30}, ISSN = {1094-4087}, DOI = {10.1364/OE.27.031042}, stag_bib_extends_levelofaccess = {NA}, author = {Bruno, Natalia and Bianchet, Lorena C. and Prakash, Vindhiya and Li, Nan and Alves, Nat{\'a}lia and Mitchell, M.W.} } @Article { NajmanovaPP2019, subid = {1326}, title = {Intraocular pressure response affected by changing of sitting and supine positions}, journal = {Acta Ophthalmologica}, year = {2019}, month = {10}, day = {10}, volume = {n/a}, number = {n/a}, number2 = {16RPT03: inTENSE: Developing research capabilities for traceable intraocular pressure measurements}, pages = {1-5}, keywords = {baseline, body position, intraocular pressure, sitting, supine, time course}, web_url = {https://onlinelibrary.wiley.com/doi/full/10.1111/aos.14267}, misc2 = {EMPIR 2016: Research Potential}, publisher = {Wiley}, language = {30}, ISSN = {1755-375X, 1755-3768}, DOI = {10.1111/aos.14267}, stag_bib_extends_levelofaccess = {NA}, author = {Najmanov{\'a}, E. and Pluh{\'a}ček, F. and Haklov{\'a}, M} } @Inbook { EnricoGF2019, subid = {1357}, title = {Superconducting Josephson-Based Metamaterials for Quantum-Limited Parametric Amplification: A Review}, year = {2019}, month = {10}, day = {10}, number2 = {17FUN10: ParaWave: Josephson travelling wave parametric amplifier and its application for metrology}, keywords = {superconductivity, metamaterial, Josephson effect, parametric amplification, microwave photonics}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IntechOpen}, address = {IntechOpen Rijeka}, booktitle = {Condensed Matter Physics}, language = {30}, DOI = {10.5772/intechopen.89305}, stag_bib_extends_levelofaccess = {NA}, author = {Fasolo, L. and Greco, A. and Enrico, E.} } @Article { BochudNHLJJ2019, subid = {1231}, title = {Development and validation of a double focalizing magnetic spectrometer for beta spectrum measurements}, journal = {Nuclear Instruments and Methods in Physics Research Section A: Accelerators, Spectrometers, Detectors and Associated Equipment}, year = {2019}, month = {10}, volume = {942}, number = {21 October}, number2 = {15SIB10: MetroBeta: Radionuclide beta spectra metrology}, pages = {162384}, keywords = {magnetic spectrometer, beta shape measurement, acquisition system, Cl-36}, web_url = {https://reader.elsevier.com/reader/sd/pii/S0168900219309684?token=9907411027790E1C7A6500A4337D2D10E57E40E772BECF66298808C0FD62E4F989D02F38F9DA80F8EEB0FCC5EF556A53}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {Elsevier BV}, language = {30}, ISSN = {0168-9002}, DOI = {10.1016/j.nima.2019.162384}, stag_bib_extends_levelofaccess = {NA}, author = {Juget, F. and Juget, F. and Lorusso, G. and Haefeli, G. and Nedjadi, Y. and Bochud, F.} } @Article { BurgerHZB2019, subid = {1249}, title = {Modal analysis for nanoplasmonics with nonlocal material properties}, journal = {Physical Review B}, year = {2019}, month = {10}, volume = {100}, number = {15}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {155406}, keywords = {Nanophotonics, Plasmonic, Drude model, Electromagnetic wave theory, Finite-element method}, web_url = {https://arxiv.org/abs/1906.01941}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2469-9950, 2469-9969}, DOI = {10.1103/PhysRevB.100.155406}, stag_bib_extends_levelofaccess = {NA}, author = {Binkowski, F. and Zschiedrich, L. and Hammerschmidt, M. and Burger, S.} } @Article { GiordanoLGCDL2019, subid = {1335}, title = {Calibration of Voltage and Current Transducers for DC Railway Systems}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2019}, month = {10}, volume = {68}, number = {10}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, pages = {3850-3860}, keywords = {Calibration, current transducer, dc railway system, dynamic conditions, energy measurement, power measurement, stationary conditions, voltage transducer.}, misc2 = {EMPIR 2016: Energy}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9456, 1557-9662}, DOI = {10.1109/TIM.2019.2912232}, stag_bib_extends_levelofaccess = {NA}, author = {Crotti, G. and Delle Femine, A. and Gallo, D. and Giordano, D. and Landi, C. and Luiso, M.} } @Article { Dombrowski2019, subid = {1392}, title = {Preparedness intercomparison of passive H*(10) area photon dosemeters in 2017/2018 (IC2017prep)}, journal = {Journal of Instrumentation}, year = {2019}, month = {10}, volume = {14}, number = {10}, number2 = {16ENV04: Preparedness: Metrology for mobile detection of ionising radiation following a nuclear or radiological incident}, pages = {P10008-P10008}, keywords = {Dosimetry concepts and apparatus; Solid state detectors; Detector design and con-struction technologies and materials}, web_url = {https://iopscience.iop.org/article/10.1088/1748-0221/14/10/P10008/pdf}, misc2 = {EMPIR 2016: Environment}, publisher = {IOP Publishing}, language = {30}, ISSN = {1748-0221}, DOI = {10.1088/1748-0221/14/10/P10008}, stag_bib_extends_levelofaccess = {NA}, author = {Dombrowski, H.} } @Article { LiWW2019, subid = {1622}, title = {Three-dimensional visualisation of gas-water two-phase flow based on bubble mapping method and size projection algorithm}, journal = {Flow Measurement and Instrumentation}, year = {2019}, month = {10}, volume = {69}, number2 = {16ENG07: MultiFlowMet II: Multiphase flow reference metrology}, pages = {101590}, keywords = {algorithm, size projection, bubble mapping, gas-water two phase flows}, misc2 = {EMPIR 2016: Energy}, publisher = {Elsevier BV}, language = {30}, ISSN = {0955-5986}, DOI = {10.1016/j.flowmeasinst.2019.101590}, stag_bib_extends_levelofaccess = {NA}, author = {Li, K. and Wang, Q. and Wang, M.} } @Proceedings { Mariscotti2019_3, subid = {1957}, title = {Characterization of Active Power Flow at Harmonics for AC and DC Railway Vehicles}, journal = {2019 IEEE Vehicle Power and Propulsion Conference (VPPC)}, year = {2019}, month = {10}, volume = {1}, number = {1}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, pages = {6}, keywords = {Energy consumption, Power Quality, Power system harmonics, Rail transportation}, web_url = {https://doi.org/10.5281/zenodo.3601489}, misc2 = {EMPIR 2016: Energy}, publisher = {IEEE}, event_place = {Hanoi, Vietnam}, event_name = {2019 IEEE Vehicle Power and Propulsion Conference (VPPC)}, event_date = {14-10-2019 to 17-10-2019}, language = {30}, ISBN = {978-1-7281-1249-7}, ISSN = {1938-8756}, DOI = {10.1109/VPPC46532.2019.8952310}, stag_bib_extends_levelofaccess = {NA}, author = {Mariscotti, A.} } @Article { LaihoSSKHSBWR2019, subid = {2617}, title = {Photon-number parity of heralded single photons from a Bragg-reflection waveguide reconstructed loss-tolerantly via moment generating function}, journal = {New Journal of Physics}, year = {2019}, month = {10}, volume = {21}, number = {10}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {103025}, keywords = {factorial moment of photon number, photon-number parity, moment generating function, parametric down-conversion, Bragg-reflection waveguide, transition-edge sensor}, web_url = {https://iopscience.iop.org/article/10.1088/1367-2630/ab42ae}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {1367-2630}, DOI = {10.1088/1367-2630/ab42ae}, stag_bib_extends_levelofaccess = {NA}, author = {Laiho, K. and Schmidt, M. and Suchomel, H. and Kamp, M. and H{\"o}fling, S. and Schneider, C. and Beyer, J. and Weihs, G. and Reitzenstein, S.} } @Article { Maringer2019, subid = {1257}, title = {An innovative quick method for tracable measurement of radon 222 indrinking water}, journal = {Applied Radiation and Isotopes}, year = {2019}, month = {9}, day = {30}, volume = {155}, number2 = {16ENV10: MetroRADON: Metrology for radon monitoring}, pages = {1-9}, keywords = {Radon 222 activity concentration, Traceable calibration, Drinking water, Radon emanation, Ionisation chamber, Uncertainty budget, Characteristic limits}, web_url = {https://doi.org/10.5281/zenodo.3555047}, misc2 = {EMPIR 2016: Environment}, publisher = {Elsevier Ltd.}, language = {30}, ISSN = {0969-8043}, DOI = {10.1016/j.apradiso.2019.108907}, stag_bib_extends_levelofaccess = {NA}, author = {Maringer, F.J.} } @Article { EschelbachHLG2019, subid = {1222}, title = {Gravitational deformation of ring-focus antennas for VGOS: first investigations at the Onsala twin telescopes project}, journal = {Journal of Geodesy}, year = {2019}, month = {9}, day = {28}, volume = {2019}, number2 = {18SIB01: GeoMetre: Large-scale dimensional measurements for geodesy}, pages = {1-19}, keywords = {Ring-focus paraboloid, Radio telescope, Antenna deformation, VLBI, VGOS, Signal path variation, SQP, Reverse engineering, Photogrammetry, Unmanned aircraft system}, web_url = {https://link.springer.com/content/pdf/10.1007\%2Fs00190-019-01302-5.pdf\&\#10;https://link.springer.com/article/10.1007/s00190-019-01302-5}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Springer Berlin Heidelberg}, language = {30}, ISSN = {0949-7714}, DOI = {10.1007/s00190-019-01302-5}, stag_bib_extends_levelofaccess = {NA}, author = {L{\"o}sler, M. and Haas, R. and Eschelbach, C. and Greiwe, A.} } @Article { ToivonenK2019, subid = {1296}, title = {Dynamic Enhancement of Nitric Oxide Radioluminescence with Nitrogen Purge}, journal = {Scientific Reports}, year = {2019}, month = {9}, day = {25}, volume = {9}, number = {1}, number2 = {16ENV09: MetroDECOM II: In situ metrology for decommissioning nuclear facilities}, pages = {13884}, keywords = {Radioluminescence, nitric oxide, nitrogen purge}, web_url = {https://www.nature.com/articles/s41598-019-50396-6}, misc2 = {EMPIR 2016: Environment}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2045-2322}, DOI = {10.1038/s41598-019-50396-6}, stag_bib_extends_levelofaccess = {NA}, author = {Kerst, T. and Toivonen, J.} } @Proceedings { FortuneCRSPA2019, subid = {1198}, title = {STUDY OF NONINVASIVE INSTRUMENTS FOR THE MEASUREMENT OF X-RAY HIGH VOLTAGE TUBE}, journal = {Proceedings of CIM 2019}, year = {2019}, month = {9}, day = {24}, number2 = {15NRM02: UHV: Techniques for ultra-high voltage and very fast transients}, keywords = {Pulsed X-ray tube, KVp meters, Metrology, Dose.}, web_url = {https://www.cim2019.com}, misc2 = {EMPIR 2015: Pre-Co-Normative}, event_place = {Paris, France}, event_name = {The 19st Congr{\`e}s Internationla de M{\'e}trologie}, event_date = {24-09-2019 to 26-09-2019}, language = {30}, DOI = {10.1051/metrology/201902002}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {10.5281/zenodo.3335340}, author = {Agazar, M. and Perrillat, D. and Saadeddine, H. and Robert, C. and Casteignau, L. and Fortune, D.} } @Proceedings { Allal2019, subid = {1230}, title = {EMPIR European project for validation of vector array SAR measurement systems}, journal = {19th International Congress of Metrology (CIM2019)}, year = {2019}, month = {9}, day = {23}, number = {2019 19th}, number2 = {16NRM07: Vector SAR: SAR measurement using vector probes}, pages = {3/02003}, keywords = {Specific Absorption Rate, Vector Probe Array, MIMO}, web_url = {https://cfmetrologie.edpsciences.org/articles/metrology/abs/2019/01/metrology_cim2019_02003/metrology_cim2019_02003.html}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {EDP Sciences}, event_place = {LNE}, event_name = {19th International Congress of Metrology}, event_date = {24-09-2019 to 26-09-2019}, language = {30}, DOI = {10.1051/metrology/201902003}, stag_bib_extends_levelofaccess = {NA}, author = {Allal, Djamel} } @Proceedings { FurtadoQPF2019, subid = {1258}, title = {Robustness studies of oscillation-type density meters with viscoelastic fluids}, journal = {19th International Congress of Metrology (CIM2019)}, year = {2019}, month = {9}, day = {23}, number = {2019}, number2 = {17RPT02: rhoLiq: Establishing traceability for liquid density measurements}, pages = {16/13002}, keywords = {density, viscoelasticity, oscillation-type density meters, damping}, web_url = {https://cfmetrologie.edpsciences.org/articles/metrology/abs/2019/01/metrology_cim2019_13002/metrology_cim2019_13002.html}, misc2 = {EMPIR 2017: Research Potential}, publisher = {EDP Sciences}, event_place = {Paris, France}, event_name = {19th International Congress of Metrology}, event_date = {24-09-2019 to 26-09-2019}, language = {30}, DOI = {10.1051/metrology/201913002}, stag_bib_extends_levelofaccess = {NA}, author = {Furtado, A. and Furtado, A. and Pereira, J. and Quendera, R.} } @Proceedings { BagciHYTAGD2019, subid = {1325}, title = {Improvement of dynamic pressure standard for calibration of dynamic pressure transducers}, journal = {19th International Congress of Metrology (CIM2019)}, year = {2019}, month = {9}, day = {23}, number = {2019}, number2 = {17IND07: DynPT: Development of measurement and calibration techniques for dynamic pressures and temperatures}, keywords = {dynamic pressure, measurement, calibration, drop mass, dynamic calibration machine}, misc2 = {EMPIR 2017: Industry}, publisher = {EDP Sciences}, address = {17 av. du Hoggar PA de Courtaboeuf BP 112 PA de Courtaboeuf BP 112 Les Ulis cedex A 91944 France}, event_place = {Paris}, event_name = {19th International Congress of Metrology}, event_date = {24-09-2019 to 26-09-2019}, language = {30}, DOI = {10.1051/metrology/201927009}, stag_bib_extends_levelofaccess = {NA}, author = {Durgut, Y. and Ganioglu, O. and Aydemir, B. and Turk, A. and Yilmaz, R. and Hamarat, A. and Bağcı, E.} } @Proceedings { CucciaSBLvAMCVSBPCT2019, subid = {1781}, title = {Development of standardized methods for the analysis of amines, terpenes and ammonia in biomethane}, journal = {19th International Congress of Metrology (CIM2019)}, year = {2019}, month = {9}, day = {23}, number2 = {16ENG05: Biomethane: Metrology for biomethane}, keywords = {biomethane, terpenes, amines, ammonia}, tags = {EnG}, misc2 = {EMPIR 2016: Energy}, publisher = {EDP Sciences}, event_place = {Paris}, event_name = {19th International Congress of Metrology}, event_date = {24-09-2019 to 26-09-2019}, language = {30}, DOI = {10.1051/metrology/201906001}, stag_bib_extends_levelofaccess = {NA}, author = {Cuccia, L. and Sanz, B. and Ballestas Castro, D. and Li, J. and van der Veen, A.M.H. and Amico di Meane, E. and Moreno, S. and Culleton, L.P. and Vorin, D. and Senn{\'e}, C. and Bougueroua, F. and Pyr{\'e}e, L. and Courtois, Y. and Tastard, C.} } @Proceedings { PersijndMvL2019, subid = {1782}, title = {Metrology for biomethane conformity assessment: measure trace gas impurities in biomethane}, journal = {19th International Congress of Metrology (CIM2019)}, year = {2019}, month = {9}, day = {23}, number2 = {16ENG05: Biomethane: Metrology for biomethane}, keywords = {biomethane, siloxanes, halogenated hydrocarbons, hydrogen chloride, hydrogen fluoride, conformity assessment}, tags = {EnG}, misc2 = {EMPIR 2016: Energy}, publisher = {EDP Sciences}, event_place = {Paris}, event_name = {19th International Congress of Metrology}, event_date = {24-09-2019 to 26-09-2019}, language = {30}, DOI = {10.1051/metrology/201906002}, stag_bib_extends_levelofaccess = {NA}, author = {Persijn, S. and de Krom, I. and Meuzelaar, H. and van der Veen, A.M.H. and Li, J.} } @Proceedings { Mariscotti2019, subid = {1455}, title = {Relevance of Harmonic Active Power Terms for Energy Consumption in Some Railway Systems}, journal = {Proc. of 24nd IMEKO TC4 International Symposium}, year = {2019}, month = {9}, day = {20}, volume = {TC4}, number = {2019}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, pages = {117-121}, keywords = {Energy consumption, Power Quality, Power system harmonics, Rail transportation}, web_url = {https://www.imeko.org/publications/tc4-2019/IMEKO-TC4-2019-026.pdf}, misc2 = {EMPIR 2016: Energy}, publisher = {IMEKO-International Measurement Federation Secretariat}, event_place = {Xi'An, China}, event_name = {24nd IMEKO TC4 International Symposium}, event_date = {17-09-2019 to 20-09-2019}, language = {30}, DOI = {10.5281/zenodo.3604337}, stag_bib_extends_levelofaccess = {NA}, author = {Mariscotti, A.} } @Proceedings { GiordanoM2019, subid = {1453}, title = {Electrical Characteristics of Pantograph Arcs in DC Railways: Infrastructure Influence}, journal = {Proc. of 24nd IMEKO TC4 International Symposium}, year = {2019}, month = {9}, day = {20}, volume = {TC4}, number = {2019}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, pages = {155-159}, keywords = {Arc discharge, Electric arc, Power Quality, Rail transportation}, web_url = {https://www.imeko.org/publications/tc4-2019/IMEKO-TC4-2019-033.pdf}, misc2 = {EMPIR 2016: Energy}, publisher = {IMEKO-International Measurement Federation Secretariat}, event_place = {Xi'An, China}, event_name = {24nd IMEKO TC4 International Symposium}, event_date = {17-09-2019 to 20-09-2019}, language = {30}, ISBN = {1111}, ISSN = {1111}, DOI = {10.5281/zenodo.3604344}, stag_bib_extends_levelofaccess = {NA}, author = {Giordano, D. and Mariscotti, A.} } @Proceedings { Mariscotti2019_2, subid = {1454}, title = {Discussion of Power Quality Metrics suitable for DC Power Distribution and Smart Grids}, journal = {Proc. of 24nd IMEKO TC4 International Symposium}, year = {2019}, month = {9}, day = {20}, volume = {TC4}, number = {2019}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, pages = {150-154}, keywords = {Power Quality, DC distribution network, DC smart grid}, tags = {SEG}, web_url = {https://www.imeko.org/publications/tc4-2019/IMEKO-TC4-2019-032.pdf}, misc2 = {EMPIR 2016: Energy}, publisher = {IMEKO-International Measurement Federation Secretariat}, event_place = {Xi'An, China}, event_name = {24nd IMEKO TC4 International Symposium}, event_date = {17-09-2019 to 20-09-2019}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {.}, author = {Mariscotti, A.} } @Article { SanmamedSDGC2019, subid = {2151}, title = {Temperature influence on the frequency response of the Keysight 3458A digital multimeter}, journal = {Proceedings 23rd IMEKO TC 4 International Symposium}, year = {2019}, month = {9}, day = {20}, number2 = {17RPT03: DIG-AC: A digital traceability chain for AC voltage and current}, keywords = {Analog to Digital Converter, temperature coefficient, aperture time, digital sampling, digitizer}, misc2 = {EMPIR 2017: Research Potential}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://www.imeko.org/publications/tc4-2019/IMEKO-TC4-2019-042.pdf}, author = {Sanmamed, Y.A. and Salinas, J.R. and Diaz de Aguilar, J. and Garc{\'i}a-Lagos, F. and Caballero, R.} } @Article { HohlsBL2019, subid = {1310}, title = {Time-energy filtering of single electrons in ballistic waveguides}, journal = {New Journal of Physics}, year = {2019}, month = {9}, day = {19}, volume = {21}, number = {9}, number2 = {17FUN04: SEQUOIA: Single-electron quantum optics for quantum-enhanced measurements}, pages = {093042}, keywords = {Single electrons, time-energy filtering}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {1367-2630}, DOI = {10.1088/1367-2630/ab3fbb}, stag_bib_extends_levelofaccess = {NA}, author = {Locane, E. and Brouwer, P.W. and Kashcheyevs, V.} } @Article { BurgerHSGSR2019, subid = {1291}, title = {Benchmarking Five Global Optimization Approaches for Nano-optical Shape Optimization and Parameter Reconstruction}, journal = {ACS Photonics}, year = {2019}, month = {9}, day = {17}, volume = {6}, number = {11}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {2726-2733}, keywords = {shape optimization, parameter reconstruction, machine learning, global optimization, Bayesian optimization}, web_url = {https://arxiv.org/abs/1809.06674}, misc2 = {EMPIR 2017: Fundamental}, publisher = {ACS}, language = {30}, ISSN = {2330-4022, 2330-4022}, DOI = {10.1021/acsphotonics.9b00706}, stag_bib_extends_levelofaccess = {NA}, author = {Schneider, P.I. and Garcia Santiago, X. and Soltwisch, Vi. and Hammerschmidt, M. and Burger, S. and Rockstuhl, C.} } @Article { SterpinG2019, subid = {1332}, title = {Monte Carlo calculation of beam quality correction factors in proton beams using PENH}, journal = {Physics in Medicine \& Biology}, year = {2019}, month = {9}, day = {17}, volume = {64}, number = {18}, number2 = {16NRM03: RTNORM: kQ factors in modern external beam radiotherapy applications to update IAEA TRS-398}, pages = {185009}, keywords = {beam quality correction factors, Monte Carlo calculation, radiation dosimetry, proton therapy}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {IOP Publishing}, language = {30}, ISSN = {1361-6560}, DOI = {10.1088/1361-6560/ab3b94}, stag_bib_extends_levelofaccess = {NA}, author = {Gom{\`a}, C. and Sterpin, E.} } @Article { MayrBWHFMRWZ2019, subid = {1370}, title = {Deterministic Field-Free Skyrmion Nucleation at a Nanoengineered Injector Device}, journal = {Nano Letters}, year = {2019}, month = {9}, day = {17}, volume = {19}, number = {10}, number2 = {17FUN08: TOPS: Metrology for topological spin structures}, pages = {7246-7255}, keywords = {Skyrmion; nanomagnetism, spin-orbit torque}, web_url = {https://arxiv.org/abs/1902.10435}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Chemical Society (ACS)}, address = {CAS, a division of the American Chemical Society 2540 Olentangy River Road Contract \#: 19-0000016470-01 PO \#: 6000110532 Columbus Ohio 43210 United States}, language = {30}, ISSN = {1530-6984, 1530-6992}, DOI = {10.1021/acs.nanolett.9b02840}, stag_bib_extends_levelofaccess = {NA}, author = {Finizio, S. and Zeissler, K. and Wintz, S. and Mayr, S. and We{\ss}els, T. and Huxtable, A.J. and Burnell, G. and Marrows, C.H. and Raabe, J.} } @Article { SergeevaCholletFPPDMS2019, subid = {1268}, title = {Optimizing magnetoresistive sensor signal-to-noise via pinning field tuning}, journal = {Applied Physics Letters}, year = {2019}, month = {9}, day = {16}, volume = {115}, number = {12}, number2 = {15SIB06: NanoMag: Nano-scale traceable magnetic field measurements}, pages = {122406}, keywords = {magnetic sensor, noise, magnetoresistance}, web_url = {https://arxiv.org/abs/1909.04531}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {AIP Publishing}, language = {30}, ISSN = {0003-6951, 1077-3118}, DOI = {10.1063/1.5108604}, stag_bib_extends_levelofaccess = {NA}, author = {Moulin, J. and Doll, A. and Paul, E. and Pannetier-Lecoeur, M. and Fermon, C. and Sergeeva-Chollet, N. and Solignac, A.} } @Article { BlakesleyK2019, subid = {1951}, title = {Energy Rating for Evaluating Performance of Perovskite and Perovskite-on-Silicon Tandem Devices in Real-World Conditions}, journal = {36th European Photovoltaic Solar Energy Conference and Exhibition}, year = {2019}, month = {9}, day = {13}, number2 = {16ENG02: PV-Enerate: Advanced PV energy rating}, pages = {623 - 628}, keywords = {Energy Rating Perovskite Based Photovoltaics}, web_url = {https://zenodo.org/record/4055579}, misc2 = {EMPIR 2016: Energy}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {3-936338-60-4}, author = {Blakesley, J.C. and Koutsourakis, G. } } @Article { BremerFPRSHW2019, subid = {1804}, title = {Cesium‐Vapor‐Based Delay of Single Photons Emitted by Deterministically Fabricated Quantum Dot Microlenses}, journal = {Advanced Quantum Technologies}, year = {2019}, month = {9}, day = {12}, volume = {3}, number = {2}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {1900071}, keywords = {atomic vapors delays deterministic fabrication quantum dots single‐photon sources}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Wiley}, language = {30}, ISSN = {2511-9044, 2511-9044}, DOI = {10.1002/qute.201900071}, stag_bib_extends_levelofaccess = {NA}, author = {Bremer, L. and Fischbach, S. and Park, S‐I. and Rodt, S. and Song, J‐Dong. and Heindel, T. and Weber, N.} } @Article { PalonenOKBLGG2019, subid = {1293}, title = {Laser Spectroscopy for Monitoring of Radiocarbon in Atmospheric Samples}, journal = {Analytical Chemistry}, year = {2019}, month = {9}, day = {10}, volume = {91}, number = {19}, number2 = {16ENV09: MetroDecom II: In situ metrology for decommissioning nuclear facilities}, pages = {12315-12320}, keywords = {Radiocarbon, Laser spectroscopy}, web_url = {https://pubs.acs.org/doi/10.1021/acs.analchem.9b02496}, misc2 = {EMPIR 2016: Environment}, publisher = {American Chemical Society (ACS)}, language = {30}, ISSN = {0003-2700, 1520-6882}, DOI = {10.1021/acs.analchem.9b02496}, stag_bib_extends_levelofaccess = {NA}, author = {Genoud, G. and Genoud, G. and Lehmuskoski, J. and Bell, S. and Palonen, V. and Oinonen, M. and Koskinen-Soivi, M.L.} } @Proceedings { SahagiaL2019, subid = {1772}, title = {Absolute standardization of the radionuclide 54Mn and participation at international comparisons}, journal = {Proceedings of the 7th International Proficiency Testing Conference (PTconf), Oradea, Romania, 10-13 September 2019}, year = {2019}, month = {9}, day = {10}, number2 = {16ENV10: MetroRADON: Metrology for radon monitoring}, pages = {187-193}, keywords = {Primary Standard, Key Comparison CCRI(II)-K2.Mn-54 , 4piPC-gamma coincidence method, Ionisation chamber measurement}, misc2 = {EMPIR 2016: Environment}, publisher = {Smart Publishing Bucharest}, event_place = {Oradea (Romania)}, event_name = {7th International Proficiency Testing Conference}, event_date = {10-09-2019 to 13-09-2019}, language = {30}, ISSN = {2066-737X}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {http://www.pt-conf.org/2019/wp-content/uploads/2019/09/Proceedings-PT-Conf-2019.pdf}, author = {Sahagia, M. and Luca, A.} } @Article { GomezMMCPM2019, subid = {2735}, title = {Interferometric measurement of interhyperfine scattering lengths in 87Rb}, journal = {Physical Review A}, year = {2019}, month = {9}, day = {10}, volume = {100}, number = {3}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, keywords = {BEC, Interferometry, interhyperfine scattering}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2469-9926, 2469-9934}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://arxiv.org/abs/1904.07617}, author = {Gomez, P. and Mazzinghi, C. and Martin, F. and Coop, S. and Palacios, S. and Mitchell, M.W.} } @Proceedings { ChiampiBAZ2019, subid = {1271}, title = {Uncertainty propagation in phaseless electric properties tomography}, journal = {2019 International Conference on Electromagnetics in Advanced Applications (ICEAA)}, year = {2019}, month = {9}, number2 = {18HLT05: QUIERO: Quantitative MR-based imaging of physical biomarkers}, keywords = {magnetic resonance imaging (MRI), phaseless contrast source inversion (CSI), electric properties tomography (EPT), uncertainty propagation, Monte Carlo method}, web_url = {https://arxiv.org/abs/1911.02809}, misc2 = {EMPIR 2018: Health}, publisher = {IEEE}, event_place = {Granada}, event_name = {2019 International Conference on Electromagnetics in Advanced Applications}, event_date = {09-09-2019 to 13-09-2019}, language = {30}, DOI = {10.1109/ICEAA.2019.8879147}, stag_bib_extends_levelofaccess = {NA}, author = {Arduino, Alessandro and Bottauscio, O. and Chiampi, M. and Zilberti, L.} } @Article { Bossew2019, subid = {1289}, title = {Radon Priority Areas and Radon Extremes – Initial Statistical Considerations}, journal = {Radiation Environment and Medicine}, year = {2019}, month = {9}, volume = {8}, number = {2}, number2 = {16ENV10: MetroRADON: Metrology for radon monitoring}, pages = {94-104}, keywords = {radon priority area, anomaly, extreme}, misc2 = {EMPIR 2016: Environment}, publisher = {Hirosaki University press}, language = {30}, ISSN = {2423-9097}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {http://crss.hirosaki-u.ac.jp/wp-content/files_mf/1568795052Web_REMVol828_PeterBossew.pdf}, author = {Bossew, P.} } @Proceedings { KrokerWSKB2019, subid = {1282}, title = {Sub-Wavelength Features in Spectroscopic Mueller Matrix Ellipsometry}, journal = {Deutsche Gesellschaft f{\"u}r angewandte Optik Proceedings 2019}, year = {2019}, month = {9}, volume = {120}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, keywords = {Gratings, Measurement Technology, Scatterometry}, web_url = {https://www.dgao-proceedings.de/download/120/120_p9.pdf}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Deutsche Gesellschaft f{\"u}r angewandte Optik e.V. (DGaO)}, event_place = {Darmstadt}, event_name = {120. Jahrestagung der Deutschen Gesellschaft f{\"u}r angewandte Optik}, event_date = {11-06-2019 to 15-06-2019}, language = {30}, ISSN = {1614-8436}, stag_bib_extends_levelofaccess = {NA}, author = {Kroker, Stefanie and Wurm, Matthias and Siefke, Thomas and K{\"a}seberg, Tim and Bodermann, Bernd} } @Article { KorpelainenGKAS2019, subid = {1298}, title = {Atomic force microscope with an adjustable probe direction and piezoresistive cantilevers operated in tapping-mode / Im Tapping-Modus betriebenes Rasterkraftmikroskop mit einstellbarer Antastrichtung und piezoresistiven Cantilevern}, journal = {tm - Technisches Messen}, year = {2019}, month = {9}, volume = {86}, number = {s1}, number2 = {15SIB09: 3DNano: Traceable three-dimensional nanometrology}, pages = {12-16}, keywords = {Rasterkraftmikroskopie; piezoresistive Cantilever; Nanomessmaschine}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {Walter de Gruyter GmbH}, language = {30}, ISSN = {2196-7113, 0171-8096}, DOI = {10.1515/teme-2019-0035}, stag_bib_extends_levelofaccess = {NA}, author = {Schaude, J. and Albrecht, J. and Kl{\"o}pzig, U. and Gr{\"o}schl, A.C. and Hausotte, Tino} } @Proceedings { BermbachSHTL2019, subid = {1294}, title = {Guards and Watchdogs in One-Way Synchronization with Delay-Related Authentication Mechanisms}, journal = {2019 IEEE International Symposium on Precision Clock Synchronization for Measurement, Control, and Communication (ISPCS)}, year = {2019}, month = {9}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, pages = {1-6}, keywords = {Synchronization, Protocols, Servers, Cryptography, Clocks, Global navigation satellite system}, tags = {SEG}, web_url = {https://doi.org/10.1109/ISPCS.2019.8886633}, misc2 = {EMPIR 2017: Industry}, publisher = {IEEE}, event_place = {Portland (Oregon) United States}, event_name = {International Symposium on Precision Clock Synchronization for Measurement, Control, and Communication}, event_date = {22-09-2019 to 27-09-2019}, language = {30}, ISBN = {978-1-5386-7607-3, 978-1-5386-}, ISSN = {1949-0313, 1949-0305}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://oar.ptb.de/resources/show/10.7795/EMPIR.17IND06.CA.20191126}, author = {Bermbach, R. and Sibold, D. and Heine, K. and Teichel, K. and Langer, M.} } @Proceedings { LuisoRBCM2019, subid = {1295}, title = {Setup and Characterisation of Reference Current-to-Voltage Transformers for Wideband Current Transformers Calibration up to 2 kA}, journal = {2019 IEEE 10th International Workshop on Applied Measurements for Power Systems (AMPS)}, year = {2019}, month = {9}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, pages = {64-69}, keywords = {wideband, current transformers, calibration, measurement uncertainty, instrument transformers, power quality}, tags = {SEG}, web_url = {https://doi.org/10.1109/AMPS.2019.8897759}, misc2 = {EMPIR 2017: Industry}, publisher = {IEEE}, event_place = {Aachen, Germany}, event_name = {2019 IEEE 10th International Workshop on Applied Measurements for Power Systems}, event_date = {25-09-2019 to 27-09-2019}, language = {30}, ISBN = {978-1-7281-0075-3, 978-1-7281-}, ISSN = {2475-2304, 2473-1315}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://doi.org/10.1109/AMPS.2019.8897759}, author = {Luiso, M. and Rather, P. and Badura, H. and Chen, Y. and Mohns, E.} } @Proceedings { LandiGDCL2019, subid = {1345}, title = {Design Approach for a Stand Alone Merging Unit}, journal = {IMEKO TC10 2019 Conference Proceedings}, year = {2019}, month = {9}, volume = {1}, number = {1}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, pages = {107-112}, keywords = {Power System Measurement,Power System Diagnostics,Stand Alone Merging Unit,Time Synchronization,Analog To Digital Converter}, tags = {SEG}, misc2 = {EMPIR 2017: Industry}, publisher = {IMEKO}, event_place = {Berlin}, event_name = {16th IMEKO TC10 Conference “Testing, Diagnostics \& Inspection as a comprehensive value chain for Quality \& Safety”}, event_date = {03-09-2019 to 04-09-2019}, language = {30}, ISBN = {978-92-990084-1-6}, ISSN = {978-92-990084-1-6}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://zenodo.org/record/3600469}, author = {Landi, C. and Gallo, D. and Delle Femine, A. and Cipolletta, G. and Luiso, M.} } @Proceedings { 50cc161b112019, subid = {1346}, title = {Metrological Performances of Current Transformers Under Amplitude Modulated Currents}, journal = {IMEKO TC10 2019 Conference Proceedings}, year = {2019}, month = {9}, volume = {1}, number = {1}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, pages = {101-106}, keywords = {Current Transformer, Power System Diagnostics, Phasor Measurement Unit, Amplitude Modulations}, tags = {SEG}, web_url = {https://https://zenodo.org/record/3600440\#.Xh7728j7QdU}, misc2 = {EMPIR 2017: Industry}, publisher = {IMEKO}, address = {Budapest}, event_place = {Berlin}, event_name = {16th IMEKO TC10 Conference “Testing, Diagnostics \& Inspection as a comprehensive value chain for Quality \& Safety”}, event_date = {03-09-2019 to 04-09-2019}, language = {30}, ISBN = {978-92-990084-1-6}, ISSN = {978-92-990084-1-6}, DOI = {10.5281/zenodo.3600440}, stag_bib_extends_levelofaccess = {NA} } @Article { ReitzensteinSZBRDDDMWPOMKSSGSMoU2019, subid = {1363}, title = {Method for direct coupling of a semiconductor quantum dot to an optical fiber for single-photon source applications}, journal = {Optics Express}, year = {2019}, month = {9}, volume = {27}, number = {19}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {26772}, keywords = {semiconductor quantum dot, single-photon source}, web_url = {https://www.osapublishing.org/DirectPDFAccess/08FE2392-996C-94FE-814D27FFE5E6D46E_418606/oe-27-19-26772.pdf?da=1\&id=418606\&seq=0\&mobile=no}, misc2 = {EMPIR 2017: Fundamental}, publisher = {The Optical Society}, language = {30}, ISSN = {1094-4087}, DOI = {10.1364/OE.27.026772}, stag_bib_extends_levelofaccess = {NA}, author = {Żołnacz, K. and Musiał, A. and Srocka, N. and Gro{\ss}e, J. and Schl{\"o}singer, M.J. and Schneider, P-I. and Kravets, O. and Mikulicz, M. and Olszewski, J. and Poturaj, K. and W{\'o}jcik, G. and Mergo, P. and Dybka, K. and Dyrkacz, M. and Dłubek, M. and Rodt, S. and Burger, S. and Zschiedrich, L. and Sęk, G. and Reitzenstein, S. and Urbańczyk, W.} } @Article { Carlotti2019, subid = {1352}, title = {Pushing down the lateral dimension of single and coupled magnetic dots to the nanometric scale: Characteristics and evolution of the spin-wave eigenmodes}, journal = {Applied Physics Reviews}, year = {2019}, month = {9}, volume = {6}, number = {3}, number2 = {17FUN08: TOPS: Metrology for topological spin structures}, pages = {031304}, keywords = {spin waves, confined modes, patterned magnetic media, magnonic crystals}, web_url = {https://arxiv.org/abs/1908.11098v1}, misc2 = {EMPIR 2017: Fundamental}, publisher = {AIP Publishing}, language = {30}, ISSN = {1931-9401}, DOI = {10.1063/1.5110434}, stag_bib_extends_levelofaccess = {NA}, author = {Carlotti, G.} } @Article { KokHvvR2019, subid = {1380}, title = {Current waveforms of household appliances for advanced meter testing}, journal = {2019 IEEE 10th International Workshop on Applied Measurements for Power Systems (AMPS)}, year = {2019}, month = {9}, volume = {Not Applic}, number = {Not Applic}, number2 = {17NRM02: MeterEMI: Electromagnetic Interference on Static Electricity Meters}, pages = {6}, keywords = {Electromagnetic compatibility , static meters , interference , accuracy , testing , household appliances}, tags = {SEG}, web_url = {https://zenodo.org/record/3582391\#.XiG1P3u7KUl}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {IEEE}, language = {30}, DOI = {10.1109/AMPS.2019.8897771}, stag_bib_extends_levelofaccess = {NA}, author = {van Leeuwen, R. and van den Brom, H. and Hoogenboom, D. and Kok, G. and Rietveld, G.} } @Article { RietveldKvWB2019, subid = {1377}, title = {Detection Methods for Current Signals Causing Errors in Static Electricity Meters}, journal = {2019 International Symposium on Electromagnetic Compatibility - EMC EUROPE}, year = {2019}, month = {9}, volume = {Not Applic}, number = {Not Applic}, number2 = {17NRM02: MeterEMI: Electromagnetic Interference on Static Electricity Meters}, pages = {6}, keywords = {Power Quality Electricity Meters Short Time Fourier Transform Wavelet Transform Multiresolution Signal Decomposition Wavelets Smart Meters}, web_url = {https://zenodo.org/record/3582153\#.XiGzUXu7KUm}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {IEEE}, language = {30}, DOI = {10.1109/EMCEurope.2019.8872120}, stag_bib_extends_levelofaccess = {NA}, author = {Barakou, F. and Wright, P.S. and van den Brom, H.E. and Kok, G.J.P and Rietveld, G.} } @Article { LeferinkMHH2019_2, subid = {1384}, title = {Why Frequency Domain Tests Like IEC 61000-4-19 Are Not Valid; a Call for Time Domain Testing}, journal = {2019 International Symposium on Electromagnetic Compatibility - EMC EUROPE}, year = {2019}, month = {9}, volume = {Not Applic}, number = {Not Applic}, number2 = {17NRM02: MeterEMI: Electromagnetic Interference on Static Electricity Meters}, pages = {5}, keywords = {IEEE Keywords Meters, Standards, Immunity testing, Frequency-domain analysis, Time-domain analysis, Electromagnetic interference INSPEC: Controlled Indexing electromagnetic compatibility, electromagnetic interference, frequency-domain analysis, IEC standards, time-domain analysis INSPEC: Non-Controlled Indexing IEC 61000-4-19, time domain testing, electrical equipment testing, electronic equipment, differential mode disturbances, electromagnetic interference, time domain signals, frequency domain tests, static energy meters, equipment immunity, instance nonlinear effects, digital sampling error effects, nonlinear time invariant effects, frequency 2.0 kHz to 150.0 kHz}, web_url = {https://research.utwente.nl/en/publications/why-frequency-domain-tests-like-iec-61000-4-19-are-not-valid-a-ca}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {IEEE}, language = {30}, ISSN = {2325-0364}, DOI = {10.1109/EMCEurope.2019.8872070}, stag_bib_extends_levelofaccess = {NA}, author = {Have, B.t. and Hartman, T. and Moonen, N. and Leferink, F.} } @Article { vanLeeuwenHMvR2019, subid = {1378}, title = {A Testbed for Static Electricity Meter Testing with Conducted EMI}, journal = {2019 International Symposium on Electromagnetic Compatibility - EMC EUROPE}, year = {2019}, month = {9}, volume = {Not Applic}, number = {Not Applic}, number2 = {17NRM02: MeterEMI: Electromagnetic Interference on Static Electricity Meters}, pages = {6}, keywords = {Static meters, energy measurement, standards, Electromagnetic Compatibility, EMC immunity testing, electricity meters.}, tags = {SEG}, web_url = {https://zenodo.org/record/3580444\#.XiG0OHu7KUk}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {IEEE}, language = {30}, DOI = {10.1109/EMCEurope.2019.8872130}, stag_bib_extends_levelofaccess = {NA}, author = {van den Brom, H.E. and Marais, Z. and Hoogenboom, D. and van Leeuwen, R. and Rietveld, G.} } @Article { LeferinkMHH2019_3, subid = {1383}, title = {Inclination of Fast Changing Currents Effect the Readings of Static Energy Meters}, journal = {2019 International Symposium on Electromagnetic Compatibility - EMC EUROPE}, year = {2019}, month = {9}, volume = {Not Applic}, number = {Not Applic}, number2 = {17NRM02: MeterEMI: Electromagnetic Interference on Static Electricity Meters}, pages = {6}, keywords = {IEEE Keywords Meters, Impedance, Current measurement, Electromagnetic compatibility, Power supplies, Water pumps, Regulators INSPEC: Controlled Indexing amplifiers, electromagnetic interference, fluorescent lamps, LED lamps, power meters INSPEC: Non-Controlled Indexing fast changing currents effect, static energy meters, energy readings, reference meter, electromagnetic interference, fluorescent lightning, light emitting diode lamps, nondistorted mains power supply, four-quadrant amplifier, line impedance stabilization network, pulsed current waveform}, web_url = {https://research.utwente.nl/en/publications/inclination-of-fast-changing-currents-effect-the-readings-of-stat}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {IEEE}, language = {30}, ISSN = {2325-0364}, DOI = {10.1109/EMCEurope.2019.8871982}, stag_bib_extends_levelofaccess = {NA}, author = {Have, B.t. and Hartman, T. and Moonen, N. and Leferink, F.} } @Article { HoogenboomvRvMR2019, subid = {1379}, title = {Sensitivity of static energy meter reading errors to changes in non-sinusoidal load conditions}, journal = {2019 International Symposium on Electromagnetic Compatibility - EMC EUROPE}, year = {2019}, month = {9}, volume = {Not Applic}, number = {Not Applic}, number2 = {17NRM02: MeterEMI: Electromagnetic Interference on Static Electricity Meters}, pages = {6}, keywords = {static energy meter; metering error; electromagnetic interference; accuracy; impedance; phase firing angle.}, tags = {SEG}, web_url = {https://zenodo.org/record/3580436\#.XiG00Xu7KUl}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {IEEE}, language = {30}, DOI = {10.1109/EMCEurope.2019.8872006}, stag_bib_extends_levelofaccess = {NA}, author = {Marais, Z. and van den Brom, H.E. and Rietveld, G. and van Leeuwen, R. and Hoogenboom, D. and Rens, J.} } @Article { LeferinkSAPH2019, subid = {1381}, title = {On-site Waveform Characterization at Static Meters Loaded with Electrical Vehicle Chargers}, journal = {2019 International Symposium on Electromagnetic Compatibility - EMC EUROPE}, year = {2019}, month = {9}, volume = {Not Applic}, number = {Not Applic}, number2 = {17NRM02: MeterEMI: Electromagnetic Interference on Static Electricity Meters}, pages = {6}, keywords = {IEEE Keywords Current measurement, Meters, Time measurement, Electromagnetic interference, Time-domain analysis, Probes, Battery charge measurement INSPEC: Controlled Indexing battery storage plants, charge measurement, electric vehicle charging, electromagnetic interference, statistical distributions, time-domain analysis INSPEC: Non-Controlled Indexing electrical vehicle chargers, static meter misreadings, noisy waveforms, electric vehicle charging stations, on-site waveform characterization, EV charging stations, TEMPS software, time domain electromagnetic interference measurement and post-processing system, amplitude probability distribution, APD, EMI measurements, baseband digitizer}, tags = {SEG}, web_url = {https://research.utwente.nl/en/publications/on-site-waveform-characterization-at-static-meters-loaded-with-el}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {IEEE}, language = {30}, ISSN = {2325-0364}, DOI = {10.1109/EMCEurope.2019.8871469}, stag_bib_extends_levelofaccess = {NA}, author = {Hartman, T. and Pous, M. and Azpurua, M.A. and Silva, F. and Leferink, F.} } @Proceedings { MarrowsKGDCCBSK2019, subid = {1428}, title = {Measuring Interfacial Dzyaloshinskii-Moriya Interaction: A Review}, journal = {Proceedings}, year = {2019}, month = {9}, volume = {26}, number = {1}, number2 = {17FUN08: TOPS: Metrology for topological spin structures}, pages = {41}, keywords = {Dzyaloshinskii-Moriya interaction}, misc2 = {EMPIR 2017: Fundamental}, publisher = {MDPI AG}, event_place = {Ferrara}, event_name = {XXXVII International Symposium on Dynamical Properties of Solids}, event_date = {08-09-2019 to 12-09-2019}, language = {30}, ISSN = {2504-3900}, DOI = {10.3390/proceedings2019026041}, stag_bib_extends_levelofaccess = {NA}, author = {Back, C. and Carlotti, G. and Casiraghi, A. and Durin, G. and Garcia-Sanchez, F. and Kuepferling, M. and Marrows, C. and Soares, G. and Tacchi, S.} } @Proceedings { KehrtJS2019, subid = {1445}, title = {Comparison of Waveguide and Free-Space Power Measurement in the Millimeter-Wave Range}, journal = {2019 44th International Conference on Infrared, Millimeter, and Terahertz Waves (IRMMW-THz)}, year = {2019}, month = {9}, number2 = {18SIB09: TEMMT: Traceability for electrical measurements at millimetre-wave and terahertz frequencies for communications and electronics technologies}, keywords = {Optical waveguides, Power measurement, Detectors, Antenna measurements, Horn antennas}, web_url = {https://oar.ptb.de/files/download/5e5d0f6f4c93903e3800394c}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {IEEE}, event_place = {Paris}, event_name = {2019 44th International Conference on Infrared, Millimeter, and Terahertz Waves (IRMMW-THz)}, event_date = {01-09-2019 to 06-09-2019}, language = {30}, stag_bib_extends_levelofaccess = {NA}, author = {Kehrt, M. and Judaschke, R. and Steiger, A.} } @Article { KellmanMRSBXORNIRMGNPC2019, subid = {1474}, title = {Simultaneous 13N-Ammonia and gadolinium first-pass myocardial perfusion with quantitative hybrid PET-MR imaging: a phantom and clinical feasibility study}, journal = {European Journal of Hybrid Imaging}, year = {2019}, month = {9}, volume = {3}, number = {1}, number2 = {15HLT05: PerfusImaging: Metrology for multi-modality imaging of impaired tissue perfusion}, keywords = {myocardial perfusion, hybrid PET-MR}, misc2 = {EMPIR 2015: Health}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2510-3636}, DOI = {10.1186/s41824-019-0062-6}, stag_bib_extends_levelofaccess = {NA}, author = {Nazir, M.S. and Gould, S-M. and Milidonis, X. and Reyes, E. and Ismail, T.F. and Neji, R. and Roujol, S. and O’Doherty, J. and Xue, H. and Barrington, S.F. and Schaeffter, T. and Razavi, R. and Marsden, P. and Kellman, P. and Plein, S. and Chiribiri, A.} } @Proceedings { NeubergerRSW2019, subid = {1502}, title = {LED-Based Differential Spectral Responsivity Measurements of PV Modules}, journal = {https://www.eupvsec-proceedings.com/proceedings}, year = {2019}, month = {9}, number2 = {16ENG02: PV-Enerate: Advanced PV energy rating}, keywords = {Spectral Response, LED, PV Modules, Solar Simulator, DSR}, misc2 = {EMPIR 2016: Energy}, event_place = {Marseille, France}, event_name = {36th European Photovoltaic Solar Energy Conference and Exhibitio}, event_date = {09-09-2019 to 13-09-2019}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://zenodo.org/record/3784708}, author = {Neuberger, F. and Riechelmann, S. and Straeter, H. and Winter, S.} } @Proceedings { Riechelmann2019, subid = {1503}, title = {Characterizing the Angular Distribution of an LED-Based Solar Simulator for PV Modules}, journal = {https://www.eupvsec-proceedings.com/proceedings}, year = {2019}, month = {9}, number2 = {16ENG02: PV-Enerate: Advanced PV energy rating}, keywords = {characterization, calibration, solar simulator}, misc2 = {EMPIR 2016: Energy}, event_place = {Marseille, France}, event_name = {EUPVSEC 2019}, event_date = {09-09-2019 to 13-09-2019}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://zenodo.org/record/3784748}, author = {Riechelmann, S.} } @Thesis { Barbiero2019, subid = {1812}, title = {Novel techniques for a Strontium Optical Lattice Clock}, year = {2019}, month = {9}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, keywords = {Sr OLC, Laser cooling,}, web_url = {http://hdl.handle.net/11583/2750550}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Politecnico Torino}, school = {Politecnico di Torino}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {http://hdl.handle.net/11583/2750550}, author = {Barbiero, M.} } @Proceedings { Mariscotti2019_4, subid = {1952}, title = {Behaviour of Spectral Active Power Terms for the Swiss 15 kV 16.7 Hz Railway System}, journal = {2019 IEEE 10th International Workshop on Applied Measurements for Power Systems (AMPS)}, year = {2019}, month = {9}, volume = {1}, number = {1}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, pages = {6}, keywords = {Electric transportation systems, Energy consumption, Power Quality, Power system harmonics}, web_url = {https://zenodo.org/record/3601481}, misc2 = {EMPIR 2016: Energy}, publisher = {IEEE}, event_place = {Aachen, Germany}, event_name = {2019 IEEE 10th International Workshop on Applied Measurements for Power Systems (AMPS)}, event_date = {25-09-2019 to 27-09-2019}, language = {30}, ISBN = {978-1-7281-0075-3}, ISSN = {2475-2304}, DOI = {10.1109/AMPS.2019.8897777}, stag_bib_extends_levelofaccess = {NA}, author = {Mariscotti, A.} } @Proceedings { SeferiCBMS2019, subid = {1964}, title = {Power Quality Event Analysis in 25 kV 50 Hz AC Railway System Networks}, journal = {2019 IEEE 10th International Workshop on Applied Measurements for Power Systems (AMPS)}, year = {2019}, month = {9}, volume = {1}, number = {1}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, keywords = {Railway transportation power systems, power quality, power system transients, voltage interruption}, web_url = {https://strathprints.strath.ac.uk/70058/}, misc2 = {EMPIR 2016: Energy}, publisher = {IEEE}, event_place = {Aachen, Germany}, event_name = {International Workshop on Applied Measurements for Power Systems (AMPS)}, event_date = {25-09-2019 to 27-09-2012}, language = {30}, ISBN = {978-1-7281-0075-3}, ISSN = {2475-2304g}, DOI = {10.1109/AMPS.2019.8897765}, stag_bib_extends_levelofaccess = {NA}, author = {Seferi, Y. and Clarkson, P. and Blair, S.M. and Mariscotti, A. and Stewart, B.G.} } @Proceedings { LuisoLGFSGCBD2019, subid = {1946}, title = {Monitoring Energy and Power Quality On Board Train}, journal = {2019 IEEE 10th International Workshop on Applied Measurements for Power Systems (AMPS)}, year = {2019}, month = {9}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, keywords = {Power and Energy measurement, Railway system, Energy saving, Reversible Substation, DC Power Quality}, web_url = {https://zenodo.org/record/4598462}, misc2 = {EMPIR 2016: Energy}, publisher = {IEEE}, event_place = {Dubrovnik, Croatia}, event_name = {2020 IEEE International Instrumentation and Measurement Technology Conference (I2MTC)}, event_date = {25-05-2020 to 28-05-2020}, language = {30}, ISBN = {978-1-7281-0075-3}, ISSN = {2475-2304}, DOI = {10.1109/AMPS.2019.8897794}, stag_bib_extends_levelofaccess = {NA}, author = {Luiso, M. and Landi, C. and Gallo, D. and Femine, A.D. and Signorino, D. and Giordano, D. and Crotti, G. and Biancucci, A. and Donadio, L.} } @Article { TacheTMPMMH2019, subid = {1409}, title = {Towards Accurate Analysis of Particle Size Distribution for Non-Spherically Shaped Nanoparticles as Quality Control Materials}, journal = {Microscopy and Microanalysis}, year = {2019}, month = {8}, day = {31}, volume = {25}, number = {Suppl. 2}, number2 = {17NRM04: nPSize: Improved traceability chain of nanoparticle size measurements}, pages = {2328-2329}, keywords = {Imaging;Nanoparticles;Non-spherical;Particle size distribution;Reference material}, web_url = {https://www.cambridge.org/core/services/aop-cambridge-core/content/view/CD48E9298865410124E22837D8CF73A0/S1431927619012376a.pdf/towards_accurate_analysis_of_particle_size_distribution_for_nonspherically_shaped_nanoparticles_as_quality_control_materials.pd}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {Cambridge University Press}, language = {30}, ISSN = {1435-8115}, DOI = {10.1017/S1431927619012376}, stag_bib_extends_levelofaccess = {NA}, author = {Mansfeld, U. and Pellegrino, F. and Maurino, V. and Marguet, S. and Testard, F. and Tache, O. and Hodoroaba, V.-D.} } @Proceedings { SauzayRJBBWS2019, subid = {1302}, title = {Estimating Uncertainty in Loss Measurement of Power Transformers}, journal = {Proceedings of the 21st International Symposium on High Voltage Engineering}, year = {2019}, month = {8}, day = {30}, number2 = {17NRM01: TrafoLoss: Loss Measurements on Power Transformers and Reactors}, keywords = {power transformers, losses, measurement, uncertainty.}, tags = {SEG}, misc2 = {EMPIR 2017: Pre-Co-Normative}, event_place = {Budapest}, event_name = {21st International Symposium on High Voltage Engineering}, event_date = {26-08-2019 to 30-08-2019}, language = {30}, DOI = {10.5281/zenodo.3559837}, stag_bib_extends_levelofaccess = {NA}, author = {Sauzay, M. and Rietveld, G. and J{\"o}nsson, B. and Bergman, A. and Bergman, A. and Walmsley, J. and Sund, J-B.} } @Proceedings { CastroVWKHS2019, subid = {1202}, title = {Stability of the surface passivation properties of atomic layer deposited aluminum oxide in damp heat conditions}, journal = {AIP Conference Proceedings}, year = {2019}, month = {8}, day = {27}, volume = {2147}, number = {1}, number2 = {16ENG03: HyMet: Hybrid metrology for thin films in energy applications}, pages = {050003}, keywords = {Aluminium oxide, surface passivation, damp heat exposure, atomic layer deposition, degradation}, web_url = {https://aip.scitation.org/doi/pdf/10.1063/1.5123852?class=pdf}, misc2 = {EMPIR 2016: Energy}, publisher = {AIP Publishing}, event_place = {Leuven, Belgium}, event_name = {SiliconPV 2019, THE 9TH INTERNATIONAL CONFERENCE ON CRYSTALLINE SILICON PHOTOVOLTAICS}, event_date = {08-04-2019 to 10-04-2019}, language = {30}, ISBN = {978-0-7354-1892-9}, ISSN = {1551-7616}, DOI = {10.1063/1.5123852}, stag_bib_extends_levelofaccess = {NA}, author = {Heikkinen, I.T.S. and Koutsourakis, G. and Wood, S. and V{\"a}h{\"a}nissi, V. and Castro, F.A. and Savin, H.} } @Proceedings { KhamlichiG2015, subid = {1097}, title = {Calibration Setup For Traceable Measurements Of Very Fast Transients}, journal = {Proceedings of IHS2019}, year = {2019}, month = {8}, day = {26}, number2 = {15NRM02: UHV: Techniques for ultra-high voltage and very fast transients}, keywords = {Calibration, setup, transients}, misc2 = {EMPIR 2015: Pre-Co-Normative}, event_place = {Budapest, Hungary}, event_name = {International Symposium on High Voltage Engineering 2019}, language = {30}, DOI = {10.5281/zenodo.3238169}, stag_bib_extends_levelofaccess = {NA}, author = {Khamlichi, A. and Garnacho, F. and H{\"a}llstr{\"o}m, J. and Elg, A.P.} } @Proceedings { RoviraGSFA2019, subid = {1197}, title = {Characterisation of high voltage dividers for X-ray measurements}, journal = {Proceedings of IHS2019}, year = {2019}, month = {8}, day = {26}, number2 = {15NRM02: UHV: Techniques for ultra-high voltage and very fast transients}, keywords = {High Voltage, Pulsed X-ray tube , Divider, Metrology}, misc2 = {EMPIR 2015: Pre-Co-Normative}, event_place = {Budapest, Hungary,}, event_name = {The 21st International Symposium on High Voltage Engineering (ISH2019)}, event_date = {26-08-2019 to 30-08-2019}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://doi.org/10.5281/zenodo.3243494}, author = {Rovira, J. and Garnacho, F. and Saadeddine, H. and Fortune, D. and Agazar, M.} } @Proceedings { HallstromMPE2019, subid = {1184}, title = {High voltage topologies for very fast transient measurements}, journal = {Proceedings of ISH2019}, year = {2019}, month = {8}, day = {26}, number2 = {15NRM02: UHV: Techniques for ultra-high voltage and very fast transients}, keywords = {high voltage measurement, fast transients}, misc2 = {EMPIR 2015: Pre-Co-Normative}, event_place = {Budapest, Hungary}, event_name = {21st International Symposium on High Voltage Engineering}, event_date = {26-08-2019 to 30-08-2019}, language = {30}, DOI = {10.5281/zenodo.3244216}, stag_bib_extends_levelofaccess = {NA}, author = {H{\"a}llstr{\"o}m, J. and Meisner, J. and Passon, S. and Elg, A-P.} } @Proceedings { ViniciusdLYHHFL2019, subid = {1187}, title = {Comparison of Measuring Systems for Puncture Test According to IEC 61211}, journal = {21st International Symposium on High Voltage Engineering}, year = {2019}, month = {8}, day = {26}, number2 = {15NRM02: UHV: Techniques for ultra-high voltage and very fast transients}, keywords = {puncture test, measurement}, misc2 = {EMPIR 2015: Pre-Co-Normative}, event_place = {Budapest, Hungary}, event_name = {21st International Symposium on High Voltage Engineering}, event_date = {26-08-2019 to 30-08-2019}, language = {30}, DOI = {10.5281/zenodo.3243452}, stag_bib_extends_levelofaccess = {NA}, author = {H{\"a}llstr{\"o}m, J. and Havunen, J. and Yan, W. and Li, Y. and Vinicius, M. and Filho, O. and Laiho, M.} } @Proceedings { KaramanDMEBHHRGG2019, subid = {1186}, title = {Comparison of PD calibration capabilities in four National Metrology Institutes down to 0.1 pC}, journal = {Proceedings of ISH2019}, year = {2019}, month = {8}, day = {26}, number2 = {15NRM02: UHV: Techniques for ultra-high voltage and very fast transients}, keywords = {partial discharge, calibration}, misc2 = {EMPIR 2015: Pre-Co-Normative}, event_place = {Budapest, Hungary}, event_name = {21st International Symposium on High Voltage Engineering}, event_date = {26-08-2019 to 30-08-2019}, language = {30}, DOI = {10.5281/zenodo.3243449}, stag_bib_extends_levelofaccess = {NA}, author = {H{\"a}llstr{\"o}m, J. and Havunen, J. and Bergman, A.E. and Elg, A-P. and Merev, A. and Dedeoğlu, S. and Karaman, I. and Rovira, J. and Garcia, T. and Garnacho, F.} } @Proceedings { NieminenHRGGE2019, subid = {1212}, title = {Traceable measurement of transmitted overvoltages in instrument transformers}, journal = {Proceedings of ISH2019}, year = {2019}, month = {8}, day = {26}, number2 = {15NRM02: UHV: Techniques for ultra-high voltage and very fast transients}, keywords = {Voltage instrument transformers, Transient overoltages, traceability}, tags = {SEG}, misc2 = {EMPIR 2015: Pre-Co-Normative}, event_place = {Budapest, Hungary}, event_name = {21st International Symposium on High Voltage Engineering (ISH2019)}, event_date = {26-08-2019 to 30-08-2019}, language = {30}, DOI = {10.5281/zenodo.3244088}, stag_bib_extends_levelofaccess = {NA}, author = {Nieminen, T. and H{\"a}llstr{\"o}m, J. and Rovira, J. and Garcia, T. and Garnacho, F. and Elg, A-P.} } @Proceedings { LehtonenHTSHM2019, subid = {1303}, title = {Measuring Losses of an Air-Core Shunt Reactor with an Advanced Loss Measuring System}, journal = {Proceedings of ISH 2019}, year = {2019}, month = {8}, day = {26}, number2 = {17NRM01: TrafoLoss: Loss Measurements on Power Transformers and Reactors}, keywords = {Reactor, loss measurement, voltage divider, loss measuring system}, tags = {SEG}, misc2 = {EMPIR 2017: Pre-Co-Normative}, event_place = {Budapest, Hungary}, event_name = {21st International Symposium on High Voltage Engineering}, event_date = {26-08-2019 to 30-08-2019}, language = {30}, DOI = {10.5281/zenodo.3521194}, stag_bib_extends_levelofaccess = {NA}, author = {Havunen, J. and Suomalainen, E-P. and Tornberg, J. and H{\"a}llstr{\"o}m, J. and Lehtonen, T. and Mervi{\"o}, A.} } @Inbook { RuttingerPGCPSKBJSBSWWS2019, subid = {1193}, title = {European Research on Magnetic Nanoparticles for Biomedical Applications: Standardisation Aspects}, year = {2019}, month = {8}, day = {23}, volume = {Advances i}, number2 = {16NRM04: MagNaStand: Towards an ISO standard for magnetic nanoparticles}, pages = {316-326}, keywords = {magnetic nanoparticles, standardisation European research}, web_url = {https://arxiv.org/abs/1905.08791}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {Springer International Publishing}, address = {Cham}, booktitle = {Current Trends in Biomedical Engineering and Bioimages Analysis. PCBEE 2019.}, language = {30}, ISBN = {978-3-030-29884-5}, DOI = {10.1007/978-3-030-29885-2_29}, stag_bib_extends_levelofaccess = {NA}, author = {Schier, Peter and Barton, Craig and Spassov, Simo and Johansson, Christer and Baumgarten, Daniel and Kazakova, Olga and Southern, Paul and Pankhurst, Quentin and Coisson, Marco and Gr{\"u}ttner, Cordula and Price, Alex and R{\"u}ttinger, Roman and Wiekhorst, Frank and Wells, James and Steinhoff, Uwe} } @Article { FuenteSMDGQPR2019, subid = {1290}, title = {Testing and Calibration of CDs as Radon Detectors at Highly Variable Radon Concentrations and Temperatures}, journal = {International Journal of Environmental Research and Public Health}, year = {2019}, month = {8}, day = {22}, volume = {16}, number = {17}, number2 = {16ENV10: MetroRADON: Metrology for radon monitoring}, pages = {3038}, keywords = {radon; CD-method; blind comparison; extremely variable concentrations; unstabletemperature}, web_url = {https://www.mdpi.com/1660-4601/16/17/3038/htm}, misc2 = {EMPIR 2016: Environment}, publisher = {MDPI AG}, language = {30}, ISSN = {1660-4601}, DOI = {10.3390/ijerph16173038}, stag_bib_extends_levelofaccess = {NA}, author = {Pressyanov, D. and Quindos Poncela, L.S. and Georgiev, S. and Dimitrova, I. and Mitev, K. and Sainz, C. and Fuente, I. and Rabago, D.} } @Proceedings { VentreMDBCFPPRSTBASSGHBZFDKL2019, subid = {1200}, title = {Metrology for Inductive Charging of Electric Vehicles (MICEV)}, journal = {2019 AEIT International Conference of Electrical and Electronic Technologies for Automotive (AEIT AUTOMOTIVE)}, year = {2019}, month = {8}, day = {19}, volume = {Electrical}, number = {2019 AEIT}, number2 = {16ENG08: MICEV: Metrology for inductive charging of electric vehicles}, pages = {6 pages}, keywords = {Dosimetry, Energy efficiency, Inductive charging, Magnetic fields, Metrology, Safety}, tags = {SEG}, web_url = {http://arxiv.org/abs/1908.11108}, misc2 = {EMPIR 2016: Energy}, publisher = {IEEE}, event_place = {Turin (Italy)}, event_name = {2019 AEIT International Conference of Electrical and Electronic Technologies for Automotive (AEIT AUTOMOTIVE)}, event_date = {02-07-2019 to 04-07-2019}, language = {30}, ISBN = {978-8-8872-3743-6}, ISSN = {0018-9219}, DOI = {10.23919/EETA.2019.8804498}, stag_bib_extends_levelofaccess = {NA}, author = {Zucca, M. and Bottauscio, O. and Harmon, S. and Guilizzoni, R. and Schilling, F. and Schmidt, M. and Ankarson, P. and Bergsten, T. and Tammi, K. and Sainio, P. and Romero, J.B. and Puyal, E.L. and Pichon, L. and Freschi, F. and Cirimele, V. and Bauer, P. and Dong, J. and Maffucci, A. and Ventre, S. and Femia, N. and Di Capua, G. and Kuster, N. and Liorni, I.} } @Article { GomaZHB2019, subid = {1331}, title = {Comparison of PENH, FLUKA and Geant4/TOPAS for absorbed dose calculations in air cavities representing ionization chambers in high‐energy photon and proton beams}, journal = {Medical Physics}, year = {2019}, month = {8}, day = {19}, volume = {46}, number = {10}, number2 = {16NRM03: RTNORM: kQ factors in modern external beam radiotherapy applications to update IAEA TRS-398}, pages = {4639-4653}, keywords = {beam quality correction factors, dosimetry, high‐energy photon and proton radiation, Monte Carlo simulation, radiation therapy}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {Wiley}, language = {30}, ISSN = {0094-2405, 2473-4209}, DOI = {10.1002/mp.13737}, stag_bib_extends_levelofaccess = {NA}, author = {Baumann, K.‐S. and Horst, F. and Zink, K. and Gom{\`a}, C.} } @Manual { WattsRKP2009, subid = {1199}, title = {Good Practice Guide on Making Rectangular Waveguide Connections at Frequencies above 100 GHz}, year = {2019}, month = {8}, day = {9}, number2 = {17SIP08: NeWITT: New Waveguide Interfaces for Terahertz Technologies}, keywords = {INSPEC B1310 Waveguides and microwave transmission lines, INSPEC B1320 Waveguide and microwave transmission line components, INSPEC B2180E Connectors, INSPEC B5210C Radiowave propagation,INSPEC B7130 Measurement standards and calibration}, misc2 = {EMPIR 2017: Support for Impact}, publisher = {Physikalisch-Technische Bundesanstalt (PTB)}, address = {Braunschweig}, language = {30}, DOI = {10.7795/530.20190805}, stag_bib_extends_levelofaccess = {NA}, author = {Watts, J. and Ridler, N. and Kuhlmann, K. and Probst, T.} } @Article { WendischPMWIBABOKK2019, subid = {1057}, title = {Optical Pulse-Drive for the Pulse-Driven AC Josephson Voltage Standard}, journal = {IEEE Transactions on Applied Superconductivity}, year = {2019}, month = {8}, volume = {29}, number = {5}, number2 = {15SIB04: QuADC: Waveform metrology based on spectrally pure Josephson voltages}, pages = {1200205}, keywords = {Optical pulses, Optical fibers, Optical distortion, High-speed optical techniques, Optical attenuators, Optical crosstalk}, web_url = {https://ieeexplore.ieee.org/document/8643521}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {1051-8223, 1558-2515, 2378-707}, DOI = {10.1109/TASC.2019.2899851}, stag_bib_extends_levelofaccess = {NA}, author = {Kieler, O. and Karlsen, B. and Ohlckers, P.A. and Bardalen, E. and Akram, M.N. and Behr, R. and Ireland, J. and Williams, J. and Malmbekk, H. and Palafox, L. and Wendisch, R.} } @Article { AslanDSWZOY2019, title = {Comparison of two methods for the rapid radiochemical analysis of air dust samples in emergency situations}, journal = {Applied Radiation and Isotopes}, year = {2019}, month = {8}, volume = {150}, number2 = {ENV57: MetroERM: Metrology for radiological early warning networks in Europe}, pages = {120-126}, keywords = {Emergency preparedness, airborne radioactivity, radiochemical analysis, extraction chromatography}, web_url = {https://www.sciencedirect.com/science/article/pii/S0969804317308229?dgcid=raven_sd_via_email}, misc2 = {EMRP A169: Call 2013 Environment II}, publisher = {Elsevier BV}, address = {230 Park Avenue Suite 800 Shantae McGee New York NY 10169-0935 United States}, language = {30}, ISSN = {0969-8043}, DOI = {10.1016/j.apradiso.2019.04.031}, stag_bib_extends_levelofaccess = {NA}, author = {Aslan, N. and Dirican, A. and Seferinoğlu, M. and Wershofen, H. and Zapata-Garc{\'i}a, D. and {\"O}z\c{c}ayan, G. and Y{\"u}cel, {\"U}.} } @Article { KajolinnaPP2019, subid = {1190}, title = {SO2 emission measurement with the European standard reference method, EN 14791, and alternative methods – observations from laboratory and field studies}, journal = {Journal of the Air \& Waste Management Association}, year = {2019}, month = {8}, volume = {69}, number = {9}, number2 = {15NRM01: Sulf-Norm: Metrology for sampling and conditioning SO2 emissions from stacks}, pages = {1122-1131}, keywords = {SO2 emission measurement, European standard reference method, EN 14791, alternative methods}, web_url = {https://doi.org/10.1080/10962247.2019.1640809}, misc2 = {EMPIR 2015: Pre-Co-Normative}, publisher = {Informa UK Limited}, language = {30}, ISSN = {1096-2247, 2162-2906}, DOI = {10.1080/10962247.2019.1640809}, stag_bib_extends_levelofaccess = {NA}, author = {Pellikka, T. and Kajolinna, T. and Per{\"a}l{\"a}, M.} } @Article { ColemanERGS2019, subid = {1191}, title = {Uncertainty requirements of the European Union’s Industrial Emissions Directive for monitoring sulfur dioxide emissions: Implications from a blind comparison of sulfate measurements by accredited laboratories}, journal = {Journal of the Air \& Waste Management Association}, year = {2019}, month = {8}, volume = {69}, number = {9}, number2 = {15NRM01: Sulf-Norm: Metrology for sampling and conditioning SO2 emissions from stacks}, pages = {1070-1078}, keywords = {Uncertainty requirements, European Union’s Industrial Emissions Directive, monitoring sulfur dioxide emissions}, web_url = {https://doi.org/10.1080/10962247.2019.1604449}, misc2 = {EMPIR 2015: Pre-Co-Normative}, publisher = {Informa UK Limited}, language = {30}, ISSN = {1096-2247, 2162-2906}, DOI = {10.1080/10962247.2019.1604449}, stag_bib_extends_levelofaccess = {NA}, author = {Coleman, M.D. and Ellison, M. and Robinson, R.A. and Gardiner, T.D. and Smith, T.O.M.} } @Article { RunzEMDKK2019, subid = {1205}, title = {Polymer gel-based measurements of the isocenter accuracy in an MR-LINAC}, journal = {Journal of Physics: Conference Series}, year = {2019}, month = {8}, volume = {1305}, number2 = {15HLT08: MRgRT: Metrology for MR guided radiotherapy}, pages = {012007}, keywords = {MRgRT, dosimetry}, web_url = {https://doi.org/10.1088/1742-6596/1305/1/012007}, misc2 = {EMPIR 2015: Health}, publisher = {IOP Publishing}, language = {30}, ISSN = {1742-6588, 1742-6596}, DOI = {10.1088/1742-6596/1305/1/012007}, stag_bib_extends_levelofaccess = {NA}, author = {Dorsch, S. and Mann, P. and Elter, A. and Runz, A. and Kl{\"u}ter, S. and Karger, C.P.} } @Article { CinelliNViePG2019, subid = {1216}, title = {Qualitative overview of indoor radon surveys in Europe}, journal = {Journal of Environmental Radioactivity}, year = {2019}, month = {8}, volume = {204}, number2 = {16ENV10: MetroRADON: Metrology for radon monitoring}, pages = {163-174}, keywords = {metroRADON, indoor radon surveys, representativeness}, misc2 = {EMPIR 2016: Environment}, publisher = {Elsevier BV}, language = {30}, ISSN = {0265-931X}, DOI = {10.1016/j.jenvrad.2019.04.010}, stag_bib_extends_levelofaccess = {NA}, author = {Pantelić, G. and Čeliković, I. and Živanović, M. and Vukanac, I. and Nikolić, J.K. and Cinelli, G. and Gruber, V.} } @Article { NahleMLKKEBBPRR2019, subid = {1235}, title = {Development of a beta spectrometry setup using metallic magnetic calorimeters}, journal = {Journal of Instrumentation}, year = {2019}, month = {8}, volume = {14}, number = {08}, number2 = {15SIB10: MetroBeta: Radionuclide beta spectra metrology}, pages = {P08012-P08012}, keywords = {Calorimeters, Cryogenic detectors, Data processing methods, Spectrometers}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {1748-0221}, DOI = {10.1088/1748-0221/14/08/P08012}, stag_bib_extends_levelofaccess = {NA}, author = {Paulsen, M. and Beyer, J. and Bockhorn, L. and Enss, C. and Kempf, S. and Kossert, K. and Loidl, M. and Mariam, R. and N{\"a}hle, O. and Ranitzsch, P. and Rodrigues, M.} } @Article { KotilHHSK2019, subid = {1242}, title = {Analysis of elemental composition and porosity of mesoporous iridium-titanium mixed oxide thin films for energy application by SEM/EDS}, journal = {Microscopy and Microanalysis}, year = {2019}, month = {8}, volume = {25}, number = {S2}, number2 = {16ENG03: HyMet: Hybrid metrology for thin films in energy applications}, pages = {1770-1771}, keywords = {oxide thin films}, misc2 = {EMPIR 2016: Energy}, publisher = {Cambridge University Press (CUP)}, language = {30}, ISSN = {1431-9276, 1435-8115}, DOI = {10.1017/S1431927619009589}, stag_bib_extends_levelofaccess = {NA}, author = {Sachse, R. and Hodoroaba, V.-D. and Hertwig, A. and Kotil, L. and Kraehnert, R.} } @Article { NahleMLKKEBBPRR20190, subid = {1235}, title = {Development of a beta spectrometry setup using metallic magnetic calorimeters}, journal = {Journal of Instrumentation}, year = {2019}, month = {8}, volume = {14}, number = {08}, number2 = {17FUN02: MetroMMC: Measurement of fundamental nuclear decay data using metallic magnetic calorimeters}, pages = {P08012-P08012}, keywords = {Calorimeters, Cryogenic detectors, Data processing methods, Spectrometers}, misc2 = {EMPIR 2017: Fundamental}, publisher = {IOP Publishing}, language = {30}, ISSN = {1748-0221}, DOI = {10.1088/1748-0221/14/08/P08012}, stag_bib_extends_levelofaccess = {NA}, author = {Paulsen, M. and Beyer, J. and Bockhorn, L. and Enss, C. and Kempf, S. and Kossert, K. and Loidl, M. and Mariam, R. and N{\"a}hle, O. and Ranitzsch, P. and Rodrigues, M.} } @Article { ChouhaniFiPBJVH2019, subid = {2041}, title = {A Unique Interactive Nanostructure Knitting based Passive Sampler Adsorbent for Monitoring of Hg2+ in Water}, journal = {Sensors}, year = {2019}, month = {8}, volume = {19}, number = {15}, number2 = {16ENV01: MercOx: Metrology for oxidised mercury}, pages = {3432}, keywords = {Nanostructure Knitting based Passive Sampler , Hg2+, Water}, misc2 = {EMPIR 2016: Environment}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s19153432}, stag_bib_extends_levelofaccess = {NA}, author = {Chouhan, R.S. and Žitko, G. and Fajon, V. and Živković, I. and Pavlin, M. and Berisha, S. and Jerman, I. and Vesel, A. and Horvat, M.} } @Article { BausiKBC2019, subid = {1736}, title = {High-speed digital light source photocurrent mapping system}, journal = {Measurement Science and Technology}, year = {2019}, month = {7}, day = {30}, volume = {30}, number = {9}, number2 = {16ENG02: PV-Enerate: Advanced PV energy rating}, pages = {095902}, keywords = {High-speed digital light source photocurrent mapping system}, misc2 = {EMPIR 2016: Energy}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-0233, 1361-6501}, DOI = {10.1088/1361-6501/ab1f40}, stag_bib_extends_levelofaccess = {NA}, author = {Bausi, F. and Koutsourakis, G. and Blakesley, J.C. and Castro, F.A.} } @Article { GennserCPBBMCKCRMBJDH2019, subid = {1311}, title = {Quantum tomography of electrical currents}, journal = {Nature Communications}, year = {2019}, month = {7}, day = {29}, volume = {10}, number = {1}, number2 = {17FUN04: SEQUOIA: Single-electron quantum optics for quantum-enhanced measurements}, keywords = {Electronic wavefunction, Quantum tomography}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2041-1723}, DOI = {10.1038/s41467-019-11369-5}, stag_bib_extends_levelofaccess = {NA}, author = {Bisognin, R. and Marguerite, A. and Roussel, B. and Kumar, M. and Cabart, C. and Chapdelaine, C. and Mohammad-Djafari, A. and Berroir, J.-M. and Bocquillon, E. and Pla\c{c}ais, B. and Cavanna, A. and Gennser, U. and Jin, Y. and Degiovanni, P. and F{\`e}ve, G.} } @Article { OrtolanoARCETCZSCC2019, subid = {1227}, title = {Mapping the conductivity of graphene with Electrical Resistance Tomography}, journal = {Scientific Reports}, year = {2019}, month = {7}, day = {23}, volume = {9}, number = {1}, number2 = {16NRM01: GRACE: Developing electrical characterisation methods for future graphene electronics}, keywords = {graphene, electrical resistance tomography, conductivity, terahertz spectroscopy}, web_url = {https://doi.org/10.1038/s41598-019-46713-8}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2045-2322}, DOI = {10.1038/s41598-019-46713-8}, stag_bib_extends_levelofaccess = {NA}, author = {Cultrera, A. and Serazio, D. and Zurutuza, A. and Centeno, A. and Txoperena, O. and Etayo, D. and Cordon, A. and Redo-Sanchez, A. and Arnedo, I. and Ortolano, M. and Callegaro, L.} } @Thesis { Schaffer2019, subid = {1814}, title = {Cavity-enhanced optical clocks}, year = {2019}, month = {7}, day = {21}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, keywords = {Optical Lattice Clock, Superradiant laser}, misc2 = {EMPIR 2017: Fundamental}, school = {Kopenagen University}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://www.nbi.ku.dk/english/theses/phd-theses/phd_theses_2019/stefan_alaric_schaffer/}, author = {Sch{\"a}ffer, S.A.} } @Article { SOCHOROVARLLKFDCCBBT2019, subid = {1285}, title = {Activity measurements and determination of nuclear decay data of 166Ho in the MRTDosimetry project}, journal = {Applied Radiation and Isotopes}, year = {2019}, month = {7}, day = {20}, volume = {153}, number = {November 2}, number2 = {15HLT06: MRTDosimetry: Metrology for clinical implementation of dosimetry in molecular radiotherapy}, pages = {1-11}, keywords = {Ho166, Activity standardization, gamma-spectrometry, Half-life measurements, Molecular radiotherapy, MRTDosimetry}, misc2 = {EMPIR 2015: Health}, publisher = {Elsevier}, language = {30}, DOI = {10.1016/j.apradiso.2019.108826}, stag_bib_extends_levelofaccess = {NA}, author = {Bobin, C. and BOUCHARD, J. and CHISTE, V. and COLLINS, S. and Dry{\'a}k, P. and FENWICK, A. and Keightley, J. and L{\'e}py, M.C. and Lourenco, V. and Robinson, A. and Sochorov{\'a}, J. and THIAM, C.} } @Article { ShardCHS2019, subid = {1182}, title = {Summary of ISO/TC 201 Standard: ISO 22415—Surface chemical analysis—Secondary ion mass spectrometry—Method for determining yield volume in argon cluster sputter depth profiling of organic materials}, journal = {Surface and Interface Analysis}, year = {2019}, month = {7}, day = {15}, number2 = {15SIP02: ISOChemDepth: An International Standard for Reliable Chemical Depth Profiling of Organic Materials}, keywords = {ISO, standard, SIMS, sputtering, yield volumes}, web_url = {https://doi.org/10.1002/sia.6686}, misc2 = {EMPIR 2015: Support for Impact}, publisher = {Wiley}, language = {30}, ISSN = {0142-2421, 1096-9918}, DOI = {10.1002/sia.6686}, stag_bib_extends_levelofaccess = {NA}, author = {Shard, A.G. and Havelund, R. and Seah, M.P. and CLIFFORD, C.} } @Article { RedshawQPMIHGEDBSRY2019, subid = {1232}, title = {Direct determination of the La138\(\beta\)-decay Q value using Penning trap mass spectrometry}, journal = {Physical Review C}, year = {2019}, month = {7}, day = {11}, volume = {100}, number = {1}, number2 = {15SIB10: MetroBeta: Radionuclide beta spectra metrology}, pages = {014308}, keywords = {138La, high-precision Q-values, mass spectrometry, Penning trap}, web_url = {https://arxiv.org/abs/1904.12076v2}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2469-9985, 2469-9993}, DOI = {10.1103/PhysRevC.100.014308}, stag_bib_extends_levelofaccess = {NA}, author = {Sandler, R. and Bollen, G. and Dissanayake, J. and Eibach, M. and Gulyuz, K. and Hamaker, A. and Izzo, C. and Mougeot, X. and Puentes, D. and Quarati, F. G. A. and Redshaw, M. and Ringle, R. and Yandow, I.} } @Article { LandiGDL2019, subid = {1344}, title = {The Design of a Low Cost Phasor Measurement Unit}, journal = {MDPI Energies}, year = {2019}, month = {7}, day = {10}, volume = {12}, number = {14}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, pages = {2648}, keywords = {Power System Measurement, Phasor Measurement Unit, low cost, synchrophasor, voltage measurement, current measurement, synchronization}, web_url = {https://www.mdpi.com/1996-1073/12/14/2648/htm}, misc2 = {EMPIR 2017: Industry}, publisher = {MDPI}, language = {30}, ISSN = {1996-1073}, DOI = {10.3390/en12142648}, stag_bib_extends_levelofaccess = {NA}, author = {Delle Femine, A. and Gallo, D. and Landi, C. and Luiso, M.} } @Article { ImbraguglioDSMG2019, subid = {1178}, title = {Determination of the thermodynamic temperature between 236 K and 430 K from speed of sound measurements in helium}, journal = {Metrologia}, year = {2019}, month = {7}, volume = {56}, number = {4}, number2 = {15SIB02: InK 2: Implementing the new kelvin 2}, pages = {045006}, keywords = {Boltzmann constant, acoustic gas thermometry, primary thermometry, ITS-90}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/ab29a2}, stag_bib_extends_levelofaccess = {NA}, author = {Gavioso, R.M. and Madonna Ripa, D. and Steur, P.P.M. and Dematteis, R. and Imbraguglio, D} } @Article { VasilatouAH2019_2, subid = {1220}, title = {Facility for calibration of optical and condensation particle counters based on a turbulent aerosol mixing tube and a reference optical particle counter}, journal = {Review of Scientific Instruments}, year = {2019}, month = {7}, volume = {90}, number = {7}, number2 = {16ENV07: AEROMET: Aerosol metrology for atmospheric science and air quality}, pages = {075111}, keywords = {optical particle counters, aerosol instrumentation, aerosol generation setup, turbulent flow tube, particle homogenization, isokinetic sampling ports, particle counter, Stable and reproducible aerosols, polystyrene latex particles}, web_url = {https://aip.scitation.org/doi/10.1063/1.5095853}, misc2 = {EMPIR 2016: Environment}, publisher = {AIP Publishing}, language = {30}, ISSN = {0034-6748, 1089-7623}, DOI = {10.1063/1.5095853}, stag_bib_extends_levelofaccess = {NA}, author = {Horender, S. and Auderset, K. and Vasilatou, K.} } @Article { Turrion2019, subid = {1221}, title = {Theoretical evaluation of the impact of finite intervals in the measurement of the bidirectional reflectance distribution function}, journal = {Journal of Coatings Technology and Research}, year = {2019}, month = {7}, number2 = {16NRM08: BiRD: Bidirectional reflectance definitions}, pages = {1-10}, keywords = {Reflection BSDF, BRDF, and BTDF Scattering measurements Metrology}, web_url = {https://link.springer.com/article/10.1007/s11998-019-00241-2}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {1547-0091, 1935-3804}, DOI = {10.1007/s11998-019-00241-2}, stag_bib_extends_levelofaccess = {NA}, author = {Ferrero, A} } @Thesis { Tampellini2019, subid = {1228}, title = {Coherent fibre-optic link: applications in Time and Frequency Metrology, Geodesy, Radioastronomy and Seismology}, year = {2019}, month = {7}, number2 = {15SIB05: OFTEN: Optical frequency transfer - a European network}, keywords = {Time and Frequency metrology; frequency dissemination; optical fibres}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {Politecnico di Torino}, address = {Torino}, school = {Politecnico di Torino}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://iris.polito.it/retrieve/handle/11583/2742522/258655/Thesis_Tampellini.pdf}, author = {Tampellini, A.} } @Article { CalonicoLPCB2019, subid = {1229}, title = {Spectral purity transfer with 5 \(\times\) 10−17 instability at 1 s using a multibranch Er:fiber frequency comb}, journal = {Metrologia}, year = {2019}, month = {7}, volume = {56}, number = {4}, number2 = {15SIB05: OFTEN: Optical frequency transfer - a European network}, pages = {045008}, keywords = {optical frequency comb, multibranch Er:fiber comb, spectral purity transfer,ultrastable laser}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/ab2b0f}, stag_bib_extends_levelofaccess = {NA}, author = {Barbieri, P. and Clivati, C. and Pizzocaro, M. and Levi, F. and Calonico, D.} } @Article { PollakowskiMKNDHB2019, subid = {1267}, title = {Reference-free grazing incidence x-ray fluorescence and reflectometry as a methodology for independent validation of x-ray reflectometry on ultrathin layer stacks and a depth-dependent characterization}, journal = {Journal of Vacuum Science \& Technology A}, year = {2019}, month = {7}, volume = {37}, number = {4}, number2 = {17SIP07: Adlab-XMet: Advancing laboratory based X-ray metrology techniques}, pages = {041502}, keywords = {XRR, GIXRF, nanolayers}, web_url = {https://arxiv.org/abs/1903.01196}, misc2 = {EMPIR 2017: Support for Impact}, publisher = {American Vacuum Society}, language = {30}, ISSN = {0734-2101, 1520-8559}, DOI = {10.1116/1.5094891}, stag_bib_extends_levelofaccess = {NA}, author = {Honicke, P. and Detlefs, B. and Nolot, E. and Kayser, Y. and M{\"u}hle, U. and Pollakowski, B. and Beckhoff, B.} } @Article { MichlerJPPON2019, subid = {1292}, title = {Coherence and indistinguishability of highly pure single photons from non-resonantly and resonantly excited telecom C-band quantum dots}, journal = {Applied Physics Letters}, year = {2019}, month = {7}, volume = {115}, number = {2}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {023103-5}, keywords = {InAs/InGaAs/GaAs quantum dots, telecom C-band, Fourier-transform spectroscopy, two-photon excitation}, web_url = {https://aip.scitation.org/doi/full/10.1063/1.5095196}, misc2 = {EMPIR 2017: Fundamental}, publisher = {AIP Publishing}, language = {30}, ISSN = {0003-6951, 1077-3118}, DOI = {10.1063/1.5095196}, stag_bib_extends_levelofaccess = {NA}, author = {Nawrath, C. and Olbrich, F. and Paul, M. and Portalupi, S.L. and Jetter, M. and Michler, P.} } @Article { KeyerMHtL2019, subid = {1319}, title = {Faulty Readings of Static Energy Meters Caused by Conducted Electromagnetic Interference from a Water Pump}, journal = {Renewable Energy and Power Quality Journal}, year = {2019}, month = {7}, volume = {17}, number2 = {17NRM02: MeterEMI: Electromagnetic Interference on Static Electricity Meters}, pages = {15-19}, keywords = {Static Meter, Smart Meter, Electronic Meter, Conducted Interference, Electromagnetic Compatibility}, tags = {SEG}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {AEDERMACP (European Association for the Development of Renewable Energies and Power Quality)}, language = {30}, ISSN = {2172-038X}, DOI = {10.24084/repqj17.205}, stag_bib_extends_levelofaccess = {NA}, author = {ten Have, B. and Hartman, T. and Moonen, N. and Keyer, C. and Leferink, F.} } @Article { SchmidtCOHBMLK2019, subid = {1340}, title = {A cryogenic radio-frequency ion trap for quantum logic spectroscopy of highly charged ions}, journal = {Review of Scientific Instruments}, year = {2019}, month = {7}, volume = {90}, number = {7}, number2 = {17FUN07: CC4C: Coulomb Crystals for Clocks}, pages = {073201}, keywords = {Optical ClocksTrapped Ions}, misc2 = {EMPIR 2017: Fundamental}, publisher = {AIP Publishing}, language = {30}, ISSN = {0034-6748, 1089-7623}, DOI = {10.1063/1.5100594}, stag_bib_extends_levelofaccess = {NA}, author = {Leopold, T. and King, S. A. and Micke, P. and Bautista-Salvador, A. and Heip, J. C. and Ospelkaus, C. and Crespo L{\'o}pez-Urrutia, J. R. and Schmidt, P. O.} } @Article { HonickeKMBPD2019, subid = {1270}, title = {Reference-free grazing incidence x-ray fluorescence and reflectometry as a methodology for independent validation of x-ray reflectometry on ultrathin layer stacks and a depth-dependent characterization}, journal = {Journal of Vacuum Science \& Technology A}, year = {2019}, month = {7}, volume = {37}, number = {4}, number2 = {16ENV07: AEROMET: Aerosol metrology for atmospheric science and air quality}, pages = {041502}, keywords = {nanolayer stacks}, web_url = {https://arxiv.org/abs/1903.01196}, misc2 = {EMPIR 2016: Environment}, publisher = {American Vacuum Society}, language = {30}, ISSN = {0734-2101, 1520-8559}, DOI = {10.1116/1.5094891}, stag_bib_extends_levelofaccess = {NA}, author = {Honicke, P. and Detlefs, B. and Kayser, Y. and M{\"u}hle, U. and Pollakowski, B. and Beckhoff, B.} } @Article { SilanderHFZA2019, subid = {1542}, title = {Gas equilibration gas modulation refractometry for assessment of pressure with sub-ppm precision}, journal = {Journal of Vacuum Science \& Technology B}, year = {2019}, month = {7}, volume = {37}, number = {4}, number2 = {14IND06: pres2vac: Industrial standards in the intermediate pressure-to-vacuum range}, pages = {042901}, keywords = {Gas equilibration gas modulation refractometry for assessment of pressure with sub-ppm precision}, misc2 = {EMPIR 2014: Industry}, publisher = {American Vacuum Society}, language = {30}, ISSN = {2166-2746, 2166-2754}, DOI = {10.1116/1.5090860}, stag_bib_extends_levelofaccess = {NA}, author = {Silander, I. and Hausmaninger, T. and Forss{\'e}n, C. and Zelan, M. and Axner, O.} } @Article { StollWerianFRNKP2019, subid = {1563}, title = {Absolute isotope ratios – Analytical solution for the determination of calibration factors for any number of isotopes and isotopologues}, journal = {Spectrochimica Acta Part B: Atomic Spectroscopy}, year = {2019}, month = {7}, volume = {157}, number2 = {16ENV06: SIRS: Metrology for stable isotope reference standards}, pages = {76-83}, keywords = {Mass bias correction, Absolute isotope ratio, SI traceability, Metrology, Isotopic composition}, misc2 = {EMPIR 2016: Environment}, publisher = {Elsevier BV}, language = {30}, ISSN = {0584-8547}, DOI = {10.1016/j.sab.2019.04.008}, stag_bib_extends_levelofaccess = {NA}, author = {Stoll-Werian, Anne and Flierl, Lukas and Rienitz, Olaf and Noordmann, Janine and Kessel, R{\"u}diger and Pramann, Axel} } @Proceedings { HoffmannVQZB2019, subid = {1610}, title = {Fabrication and Measurements of Inductive Devices for Scanning Microwave Microscopy}, journal = {2019 IEEE 19th International Conference on Nanotechnology (IEEE-NANO)}, year = {2019}, month = {7}, volume = {2019}, number = {-}, number2 = {16ENG06: ADVENT: Metrology for advanced energy-saving technology in next-generation electronics applications}, pages = {1-4}, keywords = {calibration, doping profiles, inductors, scanning probe microscopy, silicon compounds}, web_url = {https://zenodo.org/record/4275929}, misc2 = {EMPIR 2016: Energy}, publisher = {IEEE}, event_place = {Macao}, event_name = {IEEE Nano}, event_date = {22-07-2019 to 26-07-2019}, language = {30}, ISBN = {Electronic ISBN: 978-1-7281-28}, ISSN = {Electronic ISSN: 1944-9380 Pri}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://zenodo.org/record/4275929}, author = {Hoffmann, J. and Vasyukov, D. and Quang, T. L. and Ziade, F. and Buchter, A.} } @Article { MurugandBvAtH2019, subid = {1816}, title = {Measurement challenges for hydrogen vehicles}, journal = {International Journal of Hydrogen Energy}, year = {2019}, month = {7}, volume = {44}, number = {35}, number2 = {16ENG01: MetroHyVe: Metrology for hydrogen vehicles}, pages = {19326-19333}, keywords = {Hydrogen; Fuel cell; Vehicles; ISO 14687; Metrology; Measurement; Flow metering; Quality control}, tags = {EnG}, misc2 = {EMPIR 2016: Energy}, publisher = {Elsevier BV}, language = {30}, ISSN = {0360-3199}, DOI = {10.1016/j.ijhydene.2019.03.190}, stag_bib_extends_levelofaccess = {NA}, author = {Murugan, A. and de Huu, M. and Bacquart, T. and van Wijk, J. and Arrhenius, K. and te Ronde, I. and Hemfrey, D.} } @Article { NawrathOPPJM2019, subid = {1808}, title = {Coherence and indistinguishability of highly pure single photons from non-resonantly and resonantly excited telecom C-band quantum dots}, journal = {Applied Physics Letters}, year = {2019}, month = {7}, volume = {115}, number = {2}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {023103}, keywords = {Quantum dotsSemiconductorsFourier transform spectroscopyExcitonsQuantum information}, misc2 = {EMPIR 2017: Fundamental}, publisher = {AIP Publishing}, language = {30}, ISSN = {0003-6951, 1077-3118}, DOI = {10.1063/1.5095196}, stag_bib_extends_levelofaccess = {NA}, author = {Nawrath, C. and Olbrich, F. and Paul, M. and Portalupi, S.L. and Jetter, M. and Michler, P.} } @Article { GaviosoMSDI2019, subid = {2646}, title = {Determination of the thermodynamic temperature between 236 K and 430 K from speed of sound measurements in helium}, journal = {Metrologia}, year = {2019}, month = {7}, volume = {56}, number = {4}, number2 = {15SIB02: InK 2: Implementing the new kelvin 2}, pages = {045006}, keywords = {primary thermometry, acoustic gas thermometry, ITS-90}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/ab29a2}, stag_bib_extends_levelofaccess = {NA}, author = {Gavioso, R.M. and Madonna Ripa, D. and Steur, P.P.M. and Dematteis, R. and Imbraguglio, D.} } @Article { KoutsourakisBC2019, subid = {1735}, title = {Signal Amplification Gains of Compressive Sampling for Photocurrent Response Mapping of Optoelectronic Devices}, journal = {Sensors}, year = {2019}, month = {6}, day = {28}, volume = {19}, number = {13}, number2 = {16ENG02: PV-Enerate: Advanced PV energy rating}, pages = {2870}, keywords = {non-destructive testing, current mapping, digital micromirror device, compressed sensing}, misc2 = {EMPIR 2016: Energy}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s19132870}, stag_bib_extends_levelofaccess = {NA}, author = {Koutsourakis, G. and Blakesley, J.C. and Castro, F.A.} } @Article { AdibekyanKMH2019, subid = {1287}, title = {Characterization, calibration and validation of an industrial emissometer}, journal = {Journal of Sensors and Sensor Systems}, year = {2019}, month = {6}, day = {27}, volume = {8}, number = {1}, number2 = {16NRM06: EMIRIM: Improvement of emissivity measurements on reflective insulation materials}, pages = {233-242}, keywords = {emissivity, TIR 100-2 emissometer, characterization, calibration, reflective foils}, web_url = {https://www.j-sens-sens-syst.net/8/233/2019/}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {Copernicus GmbH}, language = {30}, ISSN = {2194-878X}, DOI = {10.5194/jsss-8-233-2019}, stag_bib_extends_levelofaccess = {NA}, author = {Kononogova, Elena and Adibekyan, Albert and Monte, Christian and Hollandt, J{\"o}rg} } @Article { LeitoK2019, subid = {1408}, title = {Generalization of Acid‐Base Diagrams Based on the Unified pH‐Scale}, journal = {ChemPhysChem}, year = {2019}, month = {6}, day = {26}, volume = {20}, number = {14}, number2 = {17FUN09: UnipHied: Realisation of a Unified pH Scale}, pages = {1779-1785}, keywords = {electrochemistry nonaqueous solventspH-lgci diagramsproton transfer reactionsunified pH scale}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Wiley}, language = {30}, ISSN = {1439-4235, 1439-7641}, DOI = {10.1002/cphc.201900388}, stag_bib_extends_levelofaccess = {NA}, author = {Kahlert, H. and Leito, I.} } @Article { HibberdMOCORMOPVHC2019, subid = {1159}, title = {Integrating informatics tools and portable sequencing technology for rapid detection of resistance to anti-tuberculous drugs}, journal = {Genome Medicine}, year = {2019}, month = {6}, day = {24}, volume = {11}, number = {1}, number2 = {15HLT07: AntiMicroResist: Novel materials and methods for the detection, traceable monitoring and evaluation of antimicrobial resistance}, pages = {41}, keywords = {whole genome sequencing, drug resistance, tuberculosis}, web_url = {https://genomemedicine.biomedcentral.com/articles/10.1186/s13073-019-0650-x}, misc2 = {EMPIR 2015: Health}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {1756-994X}, DOI = {10.1186/s13073-019-0650-x}, stag_bib_extends_levelofaccess = {NA}, author = {Phelan, J.E. and O’Sullivan, D.M. and Machado, D. and Ramos, J. and Oppong, Y.E.A. and Campino, S. and O’Grady, J. and McNerney, R. and Hibberd, M.L. and Viveiros, M. and Huggett, J.F. and Clark, T.G.} } @Article { IacomussiVR2019, subid = {1277}, title = {Innovative Design And Metrological Approaches To Smart Lighting}, journal = {PROCEEDINGS OF the 29th Quadrennial Session of the CIE}, year = {2019}, month = {6}, day = {24}, number2 = {16NRM02: SURFACE: Pavement surface characterisation for smart and efficient road lighting}, keywords = {Smart lighting, Road lighting, ILMD detector, Pedestrian safety, Systemic Design, Design by Components, Design Network, SURFACE, EMPIR}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {International Commission on Illumination, CIE}, language = {30}, DOI = {10.25039/x46.2019.PO192}, stag_bib_extends_levelofaccess = {NA}, author = {Valpreda, Fab. and Iacomussi, P. and Rossi, G.} } @Article { DRONNEAUFBMG2019, subid = {1275}, title = {Use Of An Imaging Luminance Measuring Device To Evaluate Road Lighting Performance At Different Angles Of Observation}, journal = {PROCEEDINGS OF the 29th Quadrennial Session of the CIE}, year = {2019}, month = {6}, day = {24}, number2 = {16NRM02: SURFACE: Pavement surface characterisation for smart and efficient road lighting}, keywords = {road lighting, dynamic luminance measurements, Imaging Luminance Measuring Device (ILMD), moving observer, angles of observation, 16NRM02}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {International Commission on Illumination, CIE}, language = {30}, DOI = {10.25039/x46.2019.OP75}, stag_bib_extends_levelofaccess = {NA}, author = {GREFFIER, F. and Muzet, V. and BOUCHER, V. and FOURNELA, F. and DRONNEAU, R.} } @Article { RossiI2019, subid = {1276}, title = {Influence Of Material Characterization In The Design Of Tunnel Lighting Installations}, journal = {PROCEEDINGS OF the 29th Quadrennial Session of the CIE}, year = {2019}, month = {6}, day = {24}, number2 = {16NRM02: SURFACE: Pavement surface characterisation for smart and efficient road lighting}, keywords = {Road tunnel lighting, energy savings, SURFACE, EMPIR, luminance coefficient, r- tables.}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {International Commission on Illumination, CIE}, language = {30}, DOI = {10.25039/x46.2019.OP74}, stag_bib_extends_levelofaccess = {NA}, author = {Iacomussi, P. and Rossi, G.} } @Article { VernyGM2019, subid = {1274}, title = {Optimization Of Road Surface Reflections Properties And Lighting: Learning Of A Three-Year Experiment}, journal = {Proceedings of the 29th Quadrennial Session of the CIE}, year = {2019}, month = {6}, day = {24}, number2 = {16NRM02: SURFACE: Pavement surface characterisation for smart and efficient road lighting}, keywords = {Road photometry, Adaptative road lighting, Real-site experiment, Time evolution, Obtrusive ligh, 16NRM02}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {International Commission on Illumination, CIE}, language = {30}, DOI = {10.25039/x46.2019.OP72}, stag_bib_extends_levelofaccess = {NA}, author = {Muzet, V. and GREFFIER, F. and Verny, P.} } @Article { GandonLegerTCMC2019, subid = {1278}, title = {Towards An Optimization Of Urban Lighting Through A Combined Approach Of Lighting And Road Building Activities}, journal = {PROCEEDINGS OF the 29th Quadrennial Session of the CIE}, year = {2019}, month = {6}, day = {24}, number2 = {16NRM02: SURFACE: Pavement surface characterisation for smart and efficient road lighting}, keywords = {Road photometry, Road lighting design, Gonioreflectometer,16NRM02}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {International Commission on Illumination, CIE}, language = {30}, DOI = {10.25039/x46.2019.PP23}, stag_bib_extends_levelofaccess = {NA}, author = {Muzet, V. and Colomb, M. and Toinette, M. and Gandon-Leger, P. and Christory, J.P.} } @Article { IacomussiR2019, subid = {1279}, title = {The Veiling Luminance In Tunnel Lighting Installation}, journal = {PROCEEDINGS OF the 29th Quadrennial Session of the CIE}, year = {2019}, month = {6}, day = {24}, number2 = {16NRM02: SURFACE: Pavement surface characterisation for smart and efficient road lighting}, keywords = {Tunnel, lighting, 16NRM02}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {International Commission on Illumination, CIE}, address = {Babenbergerstrasse 9/9A Vienna 1010 Austria}, language = {30}, DOI = {10.25039/x46.2019.PP28}, stag_bib_extends_levelofaccess = {NA}, author = {Rossi, G. and Iacomussi, P.} } @Article { BrinkmannMSBLI2019, subid = {1322}, title = {3D nonrigid motion correction for quantitative assessment of hepatic lesions in DCE‐MRI}, journal = {Magnetic Resonance in Medicine}, year = {2019}, month = {6}, day = {22}, volume = {82}, number = {5}, number2 = {15HLT05: PerfusImaging: Metrology for multi-modality imaging of impaired tissue perfusion}, pages = {1753-1766}, keywords = {quantification, nonrigid motion correction, hepatic lesions, DCE-MRI}, misc2 = {EMPIR 2015: Health}, publisher = {Wiley}, language = {30}, ISSN = {0740-3194, 1522-2594}, DOI = {10.1002/mrm.27867}, stag_bib_extends_levelofaccess = {NA}, author = {Ippoliti, M. and Lukas, M. and Brenner, W. and Schaeffter, T. and Makowski, M. R. and Kolbitsch, C.} } @Proceedings { KrokerWSDKB2019, subid = {1281}, title = {Mueller matrix ellipsometry for enhanced optical form metrology of sub-lambda structures}, journal = {Modeling Aspects in Optical Metrology VII}, year = {2019}, month = {6}, day = {21}, volume = {11057}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {155-165}, keywords = {Plasmonics, Ellipsometry, Scanning electron microscopy, Numerical simulations, Metrology, Nanostructures, Near field optics}, misc2 = {EMPIR 2017: Fundamental}, publisher = {SPIE}, event_place = {Munich}, event_name = {International Society for Optics and Photonics Optical Metrology}, event_date = {24-06-2019 to 27-06-2019}, language = {30}, DOI = {10.1117/12.2527419}, stag_bib_extends_levelofaccess = {NA}, author = {K{\"a}seberg, T. and Dickmann, J. and Siefke, T. and Wurm, M. and Kroker, S. and Bodermann, B.} } @Proceedings { MontavonPS2019, subid = {1387}, title = {Model-based interfacing of large-scale metrology instruments}, journal = {Multimodal Sensing: Technologies and Applications}, year = {2019}, month = {6}, day = {21}, number2 = {17IND03: LaVA: Large Volume Metrology Applications}, keywords = {Large-Scale Metrology, Internet of Production, Cyper Physical Production Systems}, web_url = {http://arxiv.org/abs/2001.05897}, misc2 = {EMPIR 2017: Industry}, publisher = {SPIE}, event_place = {Munich}, event_name = {SPIE Optical Metrology}, event_date = {24-06-2019 to 28-06-2019}, language = {30}, DOI = {10.1117/12.2527461}, stag_bib_extends_levelofaccess = {NA}, author = {Montavon, B. and Peterek, M. and Schmitt, R.H.} } @Proceedings { MeuretHC2019, subid = {1435}, title = {Accurate and robust characterization of volume scattering materials using the intensity-based inverse adding-doubling method}, journal = {SPIE Proceeding, Modeling Aspects in Optical Metrology VII}, year = {2019}, month = {6}, day = {21}, volume = {11057}, number = {-}, number2 = {18SIB03: BxDiff: New quantities for the measurement of appearance}, pages = {110570N}, keywords = {Volume scattering, solid-state lighting, inverse problem, adding-doubling}, web_url = {https://lirias.kuleuven.be/2825988?limo=0}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {SPIE}, event_place = {Munich, Germany}, event_name = {Modeling Aspects in Optical Metrology VII (SPIE Optical Metrology)}, event_date = {24-06-2019 to 26-06-2019}, language = {30}, ISBN = {9781510627932}, ISSN = {0277-786X}, DOI = {10.1117/12.2525791}, stag_bib_extends_levelofaccess = {NA}, author = {Correia, A. and Hanselaer, P. and Meuret, Y.} } @Article { PoikonenLGKKTDFPKI2019, subid = {1201}, title = {Validation of the fisheye camera method for spatial non-uniformity corrections in luminous flux measurements with integrating spheres}, journal = {Metrologia}, year = {2019}, month = {6}, day = {18}, volume = {56}, number = {4}, number2 = {15SIB07: PhotoLED: Future photometry based on solid-state lighting products}, pages = {045002}, keywords = {fisheye camera method, integrating sphere, luminous flux, spatial correction, angular intensity distribution, photometry, measurement uncertainty}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {-}, DOI = {10.1088/1681-7575/ab17fe}, stag_bib_extends_levelofaccess = {NA}, author = {Kokka, A. and Pulli, T. and Ferrero, A. and Dekker, P. and Thorseth, A. and Kliment, P. and Klej, A. and Gerloff, T. and Ludwig, K. and Poikonen, T. and Ikonen, E.} } @Article { PraakMUP2019, subid = {1327}, title = {The Influence of the Cornea on Intraocular Pressure Measurement by ICARE PRO and ORA}, journal = {Czech and Slovak Ophthalmology}, year = {2019}, month = {6}, day = {15}, volume = {75}, number = {3}, number2 = {16RPT03: inTENSE: Developing research capabilities for traceable intraocular pressure measurements}, pages = {111-118}, keywords = {intraocular pressure, ICARE, ORA, corneal hysteresis, central corneal thickness}, web_url = {http://www.cs-ophthalmology.cz/cs/journal/2019/3/1}, misc2 = {EMPIR 2016: Research Potential}, publisher = {Czech Society of Ophthalmology of the CzMA}, language = {30}, ISSN = {1211-9059, 1805-4447}, DOI = {10.31348/2019/3/1}, stag_bib_extends_levelofaccess = {NA}, author = {Pluh{\'a}ček, F. and Unzeitigov{\'a}, A. and Marešov{\'a}, K. and Ryb{\'a}ř, J.} } @Article { MottonenRKBYFGK2019, subid = {1110}, title = {Evidence for universality of tunable-barrier electron pumps}, journal = {Metrologia}, year = {2019}, month = {6}, day = {13}, number2 = {15SIB08: e-SI-Amp: Quantum realisation of the SI ampere}, keywords = {Single electron pumps, electrical metrology, quantum electrical standards}, web_url = {https://arxiv.org/abs/1901.05218}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {IOP Publishing}, language = {30}, ISSN = {0026-1394, 1681-7575}, DOI = {10.1088/1681-7575/ab29a5}, stag_bib_extends_levelofaccess = {NA}, author = {Giblin, S. and Fujiwara, A. and Yamahata, G. and Bae, M.H. and Kim, N. and Rossi, A. and M{\"o}tt{\"o}nen, M. and Kataoka, M.} } @Article { HannNFSTK2019, subid = {1196}, title = {FI-ICP-TOFMS for quantification of biologically essential trace elements in cerebrospinal fluid – high-throughput at low sample volume}, journal = {The Analyst}, year = {2019}, month = {6}, day = {11}, volume = {144}, number = {15}, number2 = {15HLT02: ReMIND: Role of metals and metal containing biomolecules in neurodegenerative diseases such as Alzheimer’s disease}, pages = {4653-4660}, keywords = {cerebrospinal fluid, FI-ICP-TOFMS, quantification of biologically essential trace elements}, web_url = {https://pubs.rsc.org/en/Content/ArticleLanding/2019/AN/C9AN00039A\#!divAbstract}, misc2 = {EMPIR 2015: Health}, publisher = {Royal Society of Chemistry (RSC)}, language = {30}, ISSN = {0003-2654, 1364-5528}, DOI = {10.1039/C9AN00039A}, stag_bib_extends_levelofaccess = {NA}, author = {Theiner, S. and Schoeberl, A. and Fischer, L. and Neumayer, S. and Hann, S. and Koellensperger, G.} } @Article { ThorwarthDKP2019, subid = {1141}, title = {A finite element method for the determination of the relative response of ionization chambers in MR-linacs: simulation and experimental validation up to 1.5 T}, journal = {Physics in Medicine and Biology}, year = {2019}, month = {6}, day = {10}, number2 = {15HLT08: MRgRT: Metrology for MR guided radiotherapy}, keywords = {MRgRT, reference dosimetry, magnetic field}, web_url = {https://doi.org/10.1088/1361-6560/ab2837}, misc2 = {EMPIR 2015: Health}, publisher = {IOP Publishing}, language = {30}, ISSN = {0031-9155, 1361-6560}, DOI = {10.1088/1361-6560/ab2837}, stag_bib_extends_levelofaccess = {NA}, author = {Pojtinger, S. and Kapsch, R.P. and Dohm, O.S. and Thorwarth, D.} } @Article { CelepPGDH2019, subid = {1070}, title = {Harmonics Effects on Microwave Power Measurement Using Diode Sensors}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2019}, month = {6}, volume = {68}, number = {6}, number2 = {15RPT01: RFMicrowave: Development of RF and microwave metrology capability}, pages = {1852-1859}, keywords = {Diode detector, Harmonic effect, Microwave measurements, Microwave power, Power sensor}, web_url = {https://ieeexplore.ieee.org/document/8700278}, misc2 = {EMPIR 2015: Research Potential}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9456, 1557-9662}, DOI = {10.1109/TIM.2019.2905885}, stag_bib_extends_levelofaccess = {NA}, author = {Drazil, K. and Grajciar, J. and Pavlicek, T. and Celep, M. and Hudlicka, M.} } @Article { BeckerGKDS2019, subid = {1104}, title = {Electrometer Calibration With Sub-Part-Per-Million Uncertainty}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2019}, month = {6}, volume = {68}, number = {6}, number2 = {15SIB08: e-SI-Amp: Quantum realisation of the SI ampere}, pages = {1887-1894}, keywords = {Ammeters, calibration, current measurement, measurement standards, measurement uncertainty, precisionmeasurements}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9456, 1557-9662}, DOI = {10.1109/TIM.2019.2900129}, stag_bib_extends_levelofaccess = {NA}, author = {Scherer, H. and Drung, D. and Krause, C. and G{\"o}tz, M. and Becker, U.} } @Article { PottieLATMQFCX2019, subid = {1117}, title = {Two-Branch Fiber Link for International Clock Networks}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2019}, month = {6}, volume = {68}, number = {6}, number2 = {15SIB05: OFTEN: Optical frequency transfer - a European network}, pages = {2195-2200}, keywords = {Optical fiber links, phase lock loop, phase measurement, two-way noise compensation, ultrastable frequencytransfer}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9456, 1557-9662}, DOI = {10.1109/TIM.2018.2886865}, stag_bib_extends_levelofaccess = {NA}, author = {Xu, D. and Cantin, E. and Frank, F. and Quintin, N. and Meynadier, F. and Tuckey, P. and Amy-Klein, A. and Lopez, O. and Pottie, P.E.} } @Article { SchererGDG2019, subid = {1109}, title = {Interlaboratory Nanoamp Current Comparison With Subpart-Per-Million Uncertainty}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2019}, month = {6}, volume = {68}, number = {6}, number2 = {15SIB08: e-SI-Amp: Quantum realisation of the SI ampere}, pages = {1996-2002}, keywords = {Small current measurements, high resistance measurements, interlab comparisons, ULCA, electrical transfer standards, transimpedance amplifiers}, web_url = {https://arxiv.org/abs/1808.09741}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9456, 1557-9662}, DOI = {10.1109/TIM.2018.2879126}, stag_bib_extends_levelofaccess = {NA}, author = {Giblin, S.P. and Drung, D. and G{\"o}tz, M. and Scherer, H.} } @Article { vandenBromHHBKWI2019, subid = {1154}, title = {An Optoelectronic Pulse Drive for Quantum Voltage Synthesizer}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2019}, month = {6}, volume = {68}, number = {6}, number2 = {15SIB04: QuADC: Waveform metrology based on spectrally pure Josephson voltages}, pages = {2066-2071}, keywords = {Josephson arbitrary waveform synthesizer, Josephson arrays, measurement, metrology, optoelectronics, voltage measurement}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9456, 1557-9662}, DOI = {10.1109/TIM.2018.2877562}, stag_bib_extends_levelofaccess = {NA}, author = {Ireland, J. and Williams, J. and Kieler, O. and Behr, R. and Houtzager, E. and Hornecker, R. and van den Brom, H.E.} } @Article { GulmezHGE2019, subid = {1137}, title = {Reference Ultralow DC Current Source Between 1 fA and 100 pA at T{\"U}BİTAK UME}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2019}, month = {6}, volume = {68}, number = {6}, number2 = {15SIB08: e-SI-Amp: Quantum realisation of the SI ampere}, pages = {2201-2207}, keywords = {Capacitors, Standards, Voltage measurement, Temperature measurement, Temperature sensors, Current measurement, Uncertainty}, web_url = {https://arxiv.org/abs/1907.01389}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9456, 1557-9662}, DOI = {10.1109/TIM.2019.2895435}, stag_bib_extends_levelofaccess = {NA}, author = {Erkan, {\"O}. and G{\"u}lmez, Y. and G{\"u}lmez, G. and Hayırlı, C.} } @Article { RoscoeRJDW2019, subid = {1185}, title = {Field Measurement of Frequency and ROCOF in the Presence of Phase Steps}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2019}, month = {6}, volume = {68}, number = {6}, number2 = {15NRM04: ROCOF: Standard tests and requirements for rate-of-change of frequency (ROCOF) measurements in smart grids}, pages = {1688-1695}, keywords = {ROCOF, Instruments, Frequency measurement, Phase measurement, Relays, Power system stability, Phasor measurement units, Sea measurements,}, tags = {SEG}, misc2 = {EMPIR 2015: Pre-Co-Normative}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9456, 1557-9662}, DOI = {10.1109/TIM.2018.2882907}, stag_bib_extends_levelofaccess = {NA}, author = {Wright, P.. and Davis, P. and Johnstone, K. and Rietveld, G. and Roscoe, A. J.} } @Article { BursikovaKC2019, subid = {1250}, title = {Fast mechanical model for probe–sample elastic deformation estimation in scanning probe microscopy}, journal = {Ultramicroscopy}, year = {2019}, month = {6}, volume = {201}, number2 = {15SIB09: 3DNano: Traceable three-dimensional nanometrology}, pages = {18-27}, keywords = {Scanning Probe Microscopy,Uncertainty,Elastic deformation}, web_url = {https://www.sciencedirect.com/science/article/pii/S0304399118302638}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {Elsevier BV}, language = {30}, ISSN = {0304-3991}, DOI = {10.1016/j.ultramic.2019.03.010}, stag_bib_extends_levelofaccess = {NA}, author = {Klapetek, P. and Charv{\'a}tov{\'a} Campbell, A. and Burš{\'i}kov{\'a}, V. } } @Article { TeodoroFBS2019, subid = {1265}, title = {3D-Simulation of a Bayard Alpert ionisation gauge using SIMION program}, journal = {Vacuum}, year = {2019}, month = {6}, volume = {164}, number2 = {16NRM05: Ion Gauge: Towards a documentary standard for an ionisation vacuum gauge}, pages = {300-307}, keywords = {Vacuum measurementIonisation gaugeSimulationGauge sensitivity}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {Elsevier BV}, language = {30}, ISSN = {0042-207X}, DOI = {10.1016/j.vacuum.2019.03.039}, stag_bib_extends_levelofaccess = {NA}, author = {Silva, R. and Bundaleski, N. and Fonseca, A.L. and Teodoro, O.} } @Article { KorpelainenBDS2019, subid = {1297}, title = {Tip wear and tip breakage in high-speed atomic force microscopes}, journal = {Ultramicroscopy}, year = {2019}, month = {6}, volume = {201}, number2 = {15SIB09: 3DNano: Traceable three-dimensional nanometrology}, pages = {28-37}, keywords = {Atomic force microscopy (AFM), High-speed AFM, Tip wear, Tip breakage, Tip characterization, Tip-sample interaction}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {Elsevier BV}, language = {30}, ISSN = {0304-3991}, DOI = {10.1016/j.ultramic.2019.03.013}, stag_bib_extends_levelofaccess = {NA}, author = {Strahlendorff, T. and Dai, G. and Bergmann, D. and Tutsch, R.} } @Proceedings { Buermann2019, subid = {1323}, title = {Steps Towards Personalized Dosimetry in Computed Tomography}, journal = {Book of Extended Synopses}, year = {2019}, month = {6}, number2 = {15HLT05: PerfusImaging: Metrology for multi-modality imaging of impaired tissue perfusion}, pages = {216-217}, keywords = {dosimetry, personalised medicine, CT}, misc2 = {EMPIR 2015: Health}, publisher = {International Atomic Energy Agency}, event_place = {Vienna, Austria}, event_name = {International Symposium on Standards, Applications and Quality Assurance in Medical Radiation Dosimetry (IDOS 2019)}, event_date = {18-06-2019 to 21-06-2019}, language = {30}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://www.iaea.org/sites/default/files/19/06/cn-273-book-extended-synopses.pdf}, author = {B{\"u}ermann, L.} } @Article { LeferinkMHH2019, subid = {1382}, title = {Misreadings of Static Energy Meters due to Conducted EMI caused by Fast Changing Current}, journal = {2019 Joint International Symposium on Electromagnetic Compatibility, Sapporo and Asia-Pacific International Symposium on Electromagnetic Compatibility (EMC Sapporo/APEMC)}, year = {2019}, month = {6}, volume = {Not Applic}, number = {Not Applic}, number2 = {17NRM02: MeterEMI: Electromagnetic Interference on Static Electricity Meters}, pages = {4}, keywords = {IEEE Keywords Meters, Regulators, Water pumps, Current measurement, Impedance, Power measurement, Voltage measurement INSPEC: Controlled Indexing amplifiers, electromagnetic interference, power meters, water pumps INSPEC: Non-Controlled Indexing static energy meters, conducted EMI, conducted electromagnetic interference , water pump, speed regulators, reference meter, fast changing current, four-quadrant amplifier}, web_url = {https://research.utwente.nl/en/publications/misreadings-of-static-energy-meters-due-to-conducted-emi-caused-b}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {IEEE}, language = {30}, DOI = {10.23919/EMCTokyo.2019.8893903}, stag_bib_extends_levelofaccess = {NA}, author = {Have, B. t. and Hartman, T. and Moonen, N. and Leferink, F.} } @Proceedings { PeinerF2019, subid = {1404}, title = {Entwicklung eines taktilen Mikrotaster-Messsystems f{\"u}r Hochgeschwindigkeitsmessung von Form, Rauheit und mechanischen Eigenschaften}, journal = {20. GMA/ITG-Proceedings: Fachtagung Sensoren und Messsysteme 2019}, year = {2019}, month = {6}, volume = {2019}, number = {P2: Messsy}, number2 = {17IND05: MicroProbes: Multifunctional ultrafast microprobes for on-the-machine measurements}, pages = {720-725}, keywords = {Mikrotaster, Cantilever-Sensor, Kontaktresonanzspektroskopie, Modellierung, Messdatenauswertung}, web_url = {https://www.ama-science.org/proceedings/details/3479}, misc2 = {EMPIR 2017: Industry}, publisher = {AMA Service GmbH}, event_place = {N{\"u}rnberg}, event_name = {20. GMA/ITG-Fachtagung Sensoren und Messsysteme 2019}, event_date = {25-06-2019 to 26-06-2019}, language = {43}, ISBN = {978-3-9819376-0-2}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://doi.org/10.5162/sensoren2019/p2.10}, author = {Peiner, E. and Fahrbach, M.} } @Article { ZhangTPM2019, subid = {2311}, title = {Use of COMTRADE Fault Current Data to Test Inductive Current Transformers}, journal = {2019 II Workshop on Metrology for Industry 4.0 and IoT (MetroInd4.0 \& IoT)}, year = {2019}, month = {6}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, keywords = {current transformers, fault current, distorted signals}, web_url = {https://zenodo.org/record/3603834}, misc2 = {EMPIR 2017: Industry}, publisher = {IEEE}, language = {30}, DOI = {10.1109/METROI4.2019.8792871}, stag_bib_extends_levelofaccess = {NA}, author = {Zhang, J. and Tinarelli, R. and Peretto, L. and Mingotti, A.} } @Article { IvanovGWRBBR2019, subid = {1128}, title = {Complete dissolution of solid matrices using automated borate fusion in support of nuclear decommissioning and production of reference materials}, journal = {Journal of Radioanalytical and Nuclear Chemistry}, year = {2019}, month = {5}, day = {28}, volume = {321}, number = {1}, number2 = {16ENV09: MetroDecom II: In situ metrology for decommissioning nuclear facilities}, pages = {183-196}, keywords = {Fusion, dissolution, radionuclide, decommissioning, reference material, characterisation}, web_url = {https://link.springer.com/article/10.1007/s10967-019-06572-z}, misc2 = {EMPIR 2016: Environment}, publisher = {Springer Science and Business Media LLC}, address = {233 Spring St. New York NY 10013 United States}, language = {30}, ISSN = {0236-5731, 1588-2780}, DOI = {10.1007/s10967-019-06572-z}, stag_bib_extends_levelofaccess = {NA}, author = {Braysher, E. and Russell, B. and Woods, S. and Garc{\'i}a-Miranda, M. and Ivanov, P. and Bouchard, B. and Read, D.} } @Article { WolthausRLdvvW2019, subid = {1144}, title = {Technical Note: Consistency of PTW 30013 and FC 65‐G ion chamber magnetic field correction factors}, journal = {Medical Physics}, year = {2019}, month = {5}, day = {27}, number2 = {15HLT08: MRgRT: Metrology for MR guided radiotherapy}, keywords = {Reference dosimetry, MRgRT, ionisation chamber}, misc2 = {EMPIR 2015: Health}, publisher = {Wiley}, language = {30}, ISSN = {0094-2405, 2473-4209}, DOI = {10.1002/mp.13623}, stag_bib_extends_levelofaccess = {NA}, author = {Woodings, S.J. and van Asselen, B. and van Soest, T.L. and de Prez, L.A. and Lagendijk, J.J.W and Raaymakers, B.W and Wolthaus, J.W.H} } @Article { UrsinTSFC2019, subid = {1349}, title = {Hong-Ou-Mandel interferometry on a biphoton beat note}, journal = {npj Quantum Information}, year = {2019}, month = {5}, day = {24}, volume = {5}, number = {1}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, keywords = {quantum metrology, Hong-Ou-Mandel}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2056-6387}, DOI = {10.1038/s41534-019-0161-z}, stag_bib_extends_levelofaccess = {NA}, author = {Chen, Y. and Fink, M. and Steinlechner, F. and Torres, J.P. and Ursin, R.} } @Article { MainzBGWSZW2019, subid = {1206}, title = {Photon flux determination of a liquid-metal jet X-ray source by means of photon scattering}, journal = {Journal of Analytical Atomic Spectrometry}, year = {2019}, month = {5}, day = {23}, number2 = {16ENG03: HyMet: Hybrid metrology for thin films in energy applications}, keywords = {Liquid-metal jet, X-ray sources, photon flux determination, elastic and inelastic photon scattering}, web_url = {https://arxiv.org/abs/1903.06024}, misc2 = {EMPIR 2016: Energy}, language = {30}, DOI = {10.1039/C9JA00127A}, stag_bib_extends_levelofaccess = {NA}, author = {Wansleben, M. and Zech, C. and Streeck, C. and Weser, J. and Genzel, C. and Beckhoff, B. and Mainz, R.} } @Article { HohlsKGHKW2019, subid = {1126}, title = {Quantum dot state initialization by control of tunneling rates}, journal = {Physical Review B}, year = {2019}, month = {5}, day = {20}, volume = {99}, number = {20}, number2 = {17FUN04: SEQUOIA: Single-electron quantum optics for quantum-enhanced measurements}, pages = {201409(R)}, keywords = {quantum dot, single-electron, quantum state, electron quantum optics}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2469-9950, 2469-9969}, DOI = {10.1103/physrevb.99.201409}, stag_bib_extends_levelofaccess = {NA}, author = {Wenz, T. and Klochan, J. and Hohls, F. and Gerster, T. and Kashcheyevs, V. and Schumacher, H. W.} } @Article { HohlsKGHKW20190, subid = {1126}, title = {Quantum dot state initialization by control of tunneling rates}, journal = {Physical Review B}, year = {2019}, month = {5}, day = {20}, volume = {99}, number = {20}, number2 = {15SIB08: e-SI-Amp: Quantum realisation of the SI ampere}, pages = {201409(R)}, keywords = {quantum dot, single-electron, quantum state, electron quantum optics}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2469-9950, 2469-9969}, DOI = {10.1103/physrevb.99.201409}, stag_bib_extends_levelofaccess = {NA}, author = {Wenz, T. and Klochan, J. and Hohls, F. and Hohls, F. and Gerster, T. and Kashcheyevs, V.} } @Article { OliveroBOFCJGSPBFHBER2019, subid = {1261}, title = {Quantum Micro–Nano Devices Fabricated in Diamond by Femtosecond Laser and Ion Irradiation}, journal = {Advanced Quantum Technologies}, year = {2019}, month = {5}, day = {20}, volume = {2}, number = {5-6}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {1900006}, keywords = {diamond, ion‐beam irradiation, nitrogen vacancies ,NV magnetometry, quantum sensing, ultrafast laser writing}, misc2 = {EMPIR 2017: Fundamental}, publisher = {Wiley}, language = {30}, ISSN = {2511-9044, 2511-9044}, DOI = {10.1002/qute.201900006}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {http://hdl.handle.net/2318/1704485}, author = {Eaton, S.M. and Hadden, J.P. and Bharadwaj, V. and Forneris, J. and Picollo, F. and Bosia, F. and Sotillo, B. and Giakoumaki, A.N. and Jedrkiewicz, O. and Chiappini, A. and Ferrari, M. and Osellame, R. and Barclay, P.E. and Olivero, P. and Ramponi, R.} } @Article { , title = {Universal Equation for Argon Gas Cluster Sputtering Yields}, journal = {Journal of Physical Chemistry C}, year = {2019}, month = {5}, day = {13}, volume = {117}, number = {(24),}, number2 = {NEW01: TReND: Traceable characterisation of nanostructured devices}, pages = {pp 12622–12632}, keywords = {gold, Irganox1010, OLED, polymers, silicon, silicon dioxide.}, web_url = {http://pubs.acs.org/doi/abs/10.1021/jp402684c}, misc2 = {EMRP A169: Call 2011 Metrology for New Technologies}, publisher = {ACS Publications}, address = {Washington DC}, language = {30}, ISSN = {1932-7447}, DOI = {10.1021/jp402684c}, extern = {1}, stag_bib_extends_fe_group = {59}, stag_bib_extends_levelofaccess = {Yes, EURAMET is permitted to upload an author's version (post-print) of the publication to the Repository on its website after an embargo period. The embargo period ends on 2014-5-29}, author = {Seah, M.P} } @Article { LuisoLGDC2019, subid = {1343}, title = {Compensation of Current Transformers’ Nonlinearities by Tensor Linearization}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2019}, month = {5}, day = {13}, volume = {68}, number = {10}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, pages = {3841 - 3849}, keywords = {Current transformer (CT), frequency coupling matrix (FCM), harmonics, nonlinearity compensation, phase-dependent characteristics, power quality, power system measurements}, tags = {SEG}, web_url = {https://ieeexplore.ieee.org/document/8713410}, misc2 = {EMPIR 2017: Industry}, publisher = {IEEE}, language = {30}, ISSN = {0018-9456}, DOI = {10.1109/TIM.2019.2905908}, stag_bib_extends_levelofaccess = {NA}, author = {Collin, A.J. and Delle Femine, A. and Gallo, D. and Langella, R. and Luiso, M.} } @Article { DudekD2019, subid = {1236}, title = {Propagation of the nuclear mean-field uncertainties with increasing distance from the parameter adjustment zone: Applications to superheavy nuclei}, journal = {Physical Review C}, year = {2019}, month = {5}, day = {10}, volume = {99}, number = {5}, number2 = {15SIB10: MetroBeta: Radionuclide beta spectra metrology}, keywords = {Nuclear mean field theory, inverse problem, modeling stability conditions}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2469-9985, 2469-9993}, DOI = {10.1103/PhysRevC.99.054310}, stag_bib_extends_levelofaccess = {NA}, author = {Dedes, I. and Dudek, J.} } @Article { SkalnikSLZ2019, title = {Mathematical approach to evaluate involute gear profile and helix deviations without using special gear software}, journal = {Mechanism and Machine Theory}, year = {2019}, month = {5}, volume = {135}, number2 = {ENG56: Drive Train: Traceable measurement of drive train components for renewable energy systems}, pages = {150-164}, keywords = {Coordinate measurementCylindrical gearProfile deviationHelix deviationGear measurement standardCAD model}, web_url = {https://www.sciencedirect.com/science/article/pii/S0094114X18306323?via\%3Dihub}, misc2 = {EMRP A169: Call 2013 Energy II}, publisher = {Elsevier BV}, language = {30}, ISSN = {0094-114X}, DOI = {10.1016/j.mechmachtheory.2019.01.030}, stag_bib_extends_levelofaccess = {NA}, author = {Skaln{\'i}k, P. and S{\'y}kora, J. and Linkeov{\'a}, I. and Zelen{\'y}, V.} } @Article { HeinrichPSDKFA2019, subid = {1067}, title = {Influence of Microwave Probes on Calibrated On-Wafer Measurements}, journal = {IEEE Transactions on Microwave Theory and Techniques}, year = {2019}, month = {5}, volume = {67}, number = {5}, number2 = {14IND02: PlanarCal: Microwave measurements for planar circuits and components}, pages = {1892-1900}, keywords = {Calibration, coplanar waveguide, electromagnetic field simulation, multiline-thru-reflect-line, on-wafer probing, probes}, web_url = {https://www.fbh-berlin.de/fileadmin/downloads/Publications/2019/FINAL_VERSION_repository.pdf}, misc2 = {EMPIR 2014: Industry}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9480, 1557-9670}, DOI = {10.1109/TMTT.2019.2903400}, stag_bib_extends_levelofaccess = {NA}, author = {Phung, G.N. and Schmuckle, F.J. and Doerner, R. and Kahne, B. and Fritzsch, T. and Arz, U. and Heinrich, W.} } @Article { LeferinktMH2019, subid = {1385}, title = {Fast Magnetic Emission Tests for Continuous Measurements Around an Equipment Under Test}, journal = {2019 ESA Workshop on Aerospace EMC (Aerospace EMC)}, year = {2019}, month = {5}, volume = {Not Applic}, number = {Not Applic}, number2 = {17NRM02: MeterEMI: Electromagnetic Interference on Static Electricity Meters}, keywords = {IEEE Keywords Position measurement, Time measurement, Time-frequency analysis, Magnetic field measurement, Electromagnetic interference INSPEC: Controlled Indexing electromagnetic interference, position measurement, time-domain analysis INSPEC: Non-Controlled Indexing continuous measurements, fast magnetic emission tests, continuous positional measurement, maximum emission, maximum interference, measurement positions, time domain electromagnetic interference analyzers, EMI test receiver, long measurement time, EUT, radiated electromagnetic interference emission}, web_url = {https://research.utwente.nl/en/publications/fast-magnetic-emission-tests-for-continuous-measurements-around-a}, misc2 = {EMPIR 2017: Pre-Co-Normative}, publisher = {IEEE}, language = {30}, DOI = {10.23919/AeroEMC.2019.8788950}, stag_bib_extends_levelofaccess = {NA}, author = {Hartman, T. and Moonen, N. and ten Have, B. and Leferink, F.} } @Proceedings { LandiGDL2019_3, subid = {1457}, title = {Discussion on DC and AC Power Quality Assessment in Railway Traction Supply Systems}, journal = {2019 IEEE International Instrumentation and Measurement Technology Conference (I2MTC)}, year = {2019}, month = {5}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, keywords = {Power system measurements, AC and DC railway system, AC and DC Power Quality, Power Quality measurements.}, web_url = {https://zenodo.org/record/3604218\#.XnHZQvF7mV5}, misc2 = {EMPIR 2016: Energy}, publisher = {IEEE}, event_place = {Auckland, New Zealand}, event_name = {International Instrumentation and Measurement technology Conference}, event_date = {20-05-2019 to 23-05-2019}, language = {30}, DOI = {10.1109/I2MTC.2019.8826869}, stag_bib_extends_levelofaccess = {NA}, author = {Delle Femine, A. and Gallo, D. and Landi, C. and Luiso, M.} } @Proceedings { SignorinoCLFGGL2019, subid = {1452}, title = {Phantom Power Generator for DC Railway Metrology}, journal = {2019 IEEE International Instrumentation and Measurement Technology Conference (I2MTC)}, year = {2019}, month = {5}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, keywords = {DC railway system, power and energy measurement, voltage and current transducer, stationary and dynamic metrological characterization}, web_url = {https://doi.org/10.5281/zenodo.3597387}, misc2 = {EMPIR 2016: Energy}, publisher = {IEEE}, address = {445 Hoes Lane Piscataway NJ 08855-1331 United States}, event_place = {Auckland (New Zeland)}, event_name = {2019 IEEE International Instrumentation and Measurement Technology Conference (I2MTC)}, event_date = {20-05-2019 to 23-05-2019}, language = {30}, DOI = {10.1109/I2MTC.2019.8826995}, stag_bib_extends_levelofaccess = {NA}, author = {Signorino, D. and Crotti, G. and Delle Femine, A. and Gallo, D. and Giordano, D. and Landi, C. and Luiso, M.} } @Proceedings { SchulerREL2019, subid = {1247}, title = {Zur Bestimmung des ILRS-Referenzpunktes am Satellite Observing System Wettzell}, journal = {Photogrammetrie - Laserscanning - Optische 3D-Messtechnik}, year = {2019}, month = {4}, day = {30}, volume = {2019}, number2 = {18SIB01: GeoMetre: Large-scale dimensional measurements for geodesy}, pages = {162-175}, keywords = {geometric reference points, VLBI, SLR, ILRS, geodesy, satellite, local tie vectors}, misc2 = {EMPIR 2018: SI Broader Scope}, publisher = {Wichmann Verlag}, event_place = {Oldenburg}, event_name = {18. Oldenburger 3D-Tage 2019}, event_date = {06-02-2019 to 07-02-2019}, language = {43}, ISBN = {978-3-87907-660-4}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://doi.org/10.5281/zenodo.3515831}, author = {Sch{\"u}ler, T. and Riepl, S. and Eschelbach, C. and L{\"o}sler, M.} } @Article { TibertoCCBMF2019, subid = {1266}, title = {Infuence of shape, size and magnetostatic interactions on the hyperthermia properties of permalloy nanostructures}, journal = {Scientific Reports}, year = {2019}, month = {4}, day = {29}, volume = {9}, number2 = {15SIB06: NanoMag: Nano-scale traceable magnetic field measurements}, pages = {6591}, keywords = {Magnetic nanostructures, Hysteresis losses, Micromagnetic modelling}, web_url = {https://www.nature.com/articles/s41598-019-43197-4}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {Springer Nature}, language = {30}, ISSN = {2045-2322 (online)}, DOI = {10.1038/s41598-019-43197-4}, stag_bib_extends_levelofaccess = {NA}, author = {Ferrero, R. and Manzin, A. and Barrera, G. and Celegato, F. and Co{\"i}sson, M. and Tiberto, P.} } @Article { IacomussiRMLG2019, subid = {1255}, title = {Road Surface Photometric Characterisation and Its Impact on Energy Savings}, journal = {Coatings}, year = {2019}, month = {4}, day = {26}, volume = {9}, number = {5}, number2 = {16NRM02: SURFACE: Pavement surface characterisation for smart and efficient road lighting}, pages = {286}, keywords = {road surface; luminance coefficient q; road lighting; energy savings; road users safety; EMPIR; EURAMET; Surface 16NRM02 project}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {Paola Iacomussi}, language = {30}, ISSN = {2079-6412}, DOI = {10.3390/coatings9050286}, stag_bib_extends_levelofaccess = {NA}, author = {Gidlund, H. and Lindgren, M. and Muzet, V. and Rossi, G. and Iacomussi, P.} } @Article { WarwickRCZ2019, subid = {1925}, title = {Evaluation of inductively coupled plasma tandem mass spectrometry for radionuclide assay in nuclear waste characterisation}, journal = {Journal of Analytical Atomic Spectrometry}, year = {2019}, month = {4}, day = {26}, volume = {34}, number = {9}, number2 = {16ENV09: MetroDecom II: In situ metrology for decommissioning nuclear facilities}, pages = {1810-1821}, keywords = {tandem mass spectrometry, nuclear waste characterisation, rapid measurement, expanded measurement capability}, web_url = {https://eprints.soton.ac.uk/430647}, misc2 = {EMPIR 2016: Environment}, publisher = {Royal Society of Chemistry (RSC)}, language = {30}, ISSN = {0267-9477, 1364-5544}, DOI = {https://doi.org/10.1039/C8JA00411K}, stag_bib_extends_levelofaccess = {NA}, author = {Warwick, P. E. and Russell, B. C. and Croudace, I. W. and Zacharauskas, Ž.} } @Manual { SchmucklePASHL2019, subid = {1084}, title = {Guidelines for the design of calibration substrates, including the suppression of parasitic modes for frequencies up to and including 325 GHz}, year = {2019}, month = {4}, day = {24}, number2 = {14IND02: PlanarCal: Microwave measurements for planar circuits and components}, keywords = {Calibration, coplanar waveguide (CPW), electromagnetic field simulation, parasitic modes, substrate modes, multiline-thru-reflect-line (mTRL), on-wafer probing, probes}, web_url = {https://oar.ptb.de/resources/show/10.7795/530.20190424A}, misc2 = {EMPIR 2014: Industry}, publisher = {Physikalisch-Technische Bundesanstalt (PTB)}, language = {30}, DOI = {10.7795/530.20190424A}, stag_bib_extends_levelofaccess = {NA}, author = {Schmuckle, F.J. and Phung, G.N. and Arz, U. and Spirito, M. and Heinrich, W. and Lozar, R.} } @Manual { HaddadiDLHGLHPZWHMSRKPASC2019, subid = {1085}, title = {Best Practice Guide for Planar S-Parameter Measurements using Vector Network Analysers}, year = {2019}, month = {4}, day = {24}, number2 = {14IND02: PlanarCal: Microwave measurements for planar circuits and components}, keywords = {Calibration, on-wafer, S-parameters, traceability, uncertainty budget, coplanar waveguide (CPW), electromagnetic field simulation, parasitic modes, substrate modes, multiline-thru-reflect-line (mTRL), microwave probes, extreme impedance measurement, impedance mismatch, microwave interferometry, nanoelectronics, nanostructures, noise, vector network analyzer (VNA)}, web_url = {https://oar.ptb.de/resources/show/10.7795/530.20190424B}, misc2 = {EMPIR 2014: Industry}, publisher = {Physikalisch-Technische Bundesanstalt (PTB)}, language = {30}, DOI = {10.7795/530.20190424B}, stag_bib_extends_levelofaccess = {NA}, author = {Haddadi, K. and Dambrine, G. and Lozar, R. and Helmreich, K. and Gold, G. and Lomakin, K. and Heinrich, W. and Phung, G.N. and Zeier, M. and Wollensack, M. and Hoffmann, J. and Mubarak, F. and Shang, X. and Ridler, N. and Kuhlmann, K. and Probst, T. and Arz, U. and Spirito, M. and Clarke, R.} } @Article { GardiniVPC2019, subid = {1165}, title = {Quantitative imaging of efflux pumps in planktonic and biofilm-associated bacteria through single-molecule localization microscopy - Biomedical Imaging and Sensing Conference}, journal = {Biomedical Imaging and Sensing Conference}, year = {2019}, month = {4}, day = {21}, volume = {11140}, number = {2019}, number2 = {15HLT01: MetVBadBugs: Quantitative measurement and imaging of drug-uptake by bacteria with antimicrobial resistance}, pages = {170-174}, keywords = {Quantitative imaging of efflux pumps in planktonic and biofilm-associated bacteria throughsingle-molecule localization microscopy}, web_url = {https://www.spiedigitallibrary.org/conference-proceedings-of-spie/11140/2535451/Biomedical-Imaging-and-Sensing-Conference/10.1117/12.2535451.full}, misc2 = {EMPIR 2015: Health}, publisher = {SPIE}, language = {30}, ISSN = {0277-786X}, DOI = {10.1117/12.2535451}, stag_bib_extends_levelofaccess = {NA}, author = {Gardini, L. and Vignolini, T. and Pavone, F.S. and Capitanio, M.} } @Article { DudekR2019, subid = {1237}, title = {New approach to the adiabaticity concepts in the collective nuclear motion: Impact for the collective-inertia tensor and comparisons with experiment}, journal = {Physical Review C}, year = {2019}, month = {4}, day = {19}, volume = {99}, number = {4}, number2 = {15SIB10: MetroBeta: Radionuclide beta spectra metrology}, keywords = {Collective nuclear motion, adiabaticity, nuclear inertia tensor, cranking approximation}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2469-9985, 2469-9993}, DOI = {10.1103/PhysRevC.99.041303}, stag_bib_extends_levelofaccess = {NA}, author = {Rouvel, D. and Dudek, J.} } @Article { WiekhorstSPLW2019, subid = {941}, title = {Probing particle-matrix interactions during magnetic particle spectroscopy}, journal = {Journal of Magnetism and Magnetic Materials}, year = {2019}, month = {4}, volume = {475}, number2 = {16NRM04: MagNaStand: Towards an ISO standard for magnetic nanoparticles}, pages = {421-428}, keywords = {magnetic hyperthermia, magnetic nanoparticles}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {Elsevier BV}, language = {30}, ISSN = {0304-8853}, DOI = {10.1016/j.jmmm.2018.11.109}, stag_bib_extends_levelofaccess = {NA}, author = {Wells, J. and L{\"o}wa, N. and Paysen, H. and Steinhoff, U. and Wiekhorst, F.} } @Article { MartinezVerduVVBP2019, subid = {1014}, title = {Graininess characterization by multidimensional scaling}, journal = {Journal of Modern Optics}, year = {2019}, month = {4}, volume = {67}, number = {1}, number2 = {16NRM08: BiRD: Bidirectional reflectance definitions}, pages = {1-10}, keywords = {graininess, special-effect pigments, multidimensional scaling algorithm, psychophysical experiment}, web_url = {https://www.tandfonline.com/doi/full/10.1080/09500340.2019.1589006}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {Taylor \& Francis}, language = {30}, ISSN = {1362-3044}, DOI = {10.1080/09500340.2019.1589006}, stag_bib_extends_levelofaccess = {NA}, author = {Perales, E. and Burgos, F.J. and Vilaseca, M. and Viqueira, V. and Mart{\'i}nez-Verd{\'u}, F.M.} } @Article { RaaymakersJWvdWd2019, subid = {1046}, title = {Direct measurement of ion chamber correction factors, k\(_{Q}\) and k\(_{B}\), in a 7 MV MRI-linac}, journal = {Physics in Medicine and Biology}, year = {2019}, month = {4}, number2 = {15HLT08: MRgRT: Metrology for MR guided radiotherapy}, keywords = {absorbed dose, MRgRT, kB, kQ, magnetic field}, web_url = {https://iopscience.iop.org/article/10.1088/1361-6560/ab1511/pdf}, misc2 = {EMPIR 2015: Health}, publisher = {IOP Publishing}, language = {30}, ISSN = {0031-9155, 1361-6560}, DOI = {10.1088/1361-6560/ab1511}, stag_bib_extends_levelofaccess = {NA}, author = {de Prez, L.A. and Woodings, S.J. and de Pooter, J.A. and van Asselen, B. and Wolthaus, J.W.H. and Jansen, B.J. and Raaymakers, B.W.} } @Article { BergstenSSM2019, subid = {1076}, title = {Four-Terminal Pair Digital Sampling Impedance Bridge up to 1MHz}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2019}, month = {4}, volume = {68}, number = {6}, number2 = {15RPT04: TracePQM: Traceability routes for electrical power quality measurements}, pages = {1860 - 1869}, keywords = {Bridge circuits, Impedance, Topology, Uncertainty, Standards, Calibration, Multiplexing, impedance measurement, phase comparators, sampling methods, shunts (electrical)}, misc2 = {EMPIR 2015: Research Potential}, publisher = {IEEE}, language = {30}, ISSN = {0018-9456}, DOI = {10.1109/TIM.2019.2908649}, stag_bib_extends_levelofaccess = {NA}, author = {Maslan, S. and Š{\'i}ra, M. and Skalicka, T. and Bergsten, T.} } @Article { XuLLALAGMWTLATSPDA2019, subid = {1116}, title = {High-precision methanol spectroscopy with a widely tunable SI-traceable frequency-comb-based mid-infrared QCL}, journal = {Optica}, year = {2019}, month = {4}, volume = {6}, number = {4}, number2 = {15SIB03: OC18: Optical clocks with 1E-18 uncertainty}, pages = {411}, keywords = {Diode lasers; Laser beams; Laser sources; Optical components; Saturation spectroscopy; Tunable lasers;}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {The Optical Society}, language = {30}, ISSN = {2334-2536}, DOI = {10.1364/OPTICA.6.000411}, stag_bib_extends_levelofaccess = {NA}, author = {Santagata, R. and Tran, D.B.A. and Argence, B. and Lopez, O. and Tokunaga, S.K. and Wiotte, F. and Mouhamad, H. and Goncharov, A. and Abgrall, M. and Le Coq, Y. and Alvarez-Martinez, H. and Le Targat, R. and Lee, W.K. and Xu, D. and Pottie, P.E. and Darqui{\'e}, B. and Amy-Klein, A.} } @Article { DarquieSPXATAWTLMAGLLAL2019, subid = {1116}, title = {High-precision methanol spectroscopy with a widely tunable SI-traceable frequency-comb-based mid-infrared QCL}, journal = {Optica}, year = {2019}, month = {4}, volume = {6}, number = {4}, number2 = {15SIB05: OFTEN: Optical frequency transfer - a European network}, pages = {411}, keywords = {optical Fiber, optical frequency transfer}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {The Optical Society}, language = {30}, ISSN = {2334-2536}, DOI = {10.1364/OPTICA.6.000411}, stag_bib_extends_levelofaccess = {NA}, author = {Santagata, R. and Tran, D.B.A. and Argence, B. and Lopez, O. and Tokunaga, S.K. and Wiotte, F. and Mouhamad, H. and Goncharov, A. and Abgrall, M. and Le Coq, Y. and Alvarez-Martinez, H. and Le Targat, R. and Lee, W.K. and Xu, D. and Pottie, P.E. and Darqui{\'e}, B. and Amy-Klein, A.} } @Article { HanselaerAL2019, subid = {1223}, title = {Development of an image-based gloss measurement instrument}, journal = {Journal of Coatings Technology and Research}, year = {2019}, month = {4}, volume = {16}, number = {4}, number2 = {16NRM08: BiRD: Bidirectional reflectance definitions}, pages = {913-921}, keywords = {specular gloss meterimage-based gloss measurementcontrast glossorange peel}, web_url = {https://rdcu.be/bTtmT}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {1547-0091, 1935-3804}, DOI = {10.1007/s11998-019-00184-8}, stag_bib_extends_levelofaccess = {NA}, author = {Leloup, F.B. and Audenaert, J. and Hanselaer, P.} } @Article { BuechelerTSALWCW2019, subid = {1241}, title = {Time-resolved photoluminescence on double graded Cu(In,Ga)Se2 – Impact of front surface recombination and its temperature dependence}, journal = {Science and Technology of Advanced Materials}, year = {2019}, month = {4}, volume = {20}, number = {1}, number2 = {16ENG03: HyMet: Hybrid metrology for thin films in energy applications}, pages = {313-323}, keywords = {time-resolved photoluminescence}, misc2 = {EMPIR 2016: Energy}, publisher = {Informa UK Limited}, language = {30}, ISSN = {1468-6996, 1878-5514}, DOI = {10.1080/14686996.2019.1586583}, stag_bib_extends_levelofaccess = {NA}, author = {Weiss, T.P. and Carron, R. and Wolter, M.H. and L{\"o}ckinger, J. and Avancini, E. and Siebentritt, S. and Buecheler, S. and Tiwari, A.N.} } @Proceedings { c5e7ca83da2019, subid = {1259}, title = {Industrial Standards in the Intermediate Pressure-to-Vacuum Range}, journal = {PTB-Bericht}, year = {2019}, month = {4}, volume = {Th-10}, number = {April 2019}, number2 = {14IND06: pres2vac: Industrial standards in the intermediate pressure-to-vacuum range}, pages = {326}, keywords = {Pressure, vacuum, standard, measurement, calibration}, misc2 = {EMPIR 2014: Industry}, publisher = {Physikalisch-Technische Bundesanstalt (PTB)}, address = {Braunschweig}, event_place = {RISE, Bor{\aa}s, Sweden}, event_name = {Final Workshop}, event_date = {16-05-2018 to 17-05-2018}, language = {30}, ISBN = {978-3-95606-466-1}, ISSN = {1614-9327}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://oar.ptb.de/resources/show/10.7795/110.20191105D} } @Article { MarquesTUWdLLLGHA2019, subid = {1369}, title = {Topology Driven g-Factor Tuning in Type-II Quantum Dots}, journal = {Physical Review Applied}, year = {2019}, month = {4}, volume = {11}, number = {4}, number2 = {17FUN06: SIQUST: Single-photon sources as new quantum standards}, pages = {044011}, keywords = {quantum dots, optoelectronics, spin-orbit coupling, Aharonov-Bohm effect}, web_url = {https://arxiv.org/abs/1710.08828}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {2331-7019}, DOI = {10.1103/PhysRevApplied.11.044011}, stag_bib_extends_levelofaccess = {NA}, author = {Llorens, J.M. and Lopes-Oliveira, V. and L{\'o}pez-Richard, V. and de Oliveira, E.R. Cardozo and Wewi{\'o}r, L. and Ulloa, J.M. and Teodoro, M.D. and Marques, G.E. and Garc{\'i}a-Crist{\'o}bal, A. and Hai, G.-Q. and Al{\'e}n, B.} } @Article { MehlstaublerOBID2019, subid = {1040}, title = {946-nm Nd:YAG digital-locked laser at 1.1 \(\times\) 10−16 in 1  s and transfer-locked to a cryogenic silicon cavity}, journal = {Optics Letters}, year = {2019}, month = {3}, day = {29}, volume = {44}, number = {7}, number2 = {15SIB03: OC18: Optical clocks with 1E-18 uncertainty}, pages = {1781}, keywords = {Ultra-stable laser; Nd:YAG; Fabry-Perot cavity; time and frequency metrology; optical clock;}, web_url = {https://arxiv.org/abs/1902.07012}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {The Optical Society}, language = {30}, ISSN = {0146-9592, 1539-4794}, DOI = {10.1364/OL.44.001781}, stag_bib_extends_levelofaccess = {NA}, author = {Didier, A. and Ignatovich, S. and Benkler, E. and Okhapkin, M. and Mehlst{\"a}ubler, T.E.} } @Article { TiwariBCFBW2019, subid = {1240}, title = {Bulk and surface recombination properties in thin film semiconductors with different surface treatments from time-resolved photoluminescence measurements}, journal = {Scientific Reports}, year = {2019}, month = {3}, day = {29}, volume = {9}, number = {1}, number2 = {16ENG03: HyMet: Hybrid metrology for thin films in energy applications}, keywords = {thin filmsemiconductor}, misc2 = {EMPIR 2016: Energy}, publisher = {Springer Nature}, language = {30}, ISSN = {2045-2322}, DOI = {10.1038/s41598-019-41716-x}, stag_bib_extends_levelofaccess = {NA}, author = {Weiss, T.P. and Bissig, B. and Feurer, T. and Carron, R. and Buecheler, S. and Tiwari, A.N.} } @Article { RosendahlBBKSKS2019, subid = {1550}, title = {CT beam dosimetric characterization procedure for personalized dosimetry}, journal = {Physics in Medicine \& Biology}, year = {2019}, month = {3}, day = {29}, volume = {64}, number = {7}, number2 = {15HLT05: PerfusImaging: Metrology for multi-modality imaging of impaired tissue perfusion}, pages = {075009}, keywords = {CT beam dosimetric characterization procedure for personalized dosimetry}, misc2 = {EMPIR 2015: Health}, publisher = {IOP Publishing}, language = {30}, ISSN = {1361-6560}, DOI = {10.1088/1361-6560/ab0e97}, stag_bib_extends_levelofaccess = {NA}, author = {Rosendahl, S. and B{\"u}ermann, L. and Borowski, M. and Kortesniemi, M. and Sundell, V-M. and Kosunen, A. and Siiskonen, T.} } @Article { LeviLG2019, subid = {1088}, title = {Multipartite-entanglement tomography of a quantum simulator}, journal = {New Journal of Physics}, year = {2019}, month = {3}, day = {28}, volume = {21}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, keywords = {entanglement, spin chain, long-range interaction, quantum phase transitions}, misc2 = {EMPIR 2017: Fundamental}, language = {30}, DOI = {10.1088/1367-2630/aafb8c}, stag_bib_extends_levelofaccess = {NA}, author = {Gabbrielli, M. and Lepori, L. and Pezz{\`e}, L.} } @Article { KoellenspergerNST2019, subid = {1195}, title = {FI-ICP-TOFMS for high-throughput and low volume multi-element analysis in environmental and biological matrices}, journal = {Journal of Analytical Atomic Spectrometry}, year = {2019}, month = {3}, day = {28}, volume = {34}, number = {6}, number2 = {15HLT02: ReMIND: Role of metals and metal containing biomolecules in neurodegenerative diseases such as Alzheimer’s disease}, pages = {1272-1278}, keywords = {low volume multi-element analysis, FI-ICP-TOFMS, analysis in environmental and biological matrices}, web_url = {https://pubs.rsc.org/en/Content/ArticleLanding/2019/JA/C9JA00022D\#!divAbstract}, misc2 = {EMPIR 2015: Health}, publisher = {Royal Society of Chemistry (RSC)}, language = {30}, ISSN = {0267-9477, 1364-5544}, DOI = {10.1039/C9JA00022D}, stag_bib_extends_levelofaccess = {NA}, author = {Theiner, S. and Schoeberl, A. and Neumayer, S. and Koellensperger, G.} } @Article { BurgerZB2019, subid = {1058}, title = {An auxiliary field approach for computing optical resonances in dispersive media}, journal = {Journal of the European Optical Society-Rapid Publications}, year = {2019}, month = {3}, day = {27}, volume = {15}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {3}, keywords = {Maxwell’s equations, Material dispersion, Nonlinear eigenvalue problems, Auxiliary field approach}, misc2 = {EMPIR 2017: Fundamental}, language = {30}, DOI = {10.1186/s41476-019-0098-z}, stag_bib_extends_levelofaccess = {NA}, author = {Binkowski, F. and Zschiedrich, L. and Burger, S.} } @Article { MeesSF2019, subid = {1026}, title = {Traceability of form measurements of freeform surfaces: metrological reference surfaces}, journal = {Optical Engineering}, year = {2019}, month = {3}, day = {26}, volume = {58}, number = {9}, number2 = {15SIB01: FreeFORM: Reference algorithms and metrology on aspherical and freeform lenses}, pages = {092602-1-7}, keywords = {metrology; freeform; reference artifact; traceability; interferometry; measurement comparison}, misc2 = {EMPIR 2015: SI Broader Scope}, language = {30}, DOI = {10.1117/1.OE.58.9.092602}, stag_bib_extends_levelofaccess = {NA}, author = {Fortmeier, I. and Schulz, M. and Mee{\ss}, R.} } @Proceedings { BurgerZHS2019, subid = {1217}, title = {Using Gaussian process regression for efficient parameter reconstruction}, journal = {Metrology, Inspection, and Process Control for Microlithography XXXIII}, year = {2019}, month = {3}, day = {26}, volume = {10959}, number2 = {17FUN01: BeCOMe: Light-matter interplay for optical metrology beyond the classical spatial resolution limits}, pages = {1095911}, keywords = {computational metrology, optical metrology, computational lithography, Bayesian optimization,machine learning, finite-element methods, nanooptics}, web_url = {https://arxiv.org/abs/1903.12128}, misc2 = {EMPIR 2017: Fundamental}, publisher = {SPIE}, event_place = {San Jose, USA}, event_name = {Metrology, Inspection, and Process Control for Microlithography XXXIII}, event_date = {24-02-2019 to 28-02-2019}, language = {30}, DOI = {10.1117/12.2513268}, stag_bib_extends_levelofaccess = {NA}, author = {Schneider, P-I. and Hammerschmidt, M. and Zschiedrich, L. and Burger, S.} } @Article { MarquardtJ2019, subid = {1069}, title = {On the Effectiveness of airborne infrasound in eliciting vestibular-evoked myogenic responses}, journal = {Journal of Low Frequency Noise, Vibration and Active Control}, year = {2019}, month = {3}, day = {25}, number2 = {15HLT03: Ears II: Metrology for modern hearing assessment and protecting public health from emerging noise sources}, pages = {146134841983386}, keywords = {Vestibular-evoked myogenic potentials, wind turbines, infrasound and low-frequency hearing, wind-turbine noise syndrome, hearing and balance}, misc2 = {EMPIR 2015: Health}, publisher = {SAGE Publications}, language = {30}, ISSN = {1461-3484, 2048-4046}, DOI = {10.1177/1461348419833868}, stag_bib_extends_levelofaccess = {NA}, author = {Jurado, C. and Marquardt, T.} } @Article { KiselevDMFVPABBLXBHD2019, subid = {1024}, title = {Long Slender Piezo-Resistive Silicon Microprobes for Fast Measurements of Roughness and Mechanical Properties inside Micro-Holes with Diameters below 100 µm}, journal = {Sensors 2019}, year = {2019}, month = {3}, day = {22}, volume = {19(6)}, number = {1410}, number2 = {17IND05: MicroProbes: Multifunctional ultrafast microprobes for on-the-machine measurements}, keywords = {cantilever microprobe; high-speed; contact resonance; tip wear; piezo-resistive; mechanical damping; tip-testing standard}, web_url = {https://www.mdpi.com/1424-8220/19/6/1410}, misc2 = {EMPIR 2017: Industry}, publisher = {MDPI AG}, address = {Basel}, language = {30}, DOI = {10.3390/s19061410}, stag_bib_extends_levelofaccess = {NA}, author = {Brand, U. and XU, M. and Doering, L. and Langfahl-Klabes, J. and Behle, H. and B{\"u}tefisch, S. and Ahbe, T. and Peiner, E. and V{\"o}llmeke, S. and Frank, T. and Mickan, B. and Kiselev, I. and Hauptmannl, M. and Drexel, M.} } @Article { OelfkeBBD2019_2, subid = {1047}, title = {The effect of magnetic field strength on the response of Gafchromic EBT-3 film}, journal = {Physics in Medicine \& Biology}, year = {2019}, month = {3}, day = {14}, volume = {64}, number = {6}, number2 = {15HLT08: MRgRT: Metrology for MR guided radiotherapy}, pages = {06NT03}, keywords = {MRI-Linac, MRI-guided radiotherapy, film dosimetry, magnetic field}, web_url = {https://iopscience.iop.org/article/10.1088/1361-6560/ab0503}, misc2 = {EMPIR 2015: Health}, publisher = {IOP Publishing}, language = {30}, ISSN = {1361-6560}, DOI = {10.1088/1361-6560/ab0503}, stag_bib_extends_levelofaccess = {NA}, author = {Billas, I. and Bouchard, H. and Oelfke, U. and Duane, S.} } @Article { MinelliBPRUSSGS2019, subid = {1543}, title = {Sticky Measurement Problem: Number Concentration of Agglomerated Nanoparticles}, journal = {Langmuir}, year = {2019}, month = {3}, day = {14}, volume = {35}, number = {14}, number2 = {14IND12: Innanopart: Metrology for innovative nanoparticles}, pages = {4927-4935}, keywords = {Sticky Measurement Problem: Number Concentration of Agglomerated Nanoparticles}, misc2 = {EMPIR 2014: Industry}, publisher = {American Chemical Society (ACS)}, language = {30}, ISSN = {0743-7463, 1520-5827}, DOI = {10.1021/acs.langmuir.8b04209}, stag_bib_extends_levelofaccess = {NA}, author = {Minelli, C. and Bartczak, D. and Peters, R. and Rissler, J. and Undas, A. and Sikora, A. and Sj{\"o}str{\"o}m, E. and Goenaga-Infante, H. and Shard, A.G.} } @Article { WangJW2019, subid = {1620}, title = {Bubble mapping: three-dimensional visualisation of gas–liquid flow regimes using electrical tomography}, journal = {Measurement Science and Technology}, year = {2019}, month = {3}, day = {14}, volume = {30}, number = {4}, number2 = {16ENG07: MultiFlowMet II: Multiphase flow reference metrology}, pages = {045303}, keywords = {electrical tomography, 3D visualisation, flow regimes, bubble imaging}, misc2 = {EMPIR 2016: Energy}, publisher = {IOP Publishing}, language = {30}, ISSN = {0957-0233, 1361-6501}, DOI = {10.1088/1361-6501/ab06a9}, stag_bib_extends_levelofaccess = {NA}, author = {Wang, Q. and Jia, X. and Wang, M.} } @Article { BraunBRSB2019, subid = {1033}, title = {Measurement and Analysis of PMU Reporting Latency for Smart Grid Protection and Control Applications}, journal = {IEEE Access}, year = {2019}, month = {3}, day = {12}, number2 = {17IND06: FutureGrid II: Metrology for the next-generation digital substation instrumentation}, pages = {1-1}, keywords = {Phasor measurement units, Ethernet, Hardware, Real-time systems, Synchronization, Task analysis}, misc2 = {EMPIR 2017: Industry}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {2169-3536}, DOI = {10.1109/ACCESS.2019.2903929}, stag_bib_extends_levelofaccess = {NA}, author = {Blair, S.M. and Syed, M.H. and Roscoe, A.J. and Burt, G.M. and Braun, J.P.} } @Article { KurlyandskayaSCMBACT2019, subid = {944}, title = {Specific loss power measurements by calorimetric and thermal methods on \(\gamma\)-Fe2O3 nanoparticles for magnetic hyperthermia}, journal = {Journal of Magnetism and Magnetic Materials}, year = {2019}, month = {3}, volume = {473}, number2 = {16NRM04: MagNaStand: Towards an ISO standard for magnetic nanoparticles}, pages = {403-409}, keywords = {Magnetic hyperthermia, Fe-oxide, Magnetic nanoparticles}, misc2 = {EMPIR 2016: Pre-Co-Normative}, publisher = {Elsevier BV}, language = {30}, ISSN = {0304-8853}, DOI = {10.1016/j.jmmm.2018.10.107}, stag_bib_extends_levelofaccess = {NA}, author = {Co{\"i}sson, M. and Barrera, G. and Appino, C. and Celegato, F. and Martino, L. and Safronov, A.P. and Kurlyandskaya, G.V. and Tiberto, P.} } @Article { PisaniBE2019, subid = {1000}, title = {High-Index Glass Ball Retroreflectors for Measuring Lateral Positions}, journal = {Sensors}, year = {2019}, month = {3}, volume = {19}, number = {5}, number2 = {17IND03: LaVA: Large Volume Metrology Applications}, pages = {1082}, keywords = {backscattering, retroreflectors, glory, ray tracing, high index ball lenses}, web_url = {https://www.mdpi.com/1424-8220/19/5/1082}, misc2 = {EMPIR 2017: Industry}, publisher = {MDPI AG}, language = {30}, ISSN = {1424-8220}, DOI = {10.3390/s19051082}, stag_bib_extends_levelofaccess = {NA}, author = {Egidi, A. and Balsamo, A. and Pisani, M.} } @Proceedings { ThalmannMBK2019, subid = {1030}, title = {CT machine geometry changes under thermal load}, journal = {Nondestructive Testing}, year = {2019}, month = {3}, number2 = {17IND08: AdvanCT: Advanced Computed Tomography for dimensional and surface measurements in industry}, pages = {23681}, keywords = {CT machine geometry, thermal influences, geometry measurement system, metrology}, web_url = {http://www.ndt.net/?id=23681}, misc2 = {EMPIR 2017: Industry}, publisher = {NDT.net}, event_place = {Padova}, event_name = {9th Conference on Industrial Computed Tomography (iCT) 2019}, event_date = {13-02-2019 to 15-02-2019}, language = {30}, ISSN = {1435-4934}, stag_bib_extends_levelofaccess = {NA}, stag_bib_extends_persistent_identifier = {https://www.ndt.net/article/ctc2019/papers/iCT2019_Full_paper_47.pdf}, author = {Thalmann, R. and Meli, F. and Bircher, B.A. and K{\"u}ng, A.} } @Proceedings { ThalmannMBK2019_2, subid = {1029}, title = {CT geometry determination using individual radiographsof calibrated multi-sphere standards}, journal = {Nondestructive Testing}, year = {2019}, month = {3}, number2 = {17IND08: AdvanCT: Advanced Computed Tomography for dimensional and surface measurements in industry}, pages = {23677}, keywords = {CT machine geometry, correction, multi-sphere standard, metrology}, web_url = {https://www.ndt.net/search/docs.php3?showForm=off\&id=23677}, misc2 = {EMPIR 2017: Industry}, publisher = {NDT.net}, event_place = {Padova}, event_name = {9th Conference on Industrial Computed Tomography (iCT) 2019}, event_date = {13-02-2019 to 15-02-2019}, language = {30}, ISSN = {1435-4934}, stag_bib_extends_levelofaccess = {NA}, author = {Thalmann, R. and Meli, F. and Bircher, B.A. and K{\"u}ng, A.} } @Article { SafronovaPTLSHP2019, subid = {1051}, title = {Optical clock comparison for Lorentz symmetry testing}, journal = {Nature}, year = {2019}, month = {3}, volume = {567}, number = {7747}, number2 = {15SIB03: OC18: Optical clocks with 1E-18 uncertainty}, pages = {204-208}, keywords = {optical clock, Lorentz symmetry violation, ytterbium, ion trap}, web_url = {https://arxiv.org/abs/1809.10742\#}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {Springer Nature}, language = {30}, ISSN = {0028-0836, 1476-4687}, DOI = {10.1038/s41586-019-0972-2}, stag_bib_extends_levelofaccess = {NA}, author = {Sanner, C. and Huntemann, N. and Lange, R. and Tamm, C. and Peik, E. and Safronova, M.S. and Porsev, S.G.} } @Proceedings { SchulzFDSPH2019, subid = {1064}, title = {Crosstalk Effects of Differential Thin-Film Microstrip Lines in Multilayer Motherboards}, journal = {2019 12th German Microwave Conference (GeMiC)}, year = {2019}, month = {3}, number2 = {14IND02: PlanarCal: Microwave measurements for planar circuits and components}, pages = {178-181}, keywords = {crosstalk effects, discontinuities, microstrip}, web_url = {https://www.fbh-berlin.com/fileadmin/downloads/Publications/2019/2019_02_20_GeMiC_GNP_repository.pdf}, misc2 = {EMPIR 2014: Industry}, publisher = {IEEE}, address = {445 Hoes Lane Piscataway NJ 08855-1331 United States}, event_place = {Stuttgart}, event_name = {2019 12th German Microwave Conference (GeMiC)}, event_date = {25-03-2019 to 27-03-2019}, language = {30}, DOI = {10.23919/GEMIC.2019.8698163}, stag_bib_extends_levelofaccess = {NA}, author = {Phung, G. N. and Schmuckle, F. J. and Doerner, R. and Fritzsch, T. and Schulz, S. and Heinrich, W.} } @Article { PitreLHHCSPCGLZ2019, subid = {1167}, title = {A high-stability quasi-spherical resonator in SPRIGT for microwave frequency measurements at low temperatures}, journal = {Science Bulletin}, year = {2019}, month = {3}, volume = {64}, number = {5}, number2 = {15SIB02: InK 2: Implementing the new kelvin 2}, pages = {286-288}, keywords = {Refractive Index, Primary Thermometry, resonance frequencies}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {Elsevier BV}, language = {30}, ISSN = {2095-9273}, DOI = {10.1016/j.scib.2019.01.018}, stag_bib_extends_levelofaccess = {NA}, author = {Zhang, H. and Liu, W. and Gao, B. and Chen, Y. and Chen, H. and Pan, C. and Song, Y. and Han, D. and Hu, J. and Luo, E. and Pitre, L.} } @Article { HuKPHNKNC2019, subid = {1306}, title = {Determination of tip transfer function for quantitative MFM using frequency domain filtering and least squares method}, journal = {Scientific Reports}, year = {2019}, month = {3}, volume = {9}, number = {1}, number2 = {15SIB06: NanoMag: Nano-scale traceable magnetic field measurements}, keywords = {quantitative MFM}, web_url = {https://www.nature.com/articles/s41598-019-40477-x\#additional-information}, misc2 = {EMPIR 2015: SI Broader Scope}, publisher = {Springer Science and Business Media LLC}, language = {30}, ISSN = {2045-2322}, DOI = {10.1038/s41598-019-40477-x}, stag_bib_extends_levelofaccess = {NA}, author = {Nečas, D. and Klapetek, P. and Neu, V. and Havl{\'i}ček, M. and Puttock, R. and Kazakova, O. and Hu, X. and Zaj{\'i}čkov{\'a}, L.} } @Article { vandenBromvv2019, subid = {1458}, title = {Characterization of DC Current Sensors With AC Distortion for Railway Applications}, journal = {IEEE Transactions on Instrumentation and Measurement}, year = {2019}, month = {3}, volume = {68}, number = {6}, number2 = {16ENG04: MyRailS: Metrology for smart energy management in electric railway systems}, pages = {2084-2090}, keywords = {Current measurement, current sensors, current transducers, measurement standards, measurement techniques, measurement uncertainty, precision measurements.}, tags = {SEG}, web_url = {https://zenodo.org/record/3265674\#.Xnj0qYj7Q2w}, misc2 = {EMPIR 2016: Energy}, publisher = {Institute of Electrical and Electronics Engineers (IEEE)}, language = {30}, ISSN = {0018-9456, 1557-9662}, DOI = {10.1109/TIM.2019.2898014}, stag_bib_extends_levelofaccess = {NA}, author = {van den Brom, H. and van den Brom, H.E. and van Leeuwen, R.} } @Article { GessnerSP2019, subid = {1917}, title = {Metrological Nonlinear Squeezing Parameter}, journal = {Physical Review Letters}, year = {2019}, month = {3}, volume = {122}, number = {9}, number2 = {17FUN03: USOQS: Ultra-stable optical oscillators from quantum coherent and entangled systems}, keywords = {squeezing, complex quantum states}, web_url = {https://arxiv.org/pdf/1811.12443.pdf}, misc2 = {EMPIR 2017: Fundamental}, publisher = {American Physical Society (APS)}, language = {30}, ISSN = {0031-9007, 1079-7114}, DOI = {10.1103/PhysRevLett.122.090503}, stag_bib_extends_levelofaccess = {NA}, author = {Gessner, M. and Smerzi, A. and